1.0 2010-04-08 22:09:41 UTC 2019-11-26 03:05:01 UTC FDB011505 Subaphylline Alkaloid from Ananas comosus (pineapple). Subaphylline is found in many foods, some of which are pineapple, sweet orange, corn, and fruits. 4-Oxy-3-methoxycinnamylputrescine Cinnamamide, N-(4-aminobutyl)-4-hydroxy-3-methoxy- Feruloylputrescine N-(4-Aminobutyl)-4-hydroxy-3-methoxy-cinnamamide N-(4-Aminobutyl)-4-hydroxy-3-methoxycinnamamide N-(4-Hydroxy-3-methoxycinnamoyl)-1,4-butanediamine N-feruloylputrescine Subaphyllin Trans-n-feruloylputrescine C14H20N2O3 264.3202 264.147392516 (2Z)-N-(4-aminobutyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide (2Z)-N-(4-aminobutyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide 501-13-3 COC1=C(O)C=CC(\C=C/C(=O)NCCCCN)=C1 InChI=1S/C14H20N2O3/c1-19-13-10-11(4-6-12(13)17)5-7-14(18)16-9-3-2-8-15/h4-7,10,17H,2-3,8-9,15H2,1H3,(H,16,18)/b7-5- SFUVCMKSYKHYLD-ALCCZGGFSA-N belongs to the class of organic compounds known as hydroxycinnamic acids and derivatives. Hydroxycinnamic acids and derivatives are compounds containing an cinnamic acid (or a derivative thereof) where the benzene ring is hydroxylated. Hydroxycinnamic acids and derivatives Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Alkyl aryl ethers Amino acids and derivatives Anisoles Carbonyl compounds Cinnamic acid amides Hydrocarbon derivatives Methoxybenzenes Methoxyphenols Monoalkylamines Organic oxides Organopnictogen compounds Phenoxy compounds Secondary carboxylic acid amides Styrenes 1-hydroxy-2-unsubstituted benzenoid Alkyl aryl ether Amine Amino acid or derivatives Anisole Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxamide group Carboxylic acid derivative Cinnamic acid amide Ether Hydrocarbon derivative Hydroxycinnamic acid or derivatives Methoxybenzene Methoxyphenol Monocyclic benzene moiety Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenol Phenol ether Phenoxy compound Primary aliphatic amine Primary amine Secondary carboxylic acid amide Styrene logp 0.90 ALOGPS logs -2.96 ALOGPS solubility 2.89e-01 g/l ALOGPS melting_point Mp 171.5-172° logp 0.31 ChemAxon pka_strongest_acidic 9.6 ChemAxon pka_strongest_basic 10.2 ChemAxon iupac (2Z)-N-(4-aminobutyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide ChemAxon average_mass 264.3202 ChemAxon mono_mass 264.147392516 ChemAxon smiles COC1=C(O)C=CC(\C=C/C(=O)NCCCCN)=C1 ChemAxon formula C14H20N2O3 ChemAxon inchi InChI=1S/C14H20N2O3/c1-19-13-10-11(4-6-12(13)17)5-7-14(18)16-9-3-2-8-15/h4-7,10,17H,2-3,8-9,15H2,1H3,(H,16,18)/b7-5- ChemAxon inchikey SFUVCMKSYKHYLD-ALCCZGGFSA-N ChemAxon polar_surface_area 84.58 ChemAxon refractivity 75.68 ChemAxon polarizability 28.91 ChemAxon rotatable_bond_count 7 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 20435 Specdb::CMs 43307 Specdb::CMs 137297 Specdb::CMs 145031 Specdb::MsMs 55359 Specdb::MsMs 55360 Specdb::MsMs 55361 Specdb::MsMs 110493 Specdb::MsMs 110494 Specdb::MsMs 110495 Specdb::MsMs 2775578 Specdb::MsMs 2775579 Specdb::MsMs 2775580 Specdb::MsMs 2905752 Specdb::MsMs 2905753 Specdb::MsMs 2905754 HMDB33463 #<Reference:0x000055ce324d3ae0> Avocado Type 1 specific Persea americana 3435 Corn Type 1 specific Zea mays 4577 Fruits Unknown generic Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 Pineapple Type 1 specific Ananas comosus 4615 Potato Type 1 specific Solanum tuberosum 4113 Sweet orange Type 1 specific Citrus sinensis 2711 0.25 0.25 0.25 mg/100 g Anti-viral 689 A substance that destroys or inhibits replication of viruses. Hypotensive 1021 Pesticide 1210 Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests.