1.0 2010-04-08 22:09:09 UTC 2025-11-18 23:19:30 UTC FDB010489 Zinc methionine sulfate It is used as a food additive . Hydrogen (L-methioninato-N,O,S)(sulphato(2-)-O)zincate(1-) Zinc methionine bisulfate C5H11NO6S2Zn 310.683 308.931925047 zinc(2+) ion 2-amino-4-(methylsulfanyl)butanoic acid sulfate zinc(2+) ion methionine sulfate 56329-42-1 [Zn++].[O-]S([O-])(=O)=O.CSCCC(N)C(O)=O InChI=1S/C5H11NO2S.H2O4S.Zn/c1-9-3-2-4(6)5(7)8;1-5(2,3)4;/h4H,2-3,6H2,1H3,(H,7,8);(H2,1,2,3,4);/q;;+2/p-2 ROUREIAZUKQVBD-UHFFFAOYSA-L belongs to the class of organic compounds known as methionine and derivatives. Methionine and derivatives are compounds containing methionine or a derivative thereof resulting from reaction of methionine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Methionine and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Alpha amino acids Amino acids Carbonyl compounds Carboxylic acids Dialkylthioethers Hydrocarbon derivatives Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organic sulfate salts Organic sulfuric acids and derivatives Organic transition metal salts Organic zwitterions Organopnictogen compounds Sulfenyl compounds Thia fatty acids Aliphatic acyclic compound Alpha-amino acid Amine Amino acid Carbonyl group Carboxylic acid Dialkylthioether Fatty acid Fatty acyl Hydrocarbon derivative Methionine or derivatives Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organic salt Organic sulfate salt Organic sulfuric acid or derivatives Organic transition metal salt Organic zwitterion Organonitrogen compound Organooxygen compound Organopnictogen compound Organosulfur compound Primary aliphatic amine Primary amine Sulfenyl compound Thia fatty acid Thioether logp -2.2 ChemAxon pka_strongest_acidic 2.53 ChemAxon pka_strongest_basic 9.5 ChemAxon iupac zinc(2+) ion 2-amino-4-(methylsulfanyl)butanoic acid sulfate ChemAxon average_mass 310.683 ChemAxon mono_mass 308.931925047 ChemAxon smiles [Zn++].[O-]S([O-])(=O)=O.CSCCC(N)C(O)=O ChemAxon formula C5H11NO6S2Zn ChemAxon inchi InChI=1S/C5H11NO2S.H2O4S.Zn/c1-9-3-2-4(6)5(7)8;1-5(2,3)4;/h4H,2-3,6H2,1H3,(H,7,8);(H2,1,2,3,4);/q;;+2/p-2 ChemAxon inchikey ROUREIAZUKQVBD-UHFFFAOYSA-L ChemAxon polar_surface_area 63.32 ChemAxon refractivity 37.59 ChemAxon polarizability 15.58 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon HMDB32557