1.0 2010-04-08 22:05:22 UTC 2019-11-26 02:57:26 UTC FDB002431 gamma-Tocopherol Occurs in many nut and other vegetable oils such as soya and sunflower oil. It is used as antioxidant food additive. Member of Vitamin E group. Added to fats and oils to prevent rancidity. The naturally occurring tocopherol is a single steroisomer; synthetic forms are a mixture of all eight possible isomers [DFC] gamma-Tocopherol is one of the chemical compounds that is considered vitamin E. As a food additive, it has E number E308. [Wikipedia]. gamma-Tocopherol is found in many foods, some of which are common pea, shiitake, feijoa, and other bread. 2,7,8-Trimethyl-2-(4,8,12-trimethyltridecyl)-6-chromanol 3,4-dihydro-2,7,8-Trimethyl-2-(4,8,12-trimethyltridecyl)-2H-1-benzopyran-6-ol 3,4-Dihydro-2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-2H-1-benzopyran-6-ol, 9CI 6-Chromanol, 2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)- 7,8-Dimethyltocol 7,8-Dimethyltocolo-xylotocopherol D-gamma-tocopherol DL-a-Tocopherol DL-alpha-Tocopherol DL-α-tocopherol E308 Gama-tocopherol Gamma-tocopherol Methyltocols O-xylotocopherol Tocopherols Vitamin e gamma C28H48O2 416.6795 416.36543078 2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydro-2H-1-benzopyran-6-ol 2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydro-1-benzopyran-6-ol 1406-66-2 CC(C)CCCC(C)CCCC(C)CCCC1(C)CCC2=CC(O)=C(C)C(C)=C2O1 InChI=1S/C28H48O2/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-19-26(29)23(5)24(6)27(25)30-28/h19-22,29H,8-18H2,1-7H3 QUEDXNHFTDJVIY-UHFFFAOYSA-N belongs to the class of organic compounds known as tocopherols. These are vitamin E derivatives containing a saturated trimethyltridecyl chain attached to the carbon C6 atom of a benzopyran ring system. The differ from tocotrienols that contain an unsaturated trimethyltrideca-3,7,11-trien-1-yl chain. Tocopherols Organic compounds Lipids and lipid-like molecules Prenol lipids Quinone and hydroquinone lipids Aromatic heteropolycyclic compounds 1-benzopyrans 1-hydroxy-2-unsubstituted benzenoids Alkyl aryl ethers Diterpenoids Hydrocarbon derivatives Oxacyclic compounds 1-benzopyran 1-hydroxy-2-unsubstituted benzenoid Alkyl aryl ether Aromatic heteropolycyclic compound Benzenoid Benzopyran Chromane Diterpenoid Ether Hydrocarbon derivative Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Tocopherol vitamin E Solid logp 8.81 ALOGPS logs -7.75 ALOGPS solubility 7.37e-06 g/l ALOGPS melting_point Mp -3° logp 9.99 ChemAxon pka_strongest_acidic 10.47 ChemAxon pka_strongest_basic -4.9 ChemAxon iupac 2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydro-2H-1-benzopyran-6-ol ChemAxon average_mass 416.6795 ChemAxon mono_mass 416.36543078 ChemAxon smiles CC(C)CCCC(C)CCCC(C)CCCC1(C)CCC2=CC(O)=C(C)C(C)=C2O1 ChemAxon formula C28H48O2 ChemAxon inchi InChI=1S/C28H48O2/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-19-26(29)23(5)24(6)27(25)30-28/h19-22,29H,8-18H2,1-7H3 ChemAxon inchikey QUEDXNHFTDJVIY-UHFFFAOYSA-N ChemAxon polar_surface_area 29.46 ChemAxon refractivity 130.33 ChemAxon polarizability 54.13 ChemAxon rotatable_bond_count 12 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 14964 Specdb::CMs 38095 Specdb::MsMs 81432 Specdb::MsMs 81433 Specdb::MsMs 81434 Specdb::MsMs 142539 Specdb::MsMs 142540 Specdb::MsMs 142541 HMDB01492 #<Reference:0x000055ac3fb3dee0> #<Reference:0x000055ac3fb3dc88> #<Reference:0x000055ac3fb3da58> #<Reference:0x000055ac3fb3d878> #<Reference:0x000055ac3fb3d648> #<Reference:0x000055ac3fb3d490> #<Reference:0x000055ac3fb3d238> #<Reference:0x000055ac3fb3cf68> #<Reference:0x000055ac3fb3cbd0> #<Reference:0x000055ac3fb3c860> #<Reference:0x000055ac3fb3c5e0> #<Reference:0x000055ac3fb3c1f8> #<Reference:0x000055ac3fb3bf78> #<Reference:0x000055ac3fb3bca8> #<Reference:0x000055ac3fb3b8e8> #<Reference:0x000055ac3fb3b4d8> #<Reference:0x000055ac3fb3afd8> #<Reference:0x000055ac3fb3ac18> #<Reference:0x000055ac3fb3a768> #<Reference:0x000055ac3fb3a380> Abiyuch Type 1 specific Crateva religiosa 202634 Acerola Type 1 specific Malpighia emarginata 151847 Acorn Type 1 specific Quercus 3511 Acorn squash Type 1 Cucurbita pepo var. turbinata Adzuki bean Type 1 specific Vigna angularis 3914 Agave Type 1 specific Agave 39509 0.006 0.03 0.0 mg/100 g Alaska blueberry Type 1 specific Vaccinium alaskaense 190544 0.19 0.19 0.19 mg/100 g Alaska pollock Type 1 specific Theragra chalcogramma 1042646 0.0 0.0 0.0 mg/100 g Alaska wild rhubarb Type 1 specific Polygonum alpinum 125586 Albacore tuna Type 1 specific Thunnus alalunga 8235 0.025 0.03 0.02 mg/100 g Albizia gummifera Type 1 Albizia gummifera Alfalfa Type 1 specific Medicago sativa 3879 Allium Type 1 specific Allium 4678 1.138 5.64 0.0 mg/100 g Allspice Type 1 specific Pimenta dioica 375272 Almond Type 1 specific Prunus dulcis 3755 0.6875 1.01 0.0 mg/100 g Almond milk Type 1 0.16 0.32 0.0 mg/100 g Alpine sweetvetch Type 1 specific Hedysarum alpinum 57576 Amaranth Type 1 specific Amaranthus 3564 0.21625 0.435 0.05 mg/100 g American cranberry Type 1 specific Vaccinium macrocarpon 13750 0.04 0.04 0.04 mg/100 g American pokeweed Type 1 specific Phytolacca americana 3527 Angelica Type 1 specific Angelica keiskei 357850 Anise Type 1 specific Pimpinella anisum 271192 Annual wild rice Type 1 specific Zizania aquatica 75727 Apple Type 1 specific Malus pumila 283210 0.008889 0.07 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 0.08 0.08 0.08 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 0.01 0.01 0.01 mg/100 g Arctic blackberry Type 1 specific Rubus arcticus 70741 Arepa Type 2 specific 0.63 0.63 0.63 mg/100 g Arrowhead Type 1 specific Sagittaria latifolia 15008 Arrowroot Type 1 specific Maranta arundinacea 210060 Asian pear Type 1 specific Pyrus pyrifolia 3767 Asparagus Type 1 specific Asparagus officinalis 4686 0.132 0.21 0.02 mg/100 g Atlantic cod Type 1 specific Gadus morhua 8049 0.0 0.0 0.0 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 0.055 0.11 0.0 mg/100 g Atlantic salmon Type 1 specific Salmo salar 8030 0.3 0.3 0.3 mg/100 g Avocado Type 1 specific Persea americana 3435 0.274 0.39 0.0 mg/100 g Babassu palm Type 1 specific Attalea speciosa 145700 Baby food Type 2 specific 0.152571 1.69 0.0 mg/100 g Bagel Type 2 specific Baked beans Type 2 specific 0.706667 0.8 0.61 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 Banana Type 1 specific Musa acuminata 4641 0.021667 0.035 0.01 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 Bayberry Type 1 specific Myrica 3509 Bean Type 1 specific 0.706667 0.8 0.61 mg/100 g Bearded seal Type 1 specific Erignathus barbatus 39304 0.01 0.04 0.0 mg/100 g Beech nut Type 1 specific Fagus 21024 Beer Type 2 specific 0.0 0.0 0.0 mg/100 g Beluga whale Type 1 specific Delphinapterus leucas 9749 0.0 0.0 0.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 Biscuit Type 2 specific 5.42 12.45 1.57 mg/100 g Bitter gourd Type 1 specific Momordica charantia 3673 Bivalvia (Clam, Mussel, Oyster) Type 1 specific Bivalvia 6544 0.786667 1.47 0.0 mg/100 g Black cabbage Type 1 specific Brassica oleracea var. viridis 3713 Black chokeberry Type 1 specific Photinia melanocarpa 661339 Black crowberry Type 1 specific Empetrum nigrum 191066 Black elderberry Type 1 specific Sambucus nigra 4202 Black huckleberry Type 1 specific Gaylussacia baccata 128893 Black mulberry Type 1 specific Morus nigra 85232 Black plum Type 1 Syzygium cumini Black radish Type 1 specific Raphanus sativus var. niger 41679 Black raisin Type 1 Black raspberry Type 1 specific Rubus occidentalis 75079 Black salsify Type 1 specific Scorzonera hispanica 114289 Black tea Type 1 0.0 0.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 9.823333 28.48 0.295 mg/100 g Black-eyed pea Type 1 specific Vigna unguiculata ssp. unguiculata 3920 Blackberry Type 1 specific Rubus Blackcurrant Type 1 specific Ribes nigrum 78511 Blue crab Type 1 specific Callinectes sapidus 6763 0.0 0.0 0.0 mg/100 g Blue mussel Type 1 specific Mytilus edulis 6550 0.013333 0.02 0.0 mg/100 g Bog bilberry Type 1 specific Vaccinium uliginosum 190548 Borage Type 1 specific Borago officinalis 13363 Boysenberry Type 1 specific Rubus ursinus X idaeus Brazil nut Type 1 specific Bertholletia excelsa 3645 7.87 7.87 7.87 mg/100 g Breadfruit Type 1 specific Artocarpus altilis 194251 Breadnut tree seed Type 1 specific Brosimum alicastrum 194253 Breakfast cereal Type 2 specific 0.315417 2.43 0.03 mg/100 g Breakfast sandwich Type 2 specific 2.444167 4.74 0.43 mg/100 g Broad bean Type 1 specific Vicia faba 3906 Broccoli Type 1 specific Brassica oleracea var. italica 36774 0.138429 0.27 0.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 0.0 0.0 0.0 mg/100 g Buffalo currant Type 1 specific Ribes aureum var. villosum 23283 Bulgur Type 2 specific Burdock Type 1 specific Arctium lappa 4217 Burrito Type 2 specific 1.796 3.58 1.15 mg/100 g Butter Type 2 specific 0.0 0.0 0.0 mg/100 g Buttermilk Type 2 specific 0.03 0.03 0.03 mg/100 g Butternut Type 1 specific Juglans cinerea 91214 Butternut squash Type 1 specific Cucurbita moschata 3662 Cabbage Type 1 specific Brassica oleracea var. capitata 3716 0.0 0.0 0.0 mg/100 g Cake Type 2 specific 4.785 6.9 2.67 mg/100 g Calabash Type 1 specific Lagenaria siceraria 3668 Canada blueberry Type 1 specific Vaccinium myrtilloides 1503870 Candy bar Type 2 specific 3.95 3.95 3.95 mg/100 g Cannellini bean Type 1 Canola Type 2 specific 138011 16.278 30.35 0.0 mg/100 g Canola oil Type 2 0.95 1.9 0.0 mg/100 g Cantaloupe melon Type 1 Cucumis melo var. cantalupensis Cape gooseberry Type 1 Physalis peruviana Capers Type 1 specific Capparis spinosa 65558 Caraway Type 1 specific Carum carvi 48032 Cardamom Type 1 specific Elettaria cardamomum 105181 Cardoon Type 1 specific Cynara cardunculus 4265 Carob Type 1 specific Ceratonia siliqua 20340 Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.009167 0.025 0.0 mg/100 g Cascade huckleberry Type 1 specific Vaccinium deliciosum 190531 Cashew nut Type 1 specific Anacardium occidentale 171929 5.37 5.4 5.31 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 Castanospermum australe Type 1 Castanospermum australe Catjang pea Type 1 specific Vigna unguiculata ssp. cylindrica 3840 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 0.005836 0.07 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 0.2 0.2 0.2 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 Celery stalks Type 1 specific Apium graveolens var. dulce 117781 0.0 0.0 0.0 mg/100 g Cereals and cereal products Unknown generic Ceylon cinnamon Type 1 specific Cinnamomum verum 128608 Channel catfish Type 1 specific Ictalurus punctatus 7998 0.245 0.27 0.22 mg/100 g Chanterelle Type 1 specific Cantharellus cibarius 36066 Chayote Type 1 specific Sechium edule 184140 Cheddar Cheese Type 2 Cheddar Cheese 0.02 0.04 0.0 mg/100 g Cheese Type 2 specific 0.036389 0.13 0.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 0.016667 0.03 0.01 mg/100 g Cherry tomato Type 1 specific Solanum lycopersicum var. cerasiforme 195583 Chervil Type 1 specific Anthriscus cerefolium 40888 Chestnut Type 1 specific Castanea 21019 Chia Type 1 specific Salvia hispanica 49212 Chicken Type 1 specific Gallus gallus 9031 0.0075 0.015 0.0 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 Chicory Type 1 specific Cichorium intybus 13427 Chicory leaves Type 1 specific Cichorium intybus var. foliosum 13427 Chicory roots Type 1 specific Cichorium intybus var. sativum 13427 Chili Type 2 specific 1.055 1.19 0.92 mg/100 g Chinese bayberry Type 1 specific Myrica rubra 262757 Chinese broccoli Type 1 specific Brassica alboglabra 3714 Chinese cabbage Type 1 specific Brassica rapa 3711 48.6 48.6 48.6 mg/100 g Chinese chestnut Type 1 specific Castanea mollissima 60419 Chinese chives Type 1 specific Allium tuberosum 4683 Chinese cinnamon Type 1 specific Cinnamomum aromaticum 119260 10.44 10.44 10.44 mg/100 g Chinese mustard Type 1 specific Brassica juncea 3707 Chinese plum Type 1 Chinese water chestnut Type 1 specific Eleocharis dulcis 110284 Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 0.015 0.03 0.0 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 Chocolate Type 2 specific 7.465 9.19 5.83 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 0.025 0.05 0.0 mg/100 g Cichlidae (Tilapia) Type 1 specific Cichlidae 8113 0.065 0.1 0.0 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 5.22 10.44 0.0 mg/100 g Clam Type 1 0.8975 1.785 0.01 mg/100 g Clementine Type 1 Citrus × clementina 0.0 0.0 0.0 mg/100 g Climbing bean Type 1 specific Vigna umbellata 87088 Cloud ear fungus Type 1 specific Auricularia polytricha 29893 Cloudberry Type 1 specific Rubus chamaemorus 57936 Cloves Type 1 specific Syzygium aromaticum 219868 0.0 0.0 0.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 0.27 0.53 0.03 mg/100 g Coconut oil Type 2 0.0775 0.155 0.0 mg/100 g Coffee Type 1 generic Coffea 13442 0.01 0.01 0.01 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 0.01 0.01 0.01 mg/100 g Cold cut Type 2 specific 0.015 0.03 0.0 mg/100 g Colorado pinyon Type 1 specific Pinus edulis 3340 Common bean Type 1 specific Phaseolus vulgaris 3885 0.993333 2.01 0.08 mg/100 g Common beet Type 1 specific Beta vulgaris 161934 Common buckwheat Type 1 specific Fagopyrum esculentum 3617 7.14 7.14 7.14 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 0.0 0.0 0.0 mg/100 g Common chokecherry Type 1 specific Prunus virginiana 133204 0.94 1.06 0.82 mg/100 g Common grape Type 1 specific Vitis vinifera 29760 0.055 0.07 0.04 mg/100 g Common hazelnut Type 1 specific Corylus avellana 13451 0.0 0.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 0.00125 0.01 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 24.42 24.42 24.42 mg/100 g Common pea Type 1 specific Pisum sativum 3888 1.632 2.47 0.75 mg/100 g Common persimmon Type 1 specific Diospyros virginiana 13493 Common sage Type 1 specific Salvia officinalis 38868 Common salsify Type 1 specific Tragopogon porrifolius 13731 Common thyme Type 1 specific Thymus vulgaris 49992 Common verbena Type 1 specific Verbena officinalis 79772 Common walnut Type 1 specific Juglans regia 51240 72.981667 192.35 5.765 mg/100 g Common wheat Type 1 specific Triticum aestivum 4565 28.3 28.3 28.3 mg/100 g Cooking oil Type 2 specific 68.125 100.88 35.37 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 Corn Type 1 specific Zea mays 4577 2.655556 75.2 0.0 mg/100 g Corn chip Type 2 specific 0.0 0.0 0.0 mg/100 g Corn grits Type 2 specific 0.25 0.7 0.05 mg/100 g Corn oil Type 2 5.08 9.95 0.21 mg/100 g Corn salad Type 1 specific Valerianella locusta 59166 Cornbread Type 2 specific Cornmint Type 1 specific Mentha arvensis 292239 Cottage cheese Type 2 0.0 0.0 0.0 mg/100 g Cottonseed Type 1 specific Gossypium 3633 Cow milk, pasteurized, vitamin A + D added, 0% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 1% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 2% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin D added, 3.25% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Cowpea Type 1 specific Vigna unguiculata 3917 Cracker Type 2 specific 8.323636 14.11 4.49 mg/100 g Cream Type 2 specific 0.008571 0.04 0.0 mg/100 g Cream substitute Type 2 specific 0.47 0.47 0.47 mg/100 g Crosne Type 1 Stachys affinis Cubanelle pepper Type 1 Cucumber Type 1 specific Cucumis sativus 3659 0.01375 0.03 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 20.186667 35.1 12.73 mg/100 g Cumin Type 1 specific Cuminum cyminum 52462 Curry powder Type 2 specific 0.95 0.95 0.95 mg/100 g Custard apple Type 1 specific Annona reticulata 301862 Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 0.0 0.0 0.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 Date Type 1 specific Phoenix dactylifera 42345 0.05 0.05 0.05 mg/100 g Deerberry Type 1 specific Vaccinium stamineum 176259 Dill Type 1 specific Anethum graveolens 40922 Dock Type 1 specific Rumex 3618 Domestic pig Type 1 specific Sus scrofa domestica 9825 0.065802 3.27 0.0 mg/100 g Dried milk Type 2 specific 0.0 0.0 0.0 mg/100 g Dulce de leche Type 2 specific 0.0 0.0 0.0 mg/100 g Durian Type 1 specific Durio zibethinus 66656 Eddoe Type 1 Colocasia antiquorum Egg roll Type 2 specific 1.323333 1.72 0.98 mg/100 g Egg yolk Type 1 1.4 2.685 0.115 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 Eggs Unknown generic 1.67 4.29 0.5 mg/100 g Elderberry Type 1 specific Sambucus 4201 Elliott's blueberry Type 1 specific Vaccinium elliottii 283798 Empanada Type 2 specific 2.52 2.52 2.52 mg/100 g Endive Type 1 specific Cichorium endivia 114280 Enokitake Type 1 specific Flammulina velutipes 38945 0.0 0.0 0.0 mg/100 g Epazote Type 1 specific Dysphania ambrosioides 330163 European anchovy Type 1 specific Engraulis encrasicolus 184585 0.17 0.17 0.17 mg/100 g European chestnut Type 1 specific Castanea sativa 21020 European cranberry Type 1 specific Vaccinium oxycoccos 516948 European plum Type 1 specific Prunus domestica 3758 0.17 0.41 0.02 mg/100 g Evening primrose Type 1 specific Oenothera biennis 3942 Evergreen huckleberry Type 1 specific Vaccinium ovatum 84019 Fats and oils Unknown generic Feijoa Type 1 specific Feijoa sellowiana 260130 0.023333 0.03 0.01 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 Fenugreek Type 1 specific Trigonella foenum-graecum 78534 Fig Type 1 specific Ficus carica 3494 0.203333 0.37 0.0 mg/100 g Fireweed Type 1 specific Chamerion angustifolium 13055 Flatfish Type 1 specific Pleuronectiformes 8252 0.00875 0.015 0.0 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 24.189167 57.3 0.0 mg/100 g Flour Type 2 specific Fox grape Type 1 specific Vitis labrusca 103355 French plantain Type 1 specific Musa X paradisiaca 89151 1.06 1.06 1.06 mg/100 g French toast Type 2 specific 5.29 5.29 5.29 mg/100 g Fruit juice Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit preserve Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit salad Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit-flavor drink Type 2 specific 0.0 0.0 0.0 mg/100 g Frybread Type 2 specific 0.565 0.59 0.54 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.0 0.0 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 0.0 0.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 Garden onion Type 1 specific Allium cepa 4679 0.0 0.0 0.0 mg/100 g Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 0.0 0.0 0.0 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 Garden tomato Type 1 specific Solanum lycopersicum 4081 0.178214 0.52 0.0 mg/100 g Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 0.0475 0.095 0.0 mg/100 g Garland chrysanthemum Type 1 specific Chrysanthemum coronarium 99038 Garlic Type 1 specific Allium sativum 4682 0.0 0.0 0.0 mg/100 g Gentiana lutea Type 1 Gentiana lutea German camomile Type 1 specific Matricaria recutita 127986 Giant butterbur Type 1 specific Petasites japonicus 186965 Ginger Type 1 specific Zingiber officinale 94328 3.01 3.01 3.01 mg/100 g Ginkgo nuts Type 1 specific Ginkgo biloba 3311 Ginseng Type 1 specific Panax 4054 Globe artichoke Type 1 specific Cynara scolymus 59895 Goji Type 1 Gooseberry Type 1 specific Ribes uva-crispa 135518 Gram bean Type 1 specific Vigna mungo 3915 Grape Type 1 specific Vitis 3603 0.0125 0.05 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 0.0 0.0 0.0 mg/100 g Grapefruit/Pummelo hybrid Type 1 specific Citrus paradisi X Citrus maxima 37656 0.0025 0.005 0.0 mg/100 g Grass pea Type 1 specific Lathyrus sativus 3860 Green apple Type 1 Green bean Type 1 specific Phaseolus vulgaris 3885 0.08 0.08 0.08 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 2.52 7.55 0.0 mg/100 g Green cabbage Type 1 Brassica oleracea var. sabauda L. Green grape Type 1 Green lentil Type 1 Lens culinaris 2.115 4.23 0.0 mg/100 g Green onion Type 1 Green plum Type 1 0.0425 0.08 0.005 mg/100 g Green tea Type 1 0.0 0.0 0.0 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica Greenthread tea Type 1 specific Thelesperma 153159 Groundcherry Type 1 specific Physalis 24663 Guarana Type 1 Paullinia cupana Guava Type 1 specific Psidium guajava 120290 0.0 0.0 0.0 mg/100 g Haddock Type 1 specific Melanogrammus aeglefinus 8056 0.0 0.0 0.0 mg/100 g Half-highbush blueberry Type 1 specific Vaccinium angustifolium X Vaccinium corymbosum 934696 Hamburger Type 2 specific 0.81 3.56 0.13 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 Hawthorn Type 1 Crataegus Hazelnut Type 1 specific Corylus 13450 0.5375 2.15 0.0 mg/100 g Heart of palm Type 1 specific Hedge mustard Type 1 specific Sisymbrium 3729 Herbal tea Type 1 Hibiscus tea Type 1 specific Hibiscus sabbariffa 183260 Hickory nut Type 1 specific Carya 13402 Highbush blueberry Type 1 specific Vaccinium corymbosum 69266 Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 0.0 0.0 0.0 mg/100 g Horchata Type 2 specific 0.02 0.02 0.02 mg/100 g Horned melon Type 2 specific Cucumis metuliferus 61886 Horseradish Type 1 specific Armoracia rusticana 3704 Horseradish tree Type 1 specific Moringa oleifera 3735 Hot chocolate Type 2 specific 0.013333 0.02 0.0 mg/100 g Hummus Type 2 specific 0.04 0.04 0.04 mg/100 g Hyacinth bean Type 1 specific Lablab purpureus 35936 Hyssop Type 1 specific Hyssopus officinalis 39324 Ice cream Type 2 specific 0.06 0.06 0.06 mg/100 g Iceberg lettuce Type 1 0.0625 0.125 0.0 mg/100 g Icing Type 2 specific 3.63 7.26 0.0 mg/100 g Italian oregano Type 1 specific Origanum X majoricum 1384207 24.42 24.42 24.42 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 2.653333 7.68 0.14 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 0.0 0.0 0.0 mg/100 g Jalapeno pepper Type 1 Capsicum annuum 'Jalapeño' 0.02 0.04 0.0 mg/100 g Japanese chestnut Type 1 specific Castanea crenata 103480 Japanese persimmon Type 1 specific Diospyros kaki 35925 Japanese pumpkin Type 1 specific Cucurbita maxima 3661 20.186667 35.1 12.73 mg/100 g Japanese walnut Type 1 specific Juglans ailanthifolia 91209 Java plum Type 1 specific Syzygium cumini 260142 Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 Jew's ear Type 1 specific Auricularia auricula-judae 29892 Jicama Type 1 specific Pachyrhizus erosus 109171 Jostaberry Type 1 specific Ribes × nidigrolaria Jujube Type 1 specific Ziziphus zizyphus 48393 Juniperus communis Type 1 Juniperus communis Jute Type 1 specific Corchorus olitorius 93759 Kai-lan Type 1 specific Brassica oleracea var. alboglabra 3714 Kale Type 1 specific Brassica napus var. pabularia 0.025 0.05 0.0 mg/100 g Ketchup Type 2 specific 0.13 0.13 0.13 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 0.02125 0.035 0.01 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 Komatsuna Type 1 specific Brassica rapa var. perviridis 344680 Kumquat Type 1 specific Fortunella 2706 Lambsquarters Type 1 specific Chenopodium album 3559 Lantern fruit Type 1 Physalis alkekengi Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Leek Type 1 specific Allium porrum Lemon Type 1 specific Citrus limon 2708 Lemon balm Type 1 specific Melissa officinalis 39338 Lemon grass Type 1 specific Cymbopogon citratus 66014 Lemon sole Type 1 specific Microstomus kitt 106175 0.0075 0.015 0.0 mg/100 g Lemon thyme Type 1 specific Thymus pulegioides 751873 Lemon verbena Type 1 specific Aloysia triphylla 542672 Lentils Type 1 generic Lens culinaris 3864 2.82 4.23 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 0.229286 0.41 0.0 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 Lima bean Type 1 specific Phaseolus lunatus 3884 Lime Type 1 specific Citrus aurantiifolia 159033 Linden Type 1 specific Tilia 64580 Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 Loganberry Type 1 specific Rubus loganobaccus Longan Type 1 specific Dimocarpus longan 128017 Loquat Type 1 specific Eriobotrya japonica 32224 Lotus Type 1 specific Nelumbo 4430 Lovage Type 1 specific Levisticum officinale 48042 Lowbush blueberry Type 1 specific Vaccinium angustifolium 472369 Lupine Type 1 specific Lupinus 3869 Macadamia nut Type 1 specific Macadamia 4329 0.0 0.0 0.0 mg/100 g Macadamia nut (M. tetraphylla) Type 1 specific Macadamia tetraphylla 512563 0.0 0.0 0.0 mg/100 g Macaroni and cheese Type 2 specific 1.28 1.49 1.04 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 0.0 0.0 0.0 mg/100 g Malabar plum Type 1 specific Syzygium jambos 334483 Malabar spinach Type 1 specific Basella alba 3589 Malus (Crab apple) Type 1 specific Malus 3749 Mamey sapote Type 1 specific Pouteria sapota 233744 0.0 0.0 0.0 mg/100 g Mammee apple Type 1 specific Mammea americana 198777 Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 0.0 0.0 0.0 mg/100 g Mango Type 1 specific Mangifera indica 29780 0.00875 0.02 0.0 mg/100 g Margarine Type 2 specific 32.68 43.79 19.57 mg/100 g Margarine-like spread Type 2 specific 19.685455 36.88 7.76 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 0.01 0.02 0.0 mg/100 g Mate Type 1 Ilex paraguariensis Meatloaf Type 2 specific 0.01 0.02 0.0 mg/100 g Medlar Type 1 specific Mespilus germanica 36616 Mentha Type 1 specific Mentha 21819 Mexican groundcherry Type 1 specific Physalis philadelphica var. immaculata 374021 Mexican oregano Type 1 specific Lippia graveolens 24.42 24.42 24.42 mg/100 g Mikan Type 1 Citrus unshiu Milk (Cow) Type 2 specific 0.0168 0.0744 0.0 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 2.07 2.07 2.07 mg/100 g Miso Type 2 specific Mixed nuts Type 2 specific 6.39 6.39 6.39 mg/100 g Monk fruit Type 1 Siraitia grosvenorii Morchella (Morel) Type 1 specific Morchellaceae 5192 Moth bean Type 1 specific Vigna aconitifolia 3918 Mountain yam Type 1 specific Dioscorea pentaphylla 167592 Mozzarella cheese Type 2 0.0625 0.125 0.0 mg/100 g Mugwort Type 1 specific Artemisia vulgaris 4220 Mulberry Type 1 specific Morus 3497 Multigrain bread Type 2 specific 1.52 1.58 1.46 mg/100 g Mundu Type 1 Garcinia dulcis Mung bean Type 1 specific Vigna radiata 157791 Muscadine grape Type 1 specific Vitis rotundifolia 103349 Muskmelon Type 1 specific Cucumis melo 3656 0.046667 0.11 0.0 mg/100 g Mustard spinach Type 1 specific Brassica perviridis Nachos Type 2 specific 5.63 8.01 3.25 mg/100 g Nance Type 1 specific Byrsonima crassifolia 4270 0.716667 1.88 0.015 mg/100 g Nanking cherry Type 1 specific Prunus tomentosa 105667 Napa cabbage Type 1 specific Brassica rapa var. pekinensis 51351 Naranjilla Type 1 specific Solanum quitoense 227725 0.105 0.2 0.005 mg/100 g Narrowleaf cattail Type 1 specific Typha angustifolia 59011 Natal plum Type 1 specific Carissa macrocarpa 403101 Nectarine Type 1 specific Prunus persica var. nucipersica 323851 0.025 0.04 0.01 mg/100 g New Zealand spinach Type 1 specific Tetragonia tetragonioides 45318 Nopal Type 1 specific Opuntia cochenillifera 338184 Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 0.53 0.53 0.53 mg/100 g Nutritional drink Type 2 specific 0.52 0.52 0.52 mg/100 g Nuts Unknown generic Oat Type 1 specific Avena sativa 4498 0.0 0.0 0.0 mg/100 g Oat bread Type 2 specific Ohelo berry Type 1 specific Vaccinium reticulatum 180767 Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 0.12 0.16 0.0 mg/100 g Olive Type 1 specific Olea europaea 4146 0.310714 1.3 0.0 mg/100 g Opium poppy Type 1 specific Papaver somniferum 3469 8.82 8.82 8.82 mg/100 g Orange bell pepper Type 1 specific Capsicum annuum 4072 Orange mint Type 1 specific Mentha aquatica 190902 Orange roughy Type 1 specific Hoplostethus atlanticus 96778 0.0275 0.04 0.0 mg/100 g Oregon yampah Type 1 specific Perideridia oregana 234866 Oriental wheat Type 1 specific Triticum turanicum 376534 0.405 1.15 0.005 mg/100 g Ostrich fern Type 1 specific Matteuccia struthiopteris 3277 Other beverage Type 2 specific 0.08 0.08 0.08 mg/100 g Other bread Type 2 specific 2.79 7.7 0.7 mg/100 g Other bread product Type 2 specific 0.805 0.85 0.76 mg/100 g Other candy Type 2 specific 2.809 7.42 0.0 mg/100 g Other dish Type 2 specific 2.36 6.14 0.14 mg/100 g Other fish product Type 2 specific 2.185 4.27 0.1 mg/100 g Other pasta dish Type 2 specific 0.08 0.08 0.08 mg/100 g Other sandwich Type 2 specific 4.84 4.84 4.84 mg/100 g Other snack food Type 2 specific 1.4525 6.6 0.0 mg/100 g Other soy product Type 2 specific 5.715 5.88 5.55 mg/100 g Oval-leaf huckleberry Type 1 specific Vaccinium ovalifolium 190544 Oxheart cabbage Type 1 specific Brassica oleracea var. conica Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 0.0 0.0 0.0 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 0.0 0.0 0.0 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 0.0 0.0 0.0 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.005 0.01 0.0 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 0.0 0.0 0.0 mg/100 g Pacific sardine Type 1 specific Sardinops sagax 28381 0.01 0.01 0.01 mg/100 g Painted comber Type 1 specific Serranus scriba 349661 0.0 0.0 0.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 Pan dulce Type 2 specific 2.69 2.69 2.69 mg/100 g Pancake Type 2 specific 1.355 2.58 0.13 mg/100 g Papaya Type 1 specific Carica papaya 3649 0.053333 0.09 0.01 mg/100 g Parmesan cheese Type 2 0.0125 0.025 0.0 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 0.6475 1.53 0.0 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 Partridge berry Type 1 Mitchella repens Passion fruit Type 1 specific Passiflora edulis 78168 Pasta Type 2 specific 0.7275 1.36 0.5 mg/100 g Pastry Type 2 specific 7.21 7.61 6.81 mg/100 g Pea shoots Type 1 0.95 0.95 0.95 mg/100 g Peach Type 1 specific Prunus persica 3760 0.0225 0.04 0.0 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 Peanut Type 1 specific Arachis hypogaea 3818 9.46625 15.91 3.5 mg/100 g Peanut oil Type 2 2.695 2.695 2.695 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.0175 0.04 0.0 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 21.049167 24.44 6.315 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 2.76125 7.68 0.0 mg/100 g Pepper (C. baccatum) Type 1 specific Capsicum baccatum var. baccatum 165788 Pepper (C. chinense) Type 1 specific Capsicum chinense 80379 Pepper (C. frutescens) Type 1 specific Capsicum annuum var. annuum 40321 Pepper (C. pubescens) Type 1 specific Capsicum pubescens 113210 Pepper (Capsicum) Type 1 specific Capsicum 4071 Pepper (Spice) Type 1 specific Piper nigrum 13216 2.231667 6.56 0.0 mg/100 g Peppermint Type 1 specific Mentha X piperita 34256 Persian lime Type 1 specific Citrus latifolia 200541 0.0 0.0 0.0 mg/100 g Persimmon Type 1 specific Diospyros 13492 Pie Type 2 specific 5.006667 6.64 3.49 mg/100 g Pie crust Type 2 specific 4.685 9.41 0.14 mg/100 g Pie filling Type 2 specific 0.0 0.0 0.0 mg/100 g Pigeon pea Type 1 specific Cajanus cajan 3821 Piki bread Type 2 specific 2.815 4.83 0.8 mg/100 g Pili nut Type 1 specific Canarium ovatum 43691 Pine nut Type 1 specific Pinus 3337 2.97125 11.15 0.0 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.0 0.0 0.0 mg/100 g Pineappple sage Type 1 specific Salvia elegans 888065 Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 0.02 0.12 0.0 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 14.716 23.56 1.67 mg/100 g Pita bread Type 2 specific Pitanga Type 1 specific Eugenia uniflora 119951 Pitaya Type 1 Hylocereus undatus Pizza Type 2 specific 1.600238 3.54 0.73 mg/100 g Plains prickly pear Type 1 specific Opuntia macrorhiza 1041245 Plantain Type 1 Musa × paradisiaca Pollock Type 1 specific Pollachius 8059 0.0 0.0 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 Popcorn Type 2 specific 9.702 24.88 0.0 mg/100 g Pot marjoram Type 1 specific Origanum onites 452416 Pot pie Type 2 specific 0.52 0.71 0.33 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 1.482 7.57 0.0 mg/100 g Potato bread Type 2 specific Potato chip Type 2 specific 6.99 6.99 6.99 mg/100 g Potato puffs Type 2 specific 1.135 1.16 1.11 mg/100 g Prairie turnip Type 1 specific Pediomelum esculentum 458363 Prickly pear Type 1 specific Opuntia 106975 Processed cheese Type 2 specific 4.006667 14.01 0.04 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 Pudding Type 2 specific 0.57125 1.79 0.0 mg/100 g Pummelo Type 1 specific Citrus maxima 37334 Pupusa Type 2 specific 2.293333 4.13 1.28 mg/100 g Purple mangosteen Type 1 specific Garcinia mangostana 58228 Purslane Type 1 specific Portulaca oleracea 46147 Quince Type 1 specific Cydonia oblonga 36610 Quinoa Type 1 specific Chenopodium quinoa 63459 1.6875 4.55 0.0 mg/100 g Rabbiteye blueberry Type 1 specific Vaccinium virgatum Radish Type 1 specific Raphanus sativus 3726 0.0 0.0 0.0 mg/100 g Radish (var.) Type 1 specific Raphanus sativus var. sativus 240228 Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 0.0375 0.05 0.01 mg/100 g Raisin bread Type 2 specific Rambutan Type 1 specific Nephelium lappaceum 151071 Rape Type 1 specific Brassica napus var. napus 138011 Rapini Type 1 specific Brassica ruvo 1204434 0.24 0.32 0.16 mg/100 g Ravioli Type 2 specific 0.195 0.32 0.07 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra Red bell pepper Type 1 specific Capsicum annuum 4072 3.91 7.68 0.14 mg/100 g Red clover Type 1 Trifolium pratense Red grape Type 1 Red huckleberry Type 1 specific Vaccinium parvifolium 180766 Red onion Type 1 Red raspberry Type 1 specific Rubus idaeus 32247 Red rice Type 1 specific Oryza rufipogon 4529 0.035 0.065 0.005 mg/100 g Red tea Type 1 Redcurrant Type 1 specific Ribes rubrum 175228 Rice Type 1 specific Oryza sativa 4530 0.106 0.19 0.0 mg/100 g Rice bread Type 2 specific Robusta coffee Type 1 specific Coffea canephora 49390 0.01 0.01 0.01 mg/100 g Rocket salad (ssp.) Type 1 specific Eruca vesicaria ssp. sativa 29727 Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 0.36 0.36 0.36 mg/100 g Roman camomile Type 1 specific Chamaemelum nobile 99037 Rose hip Type 1 specific Rosa 3764 0.916667 1.34 0.07 mg/100 g Roselle Type 1 specific Hibiscus sabdariffa 183260 149.0 149.0 149.0 mg/100 g Rosemary Type 1 specific Rosmarinus officinalis 39367 Rowal Type 1 specific Pangium edule 112823 Rowanberry Type 1 specific Sorbus aucuparia 36599 Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 1.2575 2.22 0.05 mg/100 g Rye Type 1 specific Secale cereale 4550 Rye bread Type 2 specific 0.6625 0.915 0.41 mg/100 g Sacred lotus Type 1 specific Nelumbo nucifera 4432 Safflower Type 1 specific Carthamus tinctorius 4222 2.6 2.6 2.6 mg/100 g Saffron Type 1 specific Crocus sativus 82528 Sago palm Type 1 specific Metroxylon sagu 93297 Salad Type 2 specific 5.106667 5.74 4.79 mg/100 g Salad dressing Type 2 specific 20.04 35.24 11.14 mg/100 g Salmonberry Type 1 specific Rubus spectabilis 59499 0.37 0.37 0.37 mg/100 g Salted butter Type 1 0.0 0.0 0.0 mg/100 g Sapodilla Type 1 specific Manilkara zapota 3741 Saskatoon berry Type 1 specific Amelanchier alnifolia 32219 Sauce Type 2 specific 0.1 0.1 0.1 mg/100 g Sausage Type 2 specific 0.159412 0.84 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 Scallop Type 1 specific Pectinidae 6566 0.0 0.0 0.0 mg/100 g Scarlet bean Type 1 specific Phaseolus coccineus 3886 Sea-buckthornberry Type 1 specific Hippophae rhamnoides 193516 Semolina Type 2 specific Sesame Type 1 specific Sesamum orientale 4182 0.0 0.0 0.0 mg/100 g Sesbania flower Type 1 specific Sesbania bispinosa 485725 Shallot Type 1 specific Allium ascalonicum 1476995 Sheefish Type 1 specific Stenodus leucichthys 59296 0.006667 0.01 0.0 mg/100 g Shiitake Type 1 specific Lentinus edodes 5353 0.0 0.0 0.0 mg/100 g Shortening Type 2 specific 32.3 32.3 32.3 mg/100 g Shrimp Type 1 specific Caridea 6694 4.351667 10.08 0.1 mg/100 g Silver linden Type 1 specific Tilia argentea Skunk currant Type 1 specific Ribes glandulosum 175226 Small-leaf linden Type 1 specific Tilia cordata 172266 Smelt Type 1 specific Osmeridae 8012 0.08 0.08 0.08 mg/100 g Snack bar Type 2 specific 1.005833 2.41 0.0 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 0.0705 0.215 0.0 mg/100 g Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 Sorghum Type 1 specific Sorghum bicolor 4558 1.9 1.9 1.9 mg/100 g Sorrel Type 1 specific Rumex acetosa 41241 Soup Type 2 specific 0.599091 1.78 0.0 mg/100 g Sour cherry Type 1 specific Prunus cerasus 140311 Sour orange Type 1 Citrus × aurantium Sourdock Type 1 specific Rumex articus 395311 Sourdough Type 2 specific Soursop Type 1 specific Annona muricata 13337 0.0 0.0 0.0 mg/100 g Soy bean Type 1 specific Glycine max 3847 24.521429 69.9 5.55 mg/100 g Soy cream Type 2 specific Soy milk Type 2 specific Soy sauce Type 2 specific Soybean oil Type 2 7.33 14.66 0.0 mg/100 g Sparkleberry Type 1 specific Vaccinium arboreum 229201 Spearmint Type 1 specific Mentha spicata 29719 Spelt Type 1 specific Triticum spelta 58933 0.605 1.71 0.0 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 0.135833 0.18 0.0 mg/100 g Spotted seal Type 1 specific Phoca largha 39090 0.0 0.0 0.0 mg/100 g Squashberry Type 1 specific Viburnum edule 237934 Star anise Type 1 specific Illicium verum 124778 Star fruit Type 1 specific Averrhoa carambola 28974 Stew Type 2 specific 0.178571 0.76 0.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 0.08 0.08 0.08 mg/100 g Strawberry guava Type 1 specific Psidium cattleianum 375274 Stuffing Type 2 specific 1.02 1.02 1.02 mg/100 g Sugar apple Type 1 specific Annona squamosa 301693 Summer grape Type 1 specific Vitis aestivalis 3605 Summer savory Type 1 specific Satureja hortensis 49987 Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 20.186667 35.1 12.73 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 4.784444 14.99 0.0 mg/100 g Sunflower oil Type 2 0.13 0.26 0.0 mg/100 g Swamp cabbage Type 1 specific Ipomoea aquatica 89636 Swede Type 1 specific Brassica napus 3708 Sweet basil Type 1 specific Ocimum basilicum 39350 0.2725 0.77 0.0 mg/100 g Sweet bay Type 1 specific Laurus nobilis 85223 Sweet cherry Type 1 specific Prunus avium 42229 0.02 0.04 0.0 mg/100 g Sweet custard Type 2 specific 0.0 0.0 0.0 mg/100 g Sweet marjoram Type 1 specific Origanum majorana 268884 Sweet orange Type 1 specific Citrus sinensis 2711 0.025 0.05 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 0.002857 0.01 0.0 mg/100 g Sweet rowanberry Type 1 specific Grataegosorbus mitschurinii Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 Swiss cheese Type 2 0.0275 0.055 0.0 mg/100 g Swordfish Type 1 specific Xiphias gladius 8245 0.0075 0.01 0.0 mg/100 g Taco Type 2 specific 1.743333 3.02 0.91 mg/100 g Taco shell Type 2 Tamale Type 2 specific 1.9275 4.13 0.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 0.02 0.02 0.02 mg/100 g Taro Type 1 specific Colocasia esculenta 4460 Tarragon Type 1 specific Artemisia dracunculus 72341 Tartary buckwheat Type 1 specific Fagopyrum tataricum 62330 Tea Type 1 specific Camellia sinensis 4442 0.0 0.0 0.0 mg/100 g Tea leaf willow Type 1 specific Salix pulchra 669814 Teff Type 1 specific Eragrostis tef 110835 1.973333 5.04 0.115 mg/100 g Thistle Type 1 specific Cirsium 41549 Thunnus Type 1 specific Thunnus 8234 1.98 3.96 0.0 mg/100 g Tinda Type 1 specific Citrullus lanatus var. fistulosus 0.0 0.0 0.0 mg/100 g Tofu Type 2 specific Topping Type 2 specific 0.0 0.0 0.0 mg/100 g Tortilla Type 2 specific 1.1075 2.32 0.0 mg/100 g Tortilla chip Type 2 specific 0.0 0.0 0.0 mg/100 g Tostada shell Type 2 Towel gourd Type 1 specific Luffa aegyptiaca 3670 Tree fern Type 1 specific Cyathea Triticale Type 1 specific X Triticosecale rimpaui Tronchuda cabbage Type 1 specific Brassica oleracea var. costata 416546 True sole Type 1 specific Soleidae 30948 0.0075 0.015 0.0 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 0.01 0.02 0.0 mg/100 g Turmeric Type 1 specific Curcuma longa 136217 0.413333 0.72 0.05 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 0.16 0.16 0.16 mg/100 g Unclassified food or beverage Type 2 specific 1.045 1.59 0.5 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 0.41 0.46 0.36 mg/100 g Vanilla Type 1 specific Vanilla 51238 Vegetable juice Type 2 specific 0.0 0.0 0.0 mg/100 g Waffle Type 2 specific 4.29 4.52 4.03 mg/100 g Walnut Type 1 specific Juglans 16718 0.495 0.695 0.295 mg/100 g Wampee Type 1 Clausena lansium Wasabi Type 1 specific Wasabia japonica 75806 1.42 2.4 0.44 mg/100 g Water spinach Type 1 Ipomoea aquatica 0.0775 0.155 0.0 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 Watermelon Type 1 specific Citrullus lanatus 3654 0.003333 0.01 0.0 mg/100 g Wax apple Type 1 specific Eugenia javanica 119950 Wax gourd Type 1 specific Benincasa hispida 102211 Welsh onion Type 1 specific Allium fistulosum 35875 Wheat Type 1 specific Triticum 4564 0.698889 1.91 0.08 mg/100 g Wheat bread Type 2 specific 1.21 1.58 0.67 mg/100 g White bread Type 1 2.79 7.7 0.7 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 0.0 0.0 0.0 mg/100 g White lupine Type 1 specific Lupinus albus 3870 White mulberry Type 1 Morus alba White mustard Type 1 specific Sinapis alba 3728 10.935 19.82 2.05 mg/100 g Whitefish Type 1 specific Coregonus 27772 0.01 0.02 0.0 mg/100 g Wild carrot Type 1 specific Daucus carota 4039 0.0125 0.025 0.0 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 0.0 0.0 0.0 mg/100 g Wild leek Type 1 specific Allium ampeloprasum 4681 Wild rice Type 1 specific Zizania 15949 Winged bean Type 1 specific Psophocarpus tetragonolobus 3891 Winter savory Type 1 specific Satureja montana 49988 Winter squash Type 1 specific Cucurbita maxima 3661 Wonton wrapper Type 2 specific Yali pear Type 1 specific Pyrus × bretschneideri Yam Type 1 specific Dioscorea 4672 Yardlong bean Type 1 specific Vigna unguiculata ssp. sesquipedalis 138955 Yau choy Type 1 Yautia Type 1 specific Xanthosoma sagittifolium 28478 Yellow bell pepper Type 1 specific Capsicum annuum 4072 Yellow pond-lily Type 1 specific Nuphar lutea 77113 0.905 1.8 0.01 mg/100 g Yellow wax bean Type 1 specific Phaseolus vulgaris 3885 Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica Yellowfin tuna Type 1 specific Thunnus albacares 8236 0.0 0.0 0.0 mg/100 g Zwieback Type 2 specific 0.31 0.31 0.31 mg/100 g anti atherosclerotic 138 A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. anti C-reactive-protein 210 anti cancer 159 A substance that inhibits or prevents the proliferation of neoplasms. anti inflammatory 370 A substance that reduces or suppresses inflammation. anti prostaglandin 550 A chemical substance which inhibits the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. antioxidant 502 A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. In European countries, E-numbers for permitted antioxidant food additives are from E 300 to E 324. antitumor 672 A substance that inhibits or prevents the proliferation of neoplasms. cardioprotective 769 A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. cyclooxygenase inhibitor 849 A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. hypocholesterolemic 1016 natriuretic 1140 nitric-oxide inhibitor 1167 A substance that diminishes the rate of a chemical reaction. protein kinase C inhibitor 1231 An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of protein kinase C (EC 2.7.11.13).