1.0 2010-04-08 22:09:19 UTC 2018-05-28 22:25:08 UTC FDB010822 Methyl N-(3-phenylpropanoyl)anthranilate Production by the marine Streptomyces species B7747. 2-(Methyl-(3-phenylpropanoyl)amino)benzoic acid 2-[Methyl(3-phenylpropanoyl)amino]benzoic acid Methyl N-(3-phenylpropanoyl)anthranilate C17H17NO3 283.3218 283.120843415 2-(N-methyl-3-phenylpropanamido)benzoic acid 2-(N-methyl-3-phenylpropanamido)benzoic acid CN(C(=O)CCC1=CC=CC=C1)C1=CC=CC=C1C(O)=O InChI=1S/C17H17NO3/c1-18(15-10-6-5-9-14(15)17(20)21)16(19)12-11-13-7-3-2-4-8-13/h2-10H,11-12H2,1H3,(H,20,21) APLMLPAZZRMWPT-UHFFFAOYSA-N belongs to the class of organic compounds known as acylaminobenzoic acid and derivatives. These are derivatives of amino benzoic acid derivatives where the amine group is N-acylated. Acylaminobenzoic acid and derivatives Organic compounds Benzenoids Benzene and substituted derivatives Benzoic acids and derivatives Aromatic homomonocyclic compounds Anilides Benzoic acids Benzoyl derivatives Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Tertiary carboxylic acid amides Vinylogous amides Acylaminobenzoic acid or derivatives Anilide Aromatic homomonocyclic compound Benzoic acid Benzoyl Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Tertiary carboxylic acid amide Vinylogous amide logp 2.88 ALOGPS logs -3.62 ALOGPS solubility 6.80e-02 g/l ALOGPS melting_point Mp 107° logp 3.01 ChemAxon pka_strongest_acidic 3.53 ChemAxon pka_strongest_basic -3.6 ChemAxon iupac 2-(N-methyl-3-phenylpropanamido)benzoic acid ChemAxon average_mass 283.3218 ChemAxon mono_mass 283.120843415 ChemAxon smiles CN(C(=O)CCC1=CC=CC=C1)C1=CC=CC=C1C(O)=O ChemAxon formula C17H17NO3 ChemAxon inchi InChI=1S/C17H17NO3/c1-18(15-10-6-5-9-14(15)17(20)21)16(19)12-11-13-7-3-2-4-8-13/h2-10H,11-12H2,1H3,(H,20,21) ChemAxon inchikey APLMLPAZZRMWPT-UHFFFAOYSA-N ChemAxon polar_surface_area 57.61 ChemAxon refractivity 80.62 ChemAxon polarizability 30.22 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 24036 Specdb::CMs 42990 Specdb::CMs 131752 Specdb::CMs 139486 Specdb::MsMs 8069 Specdb::MsMs 8070 Specdb::MsMs 8071 Specdb::MsMs 14741 Specdb::MsMs 14742 Specdb::MsMs 14743 Specdb::MsMs 2292576 Specdb::MsMs 2292577 Specdb::MsMs 2292578 Specdb::MsMs 2646639 Specdb::MsMs 2646640 Specdb::MsMs 2646641 HMDB32845 #<Reference:0x000055ce3244cae0>