1.0 2010-04-08 22:07:45 UTC 2025-11-18 23:05:20 UTC FDB007730 2,6-Dimethylocta-3,7-diene-1,6-diol 2,6-dimethylocta-3,7-diene-1,6-diol, also known as (6e)-8-hydroxylinalool, is a member of the class of compounds known as acyclic monoterpenoids. Acyclic monoterpenoids are monoterpenes that do not contain a cycle. Thus, 2,6-dimethylocta-3,7-diene-1,6-diol is considered to be a fatty alcohol lipid molecule. 2,6-dimethylocta-3,7-diene-1,6-diol is slightly soluble (in water) and an extremely weak acidic compound (based on its pKa). 2,6-dimethylocta-3,7-diene-1,6-diol can be found in ginger, which makes 2,6-dimethylocta-3,7-diene-1,6-diol a potential biomarker for the consumption of this food product. C10H18O2 170.252 170.13067982 (2E)-2,6-dimethylocta-2,7-diene-1,6-diol (6E)-8-hydroxylinalool [H]OC\C(C)=C\CCC(C)(O[H])C=C InChI=1S/C10H18O2/c1-4-10(3,12)7-5-6-9(2)8-11/h4,6,11-12H,1,5,7-8H2,2-3H3/b9-6+ NSMIMJYEKVSYMT-RMKNXTFCSA-N belongs to the class of organic compounds known as acyclic monoterpenoids. These are monoterpenes that do not contain a cycle. Acyclic monoterpenoids Organic compounds Lipids and lipid-like molecules Prenol lipids Monoterpenoids Aliphatic acyclic compounds Fatty alcohols Hydrocarbon derivatives Primary alcohols Tertiary alcohols Acyclic monoterpenoid Alcohol Aliphatic acyclic compound Fatty acyl Fatty alcohol Hydrocarbon derivative Organic oxygen compound Organooxygen compound Primary alcohol Tertiary alcohol Fatty alcohols octadienediol logp 1.35 ALOGPS logs -1.57 ALOGPS solubility 4.55e+00 g/l ALOGPS logp 1.37 ChemAxon pka_strongest_acidic 16.64 ChemAxon pka_strongest_basic -1.3 ChemAxon iupac (2E)-2,6-dimethylocta-2,7-diene-1,6-diol ChemAxon average_mass 170.252 ChemAxon mono_mass 170.13067982 ChemAxon smiles [H]OC\C(C)=C\CCC(C)(O[H])C=C ChemAxon formula C10H18O2 ChemAxon inchi InChI=1S/C10H18O2/c1-4-10(3,12)7-5-6-9(2)8-11/h4,6,11-12H,1,5,7-8H2,2-3H3/b9-6+ ChemAxon inchikey NSMIMJYEKVSYMT-RMKNXTFCSA-N ChemAxon polar_surface_area 40.46 ChemAxon refractivity 51.98 ChemAxon polarizability 20.25 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 2 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 5922 Specdb::MsMs 54093 Specdb::MsMs 54094 Specdb::MsMs 54095 Specdb::MsMs 116403 Specdb::MsMs 116404 Specdb::MsMs 116405 Specdb::MsMs 3604304 Specdb::MsMs 3604305 Specdb::MsMs 3604306 Specdb::MsMs 3604307 Specdb::MsMs 3604308 Specdb::MsMs 3604309 Ginger Type 1 specific Zingiber officinale 94328