1.0 2010-04-08 22:09:23 UTC 2015-07-20 22:37:01 UTC FDB010968 2,3-Diphenylpyrazine 2,3-Diphenylpyrazine is a food flavorant. C16H12N2 232.2799 232.100048394 2,3-diphenylpyrazine 2,3-diphenylpyrazine 1588-89-2 C1=CC=C(C=C1)C1=C(N=CC=N1)C1=CC=CC=C1 InChI=1S/C16H12N2/c1-3-7-13(8-4-1)15-16(18-12-11-17-15)14-9-5-2-6-10-14/h1-12H PTZIVVDMBCVSMR-UHFFFAOYSA-N belongs to the class of organic compounds known as pyrazines. Pyrazines are compounds containing a pyrazine ring, which is a six-member aromatic heterocycle, that consists of two nitrogen atoms (at positions 1 and 4) and four carbon atoms. Pyrazines Organic compounds Organoheterocyclic compounds Diazines Pyrazines Aromatic heteromonocyclic compounds Azacyclic compounds Benzene and substituted derivatives Heteroaromatic compounds Hydrocarbon derivatives Organonitrogen compounds Organopnictogen compounds Aromatic heteromonocyclic compound Azacycle Benzenoid Heteroaromatic compound Hydrocarbon derivative Monocyclic benzene moiety Organic nitrogen compound Organonitrogen compound Organopnictogen compound Pyrazine logp 3.38 ALOGPS logs -4.06 ALOGPS solubility 2.02e-02 g/l ALOGPS logp 3.6 ChemAxon pka_strongest_basic 0.49 ChemAxon iupac 2,3-diphenylpyrazine ChemAxon average_mass 232.2799 ChemAxon mono_mass 232.100048394 ChemAxon smiles C1=CC=C(C=C1)C1=C(N=CC=N1)C1=CC=CC=C1 ChemAxon formula C16H12N2 ChemAxon inchi InChI=1S/C16H12N2/c1-3-7-13(8-4-1)15-16(18-12-11-17-15)14-9-5-2-6-10-14/h1-12H ChemAxon inchikey PTZIVVDMBCVSMR-UHFFFAOYSA-N ChemAxon polar_surface_area 25.78 ChemAxon refractivity 71.27 ChemAxon polarizability 25.13 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 24706 Specdb::CMs 167756 Specdb::MsMs 93924 Specdb::MsMs 93925 Specdb::MsMs 93926 Specdb::MsMs 157797 Specdb::MsMs 157798 Specdb::MsMs 157799 Specdb::MsMs 2712029 Specdb::MsMs 2712030 Specdb::MsMs 2712031 Specdb::MsMs 2996759 Specdb::MsMs 2996760 Specdb::MsMs 2996761 HMDB32981 #<Reference:0x000055ce329b0248>