1.0 2010-04-08 22:09:57 UTC 2025-11-18 23:33:04 UTC FDB012013 Eudesmic acid Isolated from eucalyptus oil etc. Eudesmic acid is found in olive. 3,4,5-Trimethoxy-benzoic acid 3,4,5-Trimethoxybenzoic acid 5-Methoxy-veratrate 5-Methoxy-veratric acid Benzoic acid, 3,4,5-trimethoxy- Eudesmate Eudesmic acid Gallate trimethyl ether Gallic acid trimethyl ether Tri-O-methylgallate Tri-o-methylgallic acid Trimethylgallate Trimethylgallic acid Veratric acid, 5-methoxy- C10H12O5 212.1993 212.068473494 3,4,5-trimethoxybenzoic acid 3,4,5-trimethoxybenzoic acid 118-41-2 COC1=CC(=CC(OC)=C1OC)C(O)=O InChI=1S/C10H12O5/c1-13-7-4-6(10(11)12)5-8(14-2)9(7)15-3/h4-5H,1-3H3,(H,11,12) SJSOFNCYXJUNBT-UHFFFAOYSA-N belongs to the class of organic compounds known as gallic acid and derivatives. Gallic acid and derivatives are compounds containing a 3,4,5-trihydroxybenzoic acid moiety. Gallic acid and derivatives Organic compounds Benzenoids Benzene and substituted derivatives Benzoic acids and derivatives Aromatic homomonocyclic compounds Alkyl aryl ethers Anisoles Benzoic acids Benzoyl derivatives Carboxylic acids Hydrocarbon derivatives M-methoxybenzoic acids and derivatives Methoxybenzenes Monocarboxylic acids and derivatives Organic oxides P-methoxybenzoic acids and derivatives Phenoxy compounds Alkyl aryl ether Anisole Aromatic homomonocyclic compound Benzoic acid Benzoyl Carboxylic acid Carboxylic acid derivative Ether Gallic acid or derivatives Hydrocarbon derivative M-methoxybenzoic acid or derivatives Methoxybenzene Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound P-methoxybenzoic acid or derivatives Phenol ether Phenoxy compound benzoic acids methoxybenzene logp 1.34 ALOGPS logs -2.01 ALOGPS solubility 2.07e+00 g/l ALOGPS melting_point Mp 171-172° logp 1.16 ChemAxon pka_strongest_acidic 3.92 ChemAxon pka_strongest_basic -4.5 ChemAxon iupac 3,4,5-trimethoxybenzoic acid ChemAxon average_mass 212.1993 ChemAxon mono_mass 212.068473494 ChemAxon smiles COC1=CC(=CC(OC)=C1OC)C(O)=O ChemAxon formula C10H12O5 ChemAxon inchi InChI=1S/C10H12O5/c1-13-7-4-6(10(11)12)5-8(14-2)9(7)15-3/h4-5H,1-3H3,(H,11,12) ChemAxon inchikey SJSOFNCYXJUNBT-UHFFFAOYSA-N ChemAxon polar_surface_area 64.99 ChemAxon refractivity 52.7 ChemAxon polarizability 20.79 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 5 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 16640 Specdb::CMs 29821 Specdb::CMs 43532 Specdb::CMs 101422 Specdb::CMs 146397 Specdb::MsMs 7487 Specdb::MsMs 7488 Specdb::MsMs 7489 Specdb::MsMs 14159 Specdb::MsMs 14160 Specdb::MsMs 14161 Specdb::MsMs 374643 Specdb::MsMs 451272 Specdb::MsMs 2753287 Specdb::MsMs 2753288 Specdb::MsMs 2753289 Specdb::MsMs 2952105 Specdb::MsMs 2952106 Specdb::MsMs 2952107 HMDB33839 #<Reference:0x000055ce322af048> Olive Type 1 specific Olea europaea 4146