1.0 2010-04-08 22:09:57 UTC 2019-11-26 03:06:00 UTC FDB012027 Decanoic acid Widespread in plant oils and as glycerides in seed oilsand is also present in apple, apricot, banana, morello cherry, citrus fruits, cheese, butter, white wine, Japanese whiskey, peated malt, wort and scallops. It is used as a defoamer, lubricant and citrus fruit coating. Salts (Na, K, Mg, Ca, Al) used as binders, emulsifiers and anticaking agents in food manuf. Decanoic acid is found in many foods, some of which are radish (variety), meatball, phyllo dough, and american shad. 1-Decanoic acid 1-Nonanecarboxylate 1-Nonanecarboxylic acid 10:0 C10:0 Caprate Capric acid Caprinate Caprinic acid Caprynate Caprynic acid CH3-[CH2]8-COOH Decanoate Decoate Decoic acid Decoic acid (obsol.) Decylate Decylic acid Dekansaeure Emery 659 FEMA 2364 Kaprinsaeure Lunac 10-95 Lunac 10-98 N-Caprate N-Capric acid N-Decanoate N-Decanoic acid N-Decoate N-Decoic acid N-Decylate N-Decylic acid Nonane-1-carboxylic acid Prifac 2906 Prifac 296 C10H20O2 172.2646 172.146329884 decanoic acid capric acid 334-48-5 CCCCCCCCCC(O)=O InChI=1S/C10H20O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H,11,12) GHVNFZFCNZKVNT-UHFFFAOYSA-N belongs to the class of organic compounds known as medium-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 4 and 12 carbon atoms. Medium-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Straight chain fatty acids Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Medium-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Straight chain fatty acid Saturated fatty acids Straight chain fatty acids Straight chain fatty acids medium-chain fatty acid straight-chain saturated fatty acid Solid logp 3.93 ALOGPS logs -3.26 ALOGPS solubility 9.46e-02 g/l ALOGPS melting_point Mp 31.5° logp 3.59 ChemAxon pka_strongest_acidic 4.95 ChemAxon iupac decanoic acid ChemAxon average_mass 172.2646 ChemAxon mono_mass 172.146329884 ChemAxon smiles CCCCCCCCCC(O)=O ChemAxon formula C10H20O2 ChemAxon inchi InChI=1S/C10H20O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H,11,12) ChemAxon inchikey GHVNFZFCNZKVNT-UHFFFAOYSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 49.48 ChemAxon polarizability 21.61 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Beta Oxidation of Very Long Chain Fatty Acids SMP00052 map01040 Fatty Acid Biosynthesis SMP00456 Specdb::EiMs 760 Specdb::NmrTwoD 1346 Specdb::MsIr 584 Specdb::MsIr 585 Specdb::MsIr 586 Specdb::CMs 1154 Specdb::CMs 3395 Specdb::CMs 29472 Specdb::CMs 31157 Specdb::CMs 31992 Specdb::CMs 37583 Specdb::CMs 171526 Specdb::CMs 1064571 Specdb::NmrOneD 1402 Specdb::NmrOneD 3039 Specdb::NmrOneD 4934 Specdb::NmrOneD 4935 Specdb::NmrOneD 272578 Specdb::NmrOneD 272579 Specdb::NmrOneD 272580 Specdb::NmrOneD 272581 Specdb::NmrOneD 272582 Specdb::NmrOneD 272583 Specdb::NmrOneD 272584 Specdb::NmrOneD 272585 Specdb::NmrOneD 272586 Specdb::NmrOneD 272587 Specdb::NmrOneD 272588 Specdb::NmrOneD 272589 Specdb::NmrOneD 272590 Specdb::NmrOneD 272591 Specdb::NmrOneD 272592 Specdb::NmrOneD 272593 Specdb::NmrOneD 272594 Specdb::NmrOneD 272595 Specdb::NmrOneD 272596 Specdb::NmrOneD 272597 Specdb::MsMs 734 Specdb::MsMs 735 Specdb::MsMs 736 Specdb::MsMs 4137 Specdb::MsMs 4138 Specdb::MsMs 4139 Specdb::MsMs 4140 Specdb::MsMs 4141 Specdb::MsMs 4142 Specdb::MsMs 8105 Specdb::MsMs 8106 Specdb::MsMs 8107 Specdb::MsMs 14777 Specdb::MsMs 14778 Specdb::MsMs 14779 Specdb::MsMs 20363 Specdb::MsMs 20364 Specdb::MsMs 20365 Specdb::MsMs 21914 Specdb::MsMs 21915 Specdb::MsMs 21916 Specdb::MsMs 285576 Specdb::MsMs 285577 Specdb::MsMs 285578 Specdb::MsMs 373902 HMDB00511 30813 DKA #<Reference:0x000055ac40a92760> #<Reference:0x000055ac40a925a8> #<Reference:0x000055ac40a923f0> #<Reference:0x000055ac40a92238> #<Reference:0x000055ac40a92058> #<Reference:0x000055ac40a91e78> #<Reference:0x000055ac40a91c98> #<Reference:0x000055ac40a91ae0> #<Reference:0x000055ac40a91928> #<Reference:0x000055ac40a91770> #<Reference:0x000055ac40a91590> #<Reference:0x000055ac40a913d8> #<Reference:0x000055ac40a91220> #<Reference:0x000055ac40a91040> #<Reference:0x000055ac40a90e88> #<Reference:0x000055ac40a90cd0> #<Reference:0x000055ac40a90b18> Abalone Type 1 specific Haliotis 6452 0.0 0.0 0.0 mg/100 g Abiyuch Type 1 specific Crateva religiosa 202634 Acerola Type 1 specific Malpighia emarginata 151847 0.0 0.0 0.0 mg/100 g Acorn Type 1 specific Quercus 3511 Adobo Type 2 specific 2.0 2.0 2.0 mg/100 g Adzuki bean Type 1 specific Vigna angularis 3914 0.0 0.0 0.0 mg/100 g Agar Type 1 specific Eucheuma 31444 0.0 0.0 0.0 mg/100 g Agave Type 1 specific Agave 39509 Alaska blueberry Type 1 specific Vaccinium alaskaense 190544 Alaska pollock Type 1 specific Theragra chalcogramma 1042646 0.0 0.0 0.0 mg/100 g Alaska wild rhubarb Type 1 specific Polygonum alpinum 125586 Albacore tuna Type 1 specific Thunnus alalunga 8235 0.0 0.0 0.0 mg/100 g Alcoholic beverages Unknown generic Alfalfa Type 1 specific Medicago sativa 3879 0.0 0.0 0.0 mg/100 g Allium Type 1 specific Allium 4678 2.3 34.0 0.0 mg/100 g Allspice Type 1 specific Pimenta dioica 375272 0.0 0.0 0.0 mg/100 g Almond Type 1 specific Prunus dulcis 3755 0.0 0.0 0.0 mg/100 g Alpine sweetvetch Type 1 specific Hedysarum alpinum 57576 Amaranth Type 1 specific Amaranthus 3564 0.0 0.0 0.0 mg/100 g American butterfish Type 1 specific Peprilus triacanthus 183653 American cranberry Type 1 specific Vaccinium macrocarpon 13750 0.0 0.0 0.0 mg/100 g American lobster Type 1 specific Homarus americanus 6706 0.0 0.0 0.0 mg/100 g American pokeweed Type 1 specific Phytolacca americana 3527 0.0 0.0 0.0 mg/100 g American shad Type 1 specific Alosa sapidissima 34773 8.0 8.0 8.0 mg/100 g Anatidae Type 1 specific Anatidae 8830 0.0 0.0 0.0 mg/100 g Anchovy Type 1 specific Engraulidae 43062 0.0 0.0 0.0 mg/100 g Angelica Type 1 specific Angelica keiskei 357850 Anguilliformes Type 1 specific Anguilliformes 7933 0.0 0.0 0.0 mg/100 g Anise Type 1 specific Pimpinella anisum 271192 0.0 0.0 0.0 mg/100 g Annual wild rice Type 1 specific Zizania aquatica 75727 Apple Type 1 specific Malus pumila 283210 0.782609 18.0 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 0.0 0.0 0.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 14.315789 179.0 0.0 mg/100 g Arctic blackberry Type 1 specific Rubus arcticus 70741 Arepa Type 2 specific 112.0 112.0 112.0 mg/100 g Arrowhead Type 1 specific Sagittaria latifolia 15008 Arrowroot Type 1 specific Maranta arundinacea 210060 Asian pear Type 1 specific Pyrus pyrifolia 3767 0.0 0.0 0.0 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 0.0 0.0 0.0 mg/100 g Atlantic cod Type 1 specific Gadus morhua 8049 0.0 0.0 0.0 mg/100 g Atlantic croaker Type 1 specific Micropogonias undulatus 29154 0.0 0.0 0.0 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 0.0 0.0 0.0 mg/100 g Atlantic herring Type 1 specific Clupea harengus harengus 7950 1.0 5.0 0.0 mg/100 g Atlantic mackerel Type 1 specific Scomber scombrus 13677 0.0 0.0 0.0 mg/100 g Atlantic pollock Type 1 specific Pollachius pollachius 185739 0.0 0.0 0.0 mg/100 g Atlantic salmon Type 1 specific Salmo salar 8030 0.0 0.0 0.0 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 0.0 0.0 0.0 mg/100 g Avocado Type 1 specific Persea americana 3435 0.0 0.0 0.0 mg/100 g Babassu palm Type 1 specific Attalea speciosa 145700 5500.0 5500.0 5500.0 mg/100 g Baby food Type 2 specific 143.112583 5351.0 0.0 mg/100 g Bagel Type 2 specific 0.0 0.0 0.0 mg/100 g Baked beans Type 2 specific 3.833333 16.0 0.