1.0 2010-04-08 22:09:45 UTC 2025-11-18 23:29:57 UTC FDB011656 cis-o-Coumaric acid 2-glucoside Isolated from Melilotus alba (white melilot). cis-o-Coumaric acid 2-glucoside is found in herbs and spices and pulses. (Z)-3-(2-Hydroxyphenyl)-2-propenoic acid O-b-D-glucopyranoside (Z)-o-Coumaric acid O-b-D-glucopyranoside cis-o-Coumaric acid 2-glucoside cis-o-Coumaric acid glucoside cis-o-Coumaric acid O-b-D-glucopyranoside C15H18O8 326.2986 326.100167552 (2E)-3-(2-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)prop-2-enoic acid melilotoside 617-45-8 OCC1OC(OC2=C(\C=C\C(O)=O)C=CC=C2)C(O)C(O)C1O InChI=1S/C15H18O8/c16-7-10-12(19)13(20)14(21)15(23-10)22-9-4-2-1-3-8(9)5-6-11(17)18/h1-6,10,12-16,19-21H,7H2,(H,17,18)/b6-5+ GVRIYIMNJGULCZ-AATRIKPKSA-N belongs to the class of organic compounds known as phenolic glycosides. These are organic compounds containing a phenolic structure attached to a glycosyl moiety. Some examples of phenolic structures include lignans, and flavonoids. Among the sugar units found in natural glycosides are D-glucose, L-Fructose, and L rhamnose. Phenolic glycosides Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aromatic heteromonocyclic compounds Acetals Carbonyl compounds Carboxylic acids Cinnamic acids Coumaric acids Hexoses Hydrocarbon derivatives Monocarboxylic acids and derivatives O-glycosyl compounds Organic oxides Oxacyclic compounds Oxanes Phenol ethers Phenoxy compounds Polyols Primary alcohols Secondary alcohols Styrenes Acetal Alcohol Aromatic heteromonocyclic compound Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Cinnamic acid Cinnamic acid or derivatives Coumaric acid Coumaric acid or derivatives Hexose monosaccharide Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety Monosaccharide O-glycosyl compound Organic oxide Organoheterocyclic compound Oxacycle Oxane Phenol ether Phenolic glycoside Phenoxy compound Polyol Primary alcohol Secondary alcohol Styrene logp -0.70 ALOGPS logs -1.69 ALOGPS solubility 6.60e+00 g/l ALOGPS logp -0.44 ChemAxon pka_strongest_acidic 3.7 ChemAxon pka_strongest_basic -3 ChemAxon iupac (2E)-3-(2-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}phenyl)prop-2-enoic acid ChemAxon average_mass 326.2986 ChemAxon mono_mass 326.100167552 ChemAxon smiles OCC1OC(OC2=C(\C=C\C(O)=O)C=CC=C2)C(O)C(O)C1O ChemAxon formula C15H18O8 ChemAxon inchi InChI=1S/C15H18O8/c16-7-10-12(19)13(20)14(21)15(23-10)22-9-4-2-1-3-8(9)5-6-11(17)18/h1-6,10,12-16,19-21H,7H2,(H,17,18)/b6-5+ ChemAxon inchikey GVRIYIMNJGULCZ-AATRIKPKSA-N ChemAxon polar_surface_area 136.68 ChemAxon refractivity 77.19 ChemAxon polarizability 31.19 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 8 ChemAxon donor_count 5 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 15807 Specdb::CMs 43365 Specdb::MsMs 104748 Specdb::MsMs 104749 Specdb::MsMs 104750 Specdb::MsMs 171084 Specdb::MsMs 171085 Specdb::MsMs 171086 Specdb::MsMs 3605242 Specdb::MsMs 3605243 Specdb::MsMs 3605244 Specdb::MsMs 3606170 Specdb::MsMs 3606171 Specdb::MsMs 3606172 HMDB0033581 Herbs and Spices Unknown generic Pulses Unknown generic