1.0 2010-04-08 22:09:52 UTC 2019-11-26 03:05:38 UTC FDB011875 L-trans-3-Hydroxy-2-pyrrolidinecarboxylic acid Constituent of collagen. L-trans-3-Hydroxy-2-pyrrolidinecarboxylic acid is found in animal foods. 2-Naphthalenesulfonamide, N-(4-aminobutyl)- 3-Hydroxy-2-pyrrolidinecarboxylic acid; L-trans-form Procollagen trans-3-hydroxy-L-proline C5H9NO3 131.1299 131.058243159 3-hydroxypyrrolidine-2-carboxylic acid 3-hydroxypyrrolidine-2-carboxylic acid 4298-08-2 OC1CCNC1C(O)=O InChI=1S/C5H9NO3/c7-3-1-2-6-4(3)5(8)9/h3-4,6-7H,1-2H2,(H,8,9) BJBUEDPLEOHJGE-UHFFFAOYSA-N belongs to the class of organic compounds known as proline and derivatives. Proline and derivatives are compounds containing proline or a derivative thereof resulting from reaction of proline at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Proline and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic heteromonocyclic compounds Alpha amino acids Amino acids Azacyclic compounds Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Dialkylamines Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Pyrrolidine carboxylic acids Secondary alcohols Alcohol Aliphatic heteromonocyclic compound Alpha-amino acid Amine Amino acid Azacycle Beta-hydroxy acid Carbonyl group Carboxylic acid Hydrocarbon derivative Hydroxy acid Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Proline or derivatives Pyrrolidine Pyrrolidine carboxylic acid Pyrrolidine carboxylic acid or derivatives Secondary alcohol Secondary aliphatic amine Secondary amine monohydroxyproline Solid logp -3.18 ALOGPS logs 0.52 ALOGPS solubility 4.31e+02 g/l ALOGPS melting_point Mp 230-236° (dec.) (232°) logp -3.7 ChemAxon pka_strongest_acidic 1.61 ChemAxon pka_strongest_basic 10.62 ChemAxon iupac 3-hydroxypyrrolidine-2-carboxylic acid ChemAxon average_mass 131.1299 ChemAxon mono_mass 131.058243159 ChemAxon smiles OC1CCNC1C(O)=O ChemAxon formula C5H9NO3 ChemAxon inchi InChI=1S/C5H9NO3/c7-3-1-2-6-4(3)5(8)9/h3-4,6-7H,1-2H2,(H,8,9) ChemAxon inchikey BJBUEDPLEOHJGE-UHFFFAOYSA-N ChemAxon polar_surface_area 69.56 ChemAxon refractivity 29.38 ChemAxon polarizability 12.35 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon HMDB02113