1.0 2010-04-08 22:10:13 UTC 2019-11-26 03:06:58 UTC FDB012528 D-Fructose D-Fructose occurs in honey and a large number of fruits, particularly apples and tomatoes. It is fluid and nutrient replenisher, and nutritive sweetener. Inulin from dandelion roots has also been used as a source. Present in polymeric form in the inulins, the energy reserve polysaccharides of many plants, e.g. dahlia and Jerusalem artichoke tubers. D-Fructose is also found in many other foods, some of which are sweet cherry, anise, and tinda. (+-)-fructose arabino-2-Hexulose b-D-arabino-Hexulose b-D-Fructofuranose b-D-Fructose b-Fruit sugar b-Levulose beta-D-arabino-Hexulose beta-D-Fructofuranose beta-D-Fructose beta-delta-arabino-Hexulose beta-delta-Fructofuranose beta-delta-Fructose beta-Fruit sugar beta-Levulose D-(-)-fructose D-(-)-levulose D-arabino-hexulose D-Fructose delta-(-)-Fructose delta-Fructose DL-fructose FRU Fructon Fructon (TN) FRUCTOSE Fructose (JP15/USP) Fructose (van) Fructose [jan] Fructose, d- Fructose, pure Fruit sugar FUD Furucton Hi-Fructo 970 Keto-d-fructose Krystar 300 Levulose Methose Nevulose Sugar, fruit β-D-arabino-hexulose β-D-fructofuranose β-D-fructose β-fruit sugar β-levulose C18H36O18 540.4676 540.190164348 (3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-2,3,4-triol fruit sugar 53188-23-1 OCC(O)C(O)C(O)C(=O)CO.OCC1OC(O)(CO)C(O)C1O.OCC1(O)OCC(O)C(O)C1O InChI=1S/3C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6;7-1-3-4(9)5(10)6(11,2-8)12-3;7-1-3(9)5(11)6(12)4(10)2-8/h2*3-5,7-11H,1-2H2;3,5-9,11-12H,1-2H2 JCOXAIPZGMCTBN-UHFFFAOYSA-N belongs to the class of organic compounds known as c-glycosyl compounds. These are glycoside in which a sugar group is bonded through one carbon to another group via a C-glycosidic bond. C-glycosyl compounds Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aliphatic heteromonocyclic compounds Hemiacetals Hydrocarbon derivatives Oxacyclic compounds Pentoses Polyols Primary alcohols Secondary alcohols Tetrahydrofurans Alcohol Aliphatic heteromonocyclic compound C-glycosyl compound Hemiacetal Hydrocarbon derivative Monosaccharide Organoheterocyclic compound Oxacycle Pentose monosaccharide Polyol Primary alcohol Secondary alcohol Tetrahydrofuran D-fructose Ketoses fructofuranose Solid melting_point Mp 102-104° logp -2.8 ChemAxon pka_strongest_acidic 10.28 ChemAxon pka_strongest_basic -3 ChemAxon iupac (3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-2,3,4-triol ChemAxon average_mass 540.4676 ChemAxon mono_mass 540.190164348 ChemAxon smiles OCC(O)C(O)C(O)C(=O)CO.OCC1OC(O)(CO)C(O)C1O.OCC1(O)OCC(O)C(O)C1O ChemAxon formula C18H36O18 ChemAxon inchi InChI=1S/3C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6;7-1-3-4(9)5(10)6(11,2-8)12-3;7-1-3(9)5(11)6(12)4(10)2-8/h2*3-5,7-11H,1-2H2;3,5-9,11-12H,1-2H2 ChemAxon inchikey JCOXAIPZGMCTBN-UHFFFAOYSA-N ChemAxon polar_surface_area 110.38 ChemAxon refractivity 36.36 ChemAxon polarizability 16.28 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 6 ChemAxon donor_count 5 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Amino Sugar Metabolism SMP00045 map00520 Fructose and Mannose Degradation SMP00064 map00051 Galactose Metabolism SMP00043 map00052 Starch and Sucrose Metabolism SMP00058 map00500 Specdb::CMs 1084161 Specdb::NmrOneD 256248 Specdb::NmrOneD 256249 Specdb::NmrOneD 256250 Specdb::NmrOneD 256251 Specdb::NmrOneD 256252 Specdb::NmrOneD 256253 Specdb::NmrOneD 256254 Specdb::NmrOneD 256255 Specdb::NmrOneD 256256 Specdb::NmrOneD 256257 Specdb::NmrOneD 256258 Specdb::NmrOneD 256259 Specdb::NmrOneD 256260 Specdb::NmrOneD 256261 Specdb::NmrOneD 256262 Specdb::NmrOneD 256263 Specdb::NmrOneD 256264 Specdb::NmrOneD 256265 Specdb::NmrOneD 256266 Specdb::NmrOneD 256267 Specdb::MsMs 25829 Specdb::MsMs 25830 Specdb::MsMs 25831 Specdb::MsMs 32387 Specdb::MsMs 32388 Specdb::MsMs 32389 HMDB00660 48095 FRU #<Reference:0x000055ac3ea50948> #<Reference:0x000055ac3ea50718> #<Reference:0x000055ac3ea504e8> #<Reference:0x000055ac3ea501f0> #<Reference:0x000055ac3ea4ff70> #<Reference:0x000055ac3ea4fdb8> #<Reference:0x000055ac3ea4fb60> #<Reference:0x000055ac3ea4f9a8> #<Reference:0x000055ac3ea4f7c8> Abiyuch Type 1 specific Crateva religiosa 202634 1901.9 3800.0 3.8 mg/100 g Adzuki bean Type 1 specific Vigna angularis 3914 0.0 0.0 0.0 mg/100 g Agar Type 1 specific Eucheuma 31444 0.0 0.0 0.0 mg/100 g Agave Type 1 specific Agave 39509 15345.245 42830.0 0.98 mg/100 g Alaska blueberry Type 1 specific Vaccinium alaskaense 190544 3350.0 3350.0 3350.0 mg/100 g Alaska pollock Type 1 specific Theragra chalcogramma 1042646 0.0 0.0 0.0 mg/100 g Alcoholic beverages Unknown generic Alfalfa Type 1 specific Medicago sativa 3879 30.0 120.0 0.0 mg/100 g Allium Type 1 specific Allium 4678 1017.142857 2680.0 0.0 mg/100 g Almond Type 1 specific Prunus dulcis 3755 9.20125 