1.0 2010-04-08 22:08:06 UTC 2019-11-26 03:02:40 UTC FDB008493 D-Glyceric acid Isolated from various plants, e.g. Vicia faba and cress. D-Glyceric acid is found in brassicas and pulses. D-2,3-Dihydroxypropanoic acid D-Glycerate D-Glyceric acid R-2,3-Dihydroxypropanoic acid C3H6O4 106.0773 106.02660868 2,3-dihydroxypropanoic acid glyceric acid 6000-40-4 OCC(O)C(O)=O InChI=1S/C3H6O4/c4-1-2(5)3(6)7/h2,4-5H,1H2,(H,6,7) RBNPOMFGQQGHHO-UHFFFAOYSA-N belongs to the class of organic compounds known as sugar acids and derivatives. Sugar acids and derivatives are compounds containing a saccharide unit which bears a carboxylic acid group. Sugar acids and derivatives Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aliphatic acyclic compounds 1,2-diols Alpha hydroxy acids and derivatives Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Monosaccharides Organic oxides Primary alcohols Secondary alcohols 1,2-diol Alcohol Aliphatic acyclic compound Alpha-hydroxy acid Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Glyceric_acid Hydrocarbon derivative Hydroxy acid Monocarboxylic acid or derivatives Monosaccharide Organic oxide Primary alcohol Secondary alcohol Sugar acid trionic acid logp -1.72 ALOGPS logs 0.78 ALOGPS solubility 6.39e+02 g/l ALOGPS logp -1.5 ChemAxon pka_strongest_acidic 3.42 ChemAxon pka_strongest_basic -3 ChemAxon iupac 2,3-dihydroxypropanoic acid ChemAxon average_mass 106.0773 ChemAxon mono_mass 106.02660868 ChemAxon smiles OCC(O)C(O)=O ChemAxon formula C3H6O4 ChemAxon inchi InChI=1S/C3H6O4/c4-1-2(5)3(6)7/h2,4-5H,1H2,(H,6,7) ChemAxon inchikey RBNPOMFGQQGHHO-UHFFFAOYSA-N ChemAxon polar_surface_area 77.76 ChemAxon refractivity 20.38 ChemAxon polarizability 8.95 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 46230 Specdb::MsMs 46231 Specdb::MsMs 46232 Specdb::MsMs 130899 Specdb::MsMs 130900 Specdb::MsMs 130901 Specdb::MsMs 439268 Specdb::MsMs 440032 Specdb::MsMs 440087 Specdb::CMs 2919 Specdb::CMs 32013 Specdb::CMs 42632 Specdb::CMs 100967 HMDB31818 #<Reference:0x000055ce307ace80> Brassicas Unknown generic 3705 Pulses Unknown generic