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.0 0.0 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 2.0 5.0 0.0 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 0.0 0.0 0.0 mg/100 g Bayberry Type 1 specific Myrica 3509 Bean Type 1 specific 2.875 16.0 0.0 mg/100 g Bearded seal Type 1 specific Erignathus barbatus 39304 0.0 0.0 0.0 mg/100 g Beech nut Type 1 specific Fagus 21024 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Beer Type 2 specific 0.591667 2.65 0.0 mg/100 g Beluga whale Type 1 specific Delphinapterus leucas 9749 40.0 120.0 0.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 0.0 0.0 0.0 mg/100 g Biscuit Type 2 specific 49.670588 697.0 0.0 mg/100 g Bison Type 1 specific Bison bison 9901 Bitter gourd Type 1 specific Momordica charantia 3673 0.0 0.0 0.0 mg/100 g Bivalvia (Clam, Mussel, Oyster) Type 1 specific Bivalvia 6544 0.0 0.0 0.0 mg/100 g Black cabbage Type 1 specific Brassica oleracea var. viridis 3713 0.0 0.0 0.0 mg/100 g Black chokeberry Type 1 specific Photinia melanocarpa 661339 Black crowberry Type 1 specific Empetrum nigrum 191066 Black elderberry Type 1 specific Sambucus nigra 4202 Black huckleberry Type 1 specific Gaylussacia baccata 128893 Black mulberry Type 1 specific Morus nigra 85232 0.0 0.0 0.0 mg/100 g Black radish Type 1 specific Raphanus sativus var. niger 41679 Black raspberry Type 1 specific Rubus occidentalis 75079 Black salsify Type 1 specific Scorzonera hispanica 114289 0.0 0.0 0.0 mg/100 g Black tea Type 1 0.0 0.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 0.0 0.0 0.0 mg/100 g Black-eyed pea Type 1 specific Vigna unguiculata ssp. unguiculata 3920 0.166667 1.0 0.0 mg/100 g Blackberry Type 1 specific Rubus Blackcurrant Type 1 specific Ribes nigrum 78511 0.0 0.0 0.0 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 0.0 0.0 0.0 mg/100 g Blue mussel Type 1 specific Mytilus edulis 6550 0.0 0.0 0.0 mg/100 g Blue whiting Type 1 specific Micromesistius poutassou 81636 0.0 0.0 0.0 mg/100 g Bluefish Type 1 specific Pomatomus saltatrix 75034 0.0 0.0 0.0 mg/100 g Bog bilberry Type 1 specific Vaccinium uliginosum 190548 Borage Type 1 specific Borago officinalis 13363 Boysenberry Type 1 specific Rubus ursinus X idaeus 0.0 0.0 0.0 mg/100 g Brassicas Unknown generic 3705 Brazil nut Type 1 specific Bertholletia excelsa 3645 0.0 0.0 0.0 mg/100 g Breadfruit Type 1 specific Artocarpus altilis 194251 0.0 0.0 0.0 mg/100 g Breadnut tree seed Type 1 specific Brosimum alicastrum 194253 0.0 0.0 0.0 mg/100 g Breakfast cereal Type 2 specific 11.922509 372.0 0.0 mg/100 g Breakfast sandwich Type 2 specific 80.571429 346.0 0.0 mg/100 g Broad bean Type 1 specific Vicia faba 3906 0.0 0.0 0.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 0.0 0.0 0.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 0.0 0.0 0.0 mg/100 g Buffalo Type 1 specific Bubalus bubalis 89462 Buffalo currant Type 1 specific Ribes aureum var. villosum 23283 Bulgur Type 2 specific 0.0 0.0 0.0 mg/100 g Burbot Type 1 specific Lota lota 69944 0.0 0.0 0.0 mg/100 g Burdock Type 1 specific Arctium lappa 4217 0.0 0.0 0.0 mg/100 g Burrito Type 2 specific 39.416667 105.0 0.0 mg/100 g Butter Type 2 specific 2097.428571 2630.0 1380.0 mg/100 g Butter substitute Type 2 specific 26.0 26.0 26.0 mg/100 g Butterfat Type 2 specific 2495.0 2495.0 2495.0 mg/100 g Buttermilk Type 2 specific 54.333333 145.0 16.0 mg/100 g Butternut Type 1 specific Juglans cinerea 91214 0.0 0.0 0.0 mg/100 g Butternut squash Type 1 specific Cucurbita moschata 3662 0.0 0.0 0.0 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 Cake Type 2 specific 29.938776 437.0 0.0 mg/100 g Calabash Type 1 specific Lagenaria siceraria 3668 Canada blueberry Type 1 specific Vaccinium myrtilloides 1503870 Candy bar Type 2 specific 283.875 1081.0 0.0 mg/100 g Canola Type 2 specific 138011 0.0 0.0 0.0 mg/100 g Capers Type 1 specific Capparis spinosa 65558 0.0 0.0 0.0 mg/100 g Caraway Type 1 specific Carum carvi 48032 10.25 10.5 10.0 mg/100 g Cardamom Type 1 specific Elettaria cardamomum 105181 0.0 0.0 0.0 mg/100 g Cardoon Type 1 specific Cynara cardunculus 4265 Carob Type 1 specific Ceratonia siliqua 20340 0.0 0.0 0.0 mg/100 g Carp bream Type 1 specific Abramis brama 38527 0.0 0.0 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 23.402778 421.25 0.0 mg/100 g Cascade huckleberry Type 1 specific Vaccinium deliciosum 190531 Casein Type 2 specific 46.0 46.0 46.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 87.315 140.0 15.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 0.0 0.0 0.0 mg/100 g Catfish Type 1 specific Siluriformes 7995 2.5 5.0 0.0 mg/100 g Catjang pea Type 1 specific Vigna unguiculata ssp. cylindrica 3840 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 15.118467 551.0 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 1.0 9.0 0.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 0.0 0.0 0.0 mg/100 g Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 0.0 0.0 0.0 mg/100 g Celery stalks Type 1 specific Apium graveolens var. dulce 117781 Cereals and cereal products Unknown generic Cetacea (Dolphin, Porpoise, Whale) Type 1 specific Cetacea 9721 0.0 0.0 0.0 mg/100 g Ceylon cinnamon Type 1 specific Cinnamomum verum 128608 Channel catfish Type 1 specific Ictalurus punctatus 7998 0.0 0.0 0.0 mg/100 g Chanterelle Type 1 specific Cantharellus cibarius 36066 0.0 0.0 0.0 mg/100 g Charr Type 1 specific Salvelinus 8033 0.0 0.0 0.0 mg/100 g Chayote Type 1 specific Sechium edule 184140 0.0 0.0 0.0 mg/100 g Cheese Type 2 specific 641.433824 3432.0 0.