1.0 2010-04-08 22:08:49 UTC 2025-11-18 23:17:51 UTC FDB009846 3-Methyl-2(3-methylbut-2-en-1-yl)furan 3-methyl-2(3-methylbut-2-en-1-yl)furan is a member of the class of compounds known as heteroaromatic compounds. Heteroaromatic compounds are compounds containing an aromatic ring where a carbon atom is linked to an hetero atom. 3-methyl-2(3-methylbut-2-en-1-yl)furan is practically insoluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). 3-methyl-2(3-methylbut-2-en-1-yl)furan is a caramel, green, and minty tasting compound found in ginger, which makes 3-methyl-2(3-methylbut-2-en-1-yl)furan a potential biomarker for the consumption of this food product. 2-(3-methyl-2-butenyl)-3-methylfuran 2-(3'-methyl-2'-butenyl)-3-methylfuran 3-Methyl-2-(3-methyl-2-butenyl)furan Alpha-naginatene Furan, 3-methyl-2-(3-methyl-2-buten-1-yl)- Furan, 3-methyl-2-(3-methyl-2-butenyl)- Rose furan Rosefuran C10H14O 150.2176 150.10446507 3-methyl-2-(3-methylbut-2-en-1-yl)furan rosefuran 15186-51-3 CC(C)=CCC1=C(C)C=CO1 InChI=1S/C10H14O/c1-8(2)4-5-10-9(3)6-7-11-10/h4,6-7H,5H2,1-3H3 UTSGPHXOHJSDBC-UHFFFAOYSA-N belongs to the class of organic compounds known as heteroaromatic compounds. Heteroaromatic compounds are compounds containing an aromatic ring where a carbon atom is linked to an hetero atom. Heteroaromatic compounds Organic compounds Organoheterocyclic compounds Heteroaromatic compounds Aromatic heteromonocyclic compounds Furans Hydrocarbon derivatives Organooxygen compounds Oxacyclic compounds Aromatic heteromonocyclic compound Furan Heteroaromatic compound Hydrocarbon derivative Organic oxygen compound Organooxygen compound Oxacycle logp 3.74 ALOGPS logs -3.09 ALOGPS solubility 1.22e-01 g/l ALOGPS logp 3.12 ChemAxon pka_strongest_basic -2.6 ChemAxon iupac 3-methyl-2-(3-methylbut-2-en-1-yl)furan ChemAxon average_mass 150.2176 ChemAxon mono_mass 150.10446507 ChemAxon smiles CC(C)=CCC1=C(C)C=CO1 ChemAxon formula C10H14O ChemAxon inchi InChI=1S/C10H14O/c1-8(2)4-5-10-9(3)6-7-11-10/h4,6-7H,5H2,1-3H3 ChemAxon inchikey UTSGPHXOHJSDBC-UHFFFAOYSA-N ChemAxon polar_surface_area 13.14 ChemAxon refractivity 47.89 ChemAxon polarizability 17.68 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 0 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 66381 Specdb::MsMs 66382 Specdb::MsMs 66383 Specdb::MsMs 123930 Specdb::MsMs 123931 Specdb::MsMs 123932 Specdb::MsMs 3605041 Specdb::MsMs 3605042 Specdb::MsMs 3605043 Specdb::MsMs 3605044 Specdb::MsMs 3605045 Specdb::MsMs 3605046 Ginger Type 1 specific Zingiber officinale 94328 4.55 4.55 4.55 mg/100 g caramel green mint minty