1.0 2010-04-08 22:08:04 UTC 2025-11-18 23:10:11 UTC FDB008416 Thiamine hydrochloride Nutrient supplement; flavouring ingredient with a bitter taste. Thiamine hydrochloride is found in many foods, some of which are sesame, cinnamon, garden rhubarb, and nougat. Betalin S Betaxin Bewon Eskapen Eskaphen FEMA 3322 Hybee Lixa-beta Metabolin MP silitech Slowten Thiamin dichloride Thiaminal Thiamine chloride Thiamine dichloride Thiamine HCL Thiamine Hydrochloride (B1) Thiamine hydrochloride (JP15/USP) Thiamine hydrochloride, USAN Thiamine, hydrochloride Thiamine, monohydrochloride (8CI) Thiamol Thiavit Tiamidon Tiaminal Vetalin s Vinothiam Vitamin b hydrochloride Vitamin b(sub 1) hydrochloride Vitamin B1 hydrochloride (VAN) C12H18Cl2N4OS 337.269 336.057837322 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-hydroxyethyl)-4-methyl-1,3-thiazol-3-ium hydrochloride chloride thiamine hydrochloride chloride 67-03-8 Cl.[Cl-].CC1=C(CCO)SC=[N+]1CC1=C(N)N=C(C)N=C1 InChI=1S/C12H17N4OS.2ClH/c1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13;;/h5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15);2*1H/q+1;;/p-1 DPJRMOMPQZCRJU-UHFFFAOYSA-M belongs to the class of organic compounds known as thiamines. Thiamines are compounds containing a thiamine moiety, which is structurally characterized by a 3-[(4-Amino-2-methyl-pyrimidin-5-yl)methyl]-4-methyl-thiazol-5-yl backbone. Thiamines Organic compounds Organoheterocyclic compounds Diazines Pyrimidines and pyrimidine derivatives Aromatic heteromonocyclic compounds 4,5-disubstituted thiazoles Aminopyrimidines and derivatives Azacyclic compounds Heteroaromatic compounds Hydrocarbon derivatives Hydrochlorides Imidolactams Organic chloride salts Organopnictogen compounds Primary alcohols Primary amines 4,5-disubstituted 1,3-thiazole Alcohol Amine Aminopyrimidine Aromatic heteromonocyclic compound Azacycle Azole Heteroaromatic compound Hydrocarbon derivative Hydrochloride Imidolactam Organic chloride salt Organic nitrogen compound Organic oxygen compound Organic salt Organonitrogen compound Organooxygen compound Organopnictogen compound Primary alcohol Primary amine Thiamine Thiazole thiamine logp -1.88 ALOGPS logs -4.31 ALOGPS solubility 1.48e-02 g/l ALOGPS melting_point Mp 248° dec. logp -3.1 ChemAxon pka_strongest_acidic 15.5 ChemAxon pka_strongest_basic 5.54 ChemAxon iupac 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-hydroxyethyl)-4-methyl-1,3-thiazol-3-ium hydrochloride chloride ChemAxon average_mass 337.269 ChemAxon mono_mass 336.057837322 ChemAxon smiles Cl.[Cl-].CC1=C(CCO)SC=[N+]1CC1=C(N)N=C(C)N=C1 ChemAxon formula C12H18Cl2N4OS ChemAxon inchi InChI=1S/C12H17N4OS.2ClH/c1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13;;/h5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15);2*1H/q+1;;/p-1 ChemAxon inchikey DPJRMOMPQZCRJU-UHFFFAOYSA-M ChemAxon polar_surface_area 75.91 ChemAxon refractivity 73.4 ChemAxon polarizability 28.15 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrOneD 3958 Specdb::NmrOneD 4240 Specdb::MsMs 88845 Specdb::MsMs 88846 Specdb::MsMs 88847 Specdb::MsMs 151650 Specdb::MsMs 151651 Specdb::MsMs 151652 49105 Adzuki bean Type 1 specific Vigna angularis 3914 0.0 0.0 0.0 mg/100 g Alfalfa Type 1 specific Medicago sativa 3879 0.578 1.08 0.076 mg/100 g Allium Type 1 specific Allium 4678 0.129 0.39 0.03 mg/100 g Almond Type 1 specific Prunus dulcis 3755 0.275 0.275 0.275 mg/100 g Anatidae Type 1 specific Anatidae 8830 0.38475 0.562 0.197 mg/100 g Anchovy Type 1 specific Engraulidae 43062 0.006 0.006 0.006 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 0.145 0.15 0.14 mg/100 g Apple Type 1 specific Malus pumila 283210 0.022333 0.065 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 0.015333 0.03 0.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 0.011667 0.07 0.0 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 0.035 0.11 0.0 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 0.05 0.06 0.04 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 0.18 0.18 0.18 mg/100 g Avocado Type 1 specific Persea americana 3435 0.1 0.1 0.1 mg/100 g Baby food Type 2 specific 0.433 0.433 0.433 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.02 0.04 0.01 mg/100 g Banana Type 1 specific Musa acuminata 4641 0.039 0.039 0.039 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 0.245 0.33 0.16 mg/100 g Beer Type 2 specific 0.002167 0.007 0.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 0.03 0.03 0.03 mg/100 g Biscuit Type 2 specific 0.029167 0.085 0.0 mg/100 g Black salsify Type 1 specific Scorzonera hispanica 114289 0.15 0.15 0.15 mg/100 g Black tea Type 1 0.07 0.14 0.0 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 0.005 0.025 0.0 mg/100 g Blue whiting Type 1 specific Micromesistius poutassou 81636 0.08 0.08 0.08 mg/100 g Brazil nut Type 1 specific Bertholletia excelsa 3645 1.13 1.13 1.13 mg/100 g Breakfast cereal Type 2 specific 0.6402 0.874 0.317 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 0.065 0.079 0.053 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 0.06475 0.139 0.0 mg/100 g Burbot Type 1 specific Lota lota 69944 0.18 0.18 0.18 mg/100 g Butter Type 2 specific 0.007 0.007 0.007 mg/100 g Buttermilk Type 2 specific 0.037 0.039 0.035 mg/100 g Carp bream Type 1 specific Abramis brama 38527 0.07 0.07 0.07 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.046333 0.092 0.018 mg/100 g Casein Type 2 specific 0.0 0.0 0.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 0.2815 0.363 0.2 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 0.087 0.087 0.087 mg/100 g Catfish Type 1 specific Siluriformes 7995 0.18 0.18 0.18 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 0.086021 0.44 0.03 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 0.05625 0.058 0.051 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 0.05 0.05 0.05 mg/100 g Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 0.0 0.0 0.0 mg/100 g Cetacea (Dolphin, Porpoise, Whale) Type 1 specific Cetacea 9721 0.1 0.1 0.1 mg/100 g Chanterelle Type 1 specific Cantharellus cibarius 36066 0.09 0.09 0.09 mg/100 g Charr Type 1 specific Salvelinus 8033 0.08 0.16 0.0 mg/100 g Chayote Type 1 specific Sechium edule 184140 0.025 0.025 0.025 mg/100 g Cheese Type 2 specific 0.04835 0.091 0.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 0.091 0.091 0.091 mg/100 g Chervil Type 1 specific Anthriscus cerefolium 40888 0.125 0.125 0.125 mg/100 g Chestnut Type 1 specific Castanea 21019 0.24 0.24 0.24 mg/100 g Chewing gum Type 2 specific 0.0 0.0 0.0 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 0.5 0.5 0.5 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 0.0505 0.085 0.016 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 0.04 0.04 0.04 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 0.07 0.07 0.07 mg/100 g Chocolate Type 2 specific 0.094 0.14 0.07 mg/100 g Chocolate spread Type 2 specific 0.1 0.1 0.1 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 0.022 0.022 0.022 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 0.061667 0.085 0.05 mg/100 g Clupeinae (Herring, Sardine, Sprat) Type 1 specific Clupeinae 7948 0.033111 0.1 0.0 mg/100 g Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa powder Type 2 specific 0.073333 0.1 0.06 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 0.015 0.035 0.0 mg/100 g Coffee Type 1 generic Coffea 13442 0.011667 0.07 0.0 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 0.146556 0.437 0.024 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 0.246667 0.39 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 0.0588 0.065 0.049 mg/100 g Common dab Type 1 specific Limanda limanda 27771 0.103 0.103 0.103 mg/100 g Common ling Type 1 specific Molva molva 163112 0.01 0.01 0.01 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 0.0835 0.086 0.081 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 0.067 0.067 0.067 mg/100 g Common pea Type 1 specific Pisum sativum 3888 0.3106 0.82 0.0 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 0.518667 1.25 0.067 mg/100 g Corn Type 1 specific Zea mays 4577 0.089667 0.33 0.0 mg/100 g Cottonseed Type 1 specific Gossypium 3633 0.0 0.0 0.0 mg/100 g Crab Type 1 specific Brachyura 6752 0.066667 0.1 0.05 mg/100 g Cracker Type 2 specific 0.13 0.13 0.13 mg/100 g Crayfish Type 1 specific Astacidea 6712 0.01 0.01 0.01 mg/100 g Cream Type 2 specific 0.034111 0.04 0.018 mg/100 g Crisp bread Type 2 specific 0.31 0.34 0.27 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 0.006167 0.017 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 0.037 0.05 0.024 mg/100 g Curry powder Type 2 specific 0.253 0.253 0.253 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 0.035 0.05 0.02 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 0.19 0.19 0.19 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 0.03 0.03 0.03 mg/100 g Dill Type 1 specific Anethum graveolens 40922 0.304 0.418 0.19 mg/100 g Domestic pig Type 1 specific Sus scrofa domestica 9825 0.625457 1.14 0.0 mg/100 g Dragée Type 2 specific 0.0 0.0 0.0 mg/100 g Dried milk Type 2 specific 0.3825 0.44 0.325 mg/100 g Dumpling Type 2 specific 0.0 0.0 0.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 0.05 0.05 0.05 mg/100 g Eggs Unknown generic 0.119846 0.29 0.0 mg/100 g Elderberry Type 1 specific Sambucus 4201 0.023333 0.07 0.0 mg/100 g Endive Type 1 specific Cichorium endivia 114280 0.08 0.08 0.08 mg/100 g European plum Type 1 specific Prunus domestica 3758 0.05 0.08 0.02 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 0.219 0.408 0.03 mg/100 g Fig Type 1 specific Ficus carica 3494 0.066333 0.085 0.054 mg/100 g Fish oil Type 1 0.0 0.0 0.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 0.22 0.22 0.22 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 0.3955 0.791 0.0 mg/100 g French plantain Type 1 specific Musa X paradisiaca 89151 0.052 0.052 0.052 mg/100 g Fruit gum Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit juice Type 2 specific 0.006 0.006 0.006 mg/100 g Fruit preserve Type 2 specific 0.0 0.0 0.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.1 0.1 0.1 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 0.134286 0.93 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 0.18 0.18 0.18 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 0.03 0.03 0.03 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 0.112875 0.528 0.041 mg/100 g Garfish Type 1 specific Belone belone 129037 0.012 0.012 0.012 mg/100 g Garlic Type 1 specific Allium sativum 4682 0.333 0.466 0.2 mg/100 g Gelatin Type 2 specific 0.0 0.0 0.0 mg/100 g Gelatin dessert Type 2 specific 0.0 0.0 0.0 mg/100 g Gin Type 2 specific 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 0.025 0.025 0.025 mg/100 g Globe artichoke Type 1 specific Cynara scolymus 59895 0.089 0.089 0.089 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 0.011 0.011 0.011 mg/100 g Grape Type 1 specific Vitis 3603 0.039 0.085 0.0 mg/100 g Grape wine Type 2 specific 0.0025 0.01 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 0.045 0.05 0.04 mg/100 g Green bean Type 1 specific Phaseolus vulgaris 3885 0.093 0.099 0.09 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 0.0295 0.034 0.025 mg/100 g Green tea Type 1 0.07 0.14 0.0 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.037 0.048 0.026 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 0.06 0.06 0.06 mg/100 g Groundcherry Type 1 specific Physalis 24663 0.04 0.04 0.04 mg/100 g Guava Type 1 specific Psidium guajava 120290 0.037 0.037 0.037 mg/100 g Haddock Type 1 specific Melanogrammus aeglefinus 8056 0.036667 0.07 0.0 mg/100 g Hazelnut Type 1 specific Corylus 13450 0.39 0.39 0.39 mg/100 g Herbal tea Type 1 0.07 0.14 0.0 mg/100 g Honey Type 2 specific 0.0 0.0 0.0 mg/100 g Horseradish Type 1 specific Armoracia rusticana 3704 0.14 0.14 0.14 mg/100 g Hot chocolate Type 2 specific 0.0335 0.037 0.027 mg/100 g Ice cream Type 2 specific 0.048 0.05 0.04 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 0.05 0.05 0.05 mg/100 g Japanese pumpkin Type 1 specific Cucurbita maxima 3661 0.026 0.026 0.026 mg/100 g Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 0.07 0.07 0.07 mg/100 g Kale Type 1 specific Brassica napus var. pabularia 0.075333 0.15 0.02 mg/100 g Kefir Type 2 specific 0.045 0.045 0.045 mg/100 g Ketchup Type 2 specific 0.02 0.04 0.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 0.006 0.006 0.006 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 0.05 0.05 0.05 mg/100 g Kombu Type 1 specific Saccharina japonica 88149 0.21 0.21 0.21 mg/100 g Kumquat Type 1 specific Fortunella 2706 0.037 0.037 0.037 mg/100 g Lake trout Type 1 specific Salvelinus namaycush 8040 0.16 0.16 0.16 mg/100 g Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Leavening agent Type 2 specific 3.125 9.7 0.0 mg/100 g Leek Type 1 specific Allium porrum 0.07 0.07 0.07 mg/100 g Lemon Type 1 specific Citrus limon 2708 0.041667 0.06 0.02 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 0.09 0.09 0.09 mg/100 g Lentils Type 1 generic Lens culinaris 3864 0.182 0.5 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 0.0665 0.08 0.044 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.011 0.011 0.011 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 0.03 0.03 0.03 mg/100 g Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 0.025 0.05 0.0 mg/100 g Liquor Type 2 specific 0.001875 0.011 0.0 mg/100 g Liquorice Type 2 specific 0.01 0.04 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 0.05 0.05 0.05 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 0.019 0.019 0.019 mg/100 g Lumpsucker Type 1 specific Cyclopteridae 8101 0.07 0.07 0.07 mg/100 g Madeira wine Type 2 specific 0.0 0.0 0.0 mg/100 g Malus (Crab apple) Type 1 specific Malus 3749 0.03 0.03 0.03 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 0.079 0.105 0.053 mg/100 g Mango Type 1 specific Mangifera indica 29780 0.058 0.058 0.058 mg/100 g Margarine Type 2 specific 0.0095 0.01 0.007 mg/100 g Margarine-like spread Type 2 specific 0.005 0.005 0.005 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 0.003333 0.01 0.0 mg/100 g Marshmallow Type 2 specific 0.0 0.0 0.0 mg/100 g Marzipan Type 2 specific 0.055 0.11 0.0 mg/100 g Meat bouillon Type 2 specific 1.8448 9.1 0.002 mg/100 g Meatball Type 2 specific 0.0 0.0 0.0 mg/100 g Meringue Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Cow) Type 2 specific 0.042625 0.047 0.04 mg/100 g Milk (Human) Type 2 specific 0.01 0.02 0.0 mg/100 g Milk (Other mammals) Type 2 specific 0.048 0.048 0.048 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 0.421 0.421 0.421 mg/100 g Miso Type 2 specific 0.06 0.06 0.06 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 0.09 0.09 0.09 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 0.3525 0.621 0.084 mg/100 g Muskmelon Type 1 specific Cucumis melo 3656 0.032 0.041 0.025 mg/100 g Mustard Type 2 specific 0.0255 0.051 0.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 0.034 0.034 0.034 mg/100 g Northern pike Type 1 specific Esox lucius 8010 0.08 0.08 0.08 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Norway lobster Type 1 specific Nephrops norvegicus 6829 0.13 0.13 0.13 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.1 0.1 0.1 mg/100 g Nougat Type 2 specific 0.0 0.0 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 0.346 0.346 0.346 mg/100 g Oat Type 1 specific Avena sativa 4498 0.30875 0.424 0.0 mg/100 g Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 0.2 0.2 0.2 mg/100 g Olive Type 1 specific Olea europaea 4146 0.00525 0.021 0.0 mg/100 g Other animal fat Type 2 specific 0.027 0.054 0.0 mg/100 g Other bread Type 2 specific 0.161778 0.21 0.085 mg/100 g Other bread product Type 2 specific 0.395 0.59 0.2 