1.0 2010-04-08 22:08:31 UTC 2025-11-18 23:15:40 UTC FDB009317 3,5- and 3,6-Dimethyl-2-isobutylpyrazine It is used as a food additive . C10H16N2 164.252 164.131348523 3,5-dimethyl-2-(2-methylpropyl)pyrazine 3,5-dimethyl-2-(2-methylpropyl)pyrazine 38888-81-2 CC(C)CC1=C(C)N=C(C)C=N1 InChI=1S/C10H16N2/c1-7(2)5-10-9(4)12-8(3)6-11-10/h6-7H,5H2,1-4H3 PBBZXNLEMPGGCH-UHFFFAOYSA-N belongs to the class of organic compounds known as pyrazines. Pyrazines are compounds containing a pyrazine ring, which is a six-member aromatic heterocycle, that consists of two nitrogen atoms (at positions 1 and 4) and four carbon atoms. Pyrazines Organic compounds Organoheterocyclic compounds Diazines Pyrazines Aromatic heteromonocyclic compounds Azacyclic compounds Heteroaromatic compounds Hydrocarbon derivatives Organonitrogen compounds Organopnictogen compounds Aromatic heteromonocyclic compound Azacycle Heteroaromatic compound Hydrocarbon derivative Organic nitrogen compound Organonitrogen compound Organopnictogen compound Pyrazine logp 2.46 ALOGPS logs -1.83 ALOGPS solubility 2.40e+00 g/l ALOGPS logp 1.36 ChemAxon pka_strongest_basic 2 ChemAxon iupac 3,5-dimethyl-2-(2-methylpropyl)pyrazine ChemAxon average_mass 164.252 ChemAxon mono_mass 164.131348523 ChemAxon smiles CC(C)CC1=C(C)N=C(C)C=N1 ChemAxon formula C10H16N2 ChemAxon inchi InChI=1S/C10H16N2/c1-7(2)5-10-9(4)12-8(3)6-11-10/h6-7H,5H2,1-4H3 ChemAxon inchikey PBBZXNLEMPGGCH-UHFFFAOYSA-N ChemAxon polar_surface_area 25.78 ChemAxon refractivity 49.3 ChemAxon polarizability 19.72 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 56475 Specdb::MsMs 56476 Specdb::MsMs 56477 Specdb::MsMs 111891 Specdb::MsMs 111892 Specdb::MsMs 111893 Specdb::MsMs 3604903 Specdb::MsMs 3604904 Specdb::MsMs 3604905 Specdb::MsMs 3604906 Specdb::MsMs 3604907 Specdb::MsMs 3604908 cocoa earthy hazelnut musty