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 22.5 45.0 0.0 mg/100 g Cherry tomato Type 1 specific Solanum lycopersicum var. cerasiforme 195583 Chervil Type 1 specific Anthriscus cerefolium 40888 0.0 0.0 0.0 mg/100 g Chestnut Type 1 specific Castanea 21019 0.0 0.0 0.0 mg/100 g Chewing gum Type 2 specific 0.0 0.0 0.0 mg/100 g Chia Type 1 specific Salvia hispanica 49212 Chicken Type 1 specific Gallus gallus 9031 Chickpea Type 1 specific Cicer arietinum 3827 0.0 0.0 0.0 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 0.0 0.0 0.0 mg/100 g Chicory leaves Type 1 specific Cichorium intybus var. foliosum 13427 Chicory roots Type 1 specific Cichorium intybus var. sativum 13427 Chili Type 2 specific 7.0 20.0 0.0 mg/100 g Chimichanga Type 2 specific 25.5 27.0 24.0 mg/100 g Chinese bayberry Type 1 specific Myrica rubra 262757 Chinese broccoli Type 1 specific Brassica alboglabra 3714 0.0 0.0 0.0 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 0.0 0.0 0.0 mg/100 g Chinese chestnut Type 1 specific Castanea mollissima 60419 Chinese chives Type 1 specific Allium tuberosum 4683 Chinese cinnamon Type 1 specific Cinnamomum aromaticum 119260 3.0 3.0 3.0 mg/100 g Chinese mustard Type 1 specific Brassica juncea 3707 0.0 0.0 0.0 mg/100 g Chinese water chestnut Type 1 specific Eleocharis dulcis 110284 1.0 1.0 1.0 mg/100 g Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 0.0 0.0 0.0 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 0.0 0.0 0.0 mg/100 g Chocolate Type 2 specific 151.727273 1270.0 0.0 mg/100 g Chocolate mousse Type 2 specific 252.0 252.0 252.0 mg/100 g Chocolate spread Type 2 specific 3.5 7.0 0.0 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 0.0 0.0 0.0 mg/100 g Cichlidae (Tilapia) Type 1 specific Cichlidae 8113 0.0 0.0 0.0 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 5.0 5.0 5.0 mg/100 g Cisco Type 1 specific Coregonus artedi 36181 0.0 0.0 0.0 mg/100 g Citrus Unknown generic Clawed lobster Type 1 specific Nephropidae 6704 0.0 0.0 0.0 mg/100 g Climbing bean Type 1 specific Vigna umbellata 87088 Cloud ear fungus Type 1 specific Auricularia polytricha 29893 Cloudberry Type 1 specific Rubus chamaemorus 57936 Cloves Type 1 specific Syzygium aromaticum 219868 131.0 131.0 131.0 mg/100 g Clupeinae (Herring, Sardine, Sprat) Type 1 specific Clupeinae 7948 6.222222 112.0 0.0 mg/100 g Cocktail Type 2 specific 187.333333 459.0 0.0 mg/100 g Cocoa bean Type 1 specific Theobroma cacao 3641 Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa powder Type 2 specific 11.0 77.0 0.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 3162.070455 6000.0 11.0 mg/100 g Coffee Type 1 generic Coffea 13442 14.315789 179.0 0.0 mg/100 g Coffee mocha Type 2 specific 764.0 764.0 764.0 mg/100 g Coffee substitute Type 2 specific 20.75 83.0 0.0 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 0.0 0.0 0.0 mg/100 g Cold cut Type 2 specific 28.583333 80.0 0.0 mg/100 g Colorado pinyon Type 1 specific Pinus edulis 3340 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 0.0 0.0 0.0 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 0.294118 15.0 0.0 mg/100 g Common beet Type 1 specific Beta vulgaris 161934 0.0 0.0 0.0 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 8.5 18.0 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 0.105263 1.0 0.0 mg/100 g Common carp Type 1 specific Cyprinus carpio 7962 0.0 0.0 0.0 mg/100 g Common chokecherry Type 1 specific Prunus virginiana 133204 Common dab Type 1 specific Limanda limanda 27771 0.0 0.0 0.0 mg/100 g Common grape Type 1 specific Vitis vinifera 29760 0.0 0.0 0.0 mg/100 g Common hazelnut Type 1 specific Corylus avellana 13451 Common ling Type 1 specific Molva molva 163112 0.0 0.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 0.583333 2.0 0.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 0.0 0.0 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 13.025 22.05 4.0 mg/100 g Common pea Type 1 specific Pisum sativum 3888 0.0 0.0 0.0 mg/100 g Common persimmon Type 1 specific Diospyros virginiana 13493 Common sage Type 1 specific Salvia officinalis 38868 760.0 760.0 760.0 mg/100 g Common salsify Type 1 specific Tragopogon porrifolius 13731 0.0 0.0 0.0 mg/100 g Common thyme Type 1 specific Thymus vulgaris 49992 88.6 124.8 21.0 mg/100 g Common verbena Type 1 specific Verbena officinalis 79772 Common walnut Type 1 specific Juglans regia 51240 0.0 0.0 0.0 mg/100 g Common wheat Type 1 specific Triticum aestivum 4565 0.0 0.0 0.0 mg/100 g Conch Type 1 specific Strombidae 69694 0.0 0.0 0.0 mg/100 g Condensed milk Type 2 specific 73.0 73.0 73.0 mg/100 g Cooking oil Type 2 specific 0.0 0.0 0.0 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 0.0 0.0 0.0 mg/100 g Corn Type 1 specific Zea mays 4577 10.835821 660.0 0.0 mg/100 g Corn chip Type 2 specific 434.5 1830.0 0.0 mg/100 g Corn grits Type 2 specific 1.375 22.0 0.0 mg/100 g Corn salad Type 1 specific Valerianella locusta 59166 Cornbread Type 2 specific 10.0 21.0 3.0 mg/100 g Cornmint Type 1 specific Mentha arvensis 292239 Cottonseed Type 1 specific Gossypium 3633 0.0 0.0 0.0 mg/100 g Couscous Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 0% fat Type 2 specific 2.0 2.0 2.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 1% fat Type 2 specific 27.0 27.0 27.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 2% fat Type 2 specific 49.0 49.0 49.0 mg/100 g Cow milk, pasteurized, vitamin D added, 3.25% fat Type 2 specific 75.0 75.0 75.0 mg/100 g Cowpea Type 1 specific Vigna unguiculata 3917 0.0 0.0 0.0 mg/100 g Crab Type 1 specific Brachyura 6752 0.0 0.0 0.0 mg/100 g Cracker Type 2 specific 20.512821 472.0 0.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 0.0 0.0 0.0 mg/100 g Cream Type 2 specific 478.8 1240.0 0.0 mg/100 g Cream substitute Type 2 specific 396.909091 1457.0 0.0 mg/100 g Crisp bread Type 2 specific 0.0 0.0 0.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 0.0 0.0 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 0.935484 16.0 0.0 mg/100 g Cumin Type 1 specific Cuminum cyminum 52462 18.0 18.0 18.0 mg/100 g Cupuaçu Type 1 specific Theobroma grandiflorum 108881 0.0 0.0 0.0 mg/100 g Curry powder Type 2 specific 72.5 145.0 0.0 mg/100 g Custard apple Type 1 specific Annona reticulata 301862 Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 0.0 0.0 0.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 0.0 0.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 0.5 1.0 0.0 mg/100 g Deer Type 1 specific Cervidae 9850 0.0 0.0 0.0 mg/100 g Deerberry Type 1 specific Vaccinium stamineum 176259 Devilfish Type 1 specific Myoxocephalus 8095 Dill Type 1 specific Anethum graveolens 40922 0.0 0.0 0.0 mg/100 g Dock Type 1 specific Rumex 3618 Dolphin fish Type 1 specific Coryphaena hippurus 34814 0.0 0.0 0.0 mg/100 g Domestic goat Type 1 specific Capra aegagrus hircus 9925 0.0 0.0 0.0 mg/100 g Domestic pig Type 1 specific Sus scrofa domestica 9825 9.009501 250.0 0.0 mg/100 g Dried milk Type 2 specific 236.333333 836.0 5.0 mg/100 g Dripping Type 2 specific 33.0 33.0 33.0 mg/100 g Dulce de leche Type 2 specific 207.0 207.0 207.0 mg/100 g Durian Type 1 specific Durio zibethinus 66656 Eastern oyster Type 1 specific Crassostrea virginica 6565 0.0 0.0 0.0 mg/100 g Edible shell Type 2 specific 0.0 0.0 0.0 mg/100 g Egg roll Type 2 specific 0.0 0.0 0.0 mg/100 g Egg substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 0.0 0.0 0.0 mg/100 g Eggs Unknown generic 3.902439 104.0 0.0 mg/100 g Elderberry Type 1 specific Sambucus 4201 0.0 0.0 0.0 mg/100 g Elk Type 1 specific Cervus canadensis 1574408 Elliott's blueberry Type 1 specific Vaccinium elliottii 283798 Empanada Type 2 specific 21.0 21.0 21.0 mg/100 g Emu Type 1 specific Dromaius novaehollandiae 8790 Enchilada Type 2 specific 117.0 264.0 30.0 mg/100 g Endive Type 1 specific Cichorium endivia 114280 0.0 0.0 0.0 mg/100 g Energy drink Type 