1.0 2010-04-08 22:10:09 UTC 2019-11-26 03:06:42 UTC FDB012397 L-Isoleucine Dietary supplement, nutrient Branched chain amino acids (BCAA) are essential amino acids whose carbon structure is marked by a branch point. These three amino acids are critical to human life and are particularly involved in stress, energy and muscle metabolism. BCAA supplementation as therapy, both oral and intravenous, in human health and disease holds great promise. "BCAA" denotes valine, isoleucine and leucine which are branched chain essential amino acids. Despite their structural similarities, the branched amino acids have different metabolic routes, with valine going solely to carbohydrates, leucine solely to fats and isoleucine to both. The different metabolism accounts for different requirements for these essential amino acids in humans: 12 mg/kg, 14 mg/kg and 16 mg/kg of valine, leucine and isoleucine respectively. Furthermore, these amino acids have different deficiency symptoms. Valine deficiency is marked by neurological defects in the brain, while isoleucine deficiency is marked by muscle tremors. BCAA are decreased in patients with liver disease, such as hepatitis, hepatic coma, cirrhosis, extrahepatic biliary atresia or portacaval shunt; They provide ingredients for the manufacturing of other essential biochemical components in the body, some of which are utilized for the production of energy, stimulants to the upper brain and helping you to be more alert.; aromatic amino acids (AAA)-tyrosine, tryptophan and phenylalanine, as well as methionine-are increased in these conditions. Valine, in particular, has been established as a useful supplemental therapy to the ailing liver. All the BCAA probably compete with AAA for absorption into the brain. Supplemental BCAA with vitamin B6 and zinc help normalize the BCAA:AAA ratio. The BCAA are not without side effects. Leucine alone, for example, exacerbates pellagra and can cause psychosis in pellagra patients by increasing excretion of niacin in the urine. Leucine may lower brain serotonin and dopamine. A dose of 3 g of isoleucine added to the niacin regime has cleared leucine-aggravated psychosis in schizophrenic patients. Isoleucine may have potential as an antipsychotic treatment. Leucine is more highly concentrated in foods than other amino acids. A cup of milk contains 800 mg of leucine and only 500 mg of isoleucine and valine. A cup of wheat germ has about 1.6 g of leucine and 1 g of isoleucine and valine. The ratio evens out in eggs and cheese. One egg and an ounce of most cheeses each contain about 400 mg of leucine and 400 mg of valine and isoleucine. The ratio of leucine to other BCAA is greatest in pork, where leucine is 7 to 8 g and the other BCAA together are only 3 to 4 g. (http://www.dcnutrition.com). L-Isoleucine is found in many foods, some of which are atlantic salmon, quince, baked potato, and pistachio. (2S,3S)-2-amino-3-Methyl-pentanoate (2S,3S)-2-amino-3-Methyl-pentanoic acid (2S,3S)-2-amino-3-Methylpentanoate (2S,3S)-2-amino-3-Methylpentanoic acid (2S,3S)-a-amino-b-Methyl-N-valerate (2S,3S)-a-amino-b-Methyl-N-valeric acid (2S,3S)-a-amino-b-Methylvalerate (2S,3S)-a-amino-b-Methylvaleric acid (2S,3S)-Alph-amino-beta-methylvalerate (2S,3S)-Alph-amino-beta-methylvaleric acid (2S,3S)-alpha-amino-beta-Merthyl-N-valerate (2S,3S)-alpha-amino-beta-Merthyl-N-valeric acid (2S,3S)-alpha-amino-beta-Merthylvalerate (2S,3S)-alpha-amino-beta-Merthylvaleric acid (2S,3S)-alpha-amino-beta-Methyl-N-valerate (2S,3S)-alpha-amino-beta-Methyl-N-valeric acid (2S,3S)-alpha-amino-beta-Methylvalerate (2S,3S)-alpha-amino-beta-Methylvaleric acid (S,S)-Isoleucine (S)-Isoleucine [S-(R*,r*)]-2-amino-3-methylpentanoate [S-(R*,r*)]-2-amino-3-methylpentanoic acid &alpha;-amino-&beta;-methylvaleric acid 2-amino-3-Methylpentanoate 2-amino-3-Methylpentanoic acid 2-amino-3-Methylvalerate 2-amino-3-Methylvaleric acid 2S,3S-Isoleucine a-amino-b-Methylvalerate a-amino-b-Methylvaleric acid alpha-amino-beta-Methylvalerate alpha-amino-beta-Methylvaleric acid erythro-L-Isoleucine Ile Iso-leucine Isoleucine (van) Isoleucine; L-erythro-form L-(+)-Isoleucine L-Ile L-Isoleucine sec-C4H9CH(NH2)COOH α-amino-β-methylvalerate α-amino-β-methylvaleric acid C6H13NO2 131.1729 131.094628665 2-amino-3-methylpentanoic acid L(+)-isoleucine 73-32-5 CCC(C)C(N)C(O)=O InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) AGPKZVBTJJNPAG-UHFFFAOYSA-N belongs to the class of organic compounds known as isoleucine and derivatives. Isoleucine and derivatives are compounds containing isoleucine or a derivative thereof resulting from reaction of isoleucine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Isoleucine and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Alpha amino acids Amino acids Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Methyl-branched fatty acids Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Aliphatic acyclic compound Alpha-amino acid Amine Amino acid Branched fatty acid Carbonyl group Carboxylic acid Fatty acid Fatty acyl Hydrocarbon derivative Isoleucine or derivatives Methyl-branched fatty acid Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine alpha-amino acid branched-chain amino acid Solid logp -1.73 ALOGPS logs -0.06 ALOGPS solubility 1.14e+02 g/l ALOGPS melting_point Mp 285-286° dec. logp -1.5 ChemAxon pka_strongest_acidic 2.79 ChemAxon pka_strongest_basic 9.59 ChemAxon iupac 2-amino-3-methylpentanoic acid ChemAxon average_mass 131.1729 ChemAxon mono_mass 131.094628665 ChemAxon smiles CCC(C)C(N)C(O)=O ChemAxon formula C6H13NO2 ChemAxon inchi InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) ChemAxon inchikey AGPKZVBTJJNPAG-UHFFFAOYSA-N ChemAxon polar_surface_area 63.32 ChemAxon refractivity 34.09 ChemAxon polarizability 14.19 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Transcription/Translation SMP00019 Valine, Leucine and Isoleucine Degradation SMP00032 map00280 Specdb::NmrOneD 123678 Specdb::NmrOneD 123679 Specdb::NmrOneD 123680 Specdb::NmrOneD 123681 Specdb::NmrOneD 123682 Specdb::NmrOneD 123683 Specdb::NmrOneD 123684 Specdb::NmrOneD 123685 Specdb::NmrOneD 123686 Specdb::NmrOneD 123687 Specdb::NmrOneD 123688 Specdb::NmrOneD 123689 Specdb::NmrOneD 123690 Specdb::NmrOneD 123691 Specdb::NmrOneD 123692 Specdb::NmrOneD 123693 Specdb::NmrOneD 123694 Specdb::NmrOneD 123695 Specdb::NmrOneD 123696 Specdb::NmrOneD 123697 Specdb::CMs 956 Specdb::CMs 1026 Specdb::CMs 23982 Specdb::CMs 43586 Specdb::CMs 125196 Specdb::CMs 126652 Specdb::CMs 155544 Specdb::MsMs 20501 Specdb::MsMs 20502 Specdb::MsMs 20503 Specdb::MsMs 22052 Specdb::MsMs 22053 Specdb::MsMs 22054 Specdb::MsMs 440026 Specdb::MsMs 445206 Specdb::MsMs 445207 Specdb::MsMs 445208 Specdb::MsMs 445209 Specdb::MsMs 447335 Specdb::MsMs 447532 Specdb::MsMs 447533 Specdb::MsMs 447534 Specdb::MsMs 447535 Specdb::MsMs 447536 Specdb::MsMs 447537 Specdb::MsMs 447538 Specdb::MsMs 447539 Specdb::MsMs 447540 Specdb::MsMs 447541 Specdb::MsMs 447542 Specdb::MsMs 447543 Specdb::MsMs 451867 HMDB00172 ILE #<Reference:0x0000561272ff36f8> #<Reference:0x0000561272ff3540> #<Reference:0x0000561272ff3388> #<Reference:0x0000561272ff31d0> #<Reference:0x0000561272ff3018> #<Reference:0x0000561272ff2e60> #<Reference:0x0000561272ff2ca8> #<Reference:0x0000561272ff2af0> #<Reference:0x0000561272ff2938> #<Reference:0x0000561272ff2780> #<Reference:0x0000561272ff25a0> #<Reference:0x0000561272ff23e8> #<Reference:0x0000561272ff2230> #<Reference:0x0000561272ff2078> #<Reference:0x0000561272ff1ec0> #<Reference:0x0000561272ff1d08> #<Reference:0x0000561272ff1b50> #<Reference:0x0000561272ff1998> Abalone Type 1 specific Haliotis 6452 799.0 854.0 744.0 mg/100 g Abiyuch Type 1 specific Crateva religiosa 202634 Acerola Type 1 specific Malpighia emarginata 151847 Acorn Type 1 specific Quercus 3511 252.32125 376.0 0.285 mg/100 g Acorn squash Type 1 Cucurbita pepo var. turbinata 0.031 0.031 0.031 mg/100 g Adzuki bean Type 1 specific Vigna angularis 3914 420.9 852.4 131.0 mg/100 g Agar Type 1 specific Eucheuma 31444 Agave Type 1 specific Agave 39509 7.007 14.0 0.014 mg/100 g Alaska blueberry Type 1 specific Vaccinium alaskaense 190544 Alaska pollock Type 1 specific Theragra chalcogramma 1042646 827.5 1082.0 573.0 mg/100 g Alaska wild rhubarb Type 1 specific Polygonum alpinum 125586 Albacore tuna Type 1 specific Thunnus alalunga 8235 1155.5 1223.0 1088.0 mg/100 g Albizia gummifera Type 1 Albizia gummifera Alfalfa Type 1 specific Medicago sativa 3879 141.5 143.0 140.0 mg/100 g Allium Type 1 specific Allium 4678 73.772727 316.0 14.0 mg/100 g Allspice Type 1 specific Pimenta dioica 375272 Almond Type 1 specific Prunus dulcis 3755 637.665462 950.0 0.0 mg/100 g Alpine sweetvetch Type 1 specific Hedysarum alpinum 57576 Amaranth Type 1 specific Amaranthus 3564 280.147 775.3 0.582 mg/100 g American butterfish Type 1 specific Peprilus triacanthus 183653 605.932 1021.0 0.796 mg/100 g American cranberry Type 1 specific Vaccinium macrocarpon 13750 33.0 33.0 33.0 mg/100 g American lobster Type 1 specific Homarus americanus 6706 518.574333 832.0 0.723 mg/100 g American pokeweed Type 1 specific Phytolacca americana 3527 American shad Type 1 specific Alosa sapidissima 34773 593.593333 1000.0 0.78 mg/100 g Anatidae Type 1 specific Anatidae 8830 432.94625 1000.0 0.537 mg/100 g Anchovy Type 1 specific Engraulidae 43062 355.469 710.0 0.938 mg/100 g Angelica Type 1 specific Angelica keiskei 357850 Anguilliformes Type 1 specific Anguilliformes 7933 590.283333 960.0 0.85 mg/100 g Anise Type 1 specific Pimpinella anisum 271192 Annual wild rice Type 1 specific Zizania aquatica 75727 Apple Type 1 specific Malus pumila 283210 12.723167 52.0 0.006 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 39.311476 170.5 0.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 56.222222 172.0 0.0 mg/100 g Arctic blackberry Type 1 specific Rubus arcticus 70741 Arepa Type 2 specific 207.0 207.0 207.0 mg/100 g Arrowhead Type 1 specific Sagittaria latifolia 15008 Arrowroot Type 1 specific Maranta arundinacea 210060 10.0 10.0 10.0 mg/100 g Asian pear Type 1 specific Pyrus pyrifolia 3767 7.007 14.0 0.014 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 119.178333 778.6 0.075 mg/100 g Atlantic cod Type 1 specific Gadus morhua 8049 1163.5642 2895.0 0.821 mg/100 g Atlantic croaker Type 1 specific Micropogonias undulatus 29154 555.606333 847.0 0.819 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 733.647667 1100.0 0.943 mg/100 g Atlantic herring Type 1 specific Clupea harengus harengus 7950 801.804667 1134.0 0.828 mg/100 g Atlantic mackerel Type 1 specific Scomber scombrus 13677 978.0 1099.0 857.0 mg/100 g Atlantic pollock Type 1 specific Pollachius pollachius 185739 681.619 1148.0 0.857 mg/100 g Atlantic salmon Type 1 specific Salmo salar 8030 814.5828 1172.0 0.914 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 652.7015 1034.0 0.806 mg/100 g Avocado Type 1 specific Persea americana 3435 81.922333 166.45 0.084 mg/100 g Babassu palm Type 1 specific Attalea speciosa 145700 0.0 0.0 0.0 mg/100 g Baby food Type 2 specific 238.212121 729.0 0.0 mg/100 g Bagel Type 2 specific 404.888889 449.0 367.0 mg/100 g Baked beans Type 2 specific 247.571429 297.0 223.0 mg/100 g Baked potato Type 2 specific 233.2 314.0 101.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 49.6176 88.0 0.088 mg/100 g Banana Type 1 specific Musa acuminata 4641 58.757 167.0 0.028 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 298.109076 456.0 0.362 mg/100 g Bayberry Type 1 specific Myrica 3509 Bean Type 1 specific 247.571429 297.0 223.0 mg/100 g Bearded seal Type 1 specific Erignathus barbatus 39304 1934.25 3134.0 896.0 mg/100 g Beech nut Type 1 specific Fagus 21024 122.6225 245.0 0.245 mg/100 g Beer Type 2 specific 3.454545 8.0 0.0 mg/100 g Beluga whale Type 1 specific Delphinapterus leucas 9749 2684.0 2684.0 2684.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 0.0 0.0 0.0 mg/100 g Biscuit Type 2 specific 233.65 516.0 109.0 mg/100 g Bison Type 1 specific Bison bison 9901 0.901 0.901 0.901 mg/100 g Bitter gourd Type 1 specific Momordica charantia 3673 Bivalvia (Clam, Mussel, Oyster) Type 1 specific Bivalvia 6544 603.375 1144.0 0.0 mg/100 g Black cabbage Type 1 specific Brassica oleracea var. viridis 3713 103.833333 121.0 86.0 mg/100 g Black chokeberry Type 1 specific Photinia melanocarpa 661339 Black crowberry Type 1 specific Empetrum nigrum 191066 Black elderberry Type 1 specific Sambucus nigra 4202 Black huckleberry Type 1 specific Gaylussacia baccata 128893 Black mulberry Type 1 specific Morus nigra 85232 Black plum Type 1 Syzygium cumini Black radish Type 1 specific Raphanus sativus var. niger 41679 Black raisin Type 1 Black raspberry Type 1 specific Rubus occidentalis 75079 Black salsify Type 1 specific Scorzonera hispanica 114289 Black tea Type 1 0.5 3.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 483.483 966.0 0.966 mg/100 g Black-eyed pea Type 1 specific Vigna unguiculata ssp. unguiculata 3920 290.701077 956.0 0.158 mg/100 g Blackberry Type 1 specific Rubus Blackcurrant Type 1 specific Ribes nigrum 78511 0.466667 2.8 0.0 mg/100 g Blue cheese Type 2 1.124 1.124 1.124 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 684.775 996.0 0.875 mg/100 g Blue mussel Type 1 specific Mytilus edulis 6550 518.172667 1036.0 0.518 mg/100 g Bluefish Type 1 specific Pomatomus saltatrix 75034 702.641 1184.0 0.923 mg/100 g Bog bilberry Type 1 specific Vaccinium uliginosum 190548 Borage Type 1 specific Borago officinalis 13363 Boysenberry Type 1 specific Rubus ursinus X idaeus Brassicas Unknown generic 3705 Brazil nut Type 1 specific Bertholletia excelsa 3645 569.133333 611.4 516.0 mg/100 g Breadfruit Type 1 specific Artocarpus altilis 194251 222.635667 443.0 0.064 mg/100 g Breadnut tree seed Type 1 specific Brosimum alicastrum 194253 275.446 488.0 0.338 mg/100 g Breakfast cereal Type 2 specific 260.52459 1066.0 0.0 mg/100 g Breakfast sandwich Type 2 specific 533.714286 654.0 358.0 mg/100 g Broad bean Type 1 specific Vicia faba 3906 419.125 1053.0 215.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 114.170794 211.9 0.0035 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 156.115167 537.25 0.132 mg/100 g Buffalo Type 1 specific Bubalus bubalis 89462 1.023 1.023 1.023 mg/100 g Buffalo currant Type 1 specific Ribes aureum var. villosum 23283 Bulgur Type 2 specific 189.818333 455.0 0.455 mg/100 g Burbot Type 1 specific Lota lota 69944 677.296667 1141.0 0.89 mg/100 g Burdock Type 1 specific Arctium lappa 4217 40.406 90.0 0.03 mg/100 g Burrito Type 2 specific 359.5 574.0 117.0 mg/100 g Butter Type 2 specific 30.341833 51.0 0.0 mg/100 g Butterfat Type 2 specific 17.0 17.0 17.0 mg/100 g Buttermilk Type 2 specific 429.166571 2075.0 0.166 mg/100 g Butternut Type 1 specific Juglans cinerea 91214 793.176333 1199.35 1.179 mg/100 g Butternut squash Type 1 specific Cucurbita moschata 3662 39.148429 69.0 0.039 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 219.165 438.3 0.03 mg/100 g Cake Type 2 specific 216.104167 470.0 109.0 mg/100 g Calabash Type 1 specific Lagenaria siceraria 3668 96.7066 386.5 0.033 mg/100 g Canada blueberry Type 1 specific Vaccinium myrtilloides 1503870 Cannellini bean Type 1 Canola Type 2 specific 138011 Cantaloupe melon Type 1 Cucumis melo var. cantalupensis 0.001 0.001 0.001 mg/100 g Cape gooseberry Type 1 Physalis peruviana Capers Type 1 specific Capparis spinosa 65558 Caraway Type 1 specific Carum carvi 48032 826.0 826.0 826.0 mg/100 g Cardamom Type 1 specific Elettaria cardamomum 105181 Cardoon Type 1 specific Cynara cardunculus 4265 Carob Type 1 specific Ceratonia siliqua 20340 927.0 1645.0 209.0 mg/100 g Carp bream Type 1 specific Abramis brama 38527 0.822 0.822 0.822 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 59.059932 323.0 0.0185 mg/100 g Cascade huckleberry Type 1 specific Vaccinium deliciosum 190531 Casein Type 2 specific 4100.0 4100.0 4100.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 757.23 838.0 720.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 45.06925 127.25 0.027 mg/100 g Castanospermum australe Type 1 Castanospermum australe Catfish Type 1 specific Siluriformes 7995 623.585 1100.0 0.755 mg/100 g Catjang pea Type 1 specific Vigna unguiculata ssp. cylindrica 3840 407.49225 969.0 0.969 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 1132.27252 1808.0 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 78.219357 116.0 0.071 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 54.0 54.0 54.0 mg/100 g Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 54.0 54.0 54.0 mg/100 g Celery stalks Type 1 specific Apium graveolens var. dulce 117781 0.021 0.021 0.021 mg/100 g Cereals and cereal products Unknown generic Ceylon cinnamon Type 1 specific Cinnamomum verum 128608 Channel catfish Type 1 specific Ictalurus punctatus 7998 656.7925 851.0 0.755 mg/100 g Chanterelle Type 1 specific Cantharellus cibarius 36066 Chayote Type 1 specific Sechium edule 184140 86.965667 366.75 0.044 mg/100 g Cheese Type 2 specific 1181.273504 2202.0 190.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 21.021 42.0 0.042 mg/100 g Cherry tomato Type 1 specific Solanum lycopersicum var. cerasiforme 195583 Chervil Type 1 specific Anthriscus cerefolium 40888 137.5 180.0 95.0 mg/100 g Chestnut Type 1 specific Castanea 21019 40.0785 80.0 0.157 mg/100 g Chia Type 1 specific Salvia hispanica 49212 400.9005 801.0 0.801 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 471.986889 930.0 0.882 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 144.157286 642.0 0.101 mg/100 g Chicory leaves Type 1 specific Cichorium intybus var. foliosum 13427 Chicory roots Type 1 specific Cichorium intybus var. sativum 13427 Chili Type 2 specific 317.0 403.0 250.0 mg/100 g Chimichanga Type 2 specific 416.5 481.0 332.0 mg/100 g Chinese bayberry Type 1 specific Myrica rubra 262757 Chinese broccoli Type 1 specific Brassica alboglabra 3714 Chinese cabbage Type 1 specific Brassica rapa 3711 35.0425 70.0 0.085 mg/100 g Chinese chestnut Type 1 specific Castanea mollissima 60419 137.4314 255.0 0.157 mg/100 g Chinese chives Type 1 specific Allium tuberosum 4683 0.139 0.139 0.139 mg/100 g Chinese cinnamon Type 1 specific Cinnamomum aromaticum 119260 146.0 146.0 146.0 mg/100 g Chinese mustard Type 1 specific Brassica juncea 3707 86.5 98.0 82.0 mg/100 g Chinese plum Type 1 Chinese water chestnut Type 1 specific Eleocharis dulcis 110284 Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 783.820667 1185.0 0.924 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 386.6778 899.0 0.139 mg/100 g Chocolate Type 2 specific 287.285714 471.0 0.0 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 835.821333 1190.0 0.928 mg/100 g Cichlidae (Tilapia) Type 1 specific Cichlidae 8113 716.976667 1220.0 0.93 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 0.073 0.146 0.0 mg/100 g Cisco Type 1 specific Coregonus artedi 36181 543.291667 875.0 0.875 mg/100 g Citrus Unknown generic Clam Type 1 0.693 0.693 0.693 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 662.68075 910.0 0.723 mg/100 g Clementine Type 1 Citrus × clementina Climbing bean Type 1 specific Vigna umbellata 87088 Cloud ear fungus Type 1 specific Auricularia polytricha 29893 Cloudberry Type 1 specific Rubus chamaemorus 57936 Cloves Type 1 specific Syzygium aromaticum 219868 120.12 240.0 0.24 mg/100 g Clupeinae (Herring, Sardine, Sprat) Type 1 specific Clupeinae 7948 666.666667 1100.0 0.0 mg/100 g Cocoa bean Type 1 specific Theobroma cacao 3641 560.0 560.0 560.0 mg/100 g Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa powder Type 2 specific 576.2 760.0 180.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 93.9605 290.0 0.0 mg/100 g Coffee Type 1 generic Coffea 13442 56.222222 172.0 0.0 mg/100 g Coffee substitute Type 2 specific 161.5 199.0 124.0 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 905.570857 1261.0 0.996 mg/100 g Cold cut Type 2 specific 756.0 1151.0 540.0 mg/100 g Colorado pinyon Type 1 specific Pinus edulis 3340 304.816667 464.0 0.45 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 1.028333 1.187 0.943 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 373.6425 1118.0 29.0 mg/100 g Common beet Type 1 specific Beta vulgaris 161934 35.337333 53.0 0.048 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 338.56225 608.0 0.498 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 48.8561 197.0 0.061 mg/100 g Common carp Type 1 specific Cyprinus carpio 7962 625.607333 1054.0 0.822 mg/100 g Common chokecherry Type 1 specific Prunus virginiana 133204 Common grape Type 1 specific Vitis vinifera 29760 27.783333 57.0 11.0 mg/100 g Common hazelnut Type 1 specific Corylus avellana 13451 0.545 0.545 0.545 mg/100 g Common ling Type 1 specific Molva molva 163112 665.958333 1122.0 0.875 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 76.461538 107.0 46.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 649.216333 1298.0 0.649 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 220.7205 441.0 0.441 mg/100 g Common pea Type 1 specific Pisum sativum 3888 281.115 1014.0 111.0 mg/100 g Common persimmon Type 1 specific Diospyros virginiana 13493 17.5175 35.0 0.035 mg/100 g Common sage Type 1 specific Salvia officinalis 38868 Common salsify Type 1 specific Tragopogon porrifolius 13731 Common thyme Type 1 specific Thymus vulgaris 49992 248.0906 486.7 0.285 mg/100 g Common verbena Type 1 specific Verbena officinalis 79772 Common walnut Type 1 specific Juglans regia 51240 400.791667 625.0 0.625 mg/100 g Common wheat Type 1 specific Triticum aestivum 4565 709.0 1350.0 396.0 mg/100 g Conch Type 1 specific Strombidae 69694 Condensed milk Type 2 specific 479.0 479.0 479.0 mg/100 g Cooking oil Type 2 specific 0.0 0.0 0.0 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 Corn Type 1 specific Zea mays 4577 163.334964 485.0 0.0 mg/100 g Corn chip Type 2 specific 272.375 366.0 209.0 mg/100 g Corn grits Type 2 specific 131.230769 314.0 51.0 mg/100 g Corn salad Type 1 specific Valerianella locusta 59166 418.0 737.0 99.0 mg/100 g Cornbread Type 2 specific 277.0 310.0 254.0 mg/100 g Cornmint Type 1 specific Mentha arvensis 292239 Cottonseed Type 1 specific Gossypium 3633 888.024857 1796.0 0.0 mg/100 g Cottonseed oil Type 2 0.0 0.0 0.0 mg/100 g Couscous Type 2 specific 320.0 493.0 147.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 0% fat Type 2 specific 174.0 174.0 174.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 1% fat Type 2 specific 174.0 174.0 174.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 2% fat Type 2 specific 171.0 171.0 171.0 mg/100 g Cow milk, pasteurized, vitamin D added, 3.25% fat Type 2 specific 163.0 163.0 163.0 mg/100 g Cowpea Type 1 specific Vigna unguiculata 3917 0.158 0.158 0.158 mg/100 g Crab Type 1 specific Brachyura 6752 522.109833 1100.0 0.875 mg/100 g Cracker Type 2 specific 384.558824 610.0 246.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 524.915 847.0 0.718 mg/100 g Cream Type 2 specific 125.3794 194.0 0.131 mg/100 g Cream substitute Type 2 specific 101.833333 294.0 26.0 mg/100 g Crisp bread Type 2 specific 426.333333 570.0 318.0 mg/100 g Crosne Type 1 Stachys affinis Cubanelle pepper Type 1 Cucumber Type 1 specific Cucumis sativus 3659 30.382385 223.65 0.021 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 170.157609 1281.0 14.0 mg/100 g Cumin Type 1 specific Cuminum cyminum 52462 Cupuaçu Type 1 specific Theobroma grandiflorum 108881 0.0 0.0 0.0 mg/100 g Curry powder Type 2 specific Cusk Type 1 specific Brosme brosme 81638 665.958333 1122.0 0.875 mg/100 g Custard apple Type 1 specific Annona reticulata 301862 Cuttlefish Type 1 specific Sepiidae 6608 707.235667 1414.0 0.707 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 74.836667 344.0 0.02 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 Date Type 1 specific Phoenix dactylifera 42345 74.509 233.5 0.045 mg/100 g Deer Type 1 specific Cervidae 9850 1073.878667 1541.0 0.908 mg/100 g Deerberry Type 1 specific Vaccinium stamineum 176259 Devilfish Type 1 specific Myoxocephalus 8095 Dill Type 1 specific Anethum graveolens 40922 330.934167 798.85 0.0 mg/100 g Dock Type 1 specific Rumex 3618 72.0255 102.0 0.102 mg/100 g Dolphin fish Type 1 specific Coryphaena hippurus 34814 972.5 1093.0 852.0 mg/100 g Domestic goat Type 1 specific Capra aegagrus hircus 9925 804.680667 1371.0 1.042 mg/100 g Domestic pig Type 1 specific Sus scrofa domestica 9825 989.409877 1812.0 0.0 mg/100 g Dried milk Type 2 specific 1961.777778 2188.0 1592.0 mg/100 g Dungeness crab Type 1 specific Cancer magister 29965 641.281333 1079.0 0.844 mg/100 g Durian Type 1 specific Durio zibethinus 66656 Eastern oyster Type 1 specific Crassostrea virginica 6565 269.032714 459.0 0.229 mg/100 g Eddoe Type 1 Colocasia antiquorum Edible shell Type 2 specific 239.5 259.0 220.0 mg/100 g Egg roll Type 2 specific 289.0 350.0 210.0 mg/100 g Egg substitute Type 2 specific 330.33 660.0 0.66 mg/100 g Egg yolk Type 1 0.07 0.07 0.07 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 70.509375 321.4 0.045 mg/100 g Eggs Unknown generic 1319.65125 5023.0 0.05 mg/100 g Elderberry Type 1 specific Sambucus 4201 23.5 27.0 20.0 mg/100 g Elk Type 1 specific Cervus canadensis 1574408 0.913 0.913 0.913 mg/100 g Elliott's blueberry Type 1 specific Vaccinium elliottii 283798 Empanada Type 2 specific 461.0 461.0 461.0 mg/100 g Emu Type 1 specific Dromaius novaehollandiae 8790 0.74 0.74 0.74 mg/100 g Enchilada Type 2 specific 321.666667 407.0 275.0 mg/100 g Endive Type 1 specific Cichorium endivia 114280 166.5544 615.7 0.072 mg/100 g Enokitake Type 1 specific Flammulina velutipes 38945 90.0 90.0 90.0 mg/100 g Epazote Type 1 specific Dysphania ambrosioides 330163 European anchovy Type 1 specific Engraulis encrasicolus 184585 756.646 1331.0 0.938 mg/100 g European chestnut Type 1 specific Castanea sativa 21020 117.2705 252.0 0.064 mg/100 g European cranberry Type 1 specific Vaccinium oxycoccos 516948 European plum Type 1 specific Prunus domestica 3758 21.805 62.05 7.0 mg/100 g European rabbit Type 1 specific Oryctolagus 9984 1.034 1.034 1.034 mg/100 g Evaporated milk Type 2 specific 423.25 457.0 412.0 mg/100 g Evening primrose Type 1 specific Oenothera biennis 3942 498.5 498.5 498.5 mg/100 g Evergreen huckleberry Type 1 specific Vaccinium ovatum 84019 Falafel Type 2 specific 567.0 567.0 567.0 mg/100 g Feijoa Type 1 specific Feijoa sellowiana 260130 13.0095 26.0 0.019 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 701.233333 728.7 680.0 mg/100 g Fenugreek Type 1 specific Trigonella foenum-graecum 78534 820.080333 1241.0 1.241 mg/100 g Fig Type 1 specific Ficus carica 3494 37.963583 100.0 0.013 mg/100 g Fireweed Type 1 specific Chamerion angustifolium 13055 Flatfish Type 1 specific Pleuronectiformes 8252 567.1535 900.0 0.614 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 524.224 1200.0 0.0 mg/100 g Florida pompano Type 1 specific Trachinotus carolinus 173342 647.950333 1092.0 0.851 mg/100 g Flour Type 2 specific Fox grape Type 1 specific Vitis labrusca 103355 French plantain Type 1 specific Musa X paradisiaca 89151 31.0 36.0 22.0 mg/100 g French toast Type 2 specific 335.5 394.0 234.0 mg/100 g Freshwater drum Type 1 specific Aplodinotus grunniens 225389 614.936 1036.0 0.808 mg/100 g Freshwater eel Type 1 specific Anguilla 7935 646.95 1090.0 0.85 mg/100 g Frozen yogurt Type 2 specific 221.0 228.0 214.0 mg/100 g Fruit preserve Type 2 specific 17.0 17.0 17.0 mg/100 g Fruit-flavor drink Type 2 specific 93.5 183.0 4.0 mg/100 g Fruits Unknown generic Gadiformes Type 1 specific Gadiformes 8043 0.75 0.821 0.679 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 487.755462 1200.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 99.0 99.0 99.0 mg/100 g Garden onion Type 1 specific Allium cepa 4679 66.1748 249.9 0.014 mg/100 g Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 0.014 0.014 0.014 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 27.0 27.0 27.0 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 70.931034 340.0 0.0 mg/100 g Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 184.05 184.05 184.05 mg/100 g Garfish Type 1 specific Belone belone 129037 1000.0 1000.0 1000.0 mg/100 g Garland chrysanthemum Type 1 specific Chrysanthemum coronarium 99038 Garlic Type 1 specific Allium sativum 4682 282.2434 560.0 0.217 mg/100 g Gefilte fish Type 2 specific 486.0 486.0 486.0 mg/100 g Gelatin Type 2 specific 1400.0 1400.0 1400.0 mg/100 g Gelatin dessert Type 2 specific 441.0 1158.0 0.0 mg/100 g Gentiana lutea Type 1 Gentiana lutea German camomile Type 1 specific Matricaria recutita 127986 Giant butterbur Type 1 specific Petasites japonicus 186965 Gin Type 2 specific 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 123.1702 341.0 0.051 mg/100 g Ginkgo nuts Type 1 specific Ginkgo biloba 3311 231.5518 500.0 0.209 mg/100 g Ginseng Type 1 specific Panax 4054 Globe artichoke Type 1 specific Cynara scolymus 59895 Goji Type 1 0.261 0.261 0.261 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 0.0 0.0 0.0 mg/100 g Gram bean Type 1 specific Vigna mungo 3915 685.666667 1287.0 385.0 mg/100 g Grape Type 1 specific Vitis 3603 8.308923 67.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 6.846692 16.0 0.007 mg/100 g Grapefruit/Pummelo hybrid Type 1 specific Citrus paradisi X Citrus maxima 37656 0.008 0.008 0.008 mg/100 g Grapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Grass pea Type 1 specific Lathyrus sativus 3860 Greater sturgeon Type 1 specific Acipenser 7901 784.186 1438.0 0.744 mg/100 g Greek feta cheese Type 2 0.803 0.803 0.803 mg/100 g Green apple Type 1 Green bean Type 1 specific Phaseolus vulgaris 3885 60.36 92.76 29.0 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 79.075 579.0 22.0 mg/100 g Green cabbage Type 1 Brassica oleracea var. sabauda L. Green grape Type 1 Green lentil Type 1 Lens culinaris 1.065 1.065 1.065 mg/100 g Green onion Type 1 Green plum Type 1 0.014 0.014 0.014 mg/100 g Green tea Type 1 0.5 3.0 0.0 mg/100 g Green vegetables Unknown generic Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 62.081286 353.25 0.098 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 550.4155 849.0 0.662 mg/100 g Greenthread tea Type 1 specific Thelesperma 153159 Groundcherry Type 1 specific Physalis 24663 Grouper Type 1 specific Epinephelus 94231 679.631 1145.0 0.893 mg/100 g Guarana Type 1 Paullinia cupana Guava Type 1 specific Psidium guajava 120290 52.2186 123.0 0.093 mg/100 g Guinea hen Type 1 specific Numida meleagris 8996 1.09 1.09 1.09 mg/100 g Haddock Type 1 specific Melanogrammus aeglefinus 8056 1080.0 1300.0 871.0 mg/100 g Half-highbush blueberry Type 1 specific Vaccinium angustifolium X Vaccinium corymbosum 934696 Hamburger Type 2 specific 575.21875 822.0 345.0 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 533.0 533.0 533.0 mg/100 g Hawthorn Type 1 Crataegus Hazelnut Type 1 specific Corylus 13450 387.090833 730.0 0.0 mg/100 g Heart of palm Type 1 specific 101.0 101.0 101.0 mg/100 g Hedge mustard Type 1 specific Sisymbrium 3729 650.0 650.0 650.0 mg/100 g Herbal tea Type 1 0.0 0.0 0.0 mg/100 g Herbs and Spices Unknown generic Hibiscus tea Type 1 specific Hibiscus sabbariffa 183260 Hickory nut Type 1 specific Carya 13402 288.288 576.0 0.576 mg/100 g Highbush blueberry Type 1 specific Vaccinium corymbosum 69266 78.75 78.75 78.75 mg/100 g Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 816.9918 1165.0 0.959 mg/100 g Honey Type 2 specific 2.669333 8.0 0.0 mg/100 g Horned melon Type 2 specific Cucumis metuliferus 61886 Horse Type 1 specific Equus caballus 9796 1.014 1.014 1.014 mg/100 g Horseradish Type 1 specific Armoracia rusticana 3704 150.0 150.0 150.0 mg/100 g Horseradish tree Type 1 specific Moringa oleifera 3735 559.8125 1282.25 253.0 mg/100 g Hot chocolate Type 2 specific 182.888889 220.0 140.0 mg/100 g Hot dog Type 2 specific 459.666667 497.0 429.0 mg/100 g Hummus Type 2 specific 206.0 206.0 206.0 mg/100 g Hushpuppy Type 2 specific 321.0 321.0 321.0 mg/100 g Hyacinth bean Type 1 specific Lablab purpureus 35936 434.592875 1143.0 1.143 mg/100 g Hyssop Type 1 specific Hyssopus officinalis 39324 Ice cream Type 2 specific 216.615385 272.0 172.0 mg/100 g Ice cream cone Type 2 specific 297.0 301.0 293.0 mg/100 g Iceberg lettuce Type 1 0.018 0.018 0.018 mg/100 g Icing Type 2 specific 45.333333 119.0 0.0 mg/100 g Irish moss Type 1 specific Chondrus crispus 2769 Italian oregano Type 1 specific Origanum X majoricum 1384207 0.441 0.441 0.441 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 76.727273 579.0 20.0 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 34.5345 69.0 0.069 mg/100 g Jalapeno pepper Type 1 Capsicum annuum 'Jalapeño' Japanese chestnut Type 1 specific Castanea crenata 103480 111.0222 258.0 0.111 mg/100 g Japanese persimmon Type 1 specific Diospyros kaki 35925 28.341667 60.0 0.025 mg/100 g Japanese pumpkin Type 1 specific Cucurbita maxima 3661 540.663636 1281.0 21.0 mg/100 g Japanese sea bass Type 1 Lateolabrax japonicus 0.849 0.849 0.849 mg/100 g Japanese walnut Type 1 specific Juglans ailanthifolia 91209 Java plum Type 1 specific Syzygium cumini 260142 Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 157.25 314.5 0.0 mg/100 g Jew's ear Type 1 specific Auricularia auricula-judae 29892 Jicama Type 1 specific Pachyrhizus erosus 109171 41.2532 158.25 0.016 mg/100 g Jostaberry Type 1 specific Ribes × nidigrolaria Jujube Type 1 specific Ziziphus zizyphus 48393 Juniperus communis Type 1 Juniperus communis Junket Type 2 specific 166.0 189.0 85.0 mg/100 g Jute Type 1 specific Corchorus olitorius 93759 314.2442 1000.0 0.221 mg/100 g Kai-lan Type 1 specific Brassica oleracea var. alboglabra 3714 Kale Type 1 specific Brassica napus var. pabularia 133.727273 180.0 71.0 mg/100 g Kefir Type 2 specific 190.0 190.0 190.0 mg/100 g Kelp Type 1 specific Laminaria 33637 38.038 76.0 0.076 mg/100 g Ketchup Type 2 specific 59.333333 72.0 53.0 mg/100 g King mackerel Type 1 specific Scomberomorus cavalla 13679 711.311667 1198.0 0.935 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 32.751125 51.0 0.0045 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 132.571333 472.35 0.078 mg/100 g Komatsuna Type 1 specific Brassica rapa var. perviridis 344680 Kombu Type 1 specific Saccharina japonica 88149 Kumquat Type 1 specific Fortunella 2706 Lambsquarters Type 1 specific Chenopodium album 3559 314.3106 932.3 0.253 mg/100 g Lantern fruit Type 1 Physalis alkekengi Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Lasagna Type 2 specific 246.5 293.0 200.0 mg/100 g Leavening agent Type 2 specific 982.666667 1890.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 29.526 59.0 0.052 mg/100 g Lemon Type 1 specific Citrus limon 2708 14.0 14.0 14.0 mg/100 g Lemon balm Type 1 specific Melissa officinalis 39338 Lemon grass Type 1 specific Cymbopogon citratus 66014 Lemon sole Type 1 specific Microstomus kitt 106175 450.307 900.0 0.614 mg/100 g Lemon thyme Type 1 specific Thymus pulegioides 751873 Lemon verbena Type 1 specific Aloysia triphylla 542672 Lentils Type 1 generic Lens culinaris 3864 613.817917 1288.5 1.065 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 101.58375 742.0 0.005 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.0 0.0 0.0 mg/100 g Lima bean Type 1 specific Phaseolus lunatus 3884 473.7345 1129.0 0.44 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 0.0 0.0 0.0 mg/100 g Linden Type 1 specific Tilia 64580 Lingcod Type 1 specific Ophiodon elongatus 225387 619.271333 1043.0 0.814 mg/100 g Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 0.0 0.0 0.0 mg/100 g Liquor Type 2 specific 85.0 170.0 0.0 mg/100 g Liquorice Type 2 specific 0.0 0.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus Longan Type 1 specific Dimocarpus longan 128017 41.008667 97.0 0.026 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 10.005 15.0 0.015 mg/100 g Lotus Type 1 specific Nelumbo 4430 323.351333 765.0 0.054 mg/100 g Lovage Type 1 specific Levisticum officinale 48042 Lowbush blueberry Type 1 specific Vaccinium angustifolium 472369 Lupine Type 1 specific Lupinus 3869 1.615 1.615 1.615 mg/100 g Macadamia nut Type 1 specific Macadamia 4329 217.7035 314.0 0.314 mg/100 g Macadamia nut (M. tetraphylla) Type 1 specific Macadamia tetraphylla 512563 0.314 0.314 0.314 mg/100 g Macaroni and cheese Type 2 specific 353.875 581.0 248.0 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 27.5275 55.0 0.055 mg/100 g Malabar plum Type 1 specific Syzygium jambos 334483 Malabar spinach Type 1 specific Basella alba 3589 231.75 410.5 53.0 mg/100 g Malus (Crab apple) Type 1 specific Malus 3749 16.0 16.0 16.0 mg/100 g Mamey sapote Type 1 specific Pouteria sapota 233744 30.5305 61.0 0.061 mg/100 g Mammee apple Type 1 specific Mammea americana 198777 Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 17.001545 77.0 0.017 mg/100 g Mango Type 1 specific Mangifera indica 29780 39.00725 109.0 0.029 mg/100 g Margarine Type 2 specific 36.0 52.0 0.0 mg/100 g Margarine-like spread Type 2 specific 26.0 31.0 21.0 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 622.6295 1100.0 0.518 mg/100 g Marshmallow Type 2 specific 28.0 28.0 28.0 mg/100 g Marzipan Type 2 specific 510.0 510.0 510.0 mg/100 g Mate Type 1 Ilex paraguariensis Meat bouillon Type 2 specific 555.0 880.0 230.0 mg/100 g Meatloaf Type 2 specific 668.636364 861.0 421.0 mg/100 g Medlar Type 1 specific Mespilus germanica 36616 Mentha Type 1 specific Mentha 21819 Mexican groundcherry Type 1 specific Physalis philadelphica var. immaculata 374021 Mexican oregano Type 1 specific Lippia graveolens 0.441 0.441 0.441 mg/100 g Mikan Type 1 Citrus unshiu Milk (Cow) Type 2 specific 5005.622529 209000.0 0.0 mg/100 g Milk (Human) Type 2 specific 56.0 56.0 56.0 mg/100 g Milk (Other mammals) Type 2 specific 239.5 338.0 203.0 mg/100 g Milk substitute Type 2 specific 107.0 107.0 107.0 mg/100 g Milkfish Type 1 specific Chanos chanos 29144 719.982 1213.0 0.946 mg/100 g Milkshake Type 2 specific 197.4 234.0 158.0 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 399.410833 840.0 0.465 mg/100 g Miso Type 2 specific 508.0 508.0 508.0 mg/100 g Mixed nuts Type 2 specific 682.111111 826.0 486.0 mg/100 g Monk fruit Type 1 Siraitia grosvenorii Monkfish Type 1 specific Lophius piscatorius 8074 507.555667 855.0 0.667 mg/100 g Morchella (Morel) Type 1 specific Morchellaceae 5192 Moth bean Type 1 specific Vigna aconitifolia 3918 622.8276 1199.0 1.138 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 0.0 0.0 0.0 mg/100 g Mountain yam Type 1 specific Dioscorea pentaphylla 167592 61.359 143.75 0.045 mg/100 g Mugwort Type 1 specific Artemisia vulgaris 4220 Mulberry Type 1 specific Morus 3497 Multigrain bread Type 2 specific 337.0 351.0 323.0 mg/100 g Mundu Type 1 Garcinia dulcis Mung bean Type 1 specific Vigna radiata 157791 395.573692 1058.15 1.008 mg/100 g Muscadine grape Type 1 specific Vitis rotundifolia 103349 Muskmelon Type 1 specific Cucumis melo 3656 14.0 21.0 0.0 mg/100 g Mustard Type 2 specific 200.0 200.0 200.0 mg/100 g Mustard spinach Type 1 specific Brassica perviridis Nachos Type 2 specific 291.166667 365.0 185.0 mg/100 g Nance Type 1 specific Byrsonima crassifolia 4270 Nanking cherry Type 1 specific Prunus tomentosa 105667 18.85 24.0 13.7 mg/100 g Napa cabbage Type 1 specific Brassica rapa var. pekinensis 51351 79.333333 85.0 68.0 mg/100 g Naranjilla Type 1 specific Solanum quitoense 227725 Narrowleaf cattail Type 1 specific Typha angustifolia 59011 Natal plum Type 1 specific Carissa macrocarpa 403101 Natto Type 2 specific 931.0 931.0 931.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 6.003 9.0 0.009 mg/100 g New Zealand spinach Type 1 specific Tetragonia tetragonioides 45318 Nopal Type 1 specific Opuntia cochenillifera 338184 33.683 52.0 0.049 mg/100 g Northern bluefin tuna Type 1 specific Thunnus thynnus 8237 818.025 1378.0 1.075 mg/100 g Northern pike Type 1 specific Esox lucius 8010 675.295667 1138.0 0.887 mg/100 g Norway lobster Type 1 specific Nephrops norvegicus 6829 910.0 910.0 910.0 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.767 0.767 0.767 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 0.0 0.0 0.0 mg/100 g Nutritional drink Type 2 specific 145.0 145.0 145.0 mg/100 g Nuts Unknown generic Oat Type 1 specific Avena sativa 4498 507.230533 1300.0 0.668 mg/100 g Oat bread Type 2 specific 362.125 438.0 312.0 mg/100 g Ocean pout Type 1 specific Zoarces americanus 8199 583.589 983.0 0.767 mg/100 g Ohelo berry Type 1 specific Vaccinium reticulatum 180767 Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Oil-seed Camellia Type 1 specific Camellia oleifera 385388 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 55.133625 70.0 0.069 mg/100 g Olive Type 1 specific Olea europaea 4146 11.166667 36.0 0.0 mg/100 g Onion-family vegetables Unknown generic Opium poppy Type 1 specific Papaver somniferum 3469 878.45 937.9 819.0 mg/100 g Orange bell pepper Type 1 specific Capsicum annuum 4072 90.896667 197.65 35.04 mg/100 g Orange mint Type 1 specific Mentha aquatica 190902 Orange roughy Type 1 specific Hoplostethus atlanticus 96778 608.589 1058.0 0.767 mg/100 g Oregon yampah Type 1 specific Perideridia oregana 234866 Oriental wheat Type 1 specific Triticum turanicum 376534 271.522 566.0 0.566 mg/100 g Ostrich Type 1 specific Struthio camelus 8801 1.0165 1.045 0.961 mg/100 g Ostrich fern Type 1 specific Matteuccia struthiopteris 3277 Other alcoholic beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Other animal fat Type 2 specific 40.0 240.0 0.0 mg/100 g Other beverage Type 2 specific 133.5 237.0 9.0 mg/100 g Other bread Type 2 specific 355.529412 518.0 186.0 mg/100 g Other bread product Type 2 specific 348.0 586.0 0.0 mg/100 g Other candy Type 2 specific 201.375 534.0 0.0 mg/100 g Other cereal product Type 2 specific Other dish Type 2 specific 394.793103 942.0 93.0 mg/100 g Other fermented milk Type 2 specific 195.0 200.0 190.0 mg/100 g Other fish product Type 2 specific 589.333333 745.0 230.0 mg/100 g Other frozen dessert Type 2 specific 150.0 150.0 150.0 mg/100 g Other fruit product Type 2 specific 78.0 78.0 78.0 mg/100 g Other pasta dish Type 2 specific 196.5 240.0 153.0 mg/100 g Other sandwich Type 2 specific 555.3125 805.0 394.0 mg/100 g Other snack food Type 2 specific 372.114286 1303.0 0.0 mg/100 g Other soy product Type 2 specific 2641.166667 4300.0 159.0 mg/100 g Other vegetable product Type 2 specific 113.357143 162.0 69.0 mg/100 g Oval-leaf huckleberry Type 1 specific Vaccinium ovalifolium 190544 Oxheart cabbage Type 1 specific Brassica oleracea var. conica Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 56.056 112.0 0.112 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 504.226333 833.0 0.679 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 0.959 0.959 0.959 mg/100 g Pacific herring Type 1 specific Clupea pallasii 30724 574.585 968.0 0.755 mg/100 g Pacific jack mackerel Type 1 specific Trachurus symmetricus 271940 534.9625 1069.0 0.925 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.723 0.723 0.723 mg/100 g Pacific oyster Type 1 specific Crassostrea gigas 29159 411.470333 823.0 0.411 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 645.625333 1060.0 0.876 mg/100 g Pacific sardine Type 1 specific Sardinops sagax 28381 795.0 795.0 795.0 mg/100 g Painted comber Type 1 specific Serranus scriba 349661 798.5 874.0 723.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 69.417 89.0 0.085 mg/100 g Pancake Type 2 specific 318.384615 496.0 166.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 14.202 39.8 0.008 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 376.8236 1546.0 0.118 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 56.006156 71.0 41.01 mg/100 g Partridge berry Type 1 Mitchella repens Passion fruit Type 1 specific Passiflora edulis 78168 Pasta Type 2 specific 356.245283 784.0 7.0 mg/100 g Pastry Type 2 specific 259.690476 475.0 0.0 mg/100 g Pate Type 2 specific 509.166667 735.0 0.0 mg/100 g Pea shoots Type 1 0.195 0.195 0.195 mg/100 g Peach Type 1 specific Prunus persica 3760 34.900025 141.0 0.0005 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 0.0005 0.0005 0.0005 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 815.341621 1836.0 0.0 mg/100 g Peanut oil Type 2 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 15.889321 54.0 0.0005 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 300.704 348.0 0.336 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 107.639189 579.0 20.0 mg/100 g Pepper (C. baccatum) Type 1 specific Capsicum baccatum var. baccatum 165788 Pepper (C. chinense) Type 1 specific Capsicum chinense 80379 Pepper (C. frutescens) Type 1 specific Capsicum annuum var. annuum 40321 297.7 297.7 297.7 mg/100 g Pepper (C. pubescens) Type 1 specific Capsicum pubescens 113210 Pepper (Capsicum) Type 1 specific Capsicum 4071 Pepper (Spice) Type 1 specific Piper nigrum 13216 183.183 366.0 0.366 mg/100 g Peppermint Type 1 specific Mentha X piperita 34256 77.077 154.0 0.154 mg/100 g Perciformes Type 1 specific Perciformes 8111 1055.5 1186.0 925.0 mg/100 g Percoidei (Bass and others) Type 1 specific Percoidei 8112 851.402429 1145.0 0.817 mg/100 g Persian lime Type 1 specific Citrus latifolia 200541 2.0 2.0 2.0 mg/100 g Persimmon Type 1 specific Diospyros 13492 15.0175 30.0 0.035 mg/100 g Pheasant Type 1 specific Phasianus colchicus 9054 1.3465 1.369 1.324 mg/100 g Phyllo dough Type 2 specific 246.0 246.0 246.0 mg/100 g Pie Type 2 specific 137.107143 286.0 66.0 mg/100 g Pie crust Type 2 specific 190.8125 255.0 100.0 mg/100 g Pie filling Type 2 specific 9.0 9.0 9.0 mg/100 g Pigeon pea Type 1 specific Cajanus cajan 3821 412.857 788.5 0.785 mg/100 g Piki bread Type 2 specific Pili nut Type 1 specific Canarium ovatum 43691 241.7415 483.0 0.483 mg/100 g Pine nut Type 1 specific Pinus 3337 360.847333 542.0 0.542 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 11.756273 49.3 0.0 mg/100 g Pineappple sage Type 1 specific Salvia elegans 888065 Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 878.279143 1146.0 0.954 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 796.081 994.65 0.917 mg/100 g Pita bread Type 2 specific 355.0 367.0 349.0 mg/100 g Pitanga Type 1 specific Eugenia uniflora 119951 Pitaya Type 1 Hylocereus undatus Pizza Type 2 specific 490.71875 798.0 0.0 mg/100 g Plains prickly pear Type 1 specific Opuntia macrorhiza 1041245 Plantain Type 1 Musa × paradisiaca Pleuronectidae (Dab, Halibut, Plaice) Type 1 specific Pleuronectidae 8256 420.0 840.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.62 0.62 0.62 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 Pomes Unknown generic Popcorn Type 2 specific 329.0 431.0 157.0 mg/100 g Poppy Type 1 specific Papaver 3468 450.0 900.0 0.0 mg/100 g Pot marjoram Type 1 specific Origanum onites 452416 Pot pie Type 2 specific 246.5 271.0 222.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 114.615897 514.0 0.0 mg/100 g Potato bread Type 2 specific 268.0 268.0 268.0 mg/100 g Potato chip Type 2 specific 309.416667 403.0 248.0 mg/100 g Potato gratin Type 2 specific 214.0 284.0 144.0 mg/100 g Potato puffs Type 2 specific 86.5 87.0 86.0 mg/100 g Prairie turnip Type 1 specific Pediomelum esculentum 458363 130.8 130.8 130.8 mg/100 g Prickly pear Type 1 specific Opuntia 106975 Processed cheese Type 2 specific 800.444444 1013.0 570.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 15.0 24.0 9.0 mg/100 g Pudding Type 2 specific 113.464286 182.0 0.0 mg/100 g Pulses Unknown generic Pummelo Type 1 specific Citrus maxima 37334 Pumpkinseed sunfish Type 1 specific Lepomis gibbosus 270329 680.298 1146.0 0.894 mg/100 g Pupusa Type 2 specific 413.333333 565.0 219.0 mg/100 g Purple laver Type 1 specific Porphyra laciniata 129.6295 259.0 0.259 mg/100 g Purple mangosteen Type 1 specific Garcinia mangostana 58228 Purslane Type 1 specific Portulaca oleracea 46147 187.375 596.5 47.0 mg/100 g Quail Type 1 specific Phasianidae 9005 858.54675 1233.0 1.187 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 Quinoa Type 1 specific Chenopodium quinoa 63459 220.501333 504.0 0.504 mg/100 g Rabbit Type 1 specific Leporidae 9979 950.5085 1567.0 1.034 mg/100 g Rabbiteye blueberry Type 1 specific Vaccinium virgatum Radish Type 1 specific Raphanus sativus 3726 79.354 305.75 0.02 mg/100 g Radish (var.) Type 1 specific Raphanus sativus var. sativus 240228 Rainbow smelt Type 1 specific Osmerus mordax 8014 617.937333 1041.0 0.812 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 685.157333 1148.0 0.0 mg/100 g Raisin bread Type 2 specific 295.333333 312.0 287.0 mg/100 g Rambutan Type 1 specific Nephelium lappaceum 151071 Rape Type 1 specific Brassica napus var. napus 138011 0.0 0.0 0.0 mg/100 g Rapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Rapini Type 1 specific Brassica ruvo 1204434 114.5 125.0 104.0 mg/100 g Ravioli Type 2 specific 158.0 185.0 131.0 mg/100 g Red algae Type 1 specific Rhodophyta 2763 Red beetroot Type 1 specific Beta vulgaris var. rubra 55.0 195.5 18.0 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 2572.116952 40000.0 20.0 mg/100 g Red clover Type 1 Trifolium pratense Red grape Type 1 Red huckleberry Type 1 specific Vaccinium parvifolium 180766 Red king crab Type 1 specific Paralithodes camtschaticus 6741 608.629 938.0 0.887 mg/100 g Red onion Type 1 Red raspberry Type 1 specific Rubus idaeus 32247 24.216535 24.21653538 24.21653538 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 0.336 0.336 0.336 mg/100 g Red tea Type 1 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.0 0.0 0.0 mg/100 g Relish Type 2 specific 27.666667 50.0 12.0 mg/100 g Remoulade Type 2 specific 0.0 0.0 0.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 235.871795 580.0 0.0 mg/100 g Rice bread Type 2 specific 362.0 377.0 347.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 56.222222 172.0 0.0 mg/100 g Rocket salad Type 1 specific Eruca vesicaria 180536 Rocket salad (ssp.) Type 1 specific Eruca vesicaria ssp. sativa 29727 Roe Type 2 generic 910.7855 1465.0 1.142 mg/100 g Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 44.02 45.0 42.4 mg/100 g Roman camomile Type 1 specific Chamaemelum nobile 99037 Root vegetables Unknown generic Rose hip Type 1 specific Rosa 3764 0.0 0.0 0.0 mg/100 g Roselle Type 1 specific Hibiscus sabdariffa 183260 Rosemary Type 1 specific Rosmarinus officinalis 39367 68.068 136.0 0.136 mg/100 g Rowal Type 1 specific Pangium edule 112823 Rowanberry Type 1 specific Sorbus aucuparia 36599 Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.0 0.0 0.0 mg/100 g Rum Type 2 specific 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 285.710667 582.75 0.208 mg/100 g Rye bread Type 2 specific 316.363636 396.0 210.0 mg/100 g Sablefish Type 1 specific Anoplopoma fimbria 229290 556.1545 814.0 0.618 mg/100 g Sacred lotus Type 1 specific Nelumbo nucifera 4432 137.87 413.1 33.0 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 382.666667 1579.0 0.0 mg/100 g Saffron Type 1 specific Crocus sativus 82528 Sago palm Type 1 specific Metroxylon sagu 93297 Salad Type 2 specific 178.272727 424.0 25.0 mg/100 g Salad dressing Type 2 specific 50.2 259.0 0.0 mg/100 g Salmonberry Type 1 specific Rubus spectabilis 59499 Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 924.857143 1227.0 0.0 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Salted butter Type 1 0.051 0.051 0.051 mg/100 g Sapodilla Type 1 specific Manilkara zapota 3741 7.5075 15.0 0.015 mg/100 g Saskatoon berry Type 1 specific Amelanchier alnifolia 32219 10.25 13.0 7.5 mg/100 g Sauce Type 2 specific 100.2 578.0 17.0 mg/100 g Sausage Type 2 specific 642.595506 2206.0 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 50.0505 100.0 0.101 mg/100 g Scallop Type 1 specific Pectinidae 6566 473.2086 800.0 0.043 mg/100 g Scarlet bean Type 1 specific Phaseolus coccineus 3886 Scombridae (Bonito, Mackerel, Tuna) Type 1 specific Scombridae 8224 870.0 950.0 690.0 mg/100 g Scup Type 1 specific Stenotomus chrysops 35579 661.956667 1115.0 0.87 mg/100 g Sea trout Type 1 specific Salmo trutta forma trutta 13028 587.257333 989.0 0.772 mg/100 g Sea-buckthornberry Type 1 specific Hippophae rhamnoides 193516 Semolina Type 2 specific 456.666667 490.0 390.0 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 821.279632 2157.0 0.0 mg/100 g Sesame oil Type 2 0.0 0.0 0.0 mg/100 g Sesbania flower Type 1 specific Sesbania bispinosa 485725 47.517 68.0 0.068 mg/100 g Shallot Type 1 specific Allium ascalonicum 1476995 209.368667 522.0 0.106 mg/100 g Shark Type 1 specific Squaliformes 282414 611.655667 967.0 0.967 mg/100 g Shea tree Type 1 specific Vitellaria paradoxa 292385 0.0 0.0 0.0 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 430.43 860.0 0.86 mg/100 g Sheepshead Type 1 specific Archosargus probatocephalus 119682 710.310333 1199.0 0.931 mg/100 g Shiitake Type 1 specific Lentinus edodes 5353 122.685167 405.0 0.111 mg/100 g Shortening Type 2 specific 0.0 0.0 0.0 mg/100 g Shrimp Type 1 specific Caridea 6694 794.0 1300.0 491.0 mg/100 g Silver linden Type 1 specific Tilia argentea Skipjack tuna Type 1 specific Katsuwonus pelamis 8226 771.671333 1300.0 1.014 mg/100 g Skunk currant Type 1 specific Ribes glandulosum 175226 Small-leaf linden Type 1 specific Tilia cordata 172266 Smelt Type 1 specific Osmeridae 8012 2150.0 2150.0 2150.0 mg/100 g Snack bar Type 2 specific 377.25 1156.0 50.0 mg/100 g Snapper Type 1 specific Lutjanidae 30850 719.315 1212.0 0.945 mg/100 g Snow crab Type 1 specific Chionoecetes opilio 41210 1021.5 1146.0 897.0 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 1021.007 1450.0 1.07 mg/100 g Soft drink Type 2 specific 0.0 0.0 0.0 mg/100 g Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 184.5585 368.9 0.217 mg/100 g Sorghum Type 1 specific Sorghum bicolor 4558 240.477667 433.0 0.433 mg/100 g Sorrel Type 1 specific Rumex acetosa 41241 51.0 51.0 51.0 mg/100 g Soup Type 2 specific 161.571429 938.0 7.0 mg/100 g Sour cherry Type 1 specific Prunus cerasus 140311 Sour cream Type 2 147.0 147.0 147.0 mg/100 g Sour orange Type 1 Citrus × aurantium Sourdock Type 1 specific Rumex articus 395311 Sourdough Type 2 specific Soursop Type 1 specific Annona muricata 13337 Soy bean Type 1 specific Glycine max 3847 1341.396471 4300.0 0.0 mg/100 g Soy cream Type 2 specific Soy milk Type 2 specific 93.5 114.0 66.0 mg/100 g Soy sauce Type 2 specific 265.8974 487.0 0.487 mg/100 g Soybean oil Type 2 0.0 0.0 0.0 mg/100 g Spanish mackerel Type 1 specific Scomberomorus maculatus 99344 658.963 1087.0 0.889 mg/100 g Sparkleberry Type 1 specific Vaccinium arboreum 229201 Spearmint Type 1 specific Mentha spicata 29719 317.045 816.0 0.135 mg/100 g Spelt Type 1 specific Triticum spelta 58933 276.276 552.0 0.552 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 164.356467 946.4 0.147 mg/100 g Spiny lobster Type 1 specific Palinuridae 6731 758.332667 1276.0 0.998 mg/100 g Spirit Type 2 specific 0.0 0.0 0.0 mg/100 g Spirulina Type 1 specific Spirulina 551299 1180.110333 3209.0 0.331 mg/100 g Spot croaker Type 1 specific Leiostomus xanthurus 59837 649.284333 1094.0 0.853 mg/100 g Spread Type 2 specific 504.5 879.0 52.0 mg/100 g Squab Type 1 specific Columba 8931 0.955 0.955 0.955 mg/100 g Squashberry Type 1 specific Viburnum edule 237934 Squid Type 1 specific Teuthida 551290 486.226 780.0 0.678 mg/100 g Star anise Type 1 specific Illicium verum 124778 Star fruit Type 1 specific Averrhoa carambola 28974 56.761 138.0 0.044 mg/100 g Steller sea lion Type 1 specific Eumetopias jubatus 34886 750.0 1400.0 100.0 mg/100 g Stew Type 2 specific 271.5 350.0 148.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 15.615385 25.0 10.0 mg/100 g Strawberry guava Type 1 specific Psidium cattleianum 375274 28.590333 64.75 0.021 mg/100 g Striped bass Type 1 specific Morone saxatilis 34816 621.605667 1047.0 0.817 mg/100 g Striped mullet Type 1 specific Mugil cephalus 48193 678.630667 1143.0 0.892 mg/100 g Stuffing Type 2 specific 295.0 295.0 295.0 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 0.372 0.744 0.0 mg/100 g Succotash Type 2 specific 235.125 286.0 147.0 mg/100 g Sugar Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar apple Type 1 specific Annona squamosa 301693 Sugar substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Summer grape Type 1 specific Vitis aestivalis 3605 Summer savory Type 1 specific Satureja hortensis 49987 Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 527.029167 1281.0 33.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 920.866667 2925.0 0.0 mg/100 g Sunflower oil Type 2 0.0 0.0 0.0 mg/100 g Swamp cabbage Type 1 specific Ipomoea aquatica 89636 253.125 742.5 83.0 mg/100 g Swede Type 1 specific Brassica napus 3708 39.0 53.0 0.0 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 438.026 1060.0 0.104 mg/100 g Sweet bay Type 1 specific Laurus nobilis 85223 Sweet cherry Type 1 specific Prunus avium 42229 20.0 20.0 20.0 mg/100 g Sweet custard Type 2 specific 231.8 368.0 178.0 mg/100 g Sweet marjoram Type 1 specific Origanum majorana 268884 Sweet orange Type 1 specific Citrus sinensis 2711 18.494639 106.9 0.0035 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 69.125313 179.95 0.055 mg/100 g Sweet rowanberry Type 1 specific Grataegosorbus mitschurinii Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 129.515662 154.0 0.147 mg/100 g Swordfish Type 1 specific Xiphias gladius 8245 666.970667 1088.0 0.912 mg/100 g Syrup Type 2 specific 120.666667 210.0 1.0 mg/100 g Taco Type 2 specific 394.166667 596.0 268.0 mg/100 g Taco shell Type 2 239.5 259.0 220.0 mg/100 g Tallow Type 2 specific 37.5 150.0 0.0 mg/100 g Tamale Type 2 specific 224.666667 275.0 128.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 0.0 0.0 0.0 mg/100 g Tapioca pearl Type 2 specific 2.002 4.0 0.004 mg/100 g Taro Type 1 specific Colocasia esculenta 4460 199.061556 1036.5 0.054 mg/100 g Tarragon Type 1 specific Artemisia dracunculus 72341 Tartary buckwheat Type 1 specific Fagopyrum tataricum 62330 Tea Type 1 specific Camellia sinensis 4442 0.6 3.0 0.0 mg/100 g Tea leaf willow Type 1 specific Salix pulchra 669814 Teff Type 1 specific Eragrostis tef 110835 215.833667 501.0 0.501 mg/100 g Thistle Type 1 specific Cirsium 41549 Thunnus Type 1 specific Thunnus 8234 1201.444444 1500.0 739.0 mg/100 g Tilefish Type 1 specific Lopholatilus chamaeleonticeps 390349 644.935333 1128.0 0.806 mg/100 g Tinda Type 1 specific Citrullus lanatus var. fistulosus Toffee Type 2 specific 0.0 0.0 0.0 mg/100 g Tofu Type 2 specific 596.133 2376.0 0.435 mg/100 g Topping Type 2 specific 150.0 301.0 60.0 mg/100 g Tortilla Type 2 specific 257.833333 307.0 208.0 mg/100 g Tortilla chip Type 2 specific 327.333333 446.0 280.0 mg/100 g Tostada Type 2 specific 336.25 511.0 213.0 mg/100 g Tostada shell Type 2 Towel gourd Type 1 specific Luffa aegyptiaca 3670 Trail mix Type 2 specific 472.4 555.0 222.0 mg/100 g Tree fern Type 1 specific Cyathea Triticale Type 1 specific X Triticosecale rimpaui 321.159667 484.0 0.479 mg/100 g Tronchuda cabbage Type 1 specific Brassica oleracea var. costata 416546 True oyster Type 1 specific Ostreidae 6563 360.0 360.0 360.0 mg/100 g True sole Type 1 specific Soleidae 30948 495.307 990.0 0.614 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 612.185 948.0 0.74 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 444.3245 888.0 0.649 mg/100 g Turmeric Type 1 specific Curcuma longa 136217 0.47 0.47 0.47 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 72.8868 173.0 0.036 mg/100 g Ucuhuba Type 1 specific Virola surinamensis 224910 0.0 0.0 0.0 mg/100 g Unclassified food or beverage Type 2 specific 945.0 945.0 945.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 16.285714 33.0 0.0 mg/100 g Vanilla Type 1 specific Vanilla 51238 Vegetarian food Type 2 specific 1076.0 1995.0 559.0 mg/100 g Vinegar Type 2 specific 0.0 0.0 0.0 mg/100 g Vodka Type 2 specific 0.0 0.0 0.0 mg/100 g Waffle Type 2 specific 304.2 362.0 268.0 mg/100 g Wakame Type 1 specific Undaria pinnatifida 74381 43.5435 87.0 0.087 mg/100 g Walleye Type 1 specific Sander vitreus 283036 1006.5 1131.0 882.0 mg/100 g Walnut Type 1 specific Juglans 16718 175.2415 700.0 0.0 mg/100 g Wampee Type 1 Clausena lansium Wasabi Type 1 specific Wasabia japonica 75806 Water Type 2 specific 0.0 0.0 0.0 mg/100 g Water spinach Type 1 Ipomoea aquatica 0.147 0.147 0.147 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 179.39825 556.5 0.093 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 469.803167 1342.0 0.019 mg/100 g Wax apple Type 1 specific Eugenia javanica 119950 Wax gourd Type 1 specific Benincasa hispida 102211 Welsh onion Type 1 specific Allium fistulosum 35875 40.5405 81.0 0.081 mg/100 g Wheat Type 1 specific Triticum 4564 416.580122 1000.0 0.0 mg/100 g Wheat bread Type 2 specific 333.28125 433.0 0.0 mg/100 g Whelk Type 1 specific Buccinidae 37796 827.942667 1655.0 0.828 mg/100 g Whey Type 2 specific 423.142857 820.0 38.0 mg/100 g Whisky Type 2 specific 0.0 0.0 0.0 mg/100 g White bread Type 1 357.75 518.0 186.0 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 88.565714 438.3 27.0 mg/100 g White lupine Type 1 specific Lupinus albus 3870 1178.5 1709.0 695.0 mg/100 g White mulberry Type 1 Morus alba White mustard Type 1 specific Sinapis alba 3728 817.766667 1183.0 151.0 mg/100 g White sucker Type 1 specific Catostomus commersonii 7971 587.590667 990.0 0.772 mg/100 g White wine Type 2 5.65 6.9 5.1 mg/100 g Whitefish Type 1 specific Coregonus 27772 1069.48 2260.0 0.88 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 642.281333 1082.0 0.844 mg/100 g Wild boar Type 1 specific Sus scrofa 9823 1.039 1.039 1.039 mg/100 g Wild carrot Type 1 specific Daucus carota 4039 94.25925 188.5 0.0185 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 53.086833 224.5 0.021 mg/100 g Wild leek Type 1 specific Allium ampeloprasum 4681 126.6104 525.0 0.052 mg/100 g Wild rice Type 1 specific Zizania 15949 261.872667 618.0 0.618 mg/100 g Winged bean Type 1 specific Psophocarpus tetragonolobus 3891 698.166857 1534.8 1.468 mg/100 g Winter savory Type 1 specific Satureja montana 49988 Winter squash Type 1 specific Cucurbita maxima 3661 43.730091 78.0 0.031 mg/100 g Wonton wrapper Type 2 specific 369.0 369.0 369.0 mg/100 g Yali pear Type 1 specific Pyrus × bretschneideri Yam Type 1 specific Dioscorea 4672 40.6104 52.0 0.052 mg/100 g Yardlong bean Type 1 specific Vigna unguiculata ssp. sesquipedalis 138955 423.327778 1034.5 0.15 mg/100 g Yau choy Type 1 Yautia Type 1 specific Xanthosoma sagittifolium 28478 Yellow bell pepper Type 1 specific Capsicum annuum 4072 60.366 197.65 21.18 mg/100 g Yellow pond-lily Type 1 specific Nuphar lutea 77113 Yellow wax bean Type 1 specific Phaseolus vulgaris 3885 166.946667 972.0 29.0 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 61.5816 353.25 0.034 mg/100 g Yellowfin tuna Type 1 specific Thunnus albacares 8236 788.359 1287.0 1.077 mg/100 g Yellowtail amberjack Type 1 specific Seriola lalandi 302047 811.355333 1367.0 1.066 mg/100 g Ymer Type 2 specific 355.0 360.0 350.0 mg/100 g Yogurt Type 2 specific 217.333333 313.0 7.0 mg/100 g Zwieback Type 2 specific bitter odorless Branched-chain-amino-acid aminotransferase, cytosolic P54687 BCAT1 Branched-chain-amino-acid aminotransferase, mitochondrial O15382 BCAT2 Isoleucine--tRNA ligase, cytoplasmic P41252 IARS Isoleucine--tRNA ligase, mitochondrial Q9NSE4 IARS2 anti encephalopathic 256 Any substance introduced into a living organism with therapeutic or diagnostic purpose. anti pellagric 511 Any substance introduced into a living organism with therapeutic or diagnostic purpose. essential 920