1.0 2010-04-08 22:08:49 UTC 2025-11-18 23:17:43 UTC FDB009827 Methyl N,N-dimethylanthranilate Methyl n,n-dimethylanthranilate is a member of the class of compounds known as benzoic acid esters. Benzoic acid esters are ester derivatives of benzoic acid. Methyl n,n-dimethylanthranilate is slightly soluble (in water) and a moderately basic compound (based on its pKa). Methyl n,n-dimethylanthranilate is a fruity, leaf, and orange tasting compound found in fig, which makes methyl n,n-dimethylanthranilate a potential biomarker for the consumption of this food product. Anthranilic acid, n,n-dimethyl-, methyl ester Benzoic acid, 2-(dimethylamino)-, methyl ester Methyl 2-(dimethylamino)benzoate C10H13NO2 179.2157 179.094628665 methyl 2-(dimethylamino)benzoate methyl 2-(dimethylamino)benzoate 10072-05-6 COC(=O)C1=CC=CC=C1N(C)C InChI=1S/C10H13NO2/c1-11(2)9-7-5-4-6-8(9)10(12)13-3/h4-7H,1-3H3 ZCNSBHAIPOWHJE-UHFFFAOYSA-N belongs to the class of organic compounds known as benzoic acid esters. These are ester derivatives of benzoic acid. Benzoic acid esters Organic compounds Benzenoids Benzene and substituted derivatives Benzoic acids and derivatives Aromatic homomonocyclic compounds Amino acids and derivatives Aminobenzoic acids and derivatives Aniline and substituted anilines Benzoyl derivatives Dialkylarylamines Hydrocarbon derivatives Methyl esters Monocarboxylic acids and derivatives Organic oxides Organooxygen compounds Organopnictogen compounds Vinylogous amides Amine Amino acid or derivatives Aminobenzoic acid or derivatives Aniline or substituted anilines Aromatic homomonocyclic compound Benzoate ester Benzoyl Carboxylic acid derivative Carboxylic acid ester Dialkylarylamine Hydrocarbon derivative Methyl ester Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Tertiary aliphatic/aromatic amine Tertiary amine Vinylogous amide logp 2.01 ALOGPS logs -1.31 ALOGPS solubility 8.88e+00 g/l ALOGPS logp 2.08 ChemAxon pka_strongest_basic 1.54 ChemAxon iupac methyl 2-(dimethylamino)benzoate ChemAxon average_mass 179.2157 ChemAxon mono_mass 179.094628665 ChemAxon smiles COC(=O)C1=CC=CC=C1N(C)C ChemAxon formula C10H13NO2 ChemAxon inchi InChI=1S/C10H13NO2/c1-11(2)9-7-5-4-6-8(9)10(12)13-3/h4-7H,1-3H3 ChemAxon inchikey ZCNSBHAIPOWHJE-UHFFFAOYSA-N ChemAxon polar_surface_area 29.54 ChemAxon refractivity 52.51 ChemAxon polarizability 19.28 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 70800 Specdb::MsMs 70801 Specdb::MsMs 70802 Specdb::MsMs 129357 Specdb::MsMs 129358 Specdb::MsMs 129359 Specdb::MsMs 3605023 Specdb::MsMs 3605024 Specdb::MsMs 3605025 Specdb::MsMs 3605026 Specdb::MsMs 3605027 Specdb::MsMs 3605028 Fig Type 1 specific Ficus carica 3494 fruity leaf orange