90.0 0.0 mg/100 g Almond milk Type 1 0.0 0.0 0.0 mg/100 g Amaranth Type 1 specific Amaranthus 3564 5.0 10.0 0.0 mg/100 g American cranberry Type 1 specific Vaccinium macrocarpon 13750 630.0 630.0 630.0 mg/100 g American lobster Type 1 specific Homarus americanus 6706 0.0 0.0 0.0 mg/100 g American pokeweed Type 1 specific Phytolacca americana 3527 1400.0 1400.0 1400.0 mg/100 g Anatidae Type 1 specific Anatidae 8830 0.0 0.0 0.0 mg/100 g Anchovy Type 1 specific Engraulidae 43062 0.0 0.0 0.0 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 0.0 0.0 0.0 mg/100 g Anise Type 1 specific Pimpinella anisum 271192 Apple Type 1 specific Malus pumila 283210 3976.162727 7270.0 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 2521.0665 12470.0 0.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 0.0 0.0 0.0 mg/100 g Arepa Type 2 specific 0.0 0.0 0.0 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 17792.024 237000.0 0.0 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 0.0 0.0 0.0 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 0.0 0.0 0.0 mg/100 g Avocado Type 1 specific Persea americana 3435 141.681667 250.0 0.09 mg/100 g Baby food Type 2 specific 1455.357143 7060.0 0.0 mg/100 g Baked beans Type 2 specific 1283.333333 1560.0 1030.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.0 0.0 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 2884.196667 4850.0 2.59 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 0.0 0.0 0.0 mg/100 g Bean Type 1 specific 1283.333333 1560.0 1030.0 mg/100 g Bearded seal Type 1 specific Erignathus barbatus 39304 0.0 0.0 0.0 mg/100 g Beer Type 2 specific 42.295655 1220.0 0.0 mg/100 g Beluga whale Type 1 specific Delphinapterus leucas 9749 0.0 0.0 0.0 mg/100 g Beverages Unknown generic Bilberry Type 1 specific Vaccinium myrtillus 180763 1266.666667 3800.0 0.0 mg/100 g Biscuit Type 2 specific 506.363636 5700.0 0.0 mg/100 g Bivalvia (Clam, Mussel, Oyster) Type 1 specific Bivalvia 6544 0.0 0.0 0.0 mg/100 g Black elderberry Type 1 specific Sambucus nigra 4202 2500.0 2500.0 2500.0 mg/100 g Black raisin Type 1 1.0 1.0 1.0 mg/100 g Black salsify Type 1 specific Scorzonera hispanica 114289 0.0 0.0 0.0 mg/100 g Black tea Type 1 0.0 0.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 16.683333 50.0 0.0 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 1233.636364 4950.0 0.0 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 0.0 0.0 0.0 mg/100 g Blue whiting Type 1 specific Micromesistius poutassou 81636 0.0 0.0 0.0 mg/100 g Borage Type 1 specific Borago officinalis 13363 Brazil nut Type 1 specific Bertholletia excelsa 3645 0.0 0.0 0.0 mg/100 g Breakfast cereal Type 2 specific 1319.777778 15430.0 0.0 mg/100 g Breakfast sandwich Type 2 specific 395.0 960.0 0.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 508.191364 1300.0 0.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 173.093 930.0 0.0 mg/100 g Burbot Type 1 specific Lota lota 69944 0.0 0.0 0.0 mg/100 g Burdock Type 1 specific Arctium lappa 4217 Burrito Type 2 specific 390.0 710.0 0.0 mg/100 g Butter Type 2 specific 0.0 0.0 0.0 mg/100 g Buttermilk Type 2 specific 20.0 40.0 0.0 mg/100 g Butternut squash Type 1 specific Cucurbita moschata 3662 495.495 990.0 0.99 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 0.605 0.605 0.605 mg/100 g Cake Type 2 specific 1000.0 2540.0 0.0 mg/100 g Cantaloupe melon Type 1 Cucumis melo var. cantalupensis 0.64 0.64 0.64 mg/100 g Caraway Type 1 specific Carum carvi 48032 Carob Type 1 specific Ceratonia siliqua 20340 8450.0 8450.0 8450.0 mg/100 g Carp bream Type 1 specific Abramis brama 38527 0.0 0.0 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 704.802857 1900.0 0.0 mg/100 g Casein Type 2 specific 0.0 0.0 0.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 30.0 80.0 0.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 0.0 0.0 0.0 mg/100 g Catfish Type 1 specific Siluriformes 7995 0.0 0.0 0.0 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 4.795918 230.0 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 802.735909 1310.0 0.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 80.0 80.0 80.0 mg/100 g Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 0.0 0.0 0.0 mg/100 g Celery stalks Type 1 specific Apium graveolens var. dulce 117781 0.22 0.22 0.22 mg/100 g Cetacea (Dolphin, Porpoise, Whale) Type 1 specific Cetacea 9721 0.0 0.0 0.0 mg/100 g Channel catfish Type 1 specific Ictalurus punctatus 7998 0.0 0.0 0.0 mg/100 g Chanterelle Type 1 specific Cantharellus cibarius 36066 0.0 0.0 0.0 mg/100 g Charr Type 1 specific Salvelinus 8033 0.0 0.0 0.0 mg/100 g Chayote Type 1 specific Sechium edule 184140 0.0 0.0 0.0 mg/100 g Cheddar Cheese Type 2 Cheddar Cheese 0.0 0.0 0.0 mg/100 g Cheese Type 2 specific 3.014706 150.0 0.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 1570.15 6280.0 0.0 mg/100 g Chervil Type 1 specific Anthriscus cerefolium 40888 0.0 0.0 0.0 mg/100 g Chestnut Type 1 specific Castanea 21019 0.0 0.0 0.0 mg/100 g Chewing gum Type 2 specific 0.0 0.0 0.0 mg/100 g Chicken Type 1 specific Gallus gallus 9031 0.0 0.0 0.0 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 0.0 0.0 0.0 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 2650.0 13250.0 0.0 mg/100 g Chili Type 2 specific 540.0 630.0 490.0 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 0.0 0.0 0.0 mg/100 g Chinese cinnamon Type 1 specific Cinnamomum aromaticum 119260 1110.0 1110.0 1110.0 mg/100 g Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 0.0 0.0 0.0 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 0.0 0.0 0.0 mg/100 g Chocolate Type 2 specific 1384.615385 5900.0 0.0 mg/100 g Chocolate spread Type 2 specific 0.0 0.0 0.0 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 0.0 0.0 0.0 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 0.37 1.11 0.0 mg/100 g Clam Type 1 0.0 0.0 0.0 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 0.0 0.0 0.0 mg/100 g Clementine Type 1 Citrus × clementina 0.105 0.105 0.105 mg/100 g Cloves Type 1 specific Syzygium aromaticum 219868 535.535 1070.0 1.07 mg/100 g Clupeinae (Herring, Sardine, Sprat) Type 1 specific Clupeinae 7948 121.052632 1600.0 0.0 mg/100 g Cocoa bean Type 1 specific Theobroma cacao 3641 Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa powder Type 2 specific 0.0 0.0 0.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 203.333333 2220.0 0.0 mg/100 g Coffee Type 1 generic Coffea 13442 0.0 0.0 0.0 mg/100 g Coffee and coffee products Unknown generic Coho salmon Type 1 specific Oncorhynchus kisutch 8019 0.0 0.0 0.0 mg/100 g Cold cut Type 2 specific 0.0 0.0 0.0 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 0.0 0.0 0.0 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 231.944444 1450.0 0.0 mg/100 g Common beet Type 1 specific Beta vulgaris 161934 200.0 200.0 200.0 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 14.285714 100.0 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 882.777778 2020.0 0.0 mg/100 g Common chokecherry Type 1 specific Prunus virginiana 133204 4865.0 5380.0 4350.0 mg/100 g Common dab Type 1 specific Limanda limanda 27771 0.0 0.0 0.0 mg/100 g Common grape Type 1 specific Vitis vinifera 29760 18905.0 29680.0 8130.0 mg/100 g Common hazelnut Type 1 specific Corylus avellana 13451 0.0 0.0 0.0 mg/100 g Common ling Type 1 specific Molva molva 163112 0.0 0.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 104.545455 490.0 0.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 0.0 0.0 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 565.565 1130.0 1.13 mg/100 g Common pea Type 1 specific Pisum sativum 3888 128.421053 410.0 0.0 mg/100 g Common walnut Type 1 specific Juglans regia 51240 45.02 90.0 0.04 mg/100 g Common wheat Type 1 specific Triticum aestivum 4565 60.0 60.0 60.0 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 0.0 0.0 0.0 mg/100 g Corn Type 1 specific Zea mays 4577 277.272727 1940.0 0.0 mg/100 g Corn chip Type 2 specific 245.0 320.0 170.0 mg/100 g Corn grits Type 2 specific 0.0 0.0 0.0 mg/100 g Cottage cheese Type 2 0.0 0.0 0.0 mg/100 g Cottonseed Type 1 specific Gossypium 3633 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 0% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 1% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 2% fat Type 2 specific 10.0 10.0 10.0 mg/100 g Cow milk, pasteurized, vitamin D added, 3.25% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Crab Type 1 specific Brachyura 6752 0.0 0.0 0.0 mg/100 g Cracker Type 2 specific 412.5 1100.0 0.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 0.0 0.0 0.0 mg/100 g Cream Type 2 specific 0.0 0.0 0.0 mg/100 g Crisp bread Type 2 specific 160.0 200.0 0.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 760.594118 8810.0 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 786.25 1940.0 0.0 mg/100 g Curry powder Type 2 specific 263.333333 790.0 0.0 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 0.059 0.295 0.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 0.0 0.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 16891.488571 31950.0 0.42 mg/100 g Dill Type 1 specific Anethum graveolens 40922 0.0 0.0 0.0 mg/100 g Domestic pig Type 1 specific Sus scrofa domestica 9825 59.916318 5460.0 0.0 mg/100 g Dragée Type 2 specific 0.0 0.0 0.0 mg/100 g Dried milk Type 2 specific 0.0 0.0 0.0 mg/100 g Dulce de leche Type 2 specific 320.0 320.0 320.0 mg/100 g Dumpling Type 2 specific 0.0 0.0 0.0 mg/100 g Eastern oyster Type 1 specific Crassostrea virginica 6565 0.0 0.0 0.0 mg/100 g Egg roll Type 2 specific 827.5 1060.0 700.