1.0 2010-04-08 22:08:55 UTC 2025-11-18 23:18:19 UTC FDB010033 Pentadecanoic acid A fatty acid of exogenous (primarily ruminant) origin. Many "odd" length long chain amino acids are derived from the consumption of dairy fats (milk and meat). Pentadecanoic acid constitutes 1.05% of milk fat and 0.43% of ruminant meat fat. The content of heptadecanoic acid in the subcutaneous adipose tissue of humans appears to be a good biological marker of long-term milk fat intake in free-living individuals in populations with high consumption of dairy products. (PMID 9701185; PMID 11238766). Pentadecanoic acid is found in many foods, some of which are common bean, coriander, pepper (c. annuum), and hamburger. 123I-15-(p-iodophenyl)-3-R,S-methylpentadecanoic acid I-123 BMIPP I-123-beta-methyl-p-iodophenyl-methylpentadecanoic acid N-pentadecanoate N-pentadecanoic acid N-pentadecylate N-pentadecylic acid Pentadecanoate Pentadecanoic (palmitic) acid Pentadecyclate Pentadecyclic acid Pentadecylate Pentadecylic acid C15H30O2 242.3975 242.224580204 pentadecanoic acid pentadecanoic acid 1002-84-2 CCCCCCCCCCCCCCC(O)=O InChI=1S/C15H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h2-14H2,1H3,(H,16,17) WQEPLUUGTLDZJY-UHFFFAOYSA-N belongs to the class of organic compounds known as long-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. Long-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Straight chain fatty acids Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Long-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Straight chain fatty acid Straight chain fatty acids Straight chain fatty acids long-chain fatty acid straight-chain saturated fatty acid Solid logp 6.65 ALOGPS logs -5.86 ALOGPS solubility 3.34e-04 g/l ALOGPS melting_point 52.3 oC logp 5.81 ChemAxon pka_strongest_acidic 4.95 ChemAxon iupac pentadecanoic acid ChemAxon average_mass 242.3975 ChemAxon mono_mass 242.224580204 ChemAxon smiles CCCCCCCCCCCCCCC(O)=O ChemAxon formula C15H30O2 ChemAxon inchi InChI=1S/C15H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h2-14H2,1H3,(H,16,17) ChemAxon inchikey WQEPLUUGTLDZJY-UHFFFAOYSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 72.48 ChemAxon polarizability 32.23 ChemAxon rotatable_bond_count 13 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 764 Specdb::NmrOneD 1557 Specdb::NmrOneD 2066 Specdb::NmrOneD 2756 Specdb::CMs 1684 Specdb::CMs 14179 Specdb::CMs 31237 Specdb::CMs 32371 Specdb::CMs 37788 Specdb::CMs 166470 Specdb::CMs 1077677 Specdb::MsMs 44595 Specdb::MsMs 44596 Specdb::MsMs 44597 Specdb::MsMs 146247 Specdb::MsMs 146248 Specdb::MsMs 146249 Specdb::MsMs 285855 Specdb::MsMs 285856 Specdb::MsMs 285857 Specdb::MsMs 285858 Specdb::MsMs 373905 Specdb::MsMs 373906 Specdb::MsMs 373907 Specdb::MsMs 373908 Specdb::MsMs 440407 Specdb::MsMs 440408 Specdb::MsMs 440409 Specdb::MsMs 2227152 Specdb::MsMs 2227567 Specdb::MsMs 2229566 Specdb::MsMs 2229898 Specdb::MsMs 2231876 Specdb::MsMs 2232336 Specdb::MsMs 2234193 Specdb::MsMs 2234735 HMDB00826 42504 F15 #<Reference:0x00007f4104336390> #<Reference:0x00007f41043361d8> #<Reference:0x00007f4104335fa8> #<Reference:0x00007f4104335df0> #<Reference:0x00007f4104335c38> #<Reference:0x00007f4104335a80> #<Reference:0x00007f41043358c8> #<Reference:0x00007f4104335710> #<Reference:0x00007f4104335530> Adzuki bean Type 1 specific Vigna angularis 3914 0.0 0.0 0.0 mg/100 g Agar Type 1 specific Eucheuma 31444 0.0 0.0 0.0 mg/100 g Alaska pollock Type 1 specific Gadus chalcogramma 1042646 1.0 1.0 1.0 mg/100 g Alfalfa Type 1 specific Medicago sativa 3879 0.0 0.0 0.0 mg/100 g Allium Type 1 specific Allium haematochiton 4678 0.166667 2.0 0.0 mg/100 g Almond Type 1 specific Prunus dulcis 3755 0.0 0.0 0.0 mg/100 g Amaranth Type 1 specific Amaranthus 3564 0.0 0.0 0.0 mg/100 g American Chestnut Type 1 specific Castanea dentata 21019 0.0 0.0 0.0 mg/100 g American lobster Type 1 specific Homarus americanus 6706 5.0 5.0 5.0 mg/100 g Anatidae Type 1 specific Anatidae 8830 0.0 0.0 0.0 mg/100 g Anchovy Type 1 specific Engraulidae 43062 93.0 93.0 93.0 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 0.0 0.0 0.0 mg/100 g Apple Type 1 specific Malus pumila 3750 0.583333 7.0 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 0.0 0.0 0.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 0.555556 7.0 0.0 mg/100 g Arepa Type 2 specific 44.0 44.0 44.0 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 0.0 0.0 0.0 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 5.0 5.0 5.0 mg/100 g Atlantic salmon Type 1 specific Salmo salar 8030 46.0 46.0 46.0 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 0.0 0.0 0.0 mg/100 g Avocado Type 1 specific Persea americana 3435 0.0 0.0 0.0 mg/100 g Baby food Type 2 specific 9.285714 150.0 0.0 mg/100 g Bagel Type 2 specific 0.0 0.0 0.0 mg/100 g Baked beans Type 2 specific 0.0 0.0 0.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.0 0.0 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 0.0 0.0 0.0 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 0.0 0.0 0.0 mg/100 g Bean Type 1 specific 0.0 0.0 0.0 mg/100 g Bearded seal Type 1 specific Erignathus barbatus 39304 210.0 310.0 110.0 mg/100 g Beefalo Type 1 specific Bos taurus X Bison bison 297284 Beer Type 2 specific 0.0 0.0 0.0 mg/100 g Beluga whale Type 1 specific Delphinapterus leucas 9749 86.666667 230.0 3.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 0.0 0.0 0.0 mg/100 g Biscuit Type 2 specific 8.692308 132.0 0.0 mg/100 g Bison Type 1 specific Bison bison 9901 Bivalvia (Clam, Mussel, Oyster) Type 1 specific Bivalvia 6544 3.0 4.0 2.0 mg/100 g Black elderberry Type 1 specific Sambucus nigra 4202 Black salsify Type 1 specific Scorzonera hispanica 114289 0.0 0.0 0.0 mg/100 g Black tea Type 1 Camellia sinensis 0.0 0.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 0.0 0.0 0.0 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 0.0 0.0 0.0 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 4.0 4.0 4.0 mg/100 g Blue whiting Type 1 specific Micromesistius poutassou 81636 0.0 0.0 0.0 mg/100 g Brazil nut Type 1 specific Bertholletia excelsa 3645 0.0 0.0 0.0 mg/100 g Breakfast cereal Type 2 specific 0.738462 14.0 0.0 mg/100 g Breakfast sandwich Type 2 specific 30.266667 62.0 2.0 mg/100 g Broad bean Type 1 specific Vicia faba 3906 2.0 2.0 2.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 0.0 0.0 0.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 0.0 0.0 0.0 mg/100 g Buffalo Type 1 specific Bubalus bubalis 89462 Burbot Type 1 specific Lota lota 69944 0.0 0.0 0.0 mg/100 g Burrito Type 2 specific 18.333333 35.0 0.0 mg/100 g Butter Type 2 specific 0.0 0.0 0.0 mg/100 g Buttermilk Type 2 specific 0.0 0.0 0.0 mg/100 g Cake Type 2 specific 16.6 21.0 11.0 mg/100 g Candy bar Type 2 specific 25.230769 50.0 0.0 mg/100 g Canola Type 2 specific Brassica napus L. 138011 30.25 47.0 0.0 mg/100 g Cardamom Type 1 specific Elettaria cardamomum 105181 Carp bream Type 1 specific Abramis brama 38527 0.0 0.0 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.0 0.0 0.0 mg/100 g Casein Type 2 specific 0.0 0.0 0.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 0.0 0.0 0.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 0.0 0.0 0.0 mg/100 g Catfish Type 1 specific Siluriformes 7995 2.0 6.0 0.0 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 56.026923 176.0 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 0.1 1.0 0.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 0.0 0.0 0.0 mg/100 g Celery leaves Type 1 Plant Apium graveolens var. secalinum 941588 0.0 0.0 0.0 mg/100 g Cetacea (Dolphin, Porpoise, Whale) Type 1 specific Cetacea 9721 0.0 0.0 0.0 mg/100 g Channel catfish Type 1 specific Ictalurus punctatus 7998 7.0 8.0 6.0 mg/100 g Chanterelle Type 1 Mushroom Cantharellus cibarius 36066 0.0 0.0 0.0 mg/100 g Charr Type 1 specific Salvelinus 8033 0.0 0.0 0.0 mg/100 g Chayote Type 1 specific Sechium edule 184140 0.0 0.0 0.0 mg/100 g Cheese Type 2 specific 17.496241 312.0 0.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 0.0 0.0 0.0 mg/100 g Chervil Type 1 specific Anthriscus cerefolium 40888 0.0 0.0 0.0 mg/100 g Chewing gum Type 2 specific 0.0 0.0 0.0 mg/100 g Chia Type 1 specific Salvia hispanica 49212 30.0 30.0 30.0 mg/100 g Chicken Type 1 specific Gallus gallus 9031 0.0 0.0 0.0 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 0.0 0.0 0.0 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 0.0 0.0 0.0 mg/100 g Chili Type 2 specific 20.666667 30.0 15.0 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 0.0 0.0 0.0 mg/100 g Chinese cinnamon Type 1 specific Cinnamomum aromaticum 119260 0.0 0.0 0.0 mg/100 g Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 30.0 40.0 20.0 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 0.0 0.0 0.0 mg/100 g Chocolate Type 2 specific 5.428571 33.0 0.0 mg/100 g Chocolate mousse Type 2 specific 1.0 1.0 1.0 mg/100 g Chocolate spread Type 2 specific 0.0 0.0 0.0 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 25.0 40.0 10.0 mg/100 g Cichlidae (Tilapia) Type 1 specific Cichlidae 8113 2.5 5.0 0.0 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 0.0 0.0 0.0 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 11.0 12.0 10.0 mg/100 g Cloves Type 1 specific Syzygium aromaticum 219868 18.0 18.0 18.0 mg/100 g Clupeinae (Herring, Sardine, Sprat) Type 1 specific Clupeinae 7948 23.894737 168.0 0.0 mg/100 g Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa powder Type 2 specific 0.142857 1.0 0.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 0.3 3.0 0.0 mg/100 g Coffee Type 1 generic Coffea 13442 0.555556 7.0 0.0 mg/100 g Coffee substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 12.0 12.0 12.0 mg/100 g Cold cut Type 2 specific 2.0 12.0 0.0 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columba 8930 0.0 0.0 0.0 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 0.230769 3.0 0.0 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 0.0 0.0 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 0.0 0.0 0.0 mg/100 g Common dab Type 1 specific Limanda limanda 27771 0.0 0.0 0.0 mg/100 g Common grape Type 1 specific Vitis vinifera 29760 5.0 10.0 0.0 mg/100 g Common ling Type 1 specific Molva molva 163112 0.0 0.0 0.0 mg/100 g Common mushroom Type 1 Mushroom Agaricus bisporus 5341 0.727273 2.0 0.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 0.0 0.0 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 0.0 0.0 0.0 mg/100 g Common pea Type 1 specific Pisum sativum 3888 0.0 0.0 0.0 mg/100 g Common walnut Type 1 specific Juglans regia 51240 0.0 0.0 0.0 mg/100 g Cooking oil Type 2 specific 18.5 37.0 0.0 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 0.0 0.0 0.0 mg/100 g Corn Type 1 specific Zea mays 4577 0.026316 1.0 0.0 mg/100 g Corn chip Type 2 specific 0.0 0.0 0.0 mg/100 g Corn grits Type 2 specific 0.0 0.0 0.0 mg/100 g Corn Syrup Type 2 specific 7.5 30.0 0.0 mg/100 g Cottonseed Type 1 specific Gossypium hirsutum 3633 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 1% fat Type 2 specific 10.0 10.0 10.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 2% fat Type 2 specific 20.0 20.0 20.0 mg/100 g Cow milk, pasteurized, vitamin D added, 3.25% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Crab Type 1 specific Brachyura 6752 16.333333 29.0 10.0 mg/100 g Cracker Type 2 specific 3.368421 14.0 0.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 0.0 0.0 0.0 mg/100 g Cream Type 2 specific 8.789474 167.0 0.0 mg/100 g Crisp bread Type 2 specific 0.0 0.0 0.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 0.0 0.0 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 2.0 8.0 0.0 mg/100 g Curry powder Type 2 specific 0.0 0.0 0.0 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 0.0 0.0 0.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 0.0 0.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 0.0 0.0 0.0 mg/100 g Deer Type 1 specific Cervidae 9850 49.833333 88.0 23.0 mg/100 g Dill Type 1 specific Anethum graveolens 40922 0.0 0.0 0.0 mg/100 g Domestic goat Type 1 Animal Capra aegagrus hircus 9925 Domestic pig Type 1 Animal Sus scrofa domesticus 9825 1.552972 43.0 0.0 mg/100 g Dragée Type 2 specific 0.0 0.0 0.0 mg/100 g Dried milk Type 2 specific 0.0 0.0 0.0 mg/100 g Dulce de leche Type 2 specific 84.0 84.0 84.0 mg/100 g Dumpling Type 2 specific 0.0 0.0 0.0 mg/100 g Eastern oyster Type 1 specific Crassostrea virginica 6565 16.0 21.0 11.0 mg/100 g Edible shell Type 2 specific 3.0 6.0 0.0 mg/100 g Egg roll Type 2 specific 1.5 3.0 0.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 0.0 0.0 0.0 mg/100 g Eggs Unknown generic 1.805556 13.0 0.0 mg/100 g Elderberry Type 1 specific Sambucus 4201 0.0 0.0 0.0 mg/100 g Elk Type 1 specific Cervus canadensis 1574408 Empanada Type 2 specific 21.0 21.0 21.0 mg/100 g Emu Type 1 specific Dromaius novaehollandiae 8790 Endive Type 1 specific Cichorium endivia 114280 0.0 0.0 0.0 mg/100 g Enokitake Type 1 Mushroom Flammulina velutipes 38945 0.0 0.0 0.0 mg/100 g European plum Type 1 specific Prunus domestica 3758 0.0 0.0 0.0 mg/100 g European rabbit Type 1 specific Oryctolagus cuniculus 9984 Feijoa Type 1 specific Feijoa sellowiana 260130 0.0 0.0 0.0 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 0.0 0.0 0.0 mg/100 g Fig Type 1 specific Ficus carica 3494 0.0 0.0 0.0 mg/100 g Fish oil Type 1 0.0 0.0 0.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 3.75 8.0 0.0 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 9.142857 27.0 0.0 mg/100 g Flour Type 2 specific 0.0 0.0 0.0 mg/100 g French plantain Type 1 Plant Musa paradisiaca 89151 3.0 8.0 0.0 mg/100 g French toast Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit gum Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit juice Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit preserve Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit-flavor drink Type 2 specific 0.0 0.0 0.0 mg/100 g Frybread Type 2 specific 26.0 32.0 20.0 mg/100 g Fudge Type 2 specific 0.0 0.0 0.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.0 0.0 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 1.642857 12.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 0.0 0.0 0.0 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 0.0 0.0 0.0 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 0.0 0.0 0.0 mg/100 g Garfish Type 1 specific Belone belone 129037 14.0 14.0 14.0 mg/100 g Garlic Type 1 specific Allium sativum 4682 0.0 0.0 0.0 mg/100 g Gelatin Type 2 specific 0.0 0.0 0.0 mg/100 g Gelatin dessert Type 2 specific 0.0 0.0 0.0 mg/100 g Gin Type 2 specific 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 0.0 0.0 0.0 mg/100 g Globe artichoke Type 1 specific Cynara scolymus 59895 0.0 0.0 0.0 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 0.0 0.0 0.0 mg/100 g Grape Type 1 specific Vitis 3603 1.0 9.0 0.0 mg/100 g Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 0.0 0.0 0.0 mg/100 g Green bean Type 1 specific Phaseolus vulgaris 3885 0.0 0.0 0.0 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Green tea Type 1 Camellia sinensis 0.0 0.0 0.0 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.333333 1.0 0.0 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 36.333333 109.0 0.0 mg/100 g Greylag goose Type 1 specific Anser anser 8843 Groundcherry Type 1 specific Physalis 24663 0.0 0.0 0.0 mg/100 g Guava Type 1 specific Psidium guajava 120290 0.0 0.0 0.0 mg/100 g Guinea hen Type 1 specific Numida meleagris 8996 Haddock Type 1 specific Melanogrammus aeglefinus 8056 0.25 1.0 0.0 mg/100 g Hamburger Type 2 specific 58.347826 88.0 37.0 mg/100 g Hard wheat Type 1 Plant Triticum durum 4567 0.0 0.0 0.0 mg/100 g Hazelnut Type 1 specific Corylus avellana 13450 0.0 0.0 0.0 mg/100 g Herbal tea Type 1 0.0 0.0 0.0 mg/100 g Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 6.0 8.0 4.0 mg/100 g Honey Type 2 specific Apis mellifera 7460 0.0 0.0 0.0 mg/100 g Horchata Type 2 specific 2.0 2.0 2.0 mg/100 g Horse Type 1 specific Equus caballus 9796 Horseradish Type 1 specific Armoracia rusticana 3704 0.0 0.0 0.0 mg/100 g Hot chocolate Type 2 specific 4.0 18.0 0.0 mg/100 g Hushpuppy Type 2 specific 3.0 3.0 3.0 mg/100 g Ice cream Type 2 specific 35.387097 107.0 0.0 mg/100 g Ice cream cone Type 2 specific 0.0 0.0 0.0 mg/100 g Icing Type 2 specific 1.333333 4.0 0.0 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 2.0 2.0 2.0 mg/100 g Japanese pumpkin Type 1 specific Cucurbita maxima 3661 6.0 8.0 0.0 mg/100 g Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 0.0 0.0 0.0 mg/100 g Kale Type 1 specific Brassica napus var. pabularia 0.0 0.0 0.0 mg/100 g Kefir Type 2 specific 0.0 0.0 0.0 mg/100 g Ketchup Type 2 specific 0.0 0.0 0.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 0.0 0.0 0.0 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 0.0 0.0 0.0 mg/100 g Kombu Type 1 specific Saccharina japonica 88149 0.0 0.0 0.0 mg/100 g Kumquat Type 1 specific Fortunella 2706 0.0 0.0 0.0 mg/100 g Lake trout Type 1 specific Salvelinus namaycush 8040 0.0 0.0 0.0 mg/100 g Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Lasagna Type 2 specific 21.5 38.0 0.0 mg/100 g Leavening agent Type 2 specific 0.0 0.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 0.0 0.0 0.0 mg/100 g Lemon Type 1 Plant Citrus limon 2708 0.142857 1.0 0.0 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 7.0 7.0 7.0 mg/100 g Lentils Type 1 generic Lens culinaris 3864 0.428571 3.0 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 0.0 0.0 0.0 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.0 0.0 0.0 mg/100 g Lime Type 1 Plant Citrus aurantiifolia 159033 0.0 0.0 0.0 mg/100 g Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 0.0 0.0 0.0 mg/100 g Liquor Type 2 specific 0.0 0.0 0.0 mg/100 g Liquorice Type 2 specific Glycyrrhiza glabra 0.0 0.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 0.0 0.0 0.0 mg/100 g Loquat Type 1 Plant Eriobotrya japonica 32224 0.0 0.0 0.0 mg/100 g Lumpsucker Type 1 specific Cyclopterus lumpus 8101 0.0 0.0 0.0 mg/100 g Macadamia nut Type 1 specific Macadamia 4329 0.0 0.0 0.0 mg/100 g Macaroni and cheese Type 2 specific 18.7 46.0 0.0 mg/100 g Maitake Type 1 Mushroom Grifola frondosa 5627 0.0 0.0 0.0 mg/100 g Mallard duck Type 1 specific Anas platyrhynchos 8839 Malus (Crab apple) Type 1 specific Malus 3749 0.0 0.0 0.0 mg/100 g Mamey sapote Type 1 specific Pouteria sapota 233744 2.0 2.0 2.0 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 0.0 0.0 0.0 mg/100 g Mango Type 1 specific Mangifera indica 29780 0.0 0.0 0.0 mg/100 g Margarine Type 2 specific 9.136364 38.0 0.0 mg/100 g Margarine-like spread Type 2 specific 14.6875 48.0 0.0 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 5.0 15.0 0.0 mg/100 g Marshmallow Type 2 specific 0.0 0.0 0.0 mg/100 g Marzipan Type 2 specific 0.0 0.0 0.0 mg/100 g Meat bouillon Type 2 specific 0.8 4.0 0.0 mg/100 g Meatball Type 2 specific 0.0 0.0 0.0 mg/100 g Meatloaf Type 2 specific 3.0 3.0 3.0 mg/100 g Meringue Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Cow) Type 2 specific 110.062053 1650.179 0.0 mg/100 g Milk (Goat) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Human) Type 2 specific 0.0 0.0 0.0 mg/100 g Milkshake Type 2 specific 49.6 84.0 35.0 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 0.4 2.0 0.0 mg/100 g Miso Type 2 specific 0.0 0.0 0.0 mg/100 g Mixed nuts Type 2 specific 5.0 5.0 5.0 mg/100 g Morchella (Morel) Type 1 specific Morchellaceae 5192 0.0 0.0 0.0 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 0.0 0.0 0.0 mg/100 g Mule deer Type 1 specific Odocoileus hemionus 9871 Multigrain bread Type 2 specific 0.0 0.0 0.0 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 0.0 0.0 0.0 mg/100 g Muskmelon Type 1 specific Cucumis melo 3656 0.0 0.0 0.0 mg/100 g Mustard Type 2 specific 0.0 0.0 0.0 mg/100 g Nachos Type 2 specific 15.0 30.0 0.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 0.0 0.0 0.0 mg/100 g Northern pike Type 1 specific Esox lucius 8010 0.0 0.0 0.0 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Norway lobster Type 1 specific Nephrops norvegicus 6829 10.0 10.0 10.0 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.0 0.0 0.0 mg/100 g Nougat Type 2 specific 0.0 0.0 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 0.0 0.0 0.0 mg/100 g Nutritional drink Type 2 specific 1.0 1.0 1.0 mg/100 g Oat Type 1 specific Avena sativa 4498 0.0 0.0 0.0 mg/100 g Oil palm Type 1 specific Elaeis guineensis 51952 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 0.0 0.0 0.0 mg/100 g Olive Type 1 specific Olea europaea 4146 0.0 0.0 0.0 mg/100 g Opium poppy Type 1 specific Papaver somniferum 3469 0.0 0.0 0.0 mg/100 g Orange bell pepper Type 1 specific Capsicum annuum 4072 Orange roughy Type 1 specific Hoplostethus atlanticus 96778 0.0 0.0 0.0 mg/100 g Oriental wheat Type 1 Plant Triticum turanicum 376534 0.0 0.0 0.0 mg/100 g Ostrich Type 1 specific Struthio camelus 8801 Other alcoholic beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Other beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Other bread Type 2 specific 1.115385 14.0 0.0 mg/100 g Other bread product Type 2 specific 0.0 0.0 0.0 mg/100 g Other candy Type 2 specific 24.151515 86.0 0.0 mg/100 g Other dish Type 2 specific 8.464286 93.0 0.0 mg/100 g Other fermented milk Type 2 specific 0.0 0.0 0.0 mg/100 g Other fish product Type 2 specific 0.25 1.0 0.0 mg/100 g Other frozen dessert Type 2 specific 7.8 25.0 0.0 mg/100 g Other fruit product Type 2 specific 0.0 0.0 0.0 mg/100 g Other pasta dish Type 2 specific 11.2 27.0 0.0 mg/100 g Other sandwich Type 2 specific 8.0 20.0 0.0 mg/100 g Other snack food Type 2 specific 2.0 9.0 0.0 mg/100 g Other soy product Type 2 specific 0.0 0.0 0.0 mg/100 g Oyster mushroom Type 1 Mushroom Pleurotus ostreatus 5322 6.5 13.0 0.0 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 1.0 1.0 1.0 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.0 0.0 0.0 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 6.5 7.0 6.0 mg/100 g Painted comber Type 1 specific Serranus scriba 349661 4.5 5.0 4.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 0.0 0.0 0.0 mg/100 g Pan dulce Type 2 specific 4.0 4.0 4.0 mg/100 g Pancake Type 2 specific 0.75 2.0 0.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 0.0 0.0 0.0 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 0.0 0.0 0.0 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 0.0 0.0 0.0 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 0.0 0.0 0.0 mg/100 g Pasta Type 2 specific 0.263158 5.0 0.0 mg/100 g Pastry Type 2 specific 1.877193 45.0 0.0 mg/100 g Pate Type 2 specific 0.0 0.0 0.0 mg/100 g Peach Type 1 specific Prunus persica 3760 0.0 0.0 0.0 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 3.833333 38.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.0 0.0 0.0 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 0.0 0.0 0.0 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Pepper (C. frutescens) Type 1 specific Capsicum frutescens 40321 Pepper (Spice) Type 1 specific Piper nigrum 13216 0.0 0.0 0.0 mg/100 g Perciformes Type 1 specific Perciformes 8111 0.0 0.0 0.0 mg/100 g Persimmon Type 1 specific Diospyros 13492 0.0 0.0 0.0 mg/100 g Pheasant Type 1 specific Phasianus colchicus 9054 Pie Type 2 specific 0.0 0.0 0.0 mg/100 g Pie crust Type 2 specific 0.25 1.0 0.0 mg/100 g Pikeperch Type 1 specific Sander lucioperca 283035 0.0 0.0 0.0 mg/100 g Piki bread Type 2 specific 2.0 2.0 2.0 mg/100 g Pine nut Type 1 specific Pinus 3337 0.0 0.0 0.0 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.0 0.0 0.0 mg/100 g Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 19.0 24.0 13.0 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 0.0 0.0 0.0 mg/100 g Pizza Type 2 specific 56.533333 109.0 0.0 mg/100 g Pleuronectidae (Dab, Halibut, Plaice) Type 1 specific Pleuronectes 8256 0.0 0.0 0.0 mg/100 g Pollock Type 1 specific Pollachius pollachius 8059 0.0 0.0 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.0 0.0 0.0 mg/100 g Popcorn Type 2 specific Zea mays subsp. everta 381124 2.4 11.0 0.0 mg/100 g Poppy Type 1 specific Papaver 3468 0.0 0.0 0.0 mg/100 g Port wine Type 2 specific 0.0 0.0 0.0 mg/100 g Pot pie Type 2 specific 12.5 15.0 10.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 1.857143 63.0 0.0 mg/100 g Potato bread Type 2 specific 0.0 0.0 0.0 mg/100 g Potato chip Type 2 specific 5.75 9.0 0.0 mg/100 g Potato puffs Type 2 specific 0.0 0.0 0.0 mg/100 g Prickly pear Type 1 specific Opuntia 106975 0.0 0.0 0.0 mg/100 g Processed cheese Type 2 specific 150.142857 263.0 11.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 0.0 0.0 0.0 mg/100 g Pudding Type 2 specific 1.727273 17.0 0.0 mg/100 g Pupusa Type 2 specific 38.666667 102.0 5.0 mg/100 g Quail Type 1 specific Phasianidae 9005 Quesadilla Type 2 specific 77.0 77.0 77.0 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 0.0 0.0 0.0 mg/100 g Quinoa Type 1 specific Chenopodium quinoa 63459 0.0 0.0 0.0 mg/100 g Rabbit Type 1 specific Leporidae 9979 27.0 27.0 27.0 mg/100 g Radish Type 1 specific Raphanus raphanistrum subsp sativus 3726 0.0 0.0 0.0 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 9.142857 19.0 0.0 mg/100 g Rapeseed Type 1 specific Brassica napus var. napus 138011 0.0 0.0 0.0 mg/100 g Rapini Type 1 Plant Brassica ruvo 1204434 0.0 0.0 0.0 mg/100 g Ravioli Type 2 specific 18.5 19.0 18.0 mg/100 g Red algae Type 1 specific Palmaria palmata 2763 0.0 0.0 0.0 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra 0.0 0.0 0.0 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Red tea Type 1 Aspalathus linearis 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.0 0.0 0.0 mg/100 g Remoulade Type 2 specific 0.0 0.0 0.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 0.0 0.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 0.555556 7.0 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 0.0 0.0 0.0 mg/100 g Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 0.0 0.0 0.0 mg/100 g Rose hip Type 1 specific Rosa 3764 0.0 0.0 0.0 mg/100 g Rosemary Type 1 specific Rosmarinus officinalis 39367 131.0 131.0 131.0 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.0 0.0 0.0 mg/100 g Rum Type 2 specific 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 0.0 0.0 0.0 mg/100 g Rye bread Type 2 specific 0.0 0.0 0.0 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 0.0 0.0 0.0 mg/100 g Salad Type 2 specific 2.25 4.0 0.0 mg/100 g Salad dressing Type 2 specific 0.791667 11.0 0.0 mg/100 g Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 8.363636 46.0 0.0 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Sauce Type 2 specific 0.666667 5.0 0.0 mg/100 g Sausage Type 2 specific 16.0 194.0 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 0.0 0.0 0.0 mg/100 g Scallop Type 1 specific Pectinidae 6566 4.0 5.0 3.0 mg/100 g Schmaltz Type 2 specific 0.0 0.0 0.0 mg/100 g Scombridae (Bonito, Mackerel, Tuna) Type 1 Animal Sarda 8224 0.0 0.0 0.0 mg/100 g Semolina Type 2 specific 0.0 0.0 0.0 mg/100 g Sesame Type 1 specific Sesamum indicum 4182 0.0 0.0 0.0 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 0.0 0.0 0.0 mg/100 g Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 105.555556 201.0 0.0 mg/100 g Sherry Type 2 specific 0.0 0.0 0.0 mg/100 g Shiitake Type 1 Mushroom Lentinus edodes 5353 0.0 0.0 0.0 mg/100 g Shortening Type 2 specific 24.666667 37.0 0.0 mg/100 g Shrimp Type 1 specific Caridea 6694 3.866667 14.0 0.0 mg/100 g Smelt Type 1 specific Osmeridae 8012 60.0 60.0 60.0 mg/100 g Snack bar Type 2 specific 1.85 19.0 0.0 mg/100 g Snail Type 1 specific Gastropoda 6448 0.0 0.0 0.0 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 26.4 50.0 16.0 mg/100 g Soft drink Type 2 specific 0.0 0.0 0.0 mg/100 g Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 Sorghum Type 1 specific Sorghum bicolor 4558 2.0 2.0 2.0 mg/100 g Sorrel Type 1 specific Rumex acetosa 41241 0.0 0.0 0.0 mg/100 g Soup Type 2 specific 3.571429 24.0 0.0 mg/100 g Soy bean Type 1 specific Glycine max 3847 5.285714 37.0 0.0 mg/100 g Soy milk Type 2 specific 0.0 0.0 0.0 mg/100 g Soy sauce Type 2 specific 0.0 0.0 0.0 mg/100 g Spelt Type 1 specific Triticum spelta 58933 0.0 0.0 0.0 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 0.0 0.0 0.0 mg/100 g Spiny dogfish Type 1 specific Squalus acanthias 7797 0.0 0.0 0.0 mg/100 g Spirit Type 2 specific 0.0 0.0 0.0 mg/100 g Spotted seal Type 1 specific Phoca largha 39090 280.0 280.0 280.0 mg/100 g Squab Type 1 specific Columba 8931 Star fruit Type 1 specific Averrhoa carambola 28974 0.0 0.0 0.0 mg/100 g Stew Type 2 specific 15.285714 28.0 2.0 mg/100 g Strawberry Type 1 specific Fragaria ananassa 3747 0.0 0.0 0.0 mg/100 g Stuffing Type 2 specific 2.5 5.0 0.0 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 9.5 19.0 0.0 mg/100 g Sugar Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 6.0 8.0 0.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 75.272727 800.0 0.0 mg/100 g Swede Type 1 specific Brassica napus subsp. rapifera 3708 0.0 0.0 0.0 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 0.0 0.0 0.0 mg/100 g Sweet custard Type 2 specific 5.0 18.0 0.0 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 0.0 0.0 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 0.0 0.0 0.0 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 0.0 0.0 0.0 mg/100 g Swordfish Type 1 specific Xiphias gladius 8245 30.5 33.0 28.0 mg/100 g Taco Type 2 specific 38.75 52.0 25.0 mg/100 g Taco shell Type 2 0.0 0.0 0.0 mg/100 g Tallow Type 2 specific 31.75 94.0 0.0 mg/100 g Tamale Type 2 specific 12.25 24.0 2.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 0.0 0.0 0.0 mg/100 g Tea Type 1 Plant Camellia sinensis 4442 0.0 0.0 0.0 mg/100 g Teff Type 1 specific Eragrostis tef 110835 0.0 0.0 0.0 mg/100 g Thistle Type 1 specific Cirsium 41549 0.0 0.0 0.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 0.0 0.0 0.0 mg/100 g Toffee Type 2 specific 0.0 0.0 0.0 mg/100 g Tofu Type 2 specific 0.0 0.0 0.0 mg/100 g Topping Type 2 specific 10.0 10.0 10.0 mg/100 g Tortilla Type 2 specific 2.0 5.0 0.0 mg/100 g Tortilla chip Type 2 specific 1.75 4.0 0.0 mg/100 g Tostada shell Type 2 6.0 6.0 6.0 mg/100 g True frog Type 1 specific Ranidae 8397 0.0 0.0 0.0 mg/100 g True oyster Type 1 specific Ostreidae 6563 13.0 13.0 13.0 mg/100 g True seal Type 1 specific Phocidae 9709 0.0 0.0 0.0 mg/100 g True sole Type 1 specific Soleidae 30948 7.0 7.0 7.0 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 0.0 0.0 0.0 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 0.0 0.0 0.0 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 0.0 0.0 0.0 mg/100 g Unclassified food or beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 0.0 0.0 0.0 mg/100 g Vegetable juice Type 2 specific 0.0 0.0 0.0 mg/100 g Vegetarian food Type 2 specific 6.5 11.0 2.0 mg/100 g Velvet duck Type 1 specific Melanitta fusca 371864 Vermouth Type 2 specific 0.0 0.0 0.0 mg/100 g Vinegar Type 2 specific 0.0 0.0 0.0 mg/100 g Vodka Type 2 specific 0.0 0.0 0.0 mg/100 g Waffle Type 2 specific 0.0 0.0 0.0 mg/100 g Walnut Type 1 specific Juglans regia 16718 0.0 0.0 0.0 mg/100 g Water Type 2 specific 0.0 0.0 0.0 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 0.0 0.0 0.0 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 0.0 0.0 0.0 mg/100 g Wheat Type 1 specific Triticum 4564 0.0 0.0 0.0 mg/100 g Wheat bread Type 2 specific 0.255319 3.0 0.0 mg/100 g Whey Type 2 specific 0.0 0.0 0.0 mg/100 g Whisky Type 2 specific 0.0 0.0 0.0 mg/100 g White bread Type 1 2.9 14.0 0.0 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 0.0 0.0 0.0 mg/100 g White mustard Type 1 specific Sinapis alba 3728 1.0 2.0 0.0 mg/100 g Whitefish Type 1 specific Coregonus lavaretus 27772 24.75 90.0 0.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 0.0 0.0 0.0 mg/100 g Wild boar Type 1 specific Sus scrofa 9823 Wild celery Type 1 specific Angelica archangelica 4045 0.0 0.0 0.0 mg/100 g Yam Type 1 specific Dioscorea 4672 0.0 0.0 0.0 mg/100 g Yellow bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Yellow pond-lily Type 1 specific Nuphar lutea 77113 0.5 1.0 0.0 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.333333 1.0 0.0 mg/100 g Yellowfin tuna Type 1 specific Thunnus albacares 8236 3.5 4.0 3.0 mg/100 g Ymer Type 2 specific 0.0 0.0 0.0 mg/100 g Yogurt Type 2 specific 0.0 0.0 0.0 mg/100 g Zwieback Type 2 specific 0.0 0.0 0.0 mg/100 g waxy 60 kDa lysophospholipase Q86U10 ASPG Acid ceramidase Q13510 ASAH1 Acylphosphatase-1 P07311 ACYP1 Acylphosphatase-2 P14621 ACYP2 Alkaline ceramidase 1 Q8TDN7 ACER1 Alkaline ceramidase 2 Q5QJU3 ACER2 Aspartoacylase P45381 ASPA Aspartoacylase-2 Q96HD9 ACY3 Carboxylesterase 3 Q6UWW8 CES3 Carboxylesterase 5A Q6NT32 CES5A Cholinesterase P06276 BCHE Cocaine esterase O00748 CES2 Endothelial lipase Q9Y5X9 LIPG Eosinophil lysophospholipase Q05315 CLC Fatty acid synthase P49327 FASN Galactoside-binding soluble lectin 13 Q9UHV8 LGALS13 Gastric triacylglycerol lipase P07098 LIPF Hepatic triacylglycerol lipase P11150 LIPC Homeodomain-interacting protein kinase 1 Q86Z02 HIPK1 Inactive pancreatic lipase-related protein 1 P54315 PNLIPRP1 Lipoprotein lipase P06858 LPL Liver carboxylesterase 1 P23141 CES1 Long-chain fatty acid transport protein 3 Q5K4L6 SLC27A3 Long-chain fatty acid transport protein 4 Q6P1M0 SLC27A4 Long-chain fatty acid transport protein 6 Q9Y2P4 SLC27A6 Neuropathy target esterase Q8IY17 PNPLA6 Neutral ceramidase Q9NR71 ASAH2 Pancreatic lipase-related protein 2 P54317 PNLIPRP2 Pancreatic lipase-related protein 3 Q17RR3 PNLIPRP3 Pancreatic triacylglycerol lipase P16233 PNLIP Patatin-like phospholipase domain-containing protein 2 Q96AD5 PNPLA2 Patatin-like phospholipase domain-containing protein 3 Q9NST1 PNPLA3 Patatin-like phospholipase domain-containing protein 4 P41247 PNPLA4 Peroxisome proliferator-activated receptor gamma P37231 PPARG Putative neutral ceramidase C P0C7U2 ASAH2C Anti-oxidant 502 A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. In European countries, E-numbers for permitted antioxidant food additives are from E 300 to E 324.