mg/100 g Other candy Type 2 specific 0.0 0.0 0.0 mg/100 g Other dish Type 2 specific 0.063333 0.065 0.06 mg/100 g Other fermented milk Type 2 specific 0.0415 0.045 0.038 mg/100 g Other fish product Type 2 specific 0.0 0.0 0.0 mg/100 g Other fruit product Type 2 specific 0.064 0.064 0.064 mg/100 g Other snack food Type 2 specific 0.151667 0.251 0.096 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.05 0.05 0.05 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 0.04 0.04 0.04 mg/100 g Papaya Type 1 specific Carica papaya 3649 0.027 0.027 0.027 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 0.11 0.12 0.1 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 0.09 0.09 0.09 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 0.0 0.0 0.0 mg/100 g Pasta Type 2 specific 0.286667 0.67 0.04 mg/100 g Pastry Type 2 specific 0.036591 0.132 0.0 mg/100 g Pate Type 2 specific 0.196 0.196 0.196 mg/100 g Peach Type 1 specific Prunus persica 3760 0.010667 0.02 0.002 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 0.30525 0.91 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.0135 0.017 0.01 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 0.527667 0.66 0.45 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 0.040167 0.09 0.02 mg/100 g Pepper (Spice) Type 1 specific Piper nigrum 13216 0.109 0.109 0.109 mg/100 g Perciformes Type 1 specific Perciformes 8111 0.07 0.07 0.07 mg/100 g Persimmon Type 1 specific Diospyros 13492 0.03 0.03 0.03 mg/100 g Pikeperch Type 1 specific Sander lucioperca 283035 0.16 0.16 0.16 mg/100 g Pine nut Type 1 specific Pinus 3337 0.364 0.364 0.364 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.072667 0.08 0.058 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 0.855 0.87 0.84 mg/100 g Pizza Type 2 specific 0.22 0.22 0.22 mg/100 g Pleuronectidae (Dab, Halibut, Plaice) Type 1 specific Pleuronectidae 8256 0.13 0.21 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.066667 0.1 0.05 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.03 0.03 0.03 mg/100 g Poppy Type 1 specific Papaver 3468 0.849 0.849 0.849 mg/100 g Port wine Type 2 specific 0.0 0.0 0.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 0.133333 0.39 0.0 mg/100 g Prickly pear Type 1 specific Opuntia 106975 0.014 0.014 0.014 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 0.00625 0.025 0.0 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 0.02 0.02 0.02 mg/100 g Rabbit Type 1 specific Leporidae 9979 0.115 0.115 0.115 mg/100 g Radish Type 1 specific Raphanus sativus 3726 0.02 0.02 0.02 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 0.1 0.1 0.1 mg/100 g Rape Type 1 specific Brassica napus var. napus 138011 0.0 0.0 0.0 mg/100 g Red algae Type 1 specific Rhodophyta 2763 0.0 0.0 0.0 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra 0.015 0.025 0.01 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 0.0375 0.05 0.025 mg/100 g Red tea Type 1 0.07 0.14 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.00625 0.025 0.0 mg/100 g Remoulade Type 2 specific 0.025 0.025 0.025 mg/100 g Rice Type 1 specific Oryza sativa 4530 0.5075 2.75 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 0.011667 0.07 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 0.22 0.22 0.22 mg/100 g Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 0.072 0.072 0.072 mg/100 g Rose hip Type 1 specific Rosa 3764 0.04 0.06 0.0 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.015143 0.03 0.0 mg/100 g Rum Type 2 specific 0.006 0.006 0.006 mg/100 g Rye Type 1 specific Secale cereale 4550 0.3208 0.37 0.234 mg/100 g Rye bread Type 2 specific 0.162647 0.25 0.024 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 0.0 0.0 0.0 mg/100 g Salad dressing Type 2 specific 0.128083 1.45 0.0 mg/100 g Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 0.156667 0.23 0.04 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Sauce Type 2 specific 0.023333 0.06 0.0 mg/100 