1.0 2010-04-08 22:09:25 UTC 2025-11-18 23:24:01 UTC FDB011025 (R)-3,7-Dimethyl-5-indanecarboxylic acid Constituent of Curcuma zedoaria (zedoary). C12H14O2 190.2384 190.099379692 3,7-dimethyl-2,3-dihydro-1H-indene-5-carboxylic acid 3,7-dimethyl-2,3-dihydro-1H-indene-5-carboxylic acid 217802-61-4 CC1CCC2=C1C=C(C=C2C)C(O)=O InChI=1S/C12H14O2/c1-7-3-4-10-8(2)5-9(12(13)14)6-11(7)10/h5-7H,3-4H2,1-2H3,(H,13,14) YGZDWJVKOQPZDX-UHFFFAOYSA-N belongs to the class of organic compounds known as indanes. Indanes are compounds containing an indane moiety, which consists of a cyclopentane fused to a benzene ring. Indanes Organic compounds Benzenoids Indanes Aromatic homopolycyclic compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organooxygen compounds Aromatic homopolycyclic compound Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Indane Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound logp 2.88 ALOGPS logs -3.25 ALOGPS solubility 1.08e-01 g/l ALOGPS melting_point Mp 153-155° logp 3.44 ChemAxon pka_strongest_acidic 4.24 ChemAxon iupac 3,7-dimethyl-2,3-dihydro-1H-indene-5-carboxylic acid ChemAxon average_mass 190.2384 ChemAxon mono_mass 190.099379692 ChemAxon smiles CC1CCC2=C1C=C(C=C2C)C(O)=O ChemAxon formula C12H14O2 ChemAxon inchi InChI=1S/C12H14O2/c1-7-3-4-10-8(2)5-9(12(13)14)6-11(7)10/h5-7H,3-4H2,1-2H3,(H,13,14) ChemAxon inchikey YGZDWJVKOQPZDX-UHFFFAOYSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 55.79 ChemAxon polarizability 21.34 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 5905 Specdb::MsIr 5906 Specdb::MsIr 5907 Specdb::CMs 22032 Specdb::CMs 43068 Specdb::CMs 163435 Specdb::MsMs 101475 Specdb::MsMs 101476 Specdb::MsMs 101477 Specdb::MsMs 167109 Specdb::MsMs 167110 Specdb::MsMs 167111 Specdb::MsMs 2397324 Specdb::MsMs 2397325 Specdb::MsMs 2397326 Specdb::MsMs 2540999 Specdb::MsMs 2541000 Specdb::MsMs 2541001 HMDB33033 #<Reference:0x000055ce31eb5578>