1.0 2010-04-08 22:07:46 UTC 2025-11-18 23:05:22 UTC FDB007760 [6]-Gingerdiol acetate methyl ether [6]-gingerdiol acetate methyl ether is a member of the class of compounds known as dimethoxybenzenes. Dimethoxybenzenes are organic aromatic compounds containing a monocyclic benzene moiety carrying exactly two methoxy groups. [6]-gingerdiol acetate methyl ether is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). [6]-gingerdiol acetate methyl ether can be found in ginger, which makes [6]-gingerdiol acetate methyl ether a potential biomarker for the consumption of this food product. 6-GINGEDIOL-ACETATE-METHYL-ETHER C20H32O5 352.4651 352.224974134 1-(3,4-dimethoxyphenyl)-3-hydroxydecan-5-yl acetate 1-(3,4-dimethoxyphenyl)-3-hydroxydecan-5-yl acetate CCCCCC(CC(O)CCC1=CC(OC)=C(OC)C=C1)OC(C)=O InChI=1S/C20H32O5/c1-5-6-7-8-18(25-15(2)21)14-17(22)11-9-16-10-12-19(23-3)20(13-16)24-4/h10,12-13,17-18,22H,5-9,11,14H2,1-4H3 MVMCYBCRYZSVDR-UHFFFAOYSA-N belongs to the class of organic compounds known as dimethoxybenzenes. These are organic aromatic compounds containing a monocyclic benzene moiety carrying exactly two methoxy groups. Dimethoxybenzenes Organic compounds Benzenoids Benzene and substituted derivatives Methoxybenzenes Aromatic homomonocyclic compounds Alkyl aryl ethers Anisoles Carbonyl compounds Carboxylic acid esters Fatty alcohols Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Phenoxy compounds Secondary alcohols Alcohol Alkyl aryl ether Anisole Aromatic homomonocyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Dimethoxybenzene Ether Fatty acyl Fatty alcohol Hydrocarbon derivative Monocarboxylic acid or derivatives O-dimethoxybenzene Organic oxide Organic oxygen compound Organooxygen compound Phenol ether Phenoxy compound Secondary alcohol logp 4.15 ALOGPS logs -4.45 ALOGPS solubility 1.24e-02 g/l ALOGPS logp 3.77 ChemAxon pka_strongest_acidic 15.17 ChemAxon pka_strongest_basic -2.7 ChemAxon iupac 1-(3,4-dimethoxyphenyl)-3-hydroxydecan-5-yl acetate ChemAxon average_mass 352.4651 ChemAxon mono_mass 352.224974134 ChemAxon smiles CCCCCC(CC(O)CCC1=CC(OC)=C(OC)C=C1)OC(C)=O ChemAxon formula C20H32O5 ChemAxon inchi InChI=1S/C20H32O5/c1-5-6-7-8-18(25-15(2)21)14-17(22)11-9-16-10-12-19(23-3)20(13-16)24-4/h10,12-13,17-18,22H,5-9,11,14H2,1-4H3 ChemAxon inchikey MVMCYBCRYZSVDR-UHFFFAOYSA-N ChemAxon polar_surface_area 64.99 ChemAxon refractivity 97.88 ChemAxon polarizability 41.2 ChemAxon rotatable_bond_count 13 ChemAxon acceptor_count 4 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 54951 Specdb::MsMs 54952 Specdb::MsMs 54953 Specdb::MsMs 110766 Specdb::MsMs 110767 Specdb::MsMs 110768 Specdb::MsMs 3604328 Specdb::MsMs 3604329 Specdb::MsMs 3604330 Specdb::MsMs 3604331 Specdb::MsMs 3604332 Specdb::MsMs 3604333 Ginger Type 1 specific Zingiber officinale 94328