1.0 2010-04-08 22:07:46 UTC 2025-11-18 23:05:24 UTC FDB007773 [9]-Gingerol [9]-gingerol is a member of the class of compounds known as gingerols. Gingerols are compounds containing a gingerol moiety, which is structurally characterized by a 4-hydroxy-3-methoxyphenyl group substituted at the C6 carbon atom by a 5-hydroxy-alkane-3-one. [9]-gingerol is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). [9]-gingerol can be found in ginger, which makes [9]-gingerol a potential biomarker for the consumption of this food product. C20H32O4 336.4657 336.230059512 5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)tridecan-3-one 5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)tridecan-3-one CCCCCCCCC(O)CC(=O)CCC1=CC=C(O)C(OC)=C1 InChI=1S/C20H32O4/c1-3-4-5-6-7-8-9-17(21)15-18(22)12-10-16-11-13-19(23)20(14-16)24-2/h11,13-14,17,21,23H,3-10,12,15H2,1-2H3 POEQJXMZRAIOBX-UHFFFAOYSA-N belongs to the class of organic compounds known as gingerols. Gingerols are compounds containing a gingerol moiety, which is structurally characterized by a 4-hydroxy-3-methoxyphenyl group substituted at the C6 carbon atom by a 5-hydroxy-alkane-3-one. Gingerols Organic compounds Benzenoids Phenols Methoxyphenols Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Alkyl aryl ethers Anisoles Beta-hydroxy ketones Fatty alcohols Hydrocarbon derivatives Methoxybenzenes Organic oxides Phenoxy compounds Secondary alcohols 1-hydroxy-2-unsubstituted benzenoid Alcohol Alkyl aryl ether Anisole Aromatic homomonocyclic compound Beta-hydroxy ketone Carbonyl group Ether Fatty acyl Fatty alcohol Gingerol Hydrocarbon derivative Ketone Methoxybenzene Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol ether Phenoxy compound Secondary alcohol logp 5.03 ALOGPS logs -4.13 ALOGPS solubility 2.50e-02 g/l ALOGPS logp 4.95 ChemAxon pka_strongest_acidic 9.95 ChemAxon pka_strongest_basic -2.8 ChemAxon iupac 5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)tridecan-3-one ChemAxon average_mass 336.4657 ChemAxon mono_mass 336.230059512 ChemAxon smiles CCCCCCCCC(O)CC(=O)CCC1=CC=C(O)C(OC)=C1 ChemAxon formula C20H32O4 ChemAxon inchi InChI=1S/C20H32O4/c1-3-4-5-6-7-8-9-17(21)15-18(22)12-10-16-11-13-19(23)20(14-16)24-2/h11,13-14,17,21,23H,3-10,12,15H2,1-2H3 ChemAxon inchikey POEQJXMZRAIOBX-UHFFFAOYSA-N ChemAxon polar_surface_area 66.76 ChemAxon refractivity 96.91 ChemAxon polarizability 40.11 ChemAxon rotatable_bond_count 13 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 79956 Specdb::MsMs 79957 Specdb::MsMs 79958 Specdb::MsMs 140673 Specdb::MsMs 140674 Specdb::MsMs 140675 Specdb::MsMs 3604340 Specdb::MsMs 3604341 Specdb::MsMs 3604342 Specdb::MsMs 3604343 Specdb::MsMs 3604344 Specdb::MsMs 3604345 Ginger Type 1 specific Zingiber officinale 94328