1.0 2010-04-08 22:09:07 UTC 2025-11-18 23:19:23 UTC FDB010420 Fenchyl acetate Fenchyl acetate, also known as fenchyl acetic acid, is a member of the class of compounds known as bicyclic monoterpenoids. Bicyclic monoterpenoids are monoterpenoids containing exactly 2 rings, which are fused to each other. Fenchyl acetate is practically insoluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). Fenchyl acetate is a sweet, citrus, and fir tasting compound found in sweet basil, which makes fenchyl acetate a potential biomarker for the consumption of this food product. 1,3,3-Trimethyl-2-norbornanyl acetate 1,3,3-Trimethylbicyclo[2.2.1]hept-2-yl acetate 2-Norbornanol, 1,3,3-trimethyl-, acetate Bicyclo[2.2.1]heptan-2-ol, 1,3,3-trimethyl-, acetate C12H20O2 196.286 196.146329884 1,3,3-trimethylbicyclo[2.2.1]heptan-2-yl acetate 1,3,3-trimethylbicyclo[2.2.1]heptan-2-yl acetate 13851-11-1 CC(=O)OC1C2(C)CCC(C2)C1(C)C InChI=1S/C12H20O2/c1-8(13)14-10-11(2,3)9-5-6-12(10,4)7-9/h9-10H,5-7H2,1-4H3 JUWUWIGZUVEFQB-UHFFFAOYSA-N belongs to the class of organic compounds known as bicyclic monoterpenoids. These are monoterpenoids containing exactly 2 rings, which are fused to each other. Bicyclic monoterpenoids Organic compounds Lipids and lipid-like molecules Prenol lipids Monoterpenoids Aliphatic homopolycyclic compounds Carbonyl compounds Carboxylic acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Aliphatic homopolycyclic compound Bicyclic monoterpenoid Carbonyl group Carboxylic acid derivative Carboxylic acid ester Fenchane monoterpenoid Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound logp 3.42 ALOGPS logs -3.42 ALOGPS solubility 7.40e-02 g/l ALOGPS logp 2.59 ChemAxon pka_strongest_basic -7 ChemAxon iupac 1,3,3-trimethylbicyclo[2.2.1]heptan-2-yl acetate ChemAxon average_mass 196.286 ChemAxon mono_mass 196.146329884 ChemAxon smiles CC(=O)OC1C2(C)CCC(C2)C1(C)C ChemAxon formula C12H20O2 ChemAxon inchi InChI=1S/C12H20O2/c1-8(13)14-10-11(2,3)9-5-6-12(10,4)7-9/h9-10H,5-7H2,1-4H3 ChemAxon inchikey JUWUWIGZUVEFQB-UHFFFAOYSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 54.31 ChemAxon polarizability 22.46 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 46848 Specdb::MsMs 46849 Specdb::MsMs 46850 Specdb::MsMs 162006 Specdb::MsMs 162007 Specdb::MsMs 162008 Specdb::MsMs 3603437 Specdb::MsMs 3603438 Specdb::MsMs 3603439 Specdb::MsMs 3603440 Specdb::MsMs 3603441 Specdb::MsMs 3603442 Sweet basil Type 1 specific Ocimum basilicum 39350 3.05 3.05 3.05 mg/100 g citrus fir fresh herbal pine sweet