1.0 2010-04-08 22:08:20 UTC 2025-11-18 23:14:49 UTC FDB008943 Ammonium citrate, dibasic It is used as a food additive . Ammonium citrate, dibasic, acs C6H14N2O7 226.1846 226.080100812 diammonium 3-carboxy-3-hydroxypentanedioate diammonium 3-carboxy-3-hydroxypentanedioate 3012-65-5 [NH4+].[NH4+].OC(=O)C(O)(CC([O-])=O)CC([O-])=O InChI=1S/C6H8O7.2H3N/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);2*1H3 YXVFQADLFFNVDS-UHFFFAOYSA-N belongs to the class of organic compounds known as tricarboxylic acids and derivatives. These are carboxylic acids containing exactly three carboxyl groups. Tricarboxylic acids and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Tricarboxylic acids and derivatives Aliphatic acyclic compounds Alpha hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Organic nitrogen compounds Organic oxides Tertiary alcohols Alcohol Aliphatic acyclic compound Alpha-hydroxy acid Carbonyl group Carboxylic acid Hydrocarbon derivative Hydroxy acid Organic nitrogen compound Organic oxide Organic oxygen compound Organooxygen compound Tertiary alcohol Tricarboxylic acid or derivatives ammonium salt citrate salt logp -0.94 ALOGPS logs 0.07 ALOGPS solubility 2.65e+02 g/l ALOGPS logp -1.3 ChemAxon pka_strongest_acidic 3.05 ChemAxon pka_strongest_basic -4.2 ChemAxon iupac diammonium 3-carboxy-3-hydroxypentanedioate ChemAxon average_mass 226.1846 ChemAxon mono_mass 226.080100812 ChemAxon smiles [NH4+].[NH4+].OC(=O)C(O)(CC([O-])=O)CC([O-])=O ChemAxon formula C6H14N2O7 ChemAxon inchi InChI=1S/C6H8O7.2H3N/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);2*1H3 ChemAxon inchikey YXVFQADLFFNVDS-UHFFFAOYSA-N ChemAxon polar_surface_area 137.79 ChemAxon refractivity 57.3 ChemAxon polarizability 14.66 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 7 ChemAxon donor_count 2 ChemAxon physiological_charge -3 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 19801 Specdb::MsMs 61458 Specdb::MsMs 61459 Specdb::MsMs 61460 Specdb::MsMs 117987 Specdb::MsMs 117988 Specdb::MsMs 117989 HMDB32172