1.0 2010-04-08 22:09:57 UTC 2019-11-26 03:05:59 UTC FDB012026 Methyl decanoate Constituent of many plants. Capric acid methyl ester Decanoic acid methyl ester Decanoic acid, methyl ester Decanoic acid,methyl ester Metholene 2095 Methyl caprate Methyl caprinate Methyl decanoate Methyl n-caprate Methyl n-decanoate Methyl-n-caprate N-capric acid methyl ester Uniphat A30 C11H22O2 186.2912 186.161979948 methyl decanoate methyl decanoate 110-42-9 CCCCCCCCCC(=O)OC InChI=1S/C11H22O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h3-10H2,1-2H3 YRHYCMZPEVDGFQ-UHFFFAOYSA-N belongs to the class of organic compounds known as fatty acid methyl esters. Fatty acid methyl esters are compounds containing a fatty acid that is esterified with a methyl group. They have the general structure RC(=O)OR', where R=fatty aliphatic tail or organyl group and R'=methyl group. Fatty acid methyl esters Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acid esters Aliphatic acyclic compounds Carbonyl compounds Hydrocarbon derivatives Methyl esters Monocarboxylic acids and derivatives Organic oxides Aliphatic acyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Fatty acid methyl ester Hydrocarbon derivative Methyl ester Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Wax monoesters Liquid logp 4.58 ALOGPS logs -4.00 ALOGPS solubility 1.86e-02 g/l ALOGPS melting_point -18 oC logp 3.74 ChemAxon pka_strongest_basic -7 ChemAxon iupac methyl decanoate ChemAxon average_mass 186.2912 ChemAxon mono_mass 186.161979948 ChemAxon smiles CCCCCCCCCC(=O)OC ChemAxon formula C11H22O2 ChemAxon inchi InChI=1S/C11H22O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h3-10H2,1-2H3 ChemAxon inchikey YRHYCMZPEVDGFQ-UHFFFAOYSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 54.25 ChemAxon polarizability 23.64 ChemAxon rotatable_bond_count 9 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 6304 Specdb::MsIr 6305 Specdb::NmrOneD 4438 Specdb::NmrOneD 4556 Specdb::CMs 1038 Specdb::CMs 2364 Specdb::CMs 28192 Specdb::CMs 28220 Specdb::CMs 28242 Specdb::CMs 28692 Specdb::CMs 31634 Specdb::CMs 32310 Specdb::CMs 145805 Specdb::MsMs 9944 Specdb::MsMs 9945 Specdb::MsMs 9946 Specdb::MsMs 16616 Specdb::MsMs 16617 Specdb::MsMs 16618 Specdb::MsMs 2667187 Specdb::MsMs 2667188 Specdb::MsMs 2667189 Specdb::MsMs 3012200 Specdb::MsMs 3012201 Specdb::MsMs 3012202 HMDB33848 #<Reference:0x0000561271db6a58> Asian pear Type 1 specific Pyrus pyrifolia 3767 Blackberry Type 1 specific Rubus Evergreen blackberry Type 1 specific Rubus laciniatus Pear Type 1 specific Pyrus communis 23211 Prickly pear Type 1 specific Opuntia 106975 floral fruity oily wine