1.0 2010-04-08 22:08:17 UTC 2019-11-26 03:03:19 UTC FDB008854 3-(3,5-Dihydroxyphenyl)-2-propenoic acid Isolated from peach buds. 3-(3,5-Dihydroxyphenyl)-2-propenoic acid is found in fruits. 2-Propenoic acid, 3-(3,5-dihydroxyphenyl)- 3,5-dihydroxycinnamic Acid 3,5-Dihydroxycinnamic acid, 8CI C9H8O4 180.1574 180.042258744 (2Z)-3-(3,5-dihydroxyphenyl)prop-2-enoic acid (2Z)-3-(3,5-dihydroxyphenyl)prop-2-enoic acid 28374-93-8 OC(=O)\C=C/C1=CC(O)=CC(O)=C1 InChI=1S/C9H8O4/c10-7-3-6(1-2-9(12)13)4-8(11)5-7/h1-5,10-11H,(H,12,13)/b2-1- MFFCZSWTQMCKFP-UPHRSURJSA-N belongs to the class of organic compounds known as hydroxycinnamic acids. Hydroxycinnamic acids are compounds containing an cinnamic acid where the benzene ring is hydroxylated. Hydroxycinnamic acids Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Carbonyl compounds Carboxylic acids Cinnamic acids Coumaric acids and derivatives Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Resorcinols Styrenes 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Cinnamic acid Coumaric acid or derivatives Hydrocarbon derivative Hydroxycinnamic acid Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol Resorcinol Styrene logp 1.47 ALOGPS logs -2.10 ALOGPS solubility 1.45e+00 g/l ALOGPS melting_point Mp 245-246° logp 1.53 ChemAxon pka_strongest_acidic 3.13 ChemAxon pka_strongest_basic -5.7 ChemAxon iupac (2Z)-3-(3,5-dihydroxyphenyl)prop-2-enoic acid ChemAxon average_mass 180.1574 ChemAxon mono_mass 180.042258744 ChemAxon smiles OC(=O)\C=C/C1=CC(O)=CC(O)=C1 ChemAxon formula C9H8O4 ChemAxon inchi InChI=1S/C9H8O4/c10-7-3-6(1-2-9(12)13)4-8(11)5-7/h1-5,10-11H,(H,12,13)/b2-1- ChemAxon inchikey MFFCZSWTQMCKFP-UPHRSURJSA-N ChemAxon polar_surface_area 77.76 ChemAxon refractivity 47.02 ChemAxon polarizability 16.94 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 11141 Specdb::CMs 42763 Specdb::MsMs 58926 Specdb::MsMs 58927 Specdb::MsMs 58928 Specdb::MsMs 114957 Specdb::MsMs 114958 Specdb::MsMs 114959 HMDB32131 #<Reference:0x000055ce32173b98> Fruits Unknown generic