2 specific 0.0 0.0 0.0 mg/100 g Enokitake Type 1 specific Flammulina velutipes 38945 0.0 0.0 0.0 mg/100 g Epazote Type 1 specific Dysphania ambrosioides 330163 European anchovy Type 1 specific Engraulis encrasicolus 184585 0.0 0.0 0.0 mg/100 g European chestnut Type 1 specific Castanea sativa 21020 0.0 0.0 0.0 mg/100 g European cranberry Type 1 specific Vaccinium oxycoccos 516948 European plum Type 1 specific Prunus domestica 3758 0.416667 5.0 0.0 mg/100 g European rabbit Type 1 specific Oryctolagus 9984 Evaporated milk Type 2 specific 83.25 110.0 3.0 mg/100 g Evening primrose Type 1 specific Oenothera biennis 3942 Evergreen blackberry Type 1 specific Rubus laciniatus Evergreen huckleberry Type 1 specific Vaccinium ovatum 84019 Feijoa Type 1 specific Feijoa sellowiana 260130 4.0 4.0 4.0 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 0.0 0.0 0.0 mg/100 g Fenugreek Type 1 specific Trigonella foenum-graecum 78534 Fig Type 1 specific Ficus carica 3494 6.222222 56.0 0.0 mg/100 g Fireweed Type 1 specific Chamerion angustifolium 13055 Fish oil Type 1 0.0 0.0 0.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 2.333333 4.0 0.0 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 3.6 10.0 0.0 mg/100 g Florida pompano Type 1 specific Trachinotus carolinus 173342 0.0 0.0 0.0 mg/100 g Flour Type 2 specific 0.0 0.0 0.0 mg/100 g Focaccia Type 2 specific 0.0 0.0 0.0 mg/100 g Fox grape Type 1 specific Vitis labrusca 103355 French plantain Type 1 specific Musa X paradisiaca 89151 5.6 16.0 0.0 mg/100 g French toast Type 2 specific 8.5 17.0 0.0 mg/100 g Freshwater eel Type 1 specific Anguilla 7935 0.0 0.0 0.0 mg/100 g Frozen yogurt Type 2 specific 92.8 140.0 18.0 mg/100 g Fruit gum Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit juice Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit preserve Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit salad Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit-flavor drink Type 2 specific 2.40625 77.0 0.0 mg/100 g Fruits Unknown generic Frybread Type 2 specific 0.0 0.0 0.0 mg/100 g Fudge Type 2 specific 158.857143 260.0 23.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.0 0.0 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 0.0 0.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 0.0 0.0 0.0 mg/100 g Garden onion Type 1 specific Allium cepa 4679 Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 0.0 0.0 0.0 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 0.0 0.0 0.0 mg/100 g Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 Garfish Type 1 specific Belone belone 129037 0.0 0.0 0.0 mg/100 g Garland chrysanthemum Type 1 specific Chrysanthemum coronarium 99038 0.0 0.0 0.0 mg/100 g Garlic Type 1 specific Allium sativum 4682 1.75 3.0 0.0 mg/100 g Gelatin Type 2 specific 0.0 0.0 0.0 mg/100 g Gelatin dessert Type 2 specific 0.0 0.0 0.0 mg/100 g German camomile Type 1 specific Matricaria recutita 127986 Giant butterbur Type 1 specific Petasites japonicus 186965 Gin Type 2 specific 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 437.25 1560.0 0.0 mg/100 g Ginkgo nuts Type 1 specific Ginkgo biloba 3311 0.0 0.0 0.0 mg/100 g Ginseng Type 1 specific Panax 4054 Globe artichoke Type 1 specific Cynara scolymus 59895 0.0 0.0 0.0 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 0.0 0.0 0.0 mg/100 g Gram bean Type 1 specific Vigna mungo 3915 0.0 0.0 0.0 mg/100 g Grape Type 1 specific Vitis 3603 0.0 0.0 0.0 mg/100 g Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 0.0 0.0 0.0 mg/100 g Grapefruit/Pummelo hybrid Type 1 specific Citrus paradisi X Citrus maxima 37656 Grass pea Type 1 specific Lathyrus sativus 3860 Greater sturgeon Type 1 specific Acipenser 7901 0.0 0.0 0.0 mg/100 g Green bean Type 1 specific Phaseolus vulgaris 3885 0.0 0.0 0.0 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Green onion Type 1 Green tea Type 1 0.0 0.0 0.0 mg/100 g Green turtle Type 1 specific Chelonia mydas 8469 0.0 0.0 0.0 mg/100 g Green vegetables Unknown generic Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 2.285714 16.0 0.0 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 0.0 0.0 0.0 mg/100 g Greenthread tea Type 1 specific Thelesperma 153159 Greylag goose Type 1 specific Anser anser 8843 Groundcherry Type 1 specific Physalis 24663 0.0 0.0 0.0 mg/100 g Grouper Type 1 specific Epinephelus 94231 0.0 0.0 0.0 mg/100 g Guava Type 1 specific Psidium guajava 120290 0.0 0.0 0.0 mg/100 g Guinea hen Type 1 specific Numida meleagris 8996 Haddock Type 1 specific Melanogrammus aeglefinus 8056 0.0 0.0 0.0 mg/100 g Half-highbush blueberry Type 1 specific Vaccinium angustifolium X Vaccinium corymbosum 934696 Hamburger Type 2 specific 44.807692 108.0 0.0 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 Hazelnut Type 1 specific Corylus 13450 0.0 0.0 0.0 mg/100 g Heart of palm Type 1 specific 0.0 0.0 0.0 mg/100 g Hedge mustard Type 1 specific Sisymbrium 3729 Herbal tea Type 1 0.0 0.0 0.0 mg/100 g Herbs and Spices Unknown generic Hibiscus tea Type 1 specific Hibiscus sabbariffa 183260 0.0 0.0 0.0 mg/100 g Hickory nut Type 1 specific Carya 13402 0.0 0.0 0.0 mg/100 g Highbush blueberry Type 1 specific Vaccinium corymbosum 69266 Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 0.0 0.0 0.0 mg/100 g Honey Type 2 specific 0.0 0.0 0.0 mg/100 g Horchata Type 2 specific 12.0 12.0 12.0 mg/100 g Horned melon Type 2 specific Cucumis metuliferus 61886 Horse Type 1 specific Equus caballus 9796 Horseradish Type 1 specific Armoracia rusticana 3704 0.0 0.0 0.0 mg/100 g Horseradish tree Type 1 specific Moringa oleifera 3735 0.0 0.0 0.0 mg/100 g Hot chocolate Type 2 specific 31.75 78.0 1.0 mg/100 g Hot dog Type 2 specific 91.0 91.0 91.0 mg/100 g Hummus Type 2 specific 0.0 0.0 0.0 mg/100 g Hushpuppy Type 2 specific 1.5 2.0 1.0 mg/100 g Hyacinth bean Type 1 specific Lablab purpureus 35936 0.0 0.0 0.0 mg/100 g Hyssop Type 1 specific Hyssopus officinalis 39324 Ice cream Type 2 specific 169.441176 588.0 0.0 mg/100 g Ice cream cone Type 2 specific 78.333333 235.0 0.0 mg/100 g Icing Type 2 specific 106.666667 412.0 0.0 mg/100 g Irish moss Type 1 specific Chondrus crispus 2769 0.0 0.0 0.0 mg/100 g Italian oregano Type 1 specific Origanum X majoricum 1384207 Italian sweet red pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 28.0 28.0 28.0 mg/100 g Japanese chestnut Type 1 specific Castanea crenata 103480 Japanese persimmon Type 1 specific Diospyros kaki 35925 0.0 0.0 0.0 mg/100 g Japanese pumpkin Type 1 specific Cucurbita maxima 3661 1.0 3.0 0.0 mg/100 g Japanese walnut Type 1 specific Juglans ailanthifolia 91209 Java plum Type 1 specific Syzygium cumini 260142 Jellyfish Type 1 specific Scyphozoa 6142 0.0 0.0 0.0 mg/100 g Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 0.0 0.0 0.0 mg/100 g Jew's ear Type 1 specific Auricularia auricula-judae 29892 Jicama Type 1 specific Pachyrhizus erosus 109171 0.0 0.0 0.0 mg/100 g Jostaberry Type 1 specific Ribes × nidigrolaria Jujube Type 1 specific Ziziphus zizyphus 48393 Junket Type 2 specific 48.0 77.0 0.0 mg/100 g Jute Type 1 specific Corchorus olitorius 93759 0.0 0.0 0.0 mg/100 g Kai-lan Type 1 specific Brassica oleracea var. alboglabra 3714 Kale Type 1 specific Brassica napus var. pabularia 0.0 0.0 0.0 mg/100 g Kefir Type 2 specific 112.0 112.0 112.0 mg/100 g Kelp Type 1 specific Laminaria 33637 0.0 0.0 0.0 mg/100 g Ketchup Type 2 specific 0.0 0.0 0.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 4.666667 14.0 0.0 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 0.0 0.0 0.0 mg/100 g Komatsuna Type 1 specific Brassica rapa var. perviridis 344680 Kombu Type 1 specific Saccharina japonica 88149 0.0 0.0 0.0 mg/100 g Kumquat Type 1 specific Fortunella 2706 0.0 0.0 0.0 mg/100 g Lake trout Type 1 specific Salvelinus namaycush 8040 0.0 0.0 0.0 mg/100 g Lambsquarters Type 1 specific Chenopodium album 3559 0.0 0.0 0.0 mg/100 g Lard Type 2 specific 33.333333 100.0 0.0 mg/100 g Lasagna Type 2 specific 37.0 85.0 0.0 mg/100 g Leavening agent Type 2 specific 0.181818 2.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 0.0 0.0 0.0 mg/100 g Lemon Type 1 specific Citrus limon 2708 2.5 20.0 0.0 mg/100 g Lemon balm Type 1 specific Melissa officinalis 39338 Lemon grass Type 1 specific Cymbopogon citratus 66014 Lemon sole Type 1 specific Microstomus kitt 106175 0.0 0.0 0.0 mg/100 g Lemon thyme Type 1 specific Thymus pulegioides 751873 Lemon verbena Type 1 specific Aloysia triphylla 542672 Lentils Type 1 generic Lens culinaris 3864 0.2 1.0 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 0.0 0.0 0.0 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.0 0.0 0.0 mg/100 g Lima bean Type 1 specific Phaseolus lunatus 3884 0.0 0.0 0.0 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 0.0 0.0 0.0 mg/100 g Linden Type 1 specific Tilia 64580 Lingcod Type 1 specific Ophiodon elongatus 225387 0.0 0.0 0.0 mg/100 g Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 0.0 0.0 0.0 mg/100 g Liquor Type 2 specific 72.3 387.0 0.0 mg/100 g Liquorice Type 2 specific 0.0 0.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 0.0 0.0 0.0 mg/100 g Longan Type 1 specific Dimocarpus longan 128017 Loquat Type 1 specific Eriobotrya japonica 32224 0.0 0.0 0.0 mg/100 g Lotus Type 1 specific Nelumbo 4430 Lovage Type 1 specific Levisticum officinale 48042 Lowbush blueberry Type 1 specific Vaccinium angustifolium 472369 Lumpsucker Type 1 specific Cyclopteridae 8101 0.0 0.0 0.0 mg/100 g Lupine Type 1 specific Lupinus 3869 Macadamia nut Type 1 specific Macadamia 4329 0.0 0.0 0.0 mg/100 g Macadamia nut (M. tetraphylla) Type 1 specific Macadamia tetraphylla 512563 Macaroni and cheese Type 2 specific 59.0 132.0 0.0 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 0.0 0.0 0.0 mg/100 g Malabar plum Type 1 specific Syzygium jambos 334483 Malabar spinach Type 1 specific Basella alba 3589 Mallard duck Type 1 specific Anas platyrhynchos 8839 Malus (Crab apple) Type 1 specific Malus 3749 0.0 0.0 0.0 mg/100 g Mamey sapote Type 1 specific Pouteria sapota 233744 15.0 15.0 15.0 mg/100 g Mammee apple Type 1 specific Mammea americana 198777 0.0 0.0 0.0 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 0.033333 0.3 0.0 mg/100 g Mango Type 1 specific Mangifera indica 29780 0.0 0.0 0.0 mg/100 g Margarine Type 2 specific 20.4 130.0 0.0 mg/100 g Margarine-like spread Type 2 specific 137.172414 1670.0 0.0 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 0.0 0.0 0.0 mg/100 g Marshmallow Type 2 specific 0.0 0.0 0.0 mg/100 g Marzipan Type 2 specific 0.0 0.0 0.0 mg/100 g Meat bouillon Type 2 specific 0.0 0.0 0.0 mg/100 g Meatball Type 2 specific 0.0 0.0 0.0 mg/100 g Meatloaf Type 2 specific 34.25 80.0 0.0 mg/100 g Medlar Type 1 specific Mespilus germanica 36616 Mentha Type 1 specific Mentha 21819 Meringue Type 2 specific 0.0 0.0 0.0 mg/100 g Mexican groundcherry Type 1 specific Physalis philadelphica var. immaculata 374021 0.0 0.0 0.0 mg/100 g Mexican oregano Type 1 specific Lippia graveolens Milk (Cow) Type 2 specific 3154.894279 45279.181 2.0 mg/100 g Milk (Human) Type 2 specific 15.75 63.0 0.0 mg/100 g Milk (Other mammals) Type 2 specific 271.25 400.0 141.0 mg/100 g Milk and milk products Unknown generic Milk substitute Type 2 specific 88.0 176.0 0.0 mg/100 g Milkshake Type 2 specific 109.888889 227.0 68.0 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 1.6 8.0 0.0 mg/100 g Miso Type 2 specific 0.0 0.0 0.0 mg/100 g Mixed nuts Type 2 specific 41.666667 78.0 2.0 mg/100 g Molasses Type 2 specific 0.0 0.0 0.0 mg/100 g Mollusks Unknown generic 6447 Morchella (Morel) Type 1 specific Morchellaceae 5192 1.0 1.0 1.0 mg/100 g Moth bean Type 1 specific Vigna aconitifolia 3918 Mountain hare Type 1 specific Lepus timidus 62621 0.0 0.0 0.0 mg/100 g Mountain yam Type 1 specific Dioscorea pentaphylla 167592 Mugwort Type 1 specific Artemisia vulgaris 4220 Mulberry Type 1 specific Morus 3497 Mule deer Type 1 specific Odocoileus 9871 Multigrain bread Type 2 specific 0.0 0.0 0.0 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 0.0 0.0 0.0 mg/100 g Muscadine grape Type 1 specific Vitis rotundifolia 103349 Muskmelon Type 1 specific Cucumis melo 3656 37.3125 298.5 0.0 mg/100 g Mustard Type 2 specific 3.666667 11.0 0.0 mg/100 g Mustard spinach Type 1 specific Brassica perviridis 0.0 0.0 0.0 mg/100 g Nachos Type 2 specific 118.0 190.0 20.0 mg/100 g Nance Type 1 specific Byrsonima crassifolia 4270 Nanking cherry Type 1 specific Prunus tomentosa 105667 Napa cabbage Type 1 specific Brassica rapa var. pekinensis 51351 0.0 0.0 0.0 mg/100 g Naranjilla Type 1 specific Solanum quitoense 227725 Narrowleaf cattail Type 1 specific Typha angustifolia 59011 Natal plum Type 1 specific Carissa macrocarpa 403101 Natto Type 2 specific 0.0 0.0 0.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 0.0 0.0 0.0 mg/100 g New Zealand spinach Type 1 specific Tetragonia tetragonioides 45318 Nopal Type 1 specific Opuntia cochenillifera 338184 0.0 0.0 0.0 mg/100 g Northern bluefin tuna Type 1 specific Thunnus thynnus 8237 0.0 0.0 0.0 mg/100 g Northern pike Type 1 specific Esox lucius 8010 0.0 0.0 0.0 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Norway lobster Type 1 specific Nephrops norvegicus 6829 0.0 0.0 0.0 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.0 0.0 0.0 mg/100 g Nougat Type 2 specific 0.0 0.0 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 0.0 0.0 0.0 mg/100 g Nutritional drink Type 2 specific 1.25 11.0 0.0 mg/100 g Nuts Unknown generic Oat Type 1 specific Avena sativa 4498 0.0 0.0 0.0 mg/100 g Oat bread Type 2 specific 0.25 2.0 0.0 mg/100 g Ohelo berry Type 1 specific Vaccinium reticulatum 180767 Oil palm Type 1 specific Elaeis 51952 2540.3 3700.0 0.0 mg/100 g Oil-seed Camellia Type 1 specific Camellia oleifera 385388 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 0.0 0.0 0.0 mg/100 g Olive Type 1 specific Olea europaea 4146 0.0 0.0 0.0 mg/100 g Onion-family vegetables Unknown generic Opium poppy Type 1 specific Papaver somniferum 3469 0.0 0.0 0.0 mg/100 g Orange bell pepper Type 1 specific Capsicum annuum 4072 Orange mint Type 1 specific Mentha aquatica 190902 Orange roughy Type 1 specific Hoplostethus atlanticus 96778 0.0 0.0 0.0 mg/100 g Oregon yampah Type 1 specific Perideridia oregana 234866 Oriental wheat Type 1 specific Triticum turanicum 376534 0.0 0.0 0.0 mg/100 g Ostrich Type 1 specific Struthio camelus 8801 Ostrich fern Type 1 specific Matteuccia struthiopteris 3277 Other alcoholic beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Other animal fat Type 2 specific 23.714286 100.0 0.0 mg/100 g Other beverage Type 2 specific 43.375 151.0 0.0 mg/100 g Other bread Type 2 specific 7.575758 96.0 0.0 mg/100 g Other bread product Type 2 specific 5.0 45.0 0.0 mg/100 g Other candy Type 2 specific 205.090909 1076.0 0.0 mg/100 g Other cereal product Type 2 specific 0.0 0.0 0.0 mg/100 g Other dish Type 2 specific 43.586207 306.0 0.0 mg/100 g Other fermented milk Type 2 specific 110.5 112.0 109.0 mg/100 g Other fish product Type 2 specific 0.4 2.0 0.0 mg/100 g Other frozen dessert Type 2 specific 66.705882 631.0 0.0 mg/100 g Other fruit product Type 2 specific 33.333333 67.0 0.0 mg/100 g Other pasta dish Type 2 specific 29.0 126.0 1.0 mg/100 g Other sandwich Type 2 specific 28.944444 78.0 0.0 mg/100 g Other snack food Type 2 specific 97.272727 2010.0 0.0 mg/100 g Other soy product Type 2 specific 0.0 0.0 0.0 mg/100 g Other vegetable product Type 2 specific 0.0 0.0 0.0 mg/100 g Oval-leaf huckleberry Type 1 specific Vaccinium ovalifolium 190544 Oxheart cabbage Type 1 specific Brassica oleracea var. conica Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 0.0 0.0 0.0 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 0.0 0.0 0.0 mg/100 g Pacific jack mackerel Type 1 specific Trachurus symmetricus 271940 0.0 0.0 0.0 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.0 0.0 0.0 mg/100 g Pacific oyster Type 1 specific Crassostrea gigas 29159 0.0 0.0 0.0 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 0.0 0.0 0.0 mg/100 g Pacific sardine Type 1 specific Sardinops sagax 28381 0.0 0.0 0.0 mg/100 g Painted comber Type 1 specific Serranus scriba 349661 0.0 0.0 0.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 0.0 0.0 0.0 mg/100 g Pan dulce Type 2 specific 21.0 21.0 21.0 mg/100 g Pancake Type 2 specific 16.071429 75.0 0.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 40.0 160.0 0.0 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 0.0 0.0 0.0 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 0.0 0.0 0.0 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 0.0 0.0 0.0 mg/100 g Pasta Type 2 specific 0.085714 3.0 0.0 mg/100 g Pastry Type 2 specific 59.05618 518.0 0.0 mg/100 g Pate Type 2 specific 0.0 0.0 0.0 mg/100 g Peach Type 1 specific Prunus persica 3760 0.0 0.0 0.0 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 Peanut Type 1 specific Arachis hypogaea 3818 3.76 38.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.0 0.0 0.0 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 0.0 0.0 0.0 mg/100 g Pectin Type 2 specific 0.0 0.0 0.0 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 1.285714 30.0 0.0 mg/100 g Pepper (C. baccatum) Type 1 specific Capsicum baccatum var. baccatum 165788 Pepper (C. chinense) Type 1 specific Capsicum chinense 80379 Pepper (C. frutescens) Type 1 specific Capsicum annuum var. annuum 40321 Pepper (C. pubescens) Type 1 specific Capsicum pubescens 113210 Pepper (Capsicum) Type 1 specific Capsicum 4071 Pepper (Spice) Type 1 specific Piper nigrum 13216 18.0 36.0 0.0 mg/100 g Peppermint Type 1 specific Mentha X piperita 34256 Perciformes Type 1 specific Perciformes 8111 0.0 0.0 0.0 mg/100 g Percoidei (Bass and others) Type 1 specific Percoidei 8112 0.0 0.0 0.0 mg/100 g Persian lime Type 1 specific Citrus latifolia 200541 0.0 0.0 0.0 mg/100 g Persimmon Type 1 specific Diospyros 13492 0.0 0.0 0.0 mg/100 g Pheasant Type 1 specific Phasianus colchicus 9054 Phyllo dough Type 2 specific 0.0 0.0 0.0 mg/100 g Pie Type 2 specific 51.928571 336.0 0.0 mg/100 g Pie crust Type 2 specific 0.4375 3.0 0.0 mg/100 g Pie filling Type 2 specific 0.0 0.0 0.0 mg/100 g Pigeon pea Type 1 specific Cajanus cajan 3821 0.0 0.0 0.0 mg/100 g Pikeperch Type 1 specific Sander lucioperca 283035 0.0 0.0 0.0 mg/100 g Piki bread Type 2 specific 8.5 12.0 5.0 mg/100 g Pili nut Type 1 specific Canarium ovatum 43691 Pine nut Type 1 specific Pinus 3337 0.0 0.0 0.0 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.0 0.0 0.0 mg/100 g Pineappple sage Type 1 specific Salvia elegans 888065 Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 4.6 8.0 0.0 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 0.0 0.0 0.0 mg/100 g Pita bread Type 2 specific 0.0 0.0 0.0 mg/100 g Pitanga Type 1 specific Eugenia uniflora 119951 Pizza Type 2 specific 132.52459 274.0 0.0 mg/100 g Plains prickly pear Type 1 specific Opuntia macrorhiza 1041245 Pleuronectidae (Dab, Halibut, Plaice) Type 1 specific Pleuronectidae 8256 0.0 0.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.0 0.0 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.0 0.0 0.0 mg/100 g Pomes Unknown generic Popcorn Type 2 specific 13.142857 90.0 0.0 mg/100 g Poppy Type 1 specific Papaver 3468 0.0 0.0 0.0 mg/100 g Port wine Type 2 specific 0.0 0.0 0.0 mg/100 g Pot marjoram Type 1 specific Origanum onites 452416 Pot pie Type 2 specific 12.5 20.0 5.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 9.975862 152.0 0.0 mg/100 g Potato bread Type 2 specific 0.0 0.0 0.0 mg/100 g Potato chip Type 2 specific 6.866667 40.0 0.0 mg/100 g Potato gratin Type 2 specific 86.875 166.0 33.0 mg/100 g Potato puffs Type 2 specific 0.0 0.0 0.0 mg/100 g Prairie turnip Type 1 specific Pediomelum esculentum 458363 Prickly pear Type 1 specific Opuntia 106975 0.0 0.0 0.0 mg/100 g Processed cheese Type 2 specific 367.0625 664.0 12.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 0.0 0.0 0.0 mg/100 g Pudding Type 2 specific 64.547619 713.0 0.0 mg/100 g Pulses Unknown generic Pummelo Type 1 specific Citrus maxima 37334 Pupusa Type 2 specific 98.0 269.0 8.0 mg/100 g Purple laver Type 1 specific Porphyra laciniata 0.0 0.0 0.0 mg/100 g Purple mangosteen Type 1 specific Garcinia mangostana 58228 Purslane Type 1 specific Portulaca oleracea 46147 Quail Type 1 specific Phasianidae 9005 0.0 0.0 0.0 mg/100 g Quesadilla Type 2 specific 178.0 178.0 178.0 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 0.0 0.0 0.0 mg/100 g Quinoa Type 1 specific Chenopodium quinoa 63459 0.0 0.0 0.0 mg/100 g Rabbit Type 1 specific Leporidae 9979 0.0 0.0 0.0 mg/100 g Radish Type 1 specific Raphanus sativus 3726 0.0 0.0 0.0 mg/100 g Radish (var.) Type 1 specific Raphanus sativus var. sativus 240228 Rainbow smelt Type 1 specific Osmerus mordax 8014 0.0 0.0 0.0 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 0.0 0.0 0.0 mg/100 g Raisin bread Type 2 specific 0.0 0.0 0.0 mg/100 g Rambutan Type 1 specific Nephelium lappaceum 151071 Rape Type 1 specific Brassica napus var. napus 138011 0.0 0.0 0.0 mg/100 g Rapini Type 1 specific Brassica ruvo 1204434 0.0 0.0 0.0 mg/100 g Ravioli Type 2 specific 22.333333 46.0 2.0 mg/100 g Red algae Type 1 specific Rhodophyta 2763 0.0 0.0 0.0 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra 0.0 0.0 0.0 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Red huckleberry Type 1 specific Vaccinium parvifolium 180766 Red king crab Type 1 specific Paralithodes camtschaticus 6741 3.0 3.0 3.0 mg/100 g Red onion Type 1 Red raspberry Type 1 specific Rubus idaeus 32247 0.0 0.0 0.0 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 Red tea Type 1 0.0 0.0 0.0 mg/100 g Red wine Type 2 125.450325 250.65 0.25065 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.0 0.0 0.0 mg/100 g Relish Type 2 specific 0.0 0.0 0.0 mg/100 g Remoulade Type 2 specific 0.0 0.0 0.