1.0 2010-04-08 22:08:43 UTC 2025-11-18 23:17:07 UTC FDB009629 Iron naphthenate It is used as a food additive . Iron-sulfur Naphthenic acids, iron salts C22H14FeO4 398.189 398.024151069 λ²-iron(2+) ion bis(naphthalene-2-carboxylate) λ²-iron(2+) ion bis(2-naphthoate) 1338-14-3 [Fe++].[O-]C(=O)C1=CC=C2C=CC=CC2=C1.[O-]C(=O)C1=CC=C2C=CC=CC2=C1 InChI=1S/2C11H8O2.Fe/c2*12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;/h2*1-7H,(H,12,13);/q;;+2/p-2 PBDSMEGLJGEMDK-UHFFFAOYSA-L belongs to the class of organic compounds known as naphthalenecarboxylic acids. Naphthalenecarboxylic acids are compounds containing a naphthalene moiety, which bears a carboxylic acid group one or more positions. Naphthalene is a bicyclic compound that is made up of two fused benzene ring. Naphthalenecarboxylic acids Organic compounds Benzenoids Naphthalenes Naphthalenecarboxylic acids and derivatives Carboxylic acid salts Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organic transition metal salts Organooxygen compounds 2-naphthalenecarboxylic acid Aromatic homopolycyclic compound Carboxylic acid Carboxylic acid derivative Carboxylic acid salt Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organic salt Organic transition metal salt Organooxygen compound logp 5.14 ALOGPS logs -6.70 ALOGPS solubility 7.87e-05 g/l ALOGPS logp 2.62 ChemAxon pka_strongest_acidic 3.99 ChemAxon iupac λ²-iron(2+) ion bis(naphthalene-2-carboxylate) ChemAxon average_mass 398.189 ChemAxon mono_mass 398.024151069 ChemAxon smiles [Fe++].[O-]C(=O)C1=CC=C2C=CC=CC2=C1.[O-]C(=O)C1=CC=C2C=CC=CC2=C1 ChemAxon formula C22H14FeO4 ChemAxon inchi InChI=1S/2C11H8O2.Fe/c2*12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;/h2*1-7H,(H,12,13);/q;;+2/p-2 ChemAxon inchikey PBDSMEGLJGEMDK-UHFFFAOYSA-L ChemAxon polar_surface_area 40.13 ChemAxon refractivity 60.6 ChemAxon polarizability 17.37 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon