1.0 2010-04-08 22:09:57 UTC 2025-11-18 23:33:08 UTC FDB012022 Geraldone Geraldone, also known as 5-deoxychrysoeriol or 7,4'-dihydroxy-3'-methoxyflavone, is a member of the class of compounds known as 3'-o-methylated flavonoids. 3'-o-methylated flavonoids are flavonoids with methoxy groups attached to the C3' atom of the flavonoid backbone. Thus, geraldone is considered to be a flavonoid lipid molecule. Geraldone is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Geraldone can be found in broad bean, which makes geraldone a potential biomarker for the consumption of this food product. 4',7-Dihydroxy-3'-methoxyflavone 5-Deoxychrysoeriol Geraldone C16H12O5 284.2635 284.068473494 7-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one geraldone 21583-32-4 COC1=C(O)C=CC(=C1)C1=CC(=O)C2=C(O1)C=C(O)C=C2 InChI=1S/C16H12O5/c1-20-16-6-9(2-5-12(16)18)14-8-13(19)11-4-3-10(17)7-15(11)21-14/h2-8,17-18H,1H3 OUMMPAFEQHTYIZ-UHFFFAOYSA-N belongs to the class of organic compounds known as 3'-o-methylated flavonoids. These are flavonoids with methoxy groups attached to the C3' atom of the flavonoid backbone. 3'-O-methylated flavonoids Organic compounds Phenylpropanoids and polyketides Flavonoids O-methylated flavonoids Aromatic heteropolycyclic compounds 1-hydroxy-2-unsubstituted benzenoids 4'-hydroxyflavonoids 7-hydroxyflavonoids Alkyl aryl ethers Anisoles Chromones Flavones Heteroaromatic compounds Hydrocarbon derivatives Methoxybenzenes Methoxyphenols Organic oxides Oxacyclic compounds Phenoxy compounds Pyranones and derivatives 1-benzopyran 1-hydroxy-2-unsubstituted benzenoid 3p-methoxyflavonoid-skeleton 4'-hydroxyflavonoid 7-hydroxyflavonoid Alkyl aryl ether Anisole Aromatic heteropolycyclic compound Benzenoid Benzopyran Chromone Ether Flavone Heteroaromatic compound Hydrocarbon derivative Hydroxyflavonoid Methoxybenzene Methoxyphenol Monocyclic benzene moiety Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Phenol Phenol ether Phenoxy compound Pyran Pyranone Flavones and Flavonols Flavones and Flavonols dihydroxyflavone flavones monomethoxyflavone logp 3.37 ALOGPS logs -3.72 ALOGPS solubility 5.38e-02 g/l ALOGPS melting_point Mp 293-294° dec. logp 2.2 ChemAxon pka_strongest_acidic 6.51 ChemAxon pka_strongest_basic -4.8 ChemAxon iupac 7-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one ChemAxon average_mass 284.2635 ChemAxon mono_mass 284.068473494 ChemAxon smiles COC1=C(O)C=CC(=C1)C1=CC(=O)C2=C(O1)C=C(O)C=C2 ChemAxon formula C16H12O5 ChemAxon inchi InChI=1S/C16H12O5/c1-20-16-6-9(2-5-12(16)18)14-8-13(19)11-4-3-10(17)7-15(11)21-14/h2-8,17-18H,1H3 ChemAxon inchikey OUMMPAFEQHTYIZ-UHFFFAOYSA-N ChemAxon polar_surface_area 75.99 ChemAxon refractivity 77.4 ChemAxon polarizability 28.88 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 5 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 5731 Specdb::CMs 55089 Specdb::CMs 134722 Specdb::CMs 142456 Specdb::MsMs 45144 Specdb::MsMs 45145 Specdb::MsMs 45146 Specdb::MsMs 120261 Specdb::MsMs 120262 Specdb::MsMs 120263 Specdb::MsMs 2340186 Specdb::MsMs 2340187 Specdb::MsMs 2340188 Specdb::MsMs 2624966 Specdb::MsMs 2624967 Specdb::MsMs 2624968 Broad bean Type 1 specific Vicia faba 3906 0.1855 0.301 0.070000002 mg/100 g