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 700.0425 1400.0 0.0 mg/100 g Eggs Unknown generic 3.783784 70.0 0.0 mg/100 g Elderberry Type 1 specific Sambucus 4201 1040.0 3120.0 0.0 mg/100 g Empanada Type 2 specific 380.0 380.0 380.0 mg/100 g Endive Type 1 specific Cichorium endivia 114280 0.0 0.0 0.0 mg/100 g Enokitake Type 1 specific Flammulina velutipes 38945 0.0 0.0 0.0 mg/100 g European plum Type 1 specific Prunus domestica 3758 4986.666667 13870.0 0.0 mg/100 g Feijoa Type 1 specific Feijoa sellowiana 260130 1475.0825 2950.0 0.165 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 500.0 1000.0 0.0 mg/100 g Fenugreek Type 1 specific Trigonella foenum-graecum 78534 Fig Type 1 specific Ficus carica 3494 4718.416667 22930.0 0.0 mg/100 g Fish oil Type 1 0.0 0.0 0.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 0.0 0.0 0.0 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 0.0 0.0 0.0 mg/100 g Flour Type 2 specific 0.0 0.0 0.0 mg/100 g French plantain Type 1 specific Musa X paradisiaca 89151 1104.204 4860.0 0.0 mg/100 g French toast Type 2 specific 750.0 750.0 750.0 mg/100 g Fruit gum Type 2 specific 3100.0 3100.0 3100.0 mg/100 g Fruit juice Type 2 specific 1870.0 6460.0 0.0 mg/100 g Fruit preserve Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit-flavor drink Type 2 specific 10547.5 21990.0 200.0 mg/100 g Fruits Unknown generic Frybread Type 2 specific 0.0 0.0 0.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.0 0.0 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 0.0 0.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 70.0 70.0 70.0 mg/100 g Garden onion Type 1 specific Allium cepa 4679 5705.2875 11410.0 0.575 mg/100 g Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 0.575 0.575 0.575 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 750.0 750.0 750.0 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 1338.275862 5850.0 0.0 mg/100 g Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 1170.0 1170.0 1170.0 mg/100 g Garfish Type 1 specific Belone belone 129037 0.0 0.0 0.0 mg/100 g Garlic Type 1 specific Allium sativum 4682 62.0 310.0 0.0 mg/100 g Gelatin Type 2 specific 0.0 0.0 0.0 mg/100 g Gelatin dessert Type 2 specific 0.0 0.0 0.0 mg/100 g German camomile Type 1 specific Matricaria recutita 127986 Gin Type 2 specific 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 593.333333 1780.0 0.0 mg/100 g Ginkgo nuts Type 1 specific Ginkgo biloba 3311 Globe artichoke Type 1 specific Cynara scolymus 59895 10.0 20.0 0.0 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 1366.666667 4100.0 0.0 mg/100 g Grape Type 1 specific Vitis 3603 2629.165909 7360.0 0.0 mg/100 g Grape wine Type 2 specific 734.166667 5150.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 1994.0 3100.0 1000.0 mg/100 g Grapefruit/Pummelo hybrid Type 1 specific Citrus paradisi X Citrus maxima 37656 0.45 0.45 0.45 mg/100 g Green bean Type 1 specific Phaseolus vulgaris 3885 765.012 1450.0 0.0 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 1040.0 1500.0 0.0 mg/100 g Green lentil Type 1 Lens culinaris 0.2 0.2 0.2 mg/100 g Green plum Type 1 0.765 0.765 0.765 mg/100 g Green tea Type 1 0.0 0.0 0.0 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 760.0 1380.0 0.0 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 0.0 0.0 0.0 mg/100 g Groundcherry Type 1 specific Physalis 24663 0.0 0.0 0.0 mg/100 g Guava Type 1 specific Psidium guajava 120290 3590.0 5570.0 2600.0 mg/100 g Haddock Type 1 specific Melanogrammus aeglefinus 8056 0.0 0.0 0.0 mg/100 g Hamburger Type 2 specific 1769.333333 2930.0 620.0 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 0.0 0.0 0.0 mg/100 g Hazelnut Type 1 specific Corylus 13450 35.0 70.0 0.0 mg/100 g Herbal tea Type 1 0.0 0.0 0.0 mg/100 g Herbs and Spices Unknown generic Hibiscus tea Type 1 specific Hibiscus sabbariffa 183260 0.0 0.0 0.0 mg/100 g Highbush blueberry Type 1 specific Vaccinium corymbosum 69266 Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 0.0 0.0 0.0 mg/100 g Honey Type 2 specific 29406.36375 40940.0 5.455 mg/100 g Horchata Type 2 specific 1550.0 1550.0 1550.0 mg/100 g Horseradish Type 1 specific Armoracia rusticana 3704 126.666667 380.0 0.0 mg/100 g Hot chocolate Type 2 specific 75.454545 410.0 0.0 mg/100 g Hushpuppy Type 2 specific 170.0 170.0 170.0 mg/100 g Ice cream Type 2 specific 154.583333 1610.0 0.0 mg/100 g Iceberg lettuce Type 1 0.31 0.31 0.31 mg/100 g Italian oregano Type 1 specific Origanum X majoricum 1384207 1.13 1.13 1.13 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 2315.0 2430.0 2260.0 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 4595.4975 9190.0 0.995 mg/100 g Jalapeno pepper Type 1 Capsicum annuum 'Jalapeño' 0.405 0.405 0.405 mg/100 g Japanese persimmon Type 1 specific Diospyros kaki 35925 2780.035 5560.0 0.07 mg/100 g Japanese pumpkin Type 1 specific Cucurbita maxima 3661 297.5 900.0 70.0 mg/100 g Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 0.0 0.0 0.0 mg/100 g Kale Type 1 specific Brassica napus var. pabularia 136.6825 820.0 0.0 mg/100 g Kefir Type 2 specific 0.0 0.0 0.0 mg/100 g Ketchup Type 2 specific 3096.666667 9290.0 0.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 3366.076 5680.0 0.38 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 0.0 0.0 0.0 mg/100 g Kombu Type 1 specific Saccharina japonica 88149 0.0 0.0 0.0 mg/100 g Kumquat Type 1 specific Fortunella 2706 2300.0 2300.0 2300.0 mg/100 g Lake trout Type 1 specific Salvelinus namaycush 8040 0.0 0.0 0.0 mg/100 g Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Lasagna Type 2 specific 760.0 760.0 760.0 mg/100 g Leavening agent Type 2 specific 0.0 0.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 640.0 640.0 640.0 mg/100 g Lemon Type 1 specific Citrus limon 2708 814.285714 1400.0 0.0 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 0.0 0.0 0.0 mg/100 g Lentils Type 1 generic Lens culinaris 3864 33.775 270.0 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 412.866786 1380.0 0.0 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.0 0.0 0.0 mg/100 g Lima bean Type 1 specific Phaseolus lunatus 3884 210.0 210.0 210.0 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 0.0 0.0 0.0 mg/100 g Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 2100.0 4200.0 0.0 mg/100 g Liquor Type 2 specific 0.0 0.0 0.0 mg/100 g Liquorice Type 2 specific 4525.0 11000.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 0.0 0.0 0.0 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 0.0 0.0 0.0 mg/100 g Lumpsucker Type 1 specific Cyclopteridae 8101 0.0 0.0 0.0 mg/100 g Macadamia nut Type 1 specific Macadamia 4329 52.5 70.0 0.0 mg/100 g Macadamia nut (M. tetraphylla) Type 1 specific Macadamia tetraphylla 512563 0.0 0.0 0.0 mg/100 g Macaroni and cheese Type 2 specific 0.0 0.0 0.0 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 0.0 0.0 0.0 mg/100 g Malus (Crab apple) Type 1 specific Malus 3749 0.0 0.0 0.0 mg/100 g Mamey sapote Type 1 specific Pouteria sapota 233744 3830.6675 7660.0 1.335 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 1780.114375 5100.0 0.0 mg/100 g Mango Type 1 specific Mangifera indica 29780 2990.349167 5560.0 2.095 mg/100 g Margarine Type 2 specific 0.0 0.0 0.0 mg/100 g Margarine-like spread Type 2 specific 0.0 0.0 0.0 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 0.0 0.0 0.0 mg/100 g Marshmallow Type 2 specific 3600.0 3600.0 3600.0 mg/100 g Marzipan Type 2 specific 0.0 0.0 0.0 mg/100 g Meat bouillon Type 2 specific 0.0 0.0 0.0 mg/100 g Meatball Type 2 specific 0.0 0.0 0.0 mg/100 g Meatloaf Type 2 specific 40.0 110.0 0.0 mg/100 g Meringue Type 2 specific 800.0 800.0 800.0 mg/100 g Mexican groundcherry Type 1 specific Physalis philadelphica var. immaculata 374021 1120.0 1120.0 1120.0 mg/100 g Mexican oregano Type 1 specific Lippia graveolens 1.13 1.13 1.13 mg/100 g Milk (Cow) Type 2 specific 3.846154 40.0 0.0 mg/100 g Milk (Human) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Other mammals) Type 2 specific 0.0 0.0 0.0 mg/100 g Milkshake Type 2 specific 627.5 1650.0 0.0 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 0.0 0.0 0.0 mg/100 g Miso Type 2 specific 2000.0 6000.0 0.0 mg/100 g Mixed nuts Type 2 specific 0.0 0.0 0.0 mg/100 g Molasses Type 2 specific 6397.65 12790.0 5.3 mg/100 g Morchella (Morel) Type 1 specific Morchellaceae 5192 0.0 0.0 0.0 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 0.0 0.0 0.0 mg/100 g Mozzarella cheese Type 2 0.0 0.0 0.0 mg/100 g Multigrain bread Type 2 specific 2560.0 2670.0 2450.0 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 0.0 0.0 0.0 mg/100 g Muscadine grape Type 1 specific Vitis rotundifolia 103349 1961.96 3920.0 3.92 mg/100 g Muskmelon Type 1 specific Cucumis melo 3656 5029.0 38800.0 0.0 mg/100 g Mustard Type 2 specific 0.0 0.0 0.0 mg/100 g Nachos Type 2 specific 290.0 430.0 150.0 mg/100 g Nance Type 1 specific Byrsonima crassifolia 4270 4303.565 8180.0 0.695 mg/100 g Naranjilla Type 1 specific Solanum quitoense 227725 520.2175 1040.0 0.435 mg/100 g Narrowleaf cattail Type 1 specific Typha angustifolia 59011 35.0 70.0 0.