1.0 2010-04-08 22:07:56 UTC 2025-11-18 23:07:11 UTC FDB008135 2-Methylbutanoic acid Ethylmethylacetic acid is a carboxylic acid found in low amounts in normal humans (PMID 3372640) It has been described in the urine of individuals with 2-ethylhydracrylic aciduria associated with short/branched-chain acyl-CoA dehydrogenase deficiency (due to ACADSB gene mutations, OMIM 600301) (PMID 15615815) [HMDB] (+/-)-2-methylbutyrate (+/-)-2-methylbutyric acid 2-Ethylpropanoic acid 2-Ethylpropionate 2-Ethylpropionic acid 2-Methybutyrate 2-Methybutyric acid 2-Methyl butyrate 2-Methyl butyric acid 2-Methyl-n-butyric acid 2-Methylbutanoate 2-Methylbutanoic acid 2-Methylbutyrate 2-Methylbutyric acid a-Methyl butyrate a-Methyl butyric acid a-Methylbutyrate a-Methylbutyric acid Active valeric acid alpha-Methyl butyrate alpha-Methyl butyric acid alpha-Methyl-n-butyric acid alpha-Methylbutyrate alpha-Methylbutyric acid Butane-2-carboxylate Butane-2-carboxylic acid Butyric acid, 2-methyl- (6CI,8CI) Butyric acid, alpha-methyl- (3CI) D-2-Methyl butyrate D-2-Methyl butyric acid DL-2-Methy butyrate DL-2-Methy butyric acid DL-2-Methylbutyrate Ethylmethylacetate Ethylmethylacetic acid FEMA 2695 Methylethylacetate Methylethylacetic acid α-methyl butyrate α-methyl butyric acid α-methylbutyrate α-methylbutyric acid C5H10O2 102.1317 102.068079564 2-methylbutanoic acid (+-)-2-methylbutyrate 116-53-0 CCC(C)C(O)=O InChI=1S/C5H10O2/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7) WLAMNBDJUVNPJU-UHFFFAOYSA-N belongs to the class of organic compounds known as methyl-branched fatty acids. These are fatty acids with an acyl chain that has a methyl branch. Usually, they are saturated and contain only one or more methyl group. However, branches other than methyl may be present. Methyl-branched fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Methyl-branched fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Branched fatty acids methylbutyric acid Solid logp 1.47 ALOGPS logs -0.25 ALOGPS solubility 5.72e+01 g/l ALOGPS logp 1.46 ChemAxon pka_strongest_acidic 4.97 ChemAxon iupac 2-methylbutanoic acid ChemAxon average_mass 102.1317 ChemAxon mono_mass 102.068079564 ChemAxon smiles CCC(C)C(O)=O ChemAxon formula C5H10O2 ChemAxon inchi InChI=1S/C5H10O2/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7) ChemAxon inchikey WLAMNBDJUVNPJU-UHFFFAOYSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 26.45 ChemAxon polarizability 10.98 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 1576 Specdb::MsIr 1661 Specdb::MsIr 1662 Specdb::MsIr 1663 Specdb::CMs 2643 Specdb::CMs 29457 Specdb::CMs 38298 Specdb::CMs 99756 Specdb::CMs 135905 Specdb::CMs 143639 Specdb::NmrOneD 1860 Specdb::NmrOneD 3810 Specdb::NmrOneD 4075 Specdb::NmrOneD 10162 Specdb::NmrOneD 10163 Specdb::NmrOneD 10164 Specdb::NmrOneD 10165 Specdb::NmrOneD 10166 Specdb::NmrOneD 10167 Specdb::NmrOneD 10168 Specdb::NmrOneD 10169 Specdb::NmrOneD 10170 Specdb::NmrOneD 10171 Specdb::NmrOneD 10172 Specdb::NmrOneD 10173 Specdb::NmrOneD 10174 Specdb::NmrOneD 10175 Specdb::NmrOneD 10176 Specdb::NmrOneD 10177 Specdb::NmrOneD 10178 Specdb::NmrOneD 10179 Specdb::NmrOneD 10180 Specdb::NmrOneD 10181 Specdb::MsMs 6341 Specdb::MsMs 10691 Specdb::MsMs 10692 Specdb::MsMs 10693 Specdb::MsMs 12476 Specdb::MsMs 12477 Specdb::MsMs 12478 Specdb::MsMs 17363 Specdb::MsMs 17364 Specdb::MsMs 17365 Specdb::MsMs 19148 Specdb::MsMs 19149 Specdb::MsMs 19150 Specdb::MsMs 2343096 Specdb::MsMs 2343097 Specdb::MsMs 2343098 Specdb::MsMs 2596297 Specdb::MsMs 2596298 Specdb::MsMs 2596299 HMDB02176 37070 #<Reference:0x000055ce3216a750> #<Reference:0x000055ce3216a598> American cranberry Type 1 specific Vaccinium macrocarpon 13750 Anatidae Type 1 specific Anatidae 8830 Apricot Type 1 specific Prunus armeniaca 36596 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bilberry Type 1 specific Vaccinium myrtillus 180763 0.003 0.006 0.0 mg/100 g Bison Type 1 specific Bison bison 9901 Blackberry Type 1 specific Rubus Buffalo Type 1 specific Bubalus bubalis 89462 Burdock Type 1 specific Arctium lappa 4217 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Chinese cinnamon Type 1 specific Cinnamomum aromaticum 119260 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Evergreen blackberry Type 1 specific Rubus laciniatus Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Highbush blueberry Type 1 specific Vaccinium corymbosum 69266 0.0025 0.005 0.0 mg/100 g Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Orange bell pepper Type 1 specific Capsicum annuum 4072 Ostrich Type 1 specific Struthio camelus 8801 Pepper Type 1 specific Capsicum annuum 4072 Pepper (C. frutescens) Type 1 specific Capsicum annuum var. annuum 40321 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Red bell pepper Type 1 specific Capsicum annuum 4072 Rock ptarmigan Type 1 specific Lagopus muta 64668 Safflower Type 1 specific Carthamus tinctorius 4222 0.011 0.011 0.011 mg/100 g Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Yellow bell pepper Type 1 specific Capsicum annuum 4072 acid cheese pungent roquefort cheese sour strawberry sweat