1.0 2010-04-08 22:10:00 UTC 2025-11-18 23:34:11 UTC FDB012135 Cinnatriacetin A Production by Fistulina hepatica (beefsteak fungus). Cinnatriacetin A is found in mushrooms. Cinnatriacetin A FH 2 C23H20O5 376.4019 376.13107375 (5Z)-14-{[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy}tetradec-5-en-8,10,12-triynoic acid (5Z)-14-{[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy}tetradec-5-en-8,10,12-triynoic acid OC(=O)CCC\C=C/CC#CC#CC#CCOC(=O)\C=C\C1=CC=C(O)C=C1 InChI=1S/C23H20O5/c24-21-16-13-20(14-17-21)15-18-23(27)28-19-11-9-7-5-3-1-2-4-6-8-10-12-22(25)26/h4,6,13-18,24H,2,8,10,12,19H2,(H,25,26)/b6-4-,18-15+ UGVOYXYFLWZKOM-MJLPGFBBSA-N belongs to the class of organic compounds known as coumaric acid esters. These are aromatic compounds containing an ester derivative of coumaric acid. Coumaric acid esters Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Carbonyl compounds Carboxylic acids Cinnamic acid esters Coumaric acids and derivatives Dicarboxylic acids and derivatives Enoate esters Fatty acid esters Hydrocarbon derivatives Organic oxides Styrenes 1-hydroxy-2-unsubstituted benzenoid Alpha,beta-unsaturated carboxylic ester Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Carboxylic acid ester Cinnamic acid ester Coumaric acid ester Coumaric acid or derivatives Dicarboxylic acid or derivatives Enoate ester Fatty acid ester Fatty acyl Hydrocarbon derivative Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol Styrene logp 4.33 ALOGPS logs -4.64 ALOGPS solubility 8.60e-03 g/l ALOGPS logp 5.21 ChemAxon pka_strongest_acidic 4.06 ChemAxon pka_strongest_basic -6 ChemAxon iupac (5Z)-14-{[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy}tetradec-5-en-8,10,12-triynoic acid ChemAxon average_mass 376.4019 ChemAxon mono_mass 376.13107375 ChemAxon smiles OC(=O)CCC\C=C/CC#CC#CC#CCOC(=O)\C=C\C1=CC=C(O)C=C1 ChemAxon formula C23H20O5 ChemAxon inchi InChI=1S/C23H20O5/c24-21-16-13-20(14-17-21)15-18-23(27)28-19-11-9-7-5-3-1-2-4-6-8-10-12-22(25)26/h4,6,13-18,24H,2,8,10,12,19H2,(H,25,26)/b6-4-,18-15+ ChemAxon inchikey UGVOYXYFLWZKOM-MJLPGFBBSA-N ChemAxon polar_surface_area 83.83 ChemAxon refractivity 110.41 ChemAxon polarizability 42.39 ChemAxon rotatable_bond_count 13 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 26438 Specdb::CMs 43591 Specdb::CMs 172865 Specdb::MsMs 85653 Specdb::MsMs 85654 Specdb::MsMs 85655 Specdb::MsMs 147789 Specdb::MsMs 147790 Specdb::MsMs 147791 Specdb::MsMs 2458780 Specdb::MsMs 2458781 Specdb::MsMs 2458782 Specdb::MsMs 2476475 Specdb::MsMs 2476476 Specdb::MsMs 2476477 HMDB0033932 Common mushroom Type 1 specific Agaricus bisporus 5341 Mushrooms Unknown generic Oyster mushroom Type 1 specific Pleurotus ostreatus 5322