1.0 2010-04-08 22:09:14 UTC 2015-07-20 22:34:38 UTC FDB010664 Calcium hydrogen sulfite Preservative Calcium bisulfite (calcium bisulphite) is an inorganic compound which is the salt of calcium cation and bisulfite anion. As a food additive it is used as a preservative under the E number E227. Calcium bisulfite Calcium hydrogensulphite Calcium sulfite (Ca(HSO3)2) Calcium sulfite (Ca(HSO3)2) (7CI) E227 Sulfurous acid calcium salt (2:1) Sulfurous acid, calcium salt (2:1) CaH2O6S2 202.22 201.891870331 calcium disulfonate calcium disulfonate 13780-03-5 [Ca++].[O-]S(=O)=O.[O-]S(=O)=O InChI=1S/Ca.2H2O3S/c;2*1-4(2)3/h;2*4H,(H,1,2,3)/q+2;;/p-2 YDGNSMQWAPGGTH-UHFFFAOYSA-L belongs to the class of inorganic compounds known as alkaline earth metal oxides. These are inorganic compounds containing an oxygen atom of an oxidation state of -2, in which the heaviest atom bonded to the oxygen is an alkaline earth metal. Alkaline earth metal oxides Inorganic compounds Mixed metal/non-metal compounds Alkaline earth metal organides Alkaline earth metal oxides Inorganic calcium salts Inorganic oxides Alkaline earth metal oxide Inorganic calcium salt Inorganic oxide Inorganic salt logp -0.95 ChemAxon pka_strongest_acidic -2 ChemAxon iupac calcium disulfonate ChemAxon average_mass 202.22 ChemAxon mono_mass 201.891870331 ChemAxon smiles [Ca++].[O-]S(=O)=O.[O-]S(=O)=O ChemAxon formula CaH2O6S2 ChemAxon inchi InChI=1S/Ca.2H2O3S/c;2*1-4(2)3/h;2*4H,(H,1,2,3)/q+2;;/p-2 ChemAxon inchikey YDGNSMQWAPGGTH-UHFFFAOYSA-L ChemAxon polar_surface_area 57.2 ChemAxon refractivity 10.88 ChemAxon polarizability 5.31 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon