1.0 2010-04-08 22:09:38 UTC 2025-11-18 23:27:18 UTC FDB011419 Ammonium benzoate Preservative Ammonium benzoate Benzoic acid, ammonium salt Vulnoc AB C7H9NO2 139.1519 139.063328537 ammonium benzoate ammonium benzoate 1863-63-4 [NH4+].[O-]C(=O)C1=CC=CC=C1 InChI=1S/C7H6O2.H3N/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H,8,9);1H3 VWSRWGFGAAKTQG-UHFFFAOYSA-N belongs to the class of organic compounds known as benzoic acids. These are organic Compounds containing a benzene ring which bears at least one carboxyl group. Benzoic acids Organic compounds Benzenoids Benzene and substituted derivatives Benzoic acids and derivatives Aromatic homomonocyclic compounds Benzoyl derivatives Carboxylic acid salts Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic nitrogen compounds Organic oxides Organic salts Organooxygen compounds Aromatic homomonocyclic compound Benzoic acid Benzoyl Carboxylic acid Carboxylic acid derivative Carboxylic acid salt Hydrocarbon derivative Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organic salt Organooxygen compound logp 1.12 ALOGPS logs -1.05 ALOGPS solubility 1.24e+01 g/l ALOGPS melting_point Mp 198° logp 1.63 ChemAxon pka_strongest_acidic 4.08 ChemAxon iupac ammonium benzoate ChemAxon average_mass 139.1519 ChemAxon mono_mass 139.063328537 ChemAxon smiles [NH4+].[O-]C(=O)C1=CC=CC=C1 ChemAxon formula C7H9NO2 ChemAxon inchi InChI=1S/C7H6O2.H3N/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H,8,9);1H3 ChemAxon inchikey VWSRWGFGAAKTQG-UHFFFAOYSA-N ChemAxon polar_surface_area 40.13 ChemAxon refractivity 44.15 ChemAxon polarizability 11.52 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 19671 Specdb::MsMs 76272 Specdb::MsMs 76273 Specdb::MsMs 76274 Specdb::MsMs 136071 Specdb::MsMs 136072 Specdb::MsMs 136073 HMDB33388