1.0 2010-04-08 22:08:00 UTC 2025-11-18 23:08:27 UTC FDB008261 Ethyl phenylglycidate Flavouring ingredient Aldehyde C16 special (misleading) Ethyl phenylglycidate FEMA 2454 C11H12O3 192.2112 192.07864425 ethyl 3-phenyloxirane-2-carboxylate ethyl 3-phenylglycidate 54276-44-7 CCOC(=O)C1OC1C1=CC=CC=C1 InChI=1S/C11H12O3/c1-2-13-11(12)10-9(14-10)8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3 GOMAKLPNAAZVCJ-UHFFFAOYSA-N belongs to the class of organic compounds known as oxirane carboxylic acids. Oxirane carboxylic acids are compounds containing an oxirane ring bearing a carboxylic acid group. Oxirane carboxylic acids Organic compounds Organoheterocyclic compounds Epoxides Oxirane carboxylic acids and derivatives Aromatic heteromonocyclic compounds Benzene and substituted derivatives Carbonyl compounds Carboxylic acid esters Dialkyl ethers Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Oxacyclic compounds Aromatic heteromonocyclic compound Benzenoid Carbonyl group Carboxylic acid derivative Carboxylic acid ester Dialkyl ether Ether Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Oxacycle Oxirane carboxylic acid logp 2.07 ALOGPS logs -2.04 ALOGPS solubility 1.74e+00 g/l ALOGPS logp 1.93 ChemAxon pka_strongest_basic -4.3 ChemAxon iupac ethyl 3-phenyloxirane-2-carboxylate ChemAxon average_mass 192.2112 ChemAxon mono_mass 192.07864425 ChemAxon smiles CCOC(=O)C1OC1C1=CC=CC=C1 ChemAxon formula C11H12O3 ChemAxon inchi InChI=1S/C11H12O3/c1-2-13-11(12)10-9(14-10)8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3 ChemAxon inchikey GOMAKLPNAAZVCJ-UHFFFAOYSA-N ChemAxon polar_surface_area 38.83 ChemAxon refractivity 50.67 ChemAxon polarizability 19.92 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 19398 Specdb::CMs 147777 Specdb::MsMs 89358 Specdb::MsMs 89359 Specdb::MsMs 89360 Specdb::MsMs 152277 Specdb::MsMs 152278 Specdb::MsMs 152279 Specdb::MsMs 2354886 Specdb::MsMs 2354887 Specdb::MsMs 2354888 Specdb::MsMs 2607744 Specdb::MsMs 2607745 Specdb::MsMs 2607746 HMDB0031623