1.0 2010-04-08 22:08:18 UTC 2025-11-18 23:14:43 UTC FDB008896 Acrylamide-sodium acrylate resin It is used as a food additive . C8H15NO3 173.212 173.105193347 4-(C-hydroxycarbonimidoyl)-2-methylhexanoic acid 4-(C-hydroxycarbonimidoyl)-2-methylhexanoic acid 25085-02-3 CCC(CC(C)C(O)=O)C(O)=N InChI=1S/C8H15NO3/c1-3-6(7(9)10)4-5(2)8(11)12/h5-6H,3-4H2,1-2H3,(H2,9,10)(H,11,12) WOOUQGFMGLSRBS-UHFFFAOYSA-N belongs to the class of organic compounds known as medium-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 4 and 12 carbon atoms. Medium-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Amino fatty acids Carbonyl compounds Carboxylic acids Fatty amides Hydrocarbon derivatives Methyl-branched fatty acids Monocarboxylic acids and derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Primary carboxylic acid amides Aliphatic acyclic compound Amino fatty acid Branched fatty acid Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid derivative Fatty amide Hydrocarbon derivative Medium-chain fatty acid Methyl-branched fatty acid Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary carboxylic acid amide logp 0.39 ALOGPS logs -1.92 ALOGPS solubility 2.06e+00 g/l ALOGPS logp -1.1 ChemAxon pka_strongest_acidic -0.4 ChemAxon pka_strongest_basic 13.28 ChemAxon iupac 4-(C-hydroxycarbonimidoyl)-2-methylhexanoic acid ChemAxon average_mass 173.212 ChemAxon mono_mass 173.105193347 ChemAxon smiles CCC(CC(C)C(O)=O)C(O)=N ChemAxon formula C8H15NO3 ChemAxon inchi InChI=1S/C8H15NO3/c1-3-6(7(9)10)4-5(2)8(11)12/h5-6H,3-4H2,1-2H3,(H2,9,10)(H,11,12) ChemAxon inchikey WOOUQGFMGLSRBS-UHFFFAOYSA-N ChemAxon polar_surface_area 81.38 ChemAxon refractivity 54.65 ChemAxon polarizability 18.04 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 104157 Specdb::MsMs 104158 Specdb::MsMs 104159 Specdb::MsMs 170373 Specdb::MsMs 170374 Specdb::MsMs 170375 Specdb::MsMs 3604807 Specdb::MsMs 3604808 Specdb::MsMs 3604809 Specdb::MsMs 3604810 Specdb::MsMs 3604811 Specdb::MsMs 3604812