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 342.545 1370.0 0.0 mg/100 g Northern pike Type 1 specific Esox lucius 8010 0.0 0.0 0.0 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Norway lobster Type 1 specific Nephrops norvegicus 6829 0.0 0.0 0.0 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.0 0.0 0.0 mg/100 g Nougat Type 2 specific 0.0 0.0 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 0.0 0.0 0.0 mg/100 g Nutritional drink Type 2 specific 1280.0 3220.0 0.0 mg/100 g Oat Type 1 specific Avena sativa 4498 0.0 0.0 0.0 mg/100 g Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 52.58875 210.0 0.0 mg/100 g Olive Type 1 specific Olea europaea 4146 0.0 0.0 0.0 mg/100 g Opium poppy Type 1 specific Papaver somniferum 3469 290.0 290.0 290.0 mg/100 g Oriental wheat Type 1 specific Triticum turanicum 376534 90.0475 180.0 0.095 mg/100 g Other alcoholic beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Other animal fat Type 2 specific 0.0 0.0 0.0 mg/100 g Other beverage Type 2 specific 40.0 40.0 40.0 mg/100 g Other bread Type 2 specific 288.26087 2440.0 0.0 mg/100 g Other bread product Type 2 specific 1056.666667 2460.0 0.0 mg/100 g Other candy Type 2 specific 454.545455 1400.0 0.0 mg/100 g Other dish Type 2 specific 528.0 3030.0 0.0 mg/100 g Other fermented milk Type 2 specific 0.0 0.0 0.0 mg/100 g Other fish product Type 2 specific 222.5 620.0 0.0 mg/100 g Other frozen dessert Type 2 specific 1035.714286 3700.0 0.0 mg/100 g Other fruit product Type 2 specific 5227.5 5510.0 4850.0 mg/100 g Other pasta dish Type 2 specific 1760.0 2020.0 1500.0 mg/100 g Other sandwich Type 2 specific 992.727273 2090.0 90.0 mg/100 g Other snack food Type 2 specific 241.818182 1350.0 0.0 mg/100 g Other soy product Type 2 specific 165.0 210.0 120.0 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 0.0 0.0 0.0 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 0.0 0.0 0.0 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 0.0 0.0 0.0 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.0 0.0 0.0 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 0.0 0.0 0.0 mg/100 g Pacific sardine Type 1 specific Sardinops sagax 28381 170.0 170.0 170.0 mg/100 g Painted comber Type 1 specific Serranus scriba 349661 0.0 0.0 0.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 0.0 0.0 0.0 mg/100 g Pan dulce Type 2 specific 4050.0 4050.0 4050.0 mg/100 g Pancake Type 2 specific 645.0 2740.0 0.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 3502.245 6780.0 1.225 mg/100 g Parmesan cheese Type 2 0.0 0.0 0.0 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 204.0 420.0 0.0 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 0.0 0.0 0.0 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 0.0 0.0 0.0 mg/100 g Pasta Type 2 specific 28.181818 110.0 0.0 mg/100 g Pastry Type 2 specific 551.304348 4920.0 0.0 mg/100 g Pate Type 2 specific 0.0 0.0 0.0 mg/100 g Pea shoots Type 1 0.39 0.39 0.39 mg/100 g Peach Type 1 specific Prunus persica 3760 3629.135 13490.0 0.485 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 0.485 0.485 0.485 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 5.0 80.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 4255.04 6530.0 0.0 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 16.666667 40.0 0.0 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 1551.818182 6710.0 0.0 mg/100 g Pepper (Spice) Type 1 specific Piper nigrum 13216 57.505 230.0 0.0 mg/100 g Perciformes Type 1 specific Perciformes 8111 0.0 0.0 0.0 mg/100 g Persian lime Type 1 specific Citrus latifolia 200541 610.0 610.0 610.0 mg/100 g Persimmon Type 1 specific Diospyros 13492 6300.0 6300.0 6300.0 mg/100 g Pie Type 2 specific 2473.333333 4570.0 0.0 mg/100 g Pie crust Type 2 specific 0.0 0.0 0.0 mg/100 g Pikeperch Type 1 specific Sander lucioperca 283035 0.0 0.0 0.0 mg/100 g Piki bread Type 2 specific 0.0 0.0 0.0 mg/100 g Pine nut Type 1 specific Pinus 3337 74.0 300.0 0.0 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 2527.558438 7200.0 0.0 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 85.01875 240.0 0.0 mg/100 g Pizza Type 2 specific 982.307692 2360.0 0.0 mg/100 g Plains prickly pear Type 1 specific Opuntia macrorhiza 1041245 210.0 210.0 210.0 mg/100 g Plantain Type 1 Musa × paradisiaca 1.02 1.02 1.02 mg/100 g Pleuronectidae (Dab, Halibut, Plaice) Type 1 specific Pleuronectidae 8256 0.0 0.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.0 0.0 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 2123.333333 6370.0 0.0 mg/100 g Pomes Unknown generic Popcorn Type 2 specific 51.666667 170.0 0.0 mg/100 g Poppy Type 1 specific Papaver 3468 0.0 0.0 0.0 mg/100 g Port wine Type 2 specific 0.0 0.0 0.0 mg/100 g Pot pie Type 2 specific 90.0 100.0 80.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 122.666667 1010.0 0.0 mg/100 g Potato chip Type 2 specific 196.666667 290.0 140.0 mg/100 g Potato puffs Type 2 specific 0.0 0.0 0.0 mg/100 g Prairie turnip Type 1 specific Pediomelum esculentum 458363 80.033333 170.0 0.1 mg/100 g Prickly pear Type 1 specific Opuntia 106975 0.0 0.0 0.0 mg/100 g Processed cheese Type 2 specific 52.0 170.0 0.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 1350.0 5400.0 0.0 mg/100 g Pudding Type 2 specific 0.0 0.0 0.0 mg/100 g Pupusa Type 2 specific 250.0 330.0 200.0 mg/100 g Purslane Type 1 specific Portulaca oleracea 46147 Quesadilla Type 2 specific 400.0 400.0 400.0 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 0.0 0.0 0.0 mg/100 g Rabbit Type 1 specific Leporidae 9979 0.0 0.0 0.0 mg/100 g Radish Type 1 specific Raphanus sativus 3726 363.431667 710.0 0.295 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 0.0 0.0 0.0 mg/100 g Rape Type 1 specific Brassica napus var. napus 138011 0.0 0.0 0.0 mg/100 g Rapini Type 1 specific Brassica ruvo 1204434 205.0 240.0 170.0 mg/100 g Ravioli Type 2 specific 1160.0 1240.0 1080.0 mg/100 g Red algae Type 1 specific Rhodophyta 2763 0.0 0.0 0.0 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra 290.0 290.0 290.0 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 1750.0 2430.0 0.0 mg/100 g Red raspberry Type 1 specific Rubus idaeus 32247 3500.0 3500.0 3500.0 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 0.0 0.0 0.0 mg/100 g Red tea Type 1 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 816.4 3530.0 0.0 mg/100 g Remoulade Type 2 specific 0.0 0.0 0.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 12.8026 200.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 0.0 0.0 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 0.0 0.0 0.0 mg/100 g Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 400.0 800.0 0.0 mg/100 g Rose hip Type 1 specific Rosa 3764 1720.145 6300.0 0.0 mg/100 g Rowal Type 1 specific Pangium edule 112823 250.25 500.0 0.5 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 1090.0 3040.0 0.0 mg/100 g Rum Type 2 specific 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 266.923462 570.0 0.0 mg/100 g Rye bread Type 2 specific 65.172857 380.0 0.0 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 0.0 0.0 0.0 mg/100 g Saffron Type 1 specific Crocus sativus 82528 Salad Type 2 specific 1128.888889 1450.0 680.0 mg/100 g Salad dressing Type 2 specific 1870.47619 12490.0 0.0 mg/100 g Salmonberry Type 1 specific Rubus spectabilis 59499 1750.0 1750.0 1750.0 mg/100 g Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 0.0 0.0 0.0 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Sapodilla Type 1 specific Manilkara zapota 3741 5800.0 5800.0 5800.0 mg/100 g Sauce Type 2 specific 3263.333333 15630.0 0.0 mg/100 g Sausage Type 2 specific 8.043478 370.0 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 0.0 0.0 0.0 mg/100 g Scallop Type 1 specific Pectinidae 6566 0.0 0.0 0.0 mg/100 g Scombridae (Bonito, Mackerel, Tuna) Type 1 specific Scombridae 8224 0.0 0.0 0.0 mg/100 g Scrapple Type 2 specific 0.0 0.0 0.0 mg/100 g Semolina Type 2 specific 0.0 0.0 0.0 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 10.0 70.0 0.0 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 0.0 0.0 0.0 mg/100 g Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 0.0 0.0 0.0 mg/100 g Sherry Type 2 specific 0.0 0.0 0.0 mg/100 g Shiitake Type 1 specific Lentinus edodes 5353 0.0 0.0 0.0 mg/100 g Shrimp Type 1 specific Caridea 6694 15.833333 130.0 0.0 mg/100 g Smelt Type 1 specific Osmeridae 8012 0.0 0.0 0.0 mg/100 g Snack bar Type 2 specific 3485.0 15960.0 370.0 mg/100 g Snail Type 1 specific Gastropoda 6448 0.0 0.0 0.0 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 0.0 0.0 0.0 mg/100 g Soft drink Type 2 specific 2250.666667 6100.0 0.0 mg/100 g Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 Sorghum Type 1 specific Sorghum bicolor 4558 50.0 50.0 50.0 mg/100 g Sorrel Type 1 specific Rumex acetosa 41241 0.0 0.0 0.0 mg/100 g Soup Type 2 specific 266.086957 4670.0 0.0 mg/100 g Sour cherry Type 1 specific Prunus cerasus 140311 4293.333333 6670.0 2700.0 mg/100 g Soursop Type 1 specific Annona muricata 13337 5940.0 5940.0 5940.0 mg/100 g Soy bean Type 1 specific Glycine max 3847 78.461538 690.0 0.0 mg/100 g Soy milk Type 2 specific 0.0 0.0 0.0 mg/100 g Soy sauce Type 2 specific 0.0 0.0 0.0 mg/100 g Spelt Type 1 specific Triticum spelta 58933 120.0225 240.0 0.045 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 76.695 180.0 0.0 mg/100 g Spiny dogfish Type 1 specific Squalus acanthias 7797 0.0 0.0 0.0 mg/100 g Spirit Type 2 specific 0.0 0.0 0.0 mg/100 g Spotted seal Type 1 specific Phoca largha 39090 0.0 0.0 0.0 mg/100 g Spread Type 2 specific 0.0 0.0 0.0 mg/100 g Star fruit Type 1 specific Averrhoa carambola 28974 0.0 0.0 0.0 mg/100 g Stew Type 2 specific 82.857143 330.0 0.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 669.444444 2440.0 0.0 mg/100 g Stuffing Type 2 specific 1020.0 1020.0 1020.0 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 0.0 0.0 0.0 mg/100 g Sugar Type 2 specific 8828.181818 95000.0 0.0 mg/100 g Sugar apple Type 1 specific Annona squamosa 301693 Sugar substitute Type 2 specific 85.0 510.0 0.0 mg/100 g Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 428.0 950.0 70.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 0.0 0.0 0.0 mg/100 g Swede Type 1 specific Brassica napus 3708 0.063333 0.19 0.0 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 256.673333 750.0 0.02 mg/100 g Sweet cherry Type 1 specific Prunus avium 42229 6005.0 7455.0 5190.0 mg/100 g Sweet custard Type 2 specific 5.0 10.0 0.0 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 1879.315714 2800.0 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 439.0445 800.0 0.0 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 0.0 0.0 0.0 mg/100 g Swiss cheese Type 2 0.0 0.0 0.0 mg/100 g Syrup Type 2 specific 1602.5 5890.0 0.0 mg/100 g Taco Type 2 specific 515.0 630.0 300.0 mg/100 g Tallow Type 2 specific 0.0 0.0 0.0 mg/100 g Tamale Type 2 specific 387.5 600.0 170.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 4142.5 10500.0 0.0 mg/100 g Tarragon Type 1 specific Artemisia dracunculus 72341 Tea Type 1 specific Camellia sinensis 4442 0.0 0.0 0.0 mg/100 g Teff Type 1 specific Eragrostis tef 110835 235.0475 470.0 0.095 mg/100 g Thistle Type 1 specific Cirsium 41549 0.0 0.0 0.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 0.0 0.0 0.0 mg/100 g Tinda Type 1 specific Citrullus lanatus var. fistulosus 1225.0 1560.0 890.0 mg/100 g Toffee Type 2 specific 500.0 1000.0 0.0 mg/100 g Tofu Type 2 specific 0.0 0.0 0.0 mg/100 g Topping Type 2 specific 0.0 0.0 0.0 mg/100 g Tortilla Type 2 specific 15.0 30.0 0.0 mg/100 g Tortilla chip Type 2 specific 186.666667 340.0 70.0 mg/100 g True frog Type 1 specific Ranidae 8397 0.0 0.0 0.0 mg/100 g True oyster Type 1 specific Ostreidae 6563 0.0 0.0 0.0 mg/100 g True seal Type 1 specific Phocidae 9709 0.0 0.0 0.0 mg/100 g True sole Type 1 specific Soleidae 30948 0.0 0.0 0.0 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 0.0 0.0 0.0 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 0.0 0.0 0.0 mg/100 g Turmeric Type 1 specific Curcuma longa 136217 4150.15 12000.0 0.45 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 96.666667 290.0 0.0 mg/100 g Unclassified food or beverage Type 2 specific 25.0 130.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 3455.555556 9020.0 0.0 mg/100 g Vegetable juice Type 2 specific 213.0 213.0 213.0 mg/100 g Vegetarian food Type 2 specific 965.0 1800.0 130.0 mg/100 g Vermouth Type 2 specific 0.0 0.0 0.0 mg/100 g Vinegar Type 2 specific 2560.0 7380.0 0.0 mg/100 g Vodka Type 2 specific 0.0 0.0 0.0 mg/100 g Waffle Type 2 specific 0.0 0.0 0.0 mg/100 g Walnut Type 1 specific Juglans 16718 0.0125 0.05 0.0 mg/100 g Wasabi Type 1 specific Wasabia japonica 75806 2.3 2.3 2.3 mg/100 g Water Type 2 specific 0.0 0.0 0.0 mg/100 g Water spinach Type 1 Ipomoea aquatica 0.255 0.255 0.255 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 0.0 0.0 0.0 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 2590.16 3500.0 0.64 mg/100 g Wheat Type 1 specific Triticum 4564 31.034483 490.0 0.0 mg/100 g Wheat bread Type 2 specific 399.534884 2700.0 0.0 mg/100 g Whey Type 2 specific 0.0 0.0 0.0 mg/100 g Whisky Type 2 specific 0.0 0.0 0.0 mg/100 g White bread Type 1 803.825 2440.0 0.0 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 1447.5 2020.0 1160.0 mg/100 g White mustard Type 1 specific Sinapis alba 3728 100.0 180.0 20.0 mg/100 g White wine Type 2 1076.075 2150.0 2.15 mg/100 g Whitefish Type 1 specific Coregonus 27772 0.0 0.0 0.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 0.0 0.0 0.0 mg/100 g Wild carrot Type 1 specific Daucus carota 4039 0.86 0.86 0.86 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 438.37 660.0 0.22 mg/100 g Wild leek Type 1 specific Allium ampeloprasum 4681 Wild rice Type 1 specific Zizania 15949 200.0 200.0 200.0 mg/100 g Yam Type 1 specific Dioscorea 4672 0.0 0.0 0.0 mg/100 g Yellow bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Yellow pond-lily Type 1 specific Nuphar lutea 77113 0.0 0.0 0.0 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 570.0625 1380.0 0.0 mg/100 g Ymer Type 2 specific 0.0 0.0 0.0 mg/100 g Yogurt Type 2 specific 5065.909091 95000.0 0.0 mg/100 g odorless 14 kDa phosphohistidine phosphatase Q9NRX4 PHPT1 Hexokinase-1 P19367 HK1 Hexokinase-2 P52789 HK2 Hexokinase-3 P52790 HK3 Ketohexokinase P50053 KHK Lysosomal alpha-glucosidase P10253 GAA Maltase-glucoamylase, intestinal O43451 MGAM Neutral alpha-glucosidase C Q8TET4 GANC Sucrase-isomaltase, intestinal P14410 SI anti alcoholic 98 Any substance introduced into a living organism with therapeutic or diagnostic purpose. anti diabetic 228 Any substance introduced into a living organism with therapeutic or diagnostic purpose. anti hangover 315 Any substance introduced into a living organism with therapeutic or diagnostic purpose. anti ketotic 382 anti nauseant 464 A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. laxative 1065 An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. neoplastic 1145 sweetener 1341 Substance that sweeten food, beverages, medications, etc.