g Sausage Type 2 specific 0.139824 0.38 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 0.07 0.07 0.07 mg/100 g Scombridae (Bonito, Mackerel, Tuna) Type 1 specific Scombridae 8224 0.1 0.14 0.06 mg/100 g Semolina Type 2 specific 0.21 0.21 0.21 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 0.527333 0.791 0.0 mg/100 g Sherry Type 2 specific 0.0 0.0 0.0 mg/100 g Shrimp Type 1 specific Caridea 6694 0.025667 0.06 0.007 mg/100 g Snail Type 1 specific Gastropoda 6448 0.0 0.0 0.0 mg/100 g Soft drink Type 2 specific 0.0 0.0 0.0 mg/100 g Sorrel Type 1 specific Rumex acetosa 41241 0.04 0.04 0.04 mg/100 g Soup Type 2 specific 0.07 0.07 0.07 mg/100 g Soy bean Type 1 specific Glycine max 3847 0.3968 0.874 0.0 mg/100 g Soy milk Type 2 specific 0.06 0.06 0.06 mg/100 g Soy sauce Type 2 specific 0.033 0.033 0.033 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 0.0945 0.095 0.094 mg/100 g Spiny dogfish Type 1 specific Squalus acanthias 7797 0.052 0.052 0.052 mg/100 g Spirit Type 2 specific 0.0 0.0 0.0 mg/100 g Star fruit Type 1 specific Averrhoa carambola 28974 0.014 0.014 0.014 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 0.0085 0.022 0.0 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 0.465 0.93 0.0 mg/100 g Sugar Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 0.026 0.026 0.026 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 1.05 2.1 0.0 mg/100 g Swede Type 1 specific Brassica napus 3708 0.045 0.045 0.045 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 0.048667 0.086 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 0.065 0.065 0.065 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 0.04 0.04 0.04 mg/100 g Syrup Type 2 specific 0.0 0.0 0.0 mg/100 g Tallow Type 2 specific 0.0 0.0 0.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 0.428 0.428 0.428 mg/100 g Tea Type 1 specific Camellia sinensis 4442 0.07 0.14 0.0 mg/100 g Thistle Type 1 specific Cirsium 41549 0.0 0.0 0.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 0.072 0.163 0.025 mg/100 g Toffee Type 2 specific 0.0 0.0 0.0 mg/100 g Tofu Type 2 specific 0.06 0.06 0.06 mg/100 g True frog Type 1 specific Ranidae 8397 0.14 0.14 0.14 mg/100 g True oyster Type 1 specific Ostreidae 6563 0.08 0.08 0.08 mg/100 g True seal Type 1 specific Phocidae 9709 0.2 0.2 0.2 mg/100 g True sole Type 1 specific Soleidae 30948 0.072 0.072 0.072 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 0.036 0.036 0.036 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 0.04 0.04 0.04 mg/100 g Unclassified food or beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 0.022 0.032 0.012 mg/100 g Vegetable juice Type 2 specific 0.074 0.074 0.074 mg/100 g Vermouth Type 2 specific 0.0 0.0 0.0 mg/100 g Vinegar Type 2 specific 0.0 0.0 0.0 mg/100 g Vodka Type 2 specific 0.005 0.005 0.005 mg/100 g Walnut Type 1 specific Juglans 16718 0.22 0.44 0.0 mg/100 g Water Type 2 specific 0.0 0.0 0.0 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 0.1 0.1 0.1 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 0.02 0.02 0.02 mg/100 g Wheat Type 1 specific Triticum 4564 0.414556 1.45 0.0 mg/100 g Wheat bread Type 2 specific 0.179105 0.45 0.103 mg/100 g Whey Type 2 specific 0.228333 0.519 0.036 mg/100 g Whisky Type 2 specific 0.008 0.008 0.008 mg/100 g White bread Type 1 0.182 0.182 0.182 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 0.049 0.049 0.049 mg/100 g Whitefish Type 1 specific Coregonus 27772 0.07 0.07 0.07 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 0.05 0.05 0.05 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 0.035 0.035 0.035 mg/100 g Yam Type 1 specific Dioscorea 4672 0.112 0.112 0.112 mg/100 g Yellow bell pepper Type 1 specific Capsicum annuum 4072 0.025 0.025 0.025 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.037 0.048 0.026 mg/100 g Ymer Type 2 specific 0.0395 0.04 0.039 mg/100 g Yogurt Type 2 specific 0.0354 0.044 0.006 mg/100 g bitter mild sour