1.0 2010-04-08 22:09:33 UTC 2019-11-26 03:04:44 UTC FDB011258 o-Coumaric acid Coumaric acid is a hydroxycinnamic acid, an organic compound that is a hydroxy derivative of cinnamic acid. There are three isomers, o-coumaric acid, m-coumaric acid, and p-coumaric acid, that differ by the position of the hydroxy substitution of the phenyl group. p-Coumaric acid is the most abundant isomer of the three in nature. o-Coumaric acid is found in many foods, some of which are common wheat, date, bilberry, and corn. (2e)-3-(2-Hydroxyphenyl)-2-propenoate (2e)-3-(2-HYDROXYPHENYL)acrylate (e)-2-Hydroxycinnamate (e)-3-(2-Hydroxy-phenyl)-acrylate (e)-3-(2-Hydroxy-phenyl)-acrylic acid (e)-3-(2-Hydroxyphenyl)-2-propenoate (e)-O-Hydroxycinnamate 2-Coumarate 2-Coumaric acid 2-Hydroxycinnamate 2-Hydroxycinnamic acid 3-(2-Hydroxyphenyl)-2-propenoic acid 3-(2-Hydroxyphenyl)acrylic acid 3-(2-Hydroxyphenyl)prop-2-enoate 3-(2-Hydroxyphenyl)prop-2-enoic acid o-Coumarate o-Coumaric acid o-Cumaric acid o-Hydroxycinnamate O-Hydroxycinnamic acid o-Hydroxycinnamic acid, 8CI ortho-Hydroxycinnamate ortho-Hydroxycinnamic acid trans-O-Coumaric acid C9H8O3 164.158 164.047344122 (2E)-3-(2-hydroxyphenyl)prop-2-enoic acid O-coumaric acid 583-17-5 OC(=O)\C=C\C1=CC=CC=C1O InChI=1S/C9H8O3/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-6,10H,(H,11,12)/b6-5+ PMOWTIHVNWZYFI-AATRIKPKSA-N belongs to the class of organic compounds known as hydroxycinnamic acids. Hydroxycinnamic acids are compounds containing an cinnamic acid where the benzene ring is hydroxylated. Hydroxycinnamic acids Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Carbonyl compounds Carboxylic acids Cinnamic acids Coumaric acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Styrenes 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Cinnamic acid Coumaric acid Coumaric acid or derivatives Hydrocarbon derivative Hydroxycinnamic acid Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol Styrene 2-coumaric acid Monolignols phenols Solid logp 1.90 ALOGPS logs -2.15 ALOGPS solubility 1.15e+00 g/l ALOGPS logp 1.83 ChemAxon pka_strongest_acidic 4.04 ChemAxon pka_strongest_basic -6 ChemAxon iupac (2E)-3-(2-hydroxyphenyl)prop-2-enoic acid ChemAxon average_mass 164.158 ChemAxon mono_mass 164.047344122 ChemAxon smiles OC(=O)\C=C\C1=CC=CC=C1O ChemAxon formula C9H8O3 ChemAxon inchi InChI=1S/C9H8O3/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-6,10H,(H,11,12)/b6-5+ ChemAxon inchikey PMOWTIHVNWZYFI-AATRIKPKSA-N ChemAxon polar_surface_area 57.53 ChemAxon refractivity 45.04 ChemAxon polarizability 16.11 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrOneD 3928 Specdb::NmrOneD 4207 Specdb::MsIr 1806 Specdb::MsIr 1807 Specdb::MsIr 1808 Specdb::EiMs 1657 Specdb::CMs 884 Specdb::CMs 885 Specdb::CMs 886 Specdb::CMs 1483 Specdb::CMs 5775 Specdb::CMs 29926 Specdb::CMs 30244 Specdb::CMs 30891 Specdb::CMs 30892 Specdb::CMs 31422 Specdb::CMs 31834 Specdb::CMs 38449 Specdb::CMs 146277 Specdb::MsMs 6475 Specdb::MsMs 6476 Specdb::MsMs 6477 Specdb::MsMs 6478 Specdb::MsMs 6479 Specdb::MsMs 6483 Specdb::MsMs 6484 Specdb::MsMs 240529 Specdb::MsMs 240530 Specdb::MsMs 240531 Specdb::MsMs 242584 Specdb::MsMs 242585 Specdb::MsMs 242586 Specdb::MsMs 437426 Specdb::MsMs 437427 Specdb::MsMs 437428 Specdb::MsMs 437429 Specdb::MsMs 437430 Specdb::MsMs 439095 Specdb::MsMs 439699 Specdb::MsMs 439700 Specdb::MsMs 448051 Specdb::MsMs 2229164 Specdb::MsMs 2349275 Specdb::MsMs 2349276 HMDB02641 2HC #<Reference:0x000055ce31783cc8> American cranberry Type 1 specific Vaccinium macrocarpon 13750 4.45 8.899999619 0.0 mg/100 g Apple Type 1 specific Malus pumila 283210 0.735 2.204999983 0.0 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 Beer Type 2 specific 0.218845 0.469 0.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 Blackcurrant Type 1 specific Ribes nigrum 78511 Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.0 0.0 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 Common pea Type 1 specific Pisum sativum 3888 Common wheat Type 1 specific Triticum aestivum 4565 0.375 0.75 0.0 mg/100 g Corn Type 1 specific Zea mays 4577 27.653013 27.65301315 27.65301315 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 1.688333 2.876666665 0.500000012 mg/100 g Evening primrose Type 1 specific Oenothera biennis 3942 Fennel Type 1 specific Foeniculum vulgare 48038 4.18 4.179999828 4.179999828 mg/100 g Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 0.0 0.0 0.0 mg/100 g German camomile Type 1 specific Matricaria recutita 127986 Grape wine Type 2 specific 0.019833 0.033333333 0.0 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 17.713 17.713000139 17.713000139 mg/100 g Olive Type 1 specific Olea europaea 4146 14.375 38.0 0.5 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 1.0 1.0 1.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 3.2175 18.275 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.017462 0.017461538 0.017461538 mg/100 g Red raspberry Type 1 specific Rubus idaeus 32247 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 0.0 0.0 0.0 mg/100 g Rye bread Type 2 specific 0.0 0.0 0.0 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 Soy bean Type 1 specific Glycine max 3847 Strawberry Type 1 specific Fragaria X ananassa 3747 0.0 0.0 0.0 mg/100 g Sweet cherry Type 1 specific Prunus avium 42229 Turmeric Type 1 specific Curcuma longa 136217 Allelopathic 42 Anti bacterial 145 A substance that kills or slows the growth of bacteria. Anti-oxidant 502 A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. In European countries, E-numbers for permitted antioxidant food additives are from E 300 to E 324. Fungicide 940 A substance used to destroy fungal pests. Pesticide 1210 Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests.