1.0 2010-04-08 22:09:22 UTC 2019-11-26 03:04:19 UTC FDB010932 Di-2-furanylmethane Minor constituent of coffee. Di-2-furanylmethane is found in coffee and coffee products. 2-(2-Furylmethyl)furan 2-Furfurylfuran 2,2-Methylenebisfuran 2,2'-Difurylmethane 2,2'-Methylene difuran 2,2'-Methylenebis-furan 2,2'-methylenebisfuran 2,2'-Methylenebisfuran, 9CI 2,2'-Methylenedi-furan Di-&alpha;-furylmethane Di-alpha -furylmethane Furan, 2,2'-methylenebis- Furan, 2,2'-methylenedi- C9H8O2 148.1586 148.0524295 2-(furan-2-ylmethyl)furan 2,2-methylenebisfuran 1197-40-6 C(C1=CC=CO1)C1=CC=CO1 InChI=1S/C9H8O2/c1-3-8(10-5-1)7-9-4-2-6-11-9/h1-6H,7H2 YHGNXEIQSHICNK-UHFFFAOYSA-N belongs to the class of organic compounds known as heteroaromatic compounds. Heteroaromatic compounds are compounds containing an aromatic ring where a carbon atom is linked to an hetero atom. Heteroaromatic compounds Organic compounds Organoheterocyclic compounds Heteroaromatic compounds Aromatic heteromonocyclic compounds Furans Hydrocarbon derivatives Organooxygen compounds Oxacyclic compounds Aromatic heteromonocyclic compound Furan Heteroaromatic compound Hydrocarbon derivative Organic oxygen compound Organooxygen compound Oxacycle logp 2.52 ALOGPS logs -3.04 ALOGPS solubility 1.34e-01 g/l ALOGPS melting_point Mp -26° logp 1.8 ChemAxon pka_strongest_basic -2.7 ChemAxon iupac 2-(furan-2-ylmethyl)furan ChemAxon average_mass 148.1586 ChemAxon mono_mass 148.0524295 ChemAxon smiles C(C1=CC=CO1)C1=CC=CO1 ChemAxon formula C9H8O2 ChemAxon inchi InChI=1S/C9H8O2/c1-3-8(10-5-1)7-9-4-2-6-11-9/h1-6H,7H2 ChemAxon inchikey YHGNXEIQSHICNK-UHFFFAOYSA-N ChemAxon polar_surface_area 26.28 ChemAxon refractivity 40.84 ChemAxon polarizability 15.33 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 0 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 25741 Specdb::CMs 134186 Specdb::CMs 141920 Specdb::MsIr 5828 Specdb::MsIr 5829 Specdb::MsMs 323059 Specdb::MsMs 323060 Specdb::MsMs 323061 Specdb::MsMs 371128 Specdb::MsMs 371129 Specdb::MsMs 371130 Specdb::MsMs 2318855 Specdb::MsMs 2318856 Specdb::MsMs 2318857 Specdb::MsMs 2617340 Specdb::MsMs 2617341 Specdb::MsMs 2617342 HMDB32947 #<Reference:0x000055ce31d6f9e8> Arabica coffee Type 1 specific Coffea arabica 13443 Coffee and coffee products Unknown generic Robusta coffee Type 1 specific Coffea canephora 49390