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 0.0 0.0 0.0 mg/100 g Rice bread Type 2 specific 0.0 0.0 0.0 mg/100 g Rice cake Type 2 specific 0.0 0.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 14.315789 179.0 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 0.0 0.0 0.0 mg/100 g Rocket salad Type 1 specific Eruca vesicaria 180536 Rocket salad (ssp.) Type 1 specific Eruca vesicaria ssp. sativa 29727 0.0 0.0 0.0 mg/100 g Roe Type 2 generic 0.0 0.0 0.0 mg/100 g Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 0.0 0.0 0.0 mg/100 g Roman camomile Type 1 specific Chamaemelum nobile 99037 Root vegetables Unknown generic Rose hip Type 1 specific Rosa 3764 0.0 0.0 0.0 mg/100 g Roselle Type 1 specific Hibiscus sabdariffa 183260 Rosemary Type 1 specific Rosmarinus officinalis 39367 34.5 50.0 19.0 mg/100 g Rowal Type 1 specific Pangium edule 112823 Rowanberry Type 1 specific Sorbus aucuparia 36599 Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.0 0.0 0.0 mg/100 g Rum Type 2 specific 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 0.0 0.0 0.0 mg/100 g Rye bread Type 2 specific 1.25 26.0 0.0 mg/100 g Sablefish Type 1 specific Anoplopoma fimbria 229290 0.0 0.0 0.0 mg/100 g Sacred lotus Type 1 specific Nelumbo nucifera 4432 0.0 0.0 0.0 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 23.25 93.0 0.0 mg/100 g Saffron Type 1 specific Crocus sativus 82528 0.0 0.0 0.0 mg/100 g Sago palm Type 1 specific Metroxylon sagu 93297 Sake Type 2 specific 0.0 0.0 0.0 mg/100 g Salad Type 2 specific 8.428571 30.0 0.0 mg/100 g Salad dressing Type 2 specific 19.014925 824.0 0.0 mg/100 g Salmonberry Type 1 specific Rubus spectabilis 59499 Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 0.0 0.0 0.0 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Sapodilla Type 1 specific Manilkara zapota 3741 0.0 0.0 0.0 mg/100 g Saskatoon berry Type 1 specific Amelanchier alnifolia 32219 Sauce Type 2 specific 29.545455 381.0 0.0 mg/100 g Sausage Type 2 specific 24.357143 120.0 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 0.0 0.0 0.0 mg/100 g Scallop Type 1 specific Pectinidae 6566 0.0 0.0 0.0 mg/100 g Scarlet bean Type 1 specific Phaseolus coccineus 3886 Scombridae (Bonito, Mackerel, Tuna) Type 1 specific Scombridae 8224 0.0 0.0 0.0 mg/100 g Scrapple Type 2 specific 9.0 9.0 9.0 mg/100 g Scup Type 1 specific Stenotomus chrysops 35579 0.0 0.0 0.0 mg/100 g Sea trout Type 1 specific Salmo trutta forma trutta 13028 0.0 0.0 0.0 mg/100 g Sea-buckthornberry Type 1 specific Hippophae rhamnoides 193516 Semolina Type 2 specific 0.0 0.0 0.0 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 0.0 0.0 0.0 mg/100 g Sesbania flower Type 1 specific Sesbania bispinosa 485725 Shallot Type 1 specific Allium ascalonicum 1476995 0.0 0.0 0.0 mg/100 g Shark Type 1 specific Squaliformes 282414 0.0 0.0 0.0 mg/100 g Shea tree Type 1 specific Vitellaria paradoxa 292385 200.0 200.0 200.0 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 0.0 0.0 0.0 mg/100 g Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Sherry Type 2 specific 0.0 0.0 0.0 mg/100 g Shiitake Type 1 specific Lentinus edodes 5353 7.25 21.0 0.0 mg/100 g Shortening Type 2 specific 270.647059 4300.0 0.0 mg/100 g Shrimp Type 1 specific Caridea 6694 1.916667 8.0 0.0 mg/100 g Silver linden Type 1 specific Tilia argentea Skunk currant Type 1 specific Ribes glandulosum 175226 Small-leaf linden Type 1 specific Tilia cordata 172266 Smelt Type 1 specific Osmeridae 8012 0.0 0.0 0.0 mg/100 g Snack bar Type 2 specific 205.23913 1580.0 0.0 mg/100 g Snail Type 1 specific Gastropoda 6448 0.0 0.0 0.0 mg/100 g Snapper Type 1 specific Lutjanidae 30850 0.0 0.0 0.0 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 4.4 20.0 0.0 mg/100 g Soft drink Type 2 specific 0.0 0.0 0.0 mg/100 g Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 Sorghum Type 1 specific Sorghum bicolor 4558 8.0 8.0 8.0 mg/100 g Sorrel Type 1 specific Rumex acetosa 41241 0.0 0.0 0.0 mg/100 g Soup Type 2 specific 14.126582 150.0 0.0 mg/100 g Sour cherry Type 1 specific Prunus cerasus 140311 0.0 0.0 0.0 mg/100 g Sour cream Type 2 1006.0 1006.0 1006.0 mg/100 g Sourdock Type 1 specific Rumex articus 395311 Sourdough Type 2 specific Soursop Type 1 specific Annona muricata 13337 0.0 0.0 0.0 mg/100 g Soy bean Type 1 specific Glycine max 3847 0.0 0.0 0.0 mg/100 g Soy milk Type 2 specific 0.0 0.0 0.0 mg/100 g Soy sauce Type 2 specific 0.0 0.0 0.0 mg/100 g Soy yogurt Type 2 specific 0.0 0.0 0.0 mg/100 g Spanish mackerel Type 1 specific Scomberomorus maculatus 99344 0.0 0.0 0.0 mg/100 g Sparkleberry Type 1 specific Vaccinium arboreum 229201 Spearmint Type 1 specific Mentha spicata 29719 Spelt Type 1 specific Triticum spelta 58933 0.0 0.0 0.0 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 0.0 0.0 0.0 mg/100 g Spiny dogfish Type 1 specific Squalus acanthias 7797 0.0 0.0 0.0 mg/100 g Spiny lobster Type 1 specific Palinuridae 6731 0.0 0.0 0.0 mg/100 g Spirit Type 2 specific 0.0 0.0 0.0 mg/100 g Spirulina Type 1 specific Spirulina 551299 0.0 0.0 0.0 mg/100 g Spot croaker Type 1 specific Leiostomus xanthurus 59837 0.0 0.0 0.0 mg/100 g Spotted seal Type 1 specific Phoca largha 39090 0.0 0.0 0.0 mg/100 g Spread Type 2 specific 50.0 280.0 0.0 mg/100 g Squab Type 1 specific Columba 8931 Squashberry Type 1 specific Viburnum edule 237934 Squid Type 1 specific Teuthida 551290 0.0 0.0 0.0 mg/100 g Star anise Type 1 specific Illicium verum 124778 Star fruit Type 1 specific Averrhoa carambola 28974 0.0 0.0 0.0 mg/100 g Stew Type 2 specific 0.25 2.0 0.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 0.0 0.0 0.0 mg/100 g Strawberry guava Type 1 specific Psidium cattleianum 375274 Striped bass Type 1 specific Morone saxatilis 34816 0.0 0.0 0.0 mg/100 g Striped mullet Type 1 specific Mugil cephalus 48193 0.0 0.0 0.0 mg/100 g Stuffing Type 2 specific 6.0 7.0 5.0 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 0.0 0.0 0.0 mg/100 g Succotash Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar apple Type 1 specific Annona squamosa 301693 0.0 0.0 0.0 mg/100 g Sugar substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Summer grape Type 1 specific Vitis aestivalis 3605 Summer savory Type 1 specific Satureja hortensis 49987 Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 1.166667 3.0 0.