1.0 2010-04-08 22:09:18 UTC 2015-07-20 22:35:23 UTC FDB010784 Zinc(II) gluconate Dietary zinc supplement Bis(D-gluconato-O1,O2)zinc, 9CI ZINC GLUCONATE Zinc(II) gluconate C12H22O14Zn 455.704 454.03010199 zinc(2+) ion bis(2,3,4,5,6-pentahydroxyhexanoate) zinc(2+) ion bis(2,3,4,5,6-pentahydroxyhexanoate) 4468-02-4 [Zn++].OCC(O)C(O)C(O)C(O)C([O-])=O.OCC(O)C(O)C(O)C(O)C([O-])=O InChI=1S/2C6H12O7.Zn/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2 WHMDKBIGKVEYHS-UHFFFAOYSA-L belongs to the class of organic compounds known as medium-chain hydroxy acids and derivatives. These are hydroxy acids with a 6 to 12 carbon atoms long side chain. Medium-chain hydroxy acids and derivatives Organic compounds Organic acids and derivatives Hydroxy acids and derivatives Medium-chain hydroxy acids and derivatives Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acid salts Carboxylic acids Hydrocarbon derivatives Hydroxy fatty acids Medium-chain fatty acids Monocarboxylic acids and derivatives Monosaccharides Organic oxides Organic transition metal salts Organic zwitterions Polyols Primary alcohols Secondary alcohols Alcohol Aliphatic acyclic compound Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Carboxylic acid salt Fatty acid Fatty acyl Hydrocarbon derivative Hydroxy fatty acid Medium-chain fatty acid Medium-chain hydroxy acid Monocarboxylic acid or derivatives Monosaccharide Organic oxide Organic oxygen compound Organic salt Organic transition metal salt Organic zwitterion Organooxygen compound Polyol Primary alcohol Secondary alcohol logp -1.95 ALOGPS logs -1.06 ALOGPS solubility 4.00e+01 g/l ALOGPS logp -3.4 ChemAxon pka_strongest_acidic 3.39 ChemAxon pka_strongest_basic -3 ChemAxon iupac zinc(2+) ion bis(2,3,4,5,6-pentahydroxyhexanoate) ChemAxon average_mass 455.704 ChemAxon mono_mass 454.03010199 ChemAxon smiles [Zn++].OCC(O)C(O)C(O)C(O)C([O-])=O.OCC(O)C(O)C(O)C(O)C([O-])=O ChemAxon formula C12H22O14Zn ChemAxon inchi InChI=1S/2C6H12O7.Zn/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2 ChemAxon inchikey WHMDKBIGKVEYHS-UHFFFAOYSA-L ChemAxon polar_surface_area 141.28 ChemAxon refractivity 49.11 ChemAxon polarizability 16.55 ChemAxon rotatable_bond_count 10 ChemAxon acceptor_count 7 ChemAxon donor_count 5 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon HMDB32810