1.0 2010-04-08 22:08:24 UTC 2025-11-18 23:15:05 UTC FDB009079 Caramel The substance obtained by controlled heat treatment of food-grade carbohydrates. Food-grade acids, alkalies, and salts may be used to assist carmelization. Food-grade antifoaming agents may be used in an amount not greater than that required to produce the intended effect. Consists essentially of colloidal aggregates that are dispersible in water but only partly dispersible in alcohol-water solutions. Depending upon the particular carmelizing agent used, may have a positive or negative colloidal charge in solution. (SciFinder). C23H32N2O5 416.5106 416.231122144 (2S,3aS,6aS)-1-[(2S)-2-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}propanoyl]-octahydrocyclopenta[b]pyrrole-2-carboxylic acid ramipril 8028-89-5 [H][C@@]12CCC[C@]1([H])N([C@@H](C2)C(O)=O)C(=O)[C@H](C)N[C@@H](CCC1=CC=CC=C1)C(=O)OCC InChI=1S/C23H32N2O5/c1-3-30-23(29)18(13-12-16-8-5-4-6-9-16)24-15(2)21(26)25-19-11-7-10-17(19)14-20(25)22(27)28/h4-6,8-9,15,17-20,24H,3,7,10-14H2,1-2H3,(H,27,28)/t15-,17-,18-,19-,20-/m0/s1 HDACQVRGBOVJII-JBDAPHQKSA-N belongs to the class of organic compounds known as dipeptides. These are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. Dipeptides Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aromatic heteropolycyclic compounds Alpha amino acid amides Alpha amino acid esters Amino acids Aralkylamines Azacyclic compounds Benzene and substituted derivatives Carbonyl compounds Carboxylic acid esters Carboxylic acids Dialkylamines Dicarboxylic acids and derivatives Fatty acid esters Hydrocarbon derivatives N-acyl-L-alpha-amino acids N-acylpyrrolidines Organic oxides Organopnictogen compounds Pyrrolidine carboxylic acids Tertiary carboxylic acid amides Alpha-amino acid amide Alpha-amino acid ester Alpha-amino acid or derivatives Alpha-dipeptide Amine Amino acid Amino acid or derivatives Aralkylamine Aromatic heteropolycyclic compound Azacycle Benzenoid Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid ester Dicarboxylic acid or derivatives Fatty acid ester Fatty acyl Hydrocarbon derivative Monocyclic benzene moiety N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid N-acyl-l-alpha-amino acid N-acylpyrrolidine Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Pyrrolidine Pyrrolidine carboxylic acid Pyrrolidine carboxylic acid or derivatives Secondary aliphatic amine Secondary amine Tertiary carboxylic acid amide azabicycloalkane cyclopentapyrrole dicarboxylic acid monoester dipeptide ethyl ester logp 0.92 ALOGPS logs -4.03 ALOGPS solubility 3.90e-02 g/l ALOGPS logp 1.47 ChemAxon pka_strongest_acidic 3.75 ChemAxon pka_strongest_basic 5.2 ChemAxon iupac (2S,3aS,6aS)-1-[(2S)-2-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}propanoyl]-octahydrocyclopenta[b]pyrrole-2-carboxylic acid ChemAxon average_mass 416.5106 ChemAxon mono_mass 416.231122144 ChemAxon smiles [H][C@@]12CCC[C@]1([H])N([C@@H](C2)C(O)=O)C(=O)[C@H](C)N[C@@H](CCC1=CC=CC=C1)C(=O)OCC ChemAxon formula C23H32N2O5 ChemAxon inchi InChI=1S/C23H32N2O5/c1-3-30-23(29)18(13-12-16-8-5-4-6-9-16)24-15(2)21(26)25-19-11-7-10-17(19)14-20(25)22(27)28/h4-6,8-9,15,17-20,24H,3,7,10-14H2,1-2H3,(H,27,28)/t15-,17-,18-,19-,20-/m0/s1 ChemAxon inchikey HDACQVRGBOVJII-JBDAPHQKSA-N ChemAxon polar_surface_area 95.94 ChemAxon refractivity 111.19 ChemAxon polarizability 44.78 ChemAxon rotatable_bond_count 10 ChemAxon acceptor_count 5 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 12618 Specdb::CMs 40272 Specdb::CMs 166710 Specdb::MsMs 42855 Specdb::MsMs 42856 Specdb::MsMs 42857 Specdb::MsMs 140028 Specdb::MsMs 140029 Specdb::MsMs 140030 Specdb::MsMs 374544 Specdb::MsMs 374922 Specdb::MsMs 451510 Specdb::MsMs 2258624 Specdb::MsMs 2259930 Specdb::MsMs 2334202 Specdb::MsMs 2334203 Specdb::MsMs 2334204 Specdb::MsMs 2627582 Specdb::MsMs 2627583 Specdb::MsMs 2627584 HMDB0014324 burnt sugar