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 0.533333 4.0 0.0 mg/100 g Swamp cabbage Type 1 specific Ipomoea aquatica 89636 0.0 0.0 0.0 mg/100 g Swede Type 1 specific Brassica napus 3708 0.0 0.0 0.0 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 0.0 0.0 0.0 mg/100 g Sweet bay Type 1 specific Laurus nobilis 85223 10.0 10.0 10.0 mg/100 g Sweet cherry Type 1 specific Prunus avium 42229 0.0 0.0 0.0 mg/100 g Sweet custard Type 2 specific 51.142857 75.0 10.0 mg/100 g Sweet marjoram Type 1 specific Origanum majorana 268884 0.0 0.0 0.0 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 0.0 0.0 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 5.4 54.0 0.0 mg/100 g Sweet rowanberry Type 1 specific Grataegosorbus mitschurinii Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 0.0 0.0 0.0 mg/100 g Swordfish Type 1 specific Xiphias gladius 8245 0.0 0.0 0.0 mg/100 g Syrup Type 2 specific 12.555556 75.0 0.0 mg/100 g Taco Type 2 specific 58.6 89.0 52.0 mg/100 g Taco shell Type 2 0.0 0.0 0.0 mg/100 g Tallow Type 2 specific 0.0 0.0 0.0 mg/100 g Tamale Type 2 specific 11.5 33.0 0.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 0.0 0.0 0.0 mg/100 g Tapioca pearl Type 2 specific 0.0 0.0 0.0 mg/100 g Taro Type 1 specific Colocasia esculenta 4460 0.0 0.0 0.0 mg/100 g Tarragon Type 1 specific Artemisia dracunculus 72341 28.0 28.0 28.0 mg/100 g Tartary buckwheat Type 1 specific Fagopyrum tataricum 62330 Tea Type 1 specific Camellia sinensis 4442 0.0 0.0 0.0 mg/100 g Tea leaf willow Type 1 specific Salix pulchra 669814 Teff Type 1 specific Eragrostis tef 110835 0.0 0.0 0.0 mg/100 g Thistle Type 1 specific Cirsium 41549 0.0 0.0 0.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 0.0 0.0 0.0 mg/100 g Tilefish Type 1 specific Lopholatilus chamaeleonticeps 390349 0.0 0.0 0.0 mg/100 g Tinda Type 1 specific Citrullus lanatus var. fistulosus Toffee Type 2 specific 0.0 0.0 0.0 mg/100 g Tofu Type 2 specific 0.0 0.0 0.0 mg/100 g Topping Type 2 specific 268.909091 964.0 0.0 mg/100 g Tortilla Type 2 specific 1.571429 6.0 0.0 mg/100 g Tortilla chip Type 2 specific 11.9 31.0 0.0 mg/100 g Tostada Type 2 specific 308.0 556.0 120.0 mg/100 g Tostada shell Type 2 0.0 0.0 0.0 mg/100 g Towel gourd Type 1 specific Luffa aegyptiaca 3670 Trail mix Type 2 specific 238.0 510.0 160.0 mg/100 g Tree fern Type 1 specific Cyathea 0.0 0.0 0.0 mg/100 g Triticale Type 1 specific X Triticosecale rimpaui Tronchuda cabbage Type 1 specific Brassica oleracea var. costata 416546 True frog Type 1 specific Ranidae 8397 0.0 0.0 0.0 mg/100 g True oyster Type 1 specific Ostreidae 6563 0.0 0.0 0.0 mg/100 g True sole Type 1 specific Soleidae 30948 0.0 0.0 0.0 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 0.0 0.0 0.0 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 0.0 0.0 0.0 mg/100 g Turmeric Type 1 specific Curcuma longa 136217 299.0 299.0 299.0 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 1.125 2.0 0.0 mg/100 g Ucuhuba Type 1 specific Virola surinamensis 224910 224.0 448.0 0.0 mg/100 g Unclassified food or beverage Type 2 specific 24.428571 135.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 0.0 0.0 0.0 mg/100 g Vanilla Type 1 specific Vanilla 51238 0.0 0.0 0.0 mg/100 g Vegetable juice Type 2 specific 0.0 0.0 0.0 mg/100 g Vegetarian food Type 2 specific 6.384615 81.0 0.0 mg/100 g Velvet duck Type 1 specific Melanitta fusca 371864 Vermouth Type 2 specific 0.0 0.0 0.0 mg/100 g Vinegar Type 2 specific 0.0 0.0 0.0 mg/100 g Vodka Type 2 specific 0.0 0.0 0.0 mg/100 g Waffle Type 2 specific 13.0 72.0 0.0 mg/100 g Wakame Type 1 specific Undaria pinnatifida 74381 0.0 0.0 0.0 mg/100 g Walleye Type 1 specific Sander vitreus 283036 0.0 0.0 0.0 mg/100 g Walnut Type 1 specific Juglans 16718 0.0 0.0 0.0 mg/100 g Wasabi Type 1 specific Wasabia japonica 75806 Water Type 2 specific 0.0 0.0 0.0 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 0.0 0.0 0.0 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 117.666667 352.0 0.0 mg/100 g Wax apple Type 1 specific Eugenia javanica 119950 Wax gourd Type 1 specific Benincasa hispida 102211 0.0 0.0 0.0 mg/100 g Welsh onion Type 1 specific Allium fistulosum 35875 Wheat Type 1 specific Triticum 4564 1.272727 18.0 0.0 mg/100 g Wheat bread Type 2 specific 2.116279 34.0 0.0 mg/100 g Whelk Type 1 specific Buccinidae 37796 0.0 0.0 0.0 mg/100 g Whey Type 2 specific 129.0 842.0 2.0 mg/100 g Whisky Type 2 specific 0.0 0.0 0.0 mg/100 g White bread Type 1 8.88 96.0 0.0 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 0.0 0.0 0.0 mg/100 g White lupine Type 1 specific Lupinus albus 3870 White mustard Type 1 specific Sinapis alba 3728 0.0 0.0 0.0 mg/100 g White wine Type 2 0.502 1.004 0.0 mg/100 g Whitefish Type 1 specific Coregonus 27772 0.0 0.0 0.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 0.0 0.0 0.0 mg/100 g Wild boar Type 1 specific Sus scrofa 9823 Wild carrot Type 1 specific Daucus carota 4039 421.25 421.25 421.25 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 5.807143 20.65 0.0 mg/100 g Wild leek Type 1 specific Allium ampeloprasum 4681 0.0 0.0 0.0 mg/100 g Wild rice Type 1 specific Zizania 15949 0.0 0.0 0.0 mg/100 g Winged bean Type 1 specific Psophocarpus tetragonolobus 3891 Winter savory Type 1 specific Satureja montana 49988 Winter squash Type 1 specific Cucurbita maxima 3661 0.0 0.0 0.0 mg/100 g Wonton wrapper Type 2 specific 0.0 0.0 0.0 mg/100 g Yam Type 1 specific Dioscorea 4672 0.0 0.0 0.0 mg/100 g Yardlong bean Type 1 specific Vigna unguiculata ssp. sesquipedalis 138955 Yautia Type 1 specific Xanthosoma sagittifolium 28478 Yellow bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Yellow pond-lily Type 1 specific Nuphar lutea 77113 3.0 4.0 2.0 mg/100 g Yellow wax bean Type 1 specific Phaseolus vulgaris 3885 0.0 0.0 0.0 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 2.285714 16.0 0.0 mg/100 g Yellowfin tuna Type 1 specific Thunnus albacares 8236 0.0 0.0 0.0 mg/100 g Ymer Type 2 specific 80.0 104.0 56.0 mg/100 g Yogurt Type 2 specific 48.75 240.0 0.0 mg/100 g Zwieback Type 2 specific 77.0 77.0 77.0 mg/100 g citrus fat fatty rancid sour unpleasant Carnitine O-palmitoyltransferase 2, mitochondrial P23786 CPT2 Mitochondrial carnitine/acylcarnitine carrier protein O43772 SLC25A20 Peroxisomal carnitine O-octanoyltransferase Q9UKG9 CROT anti bacterial 145 A substance that kills or slows the growth of bacteria. flavor 936 A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. fungicide 940 A substance used to destroy fungal pests. irritant 1055 nematicide 1141 A substance used to destroy pests of the phylum Nematoda (roundworms). pesticide 1210 Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests.