1.0 2010-04-08 22:10:13 UTC 2025-11-18 23:37:30 UTC FDB012520 Harmol Alkaloid from Elaeagnus angustifolia (Russian olive) and Passiflora incarnata (maypops). Harmol is found in sea-buckthornberry, herbs and spices, and fruits. &beta;-Carboline, 7-hydroxy-1-methyl- 1-Methyl-9H-beta-carbolin-7-ol 1-Methyl-9H-pyrido(3,4-b)indol-7-ol 1-Methyl-9H-pyrido[3,4-b]indol-7-ol 1-Methyl-9H-pyrido[3,4-b]indol-7-ol, 9CI 7-Hydroxyharman 9H-Pyrido(3,4-b)indol-7-ol, 1-methyl- (8CI)(9CI) 9H-Pyrido[3,4-b]indol-7-ol, 1-methyl- beta 7-Hydroxy-1-methyl--carboline Harmol C12H10N2O 198.2206 198.079312952 1-methyl-9H-pyrido[3,4-b]indol-7-ol harmol 487-03-6 CC1=C2NC3=C(C=CC(O)=C3)C2=CC=N1 InChI=1S/C12H10N2O/c1-7-12-10(4-5-13-7)9-3-2-8(15)6-11(9)14-12/h2-6,14-15H,1H3 SATMZMMKDDTOSQ-UHFFFAOYSA-N belongs to the class of organic compounds known as harmala alkaloids. Harmala alkaloids are compounds with a structure based on harmaline, harmine, harmalol, harman or a derivative of those parents. These parents are beta-carbolines, consisting of a pyrimidine fused to the pyrrole moiety of an indole to form a pyrido[3,4-b]indole. Harmala alkaloids Organic compounds Alkaloids and derivatives Harmala alkaloids Aromatic heteropolycyclic compounds 1-hydroxy-2-unsubstituted benzenoids Azacyclic compounds Beta carbolines Heteroaromatic compounds Hydrocarbon derivatives Hydroxyindoles Indoles Methylpyridines Organonitrogen compounds Organooxygen compounds Organopnictogen compounds Pyrroles 1-hydroxy-2-unsubstituted benzenoid Aromatic heteropolycyclic compound Azacycle Benzenoid Beta-carboline Harman Heteroaromatic compound Hydrocarbon derivative Hydroxyindole Indole Indole or derivatives Methylpyridine Organic nitrogen compound Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Pyridine Pyridoindole Pyrrole an alkaloid logp 2.07 ALOGPS logs -3.06 ALOGPS solubility 1.72e-01 g/l ALOGPS melting_point Mp 304-307° logp 1.7 ChemAxon pka_strongest_acidic 9.4 ChemAxon pka_strongest_basic 6.16 ChemAxon iupac 1-methyl-9H-pyrido[3,4-b]indol-7-ol ChemAxon average_mass 198.2206 ChemAxon mono_mass 198.079312952 ChemAxon smiles CC1=C2NC3=C(C=CC(O)=C3)C2=CC=N1 ChemAxon formula C12H10N2O ChemAxon inchi InChI=1S/C12H10N2O/c1-7-12-10(4-5-13-7)9-3-2-8(15)6-11(9)14-12/h2-6,14-15H,1H3 ChemAxon inchikey SATMZMMKDDTOSQ-UHFFFAOYSA-N ChemAxon polar_surface_area 48.91 ChemAxon refractivity 57.89 ChemAxon polarizability 21.34 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 2 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 22355 Specdb::CMs 43767 Specdb::CMs 137922 Specdb::CMs 145656 Specdb::MsIr 6481 Specdb::MsIr 6482 Specdb::MsIr 6483 Specdb::MsMs 70707 Specdb::MsMs 70708 Specdb::MsMs 70709 Specdb::MsMs 129252 Specdb::MsMs 129253 Specdb::MsMs 129254 Specdb::MsMs 2227143 Specdb::MsMs 2227534 Specdb::MsMs 2229597 Specdb::MsMs 2229910 Specdb::MsMs 2231832 Specdb::MsMs 2231859 Specdb::MsMs 2231924 Specdb::MsMs 2232255 Specdb::MsMs 2232386 Specdb::MsMs 2236512 Specdb::MsMs 2239857 Specdb::MsMs 2241071 Specdb::MsMs 2241841 Specdb::MsMs 2244047 Specdb::MsMs 2245265 Specdb::MsMs 2246060 Specdb::MsMs 2246133 Specdb::MsMs 2248138 Specdb::MsMs 2248264 HMDB34217 #<Reference:0x000055ce32f9d638> Fruits Unknown generic Herbs and Spices Unknown generic Sea-buckthornberry Type 1 specific Hippophae rhamnoides 193516 Anti trypanosomic 669 A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans.