1.0 2010-04-08 22:10:13 UTC 2025-11-18 23:37:40 UTC FDB012536 Glutamic acid Glutamic acid (abbreviated as Glu or E) is one of the 20 proteinogenic amino acids. It is a non-essential amino acid. Glutamic acid is found in many foods, some of which are garden onion, orange bell pepper, oat, and cucumber. 2-Aminoglutaric acid 2-Aminopentanedioic acid, 9CI E620 FEMA 3285 Glu Glutamate Glutaminic acid C5H9NO4 147.1293 147.053157781 2-aminopentanedioic acid glutaminsaeure 6899-05-4 NC(CCC(O)=O)C(O)=O InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10) WHUUTDBJXJRKMK-UHFFFAOYSA-N belongs to the class of organic compounds known as glutamic acid and derivatives. Glutamic acid and derivatives are compounds containing glutamic acid or a derivative thereof resulting from reaction of glutamic acid at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Glutamic acid and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Alpha amino acids Amino acids Amino fatty acids Carbonyl compounds Carboxylic acids Dicarboxylic acids and derivatives Hydrocarbon derivatives Monoalkylamines Organic oxides Organopnictogen compounds Aliphatic acyclic compound Alpha-amino acid Amine Amino acid Amino fatty acid Carbonyl group Carboxylic acid Dicarboxylic acid or derivatives Fatty acid Fatty acyl Glutamic acid or derivatives Hydrocarbon derivative Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine alpha-amino acid logp -3.54 ALOGPS logs -0.26 ALOGPS solubility 8.06e+01 g/l ALOGPS logp -3.2 ChemAxon pka_strongest_acidic 1.88 ChemAxon pka_strongest_basic 9.54 ChemAxon iupac 2-aminopentanedioic acid ChemAxon average_mass 147.1293 ChemAxon mono_mass 147.053157781 ChemAxon smiles NC(CCC(O)=O)C(O)=O ChemAxon formula C5H9NO4 ChemAxon inchi InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10) ChemAxon inchikey WHUUTDBJXJRKMK-UHFFFAOYSA-N ChemAxon polar_surface_area 100.62 ChemAxon refractivity 31.29 ChemAxon polarizability 13.49 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 5 ChemAxon donor_count 3 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 730 Specdb::MsMs 12479 Specdb::MsMs 12480 Specdb::MsMs 12481 Specdb::MsMs 19151 Specdb::MsMs 19152 Specdb::MsMs 19153 Specdb::MsMs 439490 Specdb::MsMs 439491 Specdb::MsMs 445226 Specdb::MsMs 445227 Specdb::MsMs 445228 Specdb::MsMs 445229 Specdb::MsMs 447545 Specdb::MsMs 447546 Specdb::MsMs 447547 Specdb::MsMs 447548 Specdb::MsMs 447549 Specdb::MsMs 447550 Specdb::MsMs 447551 Specdb::MsMs 447552 Specdb::MsMs 447553 Specdb::MsMs 447554 Specdb::MsMs 447555 Specdb::MsMs 447556 Specdb::MsMs 449548 Specdb::CMs 31933 Specdb::CMs 31960 Specdb::CMs 33448 Specdb::CMs 48237 Specdb::CMs 102430 Specdb::CMs 102431 Specdb::CMs 149384 Specdb::NmrOneD 3167 Specdb::NmrOneD 59012 Specdb::NmrOneD 59013 Specdb::NmrOneD 59014 Specdb::NmrOneD 59015 Specdb::NmrOneD 59016 Specdb::NmrOneD 59017 Specdb::NmrOneD 59018 Specdb::NmrOneD 59019 Specdb::NmrOneD 59020 Specdb::NmrOneD 59021 Specdb::NmrOneD 59022 Specdb::NmrOneD 59023 Specdb::NmrOneD 59024 Specdb::NmrOneD 59025 Specdb::NmrOneD 59026 Specdb::NmrOneD 59027 Specdb::NmrOneD 59028 Specdb::NmrOneD 59029 Specdb::NmrOneD 59030 Specdb::NmrOneD 59031 HMDB0060475 18237 Acorn Type 1 specific Quercus 3511 0.986 0.986 0.986 mg/100 g Acorn squash Type 1 Cucurbita pepo var. turbinata 0.14 0.14 0.14 mg/100 g Agave Type 1 specific Agave 39509 0.052 0.052 0.052 mg/100 g Almond Type 1 specific Prunus dulcis 3755 6.206 6.206 6.206 mg/100 g Amaranth Type 1 specific Amaranthus 3564 2.259 2.259 2.259 mg/100 g American butterfish Type 1 specific Peprilus triacanthus 183653 2.58 2.58 2.58 mg/100 g American lobster Type 1 specific Homarus americanus 6706 2.437 2.437 2.437 mg/100 g American shad Type 1 specific Alosa sapidissima 34773 2.527 2.527 2.527 mg/100 g Anatidae Type 1 specific Anatidae 8830 2.58725 3.106 1.709 mg/100 g Anchovy Type 1 specific Engraulidae 43062 3.038 3.038 3.038 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 2.753 2.753 2.753 mg/100 g Apple Type 1 specific Malus pumila 283210 0.026 0.026 0.026 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 0.157 0.157 0.157 mg/100 g Asian pear Type 1 specific Pyrus pyrifolia 3767 0.036 0.036 0.036 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 0.233 0.233 0.233 mg/100 g Atlantic cod Type 1 specific Gadus morhua 8049 2.658 2.658 2.658 mg/100 g Atlantic croaker Type 1 specific Micropogonias undulatus 29154 2.654 2.654 2.654 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 3.174 3.174 3.174 mg/100 g Atlantic herring Type 1 specific Clupea harengus harengus 7950 2.681 2.681 2.681 mg/100 g Atlantic pollock Type 1 specific Pollachius pollachius 185739 2.777 2.777 2.777 mg/100 g Atlantic salmon Type 1 specific Salmo salar 8030 2.962 2.962 2.962 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 2.612 2.612 2.612 mg/100 g Avocado Type 1 specific Persea americana 3435 0.287 0.287 0.287 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.248 0.248 0.248 mg/100 g Banana Type 1 specific Musa acuminata 4641 0.152 0.152 0.152 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 1213.963096 2400.0 2.588 mg/100 g Beech nut Type 1 specific Fagus 21024 0.8 0.8 0.8 mg/100 g Beer Type 2 specific 192.7194 470.0 0.047 mg/100 g Bison Type 1 specific Bison bison 9901 3.04 3.04 3.04 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 5.152 5.152 5.152 mg/100 g Black-eyed pea Type 1 specific Vigna unguiculata ssp. unguiculata 3920 4.454 4.454 4.454 mg/100 g Blue cheese Type 2 5.179 5.179 5.179 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 3.08 3.08 3.08 mg/100 g Blue mussel Type 1 specific Mytilus edulis 6550 1.618 1.618 1.618 mg/100 g Bluefish Type 1 specific Pomatomus saltatrix 75034 2.991 2.991 2.991 mg/100 g Breadnut tree seed Type 1 specific Brosimum alicastrum 194253 0.835 0.835 0.835 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 0.1625 0.1625 0.1625 mg/100 g Buffalo Type 1 specific Bubalus bubalis 89462 2.956 2.956 2.956 mg/100 g Bulgur Type 2 specific 3.878 3.878 3.878 mg/100 g Burbot Type 1 specific Lota lota 69944 2.883 2.883 2.883 mg/100 g Burdock Type 1 specific Arctium lappa 4217 0.157 0.157 0.157 mg/100 g Butter Type 2 specific 0.178 0.178 0.178 mg/100 g Buttermilk Type 2 specific 0.721 0.721 0.721 mg/100 g Butternut Type 1 specific Juglans cinerea 91214 6.084 6.084 6.084 mg/100 g Butternut squash Type 1 specific Cucurbita moschata 3662 0.175 0.175 0.175 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 0.294 0.294 0.294 mg/100 g Cantaloupe melon Type 1 Cucumis melo var. cantalupensis 0.0555 0.0555 0.0555 mg/100 g Carp bream Type 1 specific Abramis brama 38527 2.662 2.662 2.662 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 122.911167 188.65 0.0835 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 0.206 0.206 0.206 mg/100 g Catfish Type 1 specific Siluriformes 7995 2.445 2.445 2.445 mg/100 g Catjang pea Type 1 specific Vigna unguiculata ssp. cylindrica 3840 4.518 4.518 4.518 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 0.257 0.257 0.257 mg/100 g Celery stalks Type 1 specific Apium graveolens var. dulce 117781 0.09 0.09 0.09 mg/100 g Channel catfish Type 1 specific Ictalurus punctatus 7998 2.445 2.445 2.445 mg/100 g Chayote Type 1 specific Sechium edule 184140 0.125 0.125 0.125 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 0.199 0.199 0.199 mg/100 g Chestnut Type 1 specific Castanea 21019 0.537 0.537 0.537 mg/100 g Chia Type 1 specific Salvia hispanica 49212 3.5 3.5 3.5 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 3.603 3.603 3.603 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 0.36 0.36 0.36 mg/100 g Chinese chestnut Type 1 specific Castanea mollissima 60419 0.537 0.537 0.537 mg/100 g Chinese chives Type 1 specific Allium tuberosum 4683 0.677 0.677 0.677 mg/100 g Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 2.994 2.994 2.994 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 0.677 0.677 0.677 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 3.006 3.006 3.006 mg/100 g Cichlidae (Tilapia) Type 1 specific Cichlidae 8113 3.213 3.213 3.213 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 0.37 0.37 0.37 mg/100 g Cisco Type 1 specific Coregonus artedi 36181 2.834 2.834 2.834 mg/100 g Clam Type 1 2.248 2.248 2.248 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 2.437 2.437 2.437 mg/100 g Cloves Type 1 specific Syzygium aromaticum 219868 0.56 0.56 0.56 mg/100 g Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 0.761 0.761 0.761 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 3.227 3.227 3.227 mg/100 g Colorado pinyon Type 1 specific Pinus edulis 3340 1.969 1.969 1.969 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 2.488667 2.82 2.268 mg/100 g Common beet Type 1 specific Beta vulgaris 161934 0.428 0.428 0.428 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 2.046 2.046 2.046 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 0.27 0.27 0.27 mg/100 g Common carp Type 1 specific Cyprinus carpio 7962 2.662 2.662 2.662 mg/100 g Common hazelnut Type 1 specific Corylus avellana 13451 3.71 3.71 3.71 mg/100 g Common ling Type 1 specific Molva molva 163112 2.834 2.834 2.834 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 2.027 2.027 2.027 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 0.975 0.975 0.975 mg/100 g Common persimmon Type 1 specific Diospyros virginiana 13493 0.104 0.104 0.104 mg/100 g Common walnut Type 1 specific Juglans regia 51240 2.816 2.816 2.816 mg/100 g Corn Type 1 specific Zea mays 4577 1.768 1.768 1.768 mg/100 g Cottonseed Type 1 specific Gossypium 3633 8.158 8.158 8.158 mg/100 g Cottonseed oil Type 2 0.0 0.0 0.0 mg/100 g Crab Type 1 specific Brachyura 6752 3.118333 3.155 3.08 mg/100 g Crayfish Type 1 specific Astacidea 6712 2.6235 2.719 2.528 mg/100 g Cream Type 2 specific 0.56225 0.629 0.454 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 169.665333 288.8 0.196 mg/100 g Cusk Type 1 specific Brosme brosme 81638 2.835 2.835 2.835 mg/100 g Cuttlefish Type 1 specific Sepiidae 6608 2.208 2.208 2.208 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 0.157 0.157 0.157 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 0.265 0.265 0.265 mg/100 g Deer Type 1 specific Cervidae 9850 3.336 3.336 3.336 mg/100 g Dill Type 1 specific Anethum graveolens 40922 169.855 339.42 0.29 mg/100 g Dock Type 1 specific Rumex 3618 0.216 0.216 0.216 mg/100 g Dungeness crab Type 1 specific Cancer magister 29965 2.969 2.969 2.969 mg/100 g Eastern oyster Type 1 specific Crassostrea virginica 6565 0.675 0.675 0.675 mg/100 g Egg substitute Type 2 specific 1.69 1.69 1.69 mg/100 g Egg yolk Type 1 0.175 0.175 0.175 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 91.338667 170.0 0.186 mg/100 g Eggs Unknown generic 0.18 0.18 0.18 mg/100 g Elk Type 1 specific Cervus canadensis 1574408 3.089 3.089 3.089 mg/100 g Emu Type 1 specific Dromaius novaehollandiae 8790 2.223 2.223 2.223 mg/100 g Endive Type 1 specific Cichorium endivia 114280 0.166 0.166 0.166 mg/100 g European anchovy Type 1 specific Engraulis encrasicolus 184585 3.038 3.038 3.038 mg/100 g European chestnut Type 1 specific Castanea sativa 21020 0.21 0.21 0.21 mg/100 g European rabbit Type 1 specific Oryctolagus 9984 3.496 3.496 3.496 mg/100 g Feijoa Type 1 specific Feijoa sellowiana 260130 0.132 0.132 0.132 mg/100 g Fenugreek Type 1 specific Trigonella foenum-graecum 78534 3.988 3.988 3.988 mg/100 g Fig Type 1 specific Ficus carica 3494 0.0425 0.0425 0.0425 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 2.127 2.127 2.127 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 4.039 4.039 4.039 mg/100 g Florida pompano Type 1 specific Trachinotus carolinus 173342 2.758 2.758 2.758 mg/100 g Freshwater drum Type 1 specific Aplodinotus grunniens 225389 2.618 2.618 2.618 mg/100 g Freshwater eel Type 1 specific Anguilla 7935 2.753 2.753 2.753 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 2.4775 2.658 2.297 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 2.658 2.658 2.658 mg/100 g Garden onion Type 1 specific Allium cepa 4679 154.272 330.0 0.258 mg/100 g Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 0.258 0.258 0.258 mg/100 g Garlic Type 1 specific Allium sativum 4682 0.805 0.805 0.805 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 0.162 0.162 0.162 mg/100 g Ginkgo nuts Type 1 specific Ginkgo biloba 3311 0.836 0.836 0.836 mg/100 g Goji Type 1 1.431 1.431 1.431 mg/100 g Grape Type 1 specific Vitis 3603 0.106 0.131 0.081 mg/100 g Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 0.16 0.16 0.16 mg/100 g Grapefruit/Pummelo hybrid Type 1 specific Citrus paradisi X Citrus maxima 37656 0.197 0.197 0.197 mg/100 g Grapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Greater sturgeon Type 1 specific Acipenser 7901 2.41 2.41 2.41 mg/100 g Greek feta cheese Type 2 2.421 2.421 2.421 mg/100 g Green bean Type 1 specific Phaseolus vulgaris 3885 188.63 200.0 177.26 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 77.55 120.0 25.1 mg/100 g Green lentil Type 1 Lens culinaris 3.819 3.819 3.819 mg/100 g Green plum Type 1 0.035 0.035 0.035 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 98.09525 132.09 0.291 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 2.145 2.145 2.145 mg/100 g Grouper Type 1 specific Epinephelus 94231 2.892 2.892 2.892 mg/100 g Guava Type 1 specific Psidium guajava 120290 0.333 0.333 0.333 mg/100 g Guinea hen Type 1 specific Numida meleagris 8996 3.092 3.092 3.092 mg/100 g Hazelnut Type 1 specific Corylus 13450 3.71 3.71 3.71 mg/100 g Hickory nut Type 1 specific Carya 13402 2.885 2.885 2.885 mg/100 g Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 3.107 3.107 3.107 mg/100 g Honey Type 2 specific 0.018 0.018 0.018 mg/100 g Horse Type 1 specific Equus caballus 9796 3.116 3.116 3.116 mg/100 g Hyacinth bean Type 1 specific Lablab purpureus 35936 3.88 3.88 3.88 mg/100 g Iceberg lettuce Type 1 0.194 0.194 0.194 mg/100 g Italian oregano Type 1 specific Origanum X majoricum 1384207 0.975 0.975 0.975 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 211.0 211.0 211.0 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 0.189 0.189 0.189 mg/100 g Japanese chestnut Type 1 specific Castanea crenata 103480 0.429 0.429 0.429 mg/100 g Japanese persimmon Type 1 specific Diospyros kaki 35925 0.076 0.076 0.076 mg/100 g Japanese pumpkin Type 1 specific Cucurbita maxima 3661 103.3 106.6 100.0 mg/100 g Japanese sea bass Type 1 Lateolabrax japonicus 2.751 2.751 2.751 mg/100 g Jicama Type 1 specific Pachyrhizus erosus 109171 0.043 0.043 0.043 mg/100 g Jute Type 1 specific Corchorus olitorius 93759 0.493 0.493 0.493 mg/100 g Kelp Type 1 specific Laminaria 33637 0.268 0.268 0.268 mg/100 g King mackerel Type 1 specific Scomberomorus cavalla 13679 3.028 3.028 3.028 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 0.012 0.012 0.012 mg/100 g Lambsquarters Type 1 specific Chenopodium album 3559 0.521 0.521 0.521 mg/100 g Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 0.226 0.226 0.226 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 2.127 2.127 2.127 mg/100 g Lentils Type 1 generic Lens culinaris 3864 3.819 3.819 3.819 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 0.0195 0.0195 0.0195 mg/100 g Lima bean Type 1 specific Phaseolus lunatus 3884 0.881 0.881 0.881 mg/100 g Lingcod Type 1 specific Ophiodon elongatus 225387 2.636 2.636 2.636 mg/100 g Longan Type 1 specific Dimocarpus longan 128017 0.209 0.209 0.209 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 0.061 0.061 0.061 mg/100 g Lotus Type 1 specific Nelumbo 4430 0.139 0.139 0.139 mg/100 g Lupine Type 1 specific Lupinus 3869 8.686 8.686 8.686 mg/100 g Macadamia nut Type 1 specific Macadamia 4329 2.267 2.267 2.267 mg/100 g Macadamia nut (M. tetraphylla) Type 1 specific Macadamia tetraphylla 512563 2.267 2.267 2.267 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 0.264 0.264 0.264 mg/100 g Mamey sapote Type 1 specific Pouteria sapota 233744 0.147 0.147 0.147 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 0.061 0.061 0.061 mg/100 g Mango Type 1 specific Mangifera indica 29780 0.096 0.096 0.096 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 1.618 1.618 1.618 mg/100 g Mexican oregano Type 1 specific Lippia graveolens 0.975 0.975 0.975 mg/100 g Milk (Cow) Type 2 specific 43355.470588 716000.0 626.0 mg/100 g Milkfish Type 1 specific Chanos chanos 29144 3.065 3.065 3.065 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 2.396 2.396 2.396 mg/100 g Monkfish Type 1 specific Lophius piscatorius 8074 2.162 2.162 2.162 mg/100 g Mountain yam Type 1 specific Dioscorea pentaphylla 167592 0.159 0.159 0.159 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 4.264 4.264 4.264 mg/100 g Nanking cherry Type 1 specific Prunus tomentosa 105667 38.45 46.0 30.9 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 0.034 0.034 0.034 mg/100 g Nopal Type 1 specific Opuntia cochenillifera 338184 0.145 0.145 0.145 mg/100 g Northern bluefin tuna Type 1 specific Thunnus thynnus 8237 3.482 3.482 3.482 mg/100 g Northern pike Type 1 specific Esox lucius 8010 2.875 2.875 2.875 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 2.484 2.484 2.484 mg/100 g Oat Type 1 specific Avena sativa 4498 2037.685902 3000.0 3.748 mg/100 g Ocean pout Type 1 specific Zoarces americanus 8199 2.484 2.484 2.484 mg/100 g Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 0.271 0.271 0.271 mg/100 g Orange bell pepper Type 1 specific Capsicum annuum 4072 142.215 180.0 104.43 mg/100 g Orange roughy Type 1 specific Hoplostethus atlanticus 96778 2.673 2.673 2.673 mg/100 g Oriental wheat Type 1 specific Triticum turanicum 376534 4.839 4.839 4.839 mg/100 g Ostrich Type 1 specific Struthio camelus 8801 3.279 3.371 3.099 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 0.632 0.632 0.632 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 2.297 2.297 2.297 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 3.107 3.107 3.107 mg/100 g Pacific herring Type 1 specific Clupea pallasii 30724 2.447 2.447 2.447 mg/100 g Pacific jack mackerel Type 1 specific Trachurus symmetricus 271940 2.996 2.996 2.996 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 2.412 2.412 2.412 mg/100 g Pacific oyster Type 1 specific Crassostrea gigas 29159 1.285 1.285 1.285 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 2.928 2.928 2.928 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 0.36 0.36 0.36 mg/100 g Papaya Type 1 specific Carica papaya 3649 0.033 0.033 0.033 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 0.249 0.249 0.249 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 219.185596 228.78 200.0 mg/100 g Pea shoots Type 1 0.741 0.741 0.741 mg/100 g Peach Type 1 specific Prunus persica 3760 0.001 0.001 0.001 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 0.001 0.001 0.001 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 5.39 5.39 5.39 mg/100 g Peanut oil Type 2 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.0025 0.0025 0.0025 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 1.829 1.829 1.829 mg/100 g Pepper (Spice) Type 1 specific Piper nigrum 13216 1.413 1.413 1.413 mg/100 g Peppermint Type 1 specific Mentha X piperita 34256 0.409 0.409 0.409 mg/100 g Percoidei (Bass and others) Type 1 specific Percoidei 8112 2.647 2.647 2.647 mg/100 g Persimmon Type 1 specific Diospyros 13492 0.104 0.104 0.104 mg/100 g Pheasant Type 1 specific Phasianus colchicus 9054 3.5435 3.603 3.484 mg/100 g Pigeon pea Type 1 specific Cajanus cajan 3821 5.031 5.031 5.031 mg/100 g Pili nut Type 1 specific Canarium ovatum 43691 2.393 2.393 2.393 mg/100 g Pine nut Type 1 specific Pinus 3337 2.926 2.926 2.926 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.079 0.079 0.079 mg/100 g Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 2.903 2.903 2.903 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 4.3 4.3 4.3 mg/100 g Pollock Type 1 specific Pollachius 8059 2.08 2.08 2.08 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 203.925 260.0 147.85 mg/100 g Pumpkinseed sunfish Type 1 specific Lepomis gibbosus 270329 2.896 2.896 2.896 mg/100 g Purple laver Type 1 specific Porphyra laciniata 0.547 0.547 0.547 mg/100 g Quail Type 1 specific Phasianidae 9005 2.82 2.82 2.82 mg/100 g Quinoa Type 1 specific Chenopodium quinoa 63459 1.865 1.865 1.865 mg/100 g Rabbit Type 1 specific Leporidae 9979 3.496 3.496 3.496 mg/100 g Radish Type 1 specific Raphanus sativus 3726 0.157 0.157 0.157 mg/100 g Rainbow smelt Type 1 specific Osmerus mordax 8014 2.632 2.632 2.632 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 3.057 3.057 3.057 mg/100 g Rapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra 366.1 490.0 242.2 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 45073.186005 180000.0 56.37 mg/100 g Red king crab Type 1 specific Paralithodes camtschaticus 6741 3.12 3.12 3.12 mg/100 g Red raspberry Type 1 specific Rubus idaeus 32247 134.906892 134.9068923 134.9068923 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 1.618 1.618 1.618 mg/100 g Roe Type 2 generic 2.67 2.67 2.67 mg/100 g Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 130.333333 180.0 100.7 mg/100 g Rosemary Type 1 specific Rosmarinus officinalis 39367 0.361 0.361 0.361 mg/100 g Rye Type 1 specific Secale cereale 4550 1372.7635 2463.6 2.294 mg/100 g Sablefish Type 1 specific Anoplopoma fimbria 229290 2.002 2.002 2.002 mg/100 g Salted butter Type 1 0.178 0.178 0.178 mg/100 g Sapodilla Type 1 specific Manilkara zapota 3741 0.038 0.038 0.038 mg/100 g Saskatoon berry Type 1 specific Amelanchier alnifolia 32219 63.05 74.1 52.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 0.445 0.445 0.445 mg/100 g Scallop Type 1 specific Pectinidae 6566 0.129 0.129 0.129 mg/100 g Scup Type 1 specific Stenotomus chrysops 35579 2.818 2.818 2.818 mg/100 g Sea trout Type 1 specific Salmo trutta forma trutta 13028 2.5 2.5 2.5 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 3.955 3.955 3.955 mg/100 g Sesame oil Type 2 0.0 0.0 0.0 mg/100 g Shallot Type 1 specific Allium ascalonicum 1476995 0.517 0.517 0.517 mg/100 g Shark Type 1 specific Squaliformes 282414 3.131 3.131 3.131 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 2.95 2.95 2.95 mg/100 g Sheepshead Type 1 specific Archosargus probatocephalus 119682 3.017 3.017 3.017 mg/100 g Shiitake Type 1 specific Lentinus edodes 5353 0.68 0.68 0.68 mg/100 g Skipjack tuna Type 1 specific Katsuwonus pelamis 8226 3.284 3.284 3.284 mg/100 g Snapper Type 1 specific Lutjanidae 30850 3.061 3.061 3.061 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 3.279 3.279 3.279 mg/100 g Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 0.805 0.805 0.805 mg/100 g Sorghum Type 1 specific Sorghum bicolor 4558 2.439 2.439 2.439 mg/100 g Soy bean Type 1 specific Glycine max 3847 7.667 7.667 7.667 mg/100 g Soy sauce Type 2 specific 2.411 2.411 2.411 mg/100 g Soybean oil Type 2 0.0 0.0 0.0 mg/100 g Spanish mackerel Type 1 specific Scomberomorus maculatus 99344 2.879 2.879 2.879 mg/100 g Spearmint Type 1 specific Mentha spicata 29719 0.358 0.358 0.358 mg/100 g Spelt Type 1 specific Triticum spelta 58933 4.651 4.651 4.651 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 165.714333 290.0 0.343 mg/100 g Spiny lobster Type 1 specific Palinuridae 6731 3.512 3.512 3.512 mg/100 g Spirulina Type 1 specific Spirulina 551299 0.864 0.864 0.864 mg/100 g Spot croaker Type 1 specific Leiostomus xanthurus 59837 2.764 2.764 2.764 mg/100 g Squab Type 1 specific Columba 8931 2.268 2.268 2.268 mg/100 g Squid Type 1 specific Teuthida 551290 2.118 2.118 2.118 mg/100 g Star fruit Type 1 specific Averrhoa carambola 28974 0.148 0.148 0.148 mg/100 g Strawberry guava Type 1 specific Psidium cattleianum 375274 0.076 0.076 0.076 mg/100 g Striped bass Type 1 specific Morone saxatilis 34816 2.647 2.647 2.647 mg/100 g Striped mullet Type 1 specific Mugil cephalus 48193 2.889 2.889 2.889 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 2.41 2.41 2.41 mg/100 g Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 115.75 140.0 91.5 mg/100 g Sunflower oil Type 2 0.0 0.0 0.0 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 0.277 0.277 0.277 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 0.272 0.272 0.272 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 0.155 0.155 0.155 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 679.582148 679.5842956 679.58 mg/100 g Swordfish Type 1 specific Xiphias gladius 8245 2.956 2.956 2.956 mg/100 g Tallow Type 2 specific 0.0 0.0 0.0 mg/100 g Tapioca pearl Type 2 specific 0.029 0.029 0.029 mg/100 g Taro Type 1 specific Colocasia esculenta 4460 0.174 0.174 0.174 mg/100 g Teff Type 1 specific Eragrostis tef 110835 3.349 3.349 3.349 mg/100 g Tilefish Type 1 specific Lopholatilus chamaeleonticeps 390349 2.612 2.612 2.612 mg/100 g Tofu Type 2 specific 4.419667 8.287 1.684 mg/100 g Triticale Type 1 specific X Triticosecale rimpaui 4.006 4.006 4.006 mg/100 g True sole Type 1 specific Soleidae 30948 2.127 2.127 2.127 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 2.396 2.396 2.396 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 3.07 3.07 3.07 mg/100 g Turmeric Type 1 specific Curcuma longa 136217 1.14 1.14 1.14 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 37.806667 57.29 0.13 mg/100 g Ucuhuba Type 1 specific Virola surinamensis 224910 0.0 0.0 0.0 mg/100 g Vodka Type 2 specific 0.0 0.0 0.0 mg/100 g Wakame Type 1 specific Undaria pinnatifida 74381 0.199 0.199 0.199 mg/100 g Walnut Type 1 specific Juglans 16718 5.152 5.152 5.152 mg/100 g Water spinach Type 1 Ipomoea aquatica 0.343 0.343 0.343 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 0.19 0.19 0.19 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 0.063 0.063 0.063 mg/100 g Welsh onion Type 1 specific Allium fistulosum 35875 0.393 0.393 0.393 mg/100 g Wheat Type 1 specific Triticum 4564 3724.888978 8200.0 1699.775913 mg/100 g Whelk Type 1 specific Buccinidae 37796 3.669 3.669 3.669 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 290.86 291.72 290.0 mg/100 g White sucker Type 1 specific Catostomus commersonii 7971 2.501 2.501 2.501 mg/100 g Whitefish Type 1 specific Coregonus 27772 2.849 2.849 2.849 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 2.734 2.734 2.734 mg/100 g Wild boar Type 1 specific Sus scrofa 9823 3.341 3.341 3.341 mg/100 g Wild carrot Type 1 specific Daucus carota 4039 0.0835 0.0835 0.0835 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 0.09 0.09 0.09 mg/100 g Wild leek Type 1 specific Allium ampeloprasum 4681 0.226 0.226 0.226 mg/100 g Wild rice Type 1 specific Zizania 15949 2.565 2.565 2.565 mg/100 g Winged bean Type 1 specific Psophocarpus tetragonolobus 3891 4.01 4.01 4.01 mg/100 g Winter squash Type 1 specific Cucurbita maxima 3661 0.14 0.14 0.14 mg/100 g Yam Type 1 specific Dioscorea 4672 0.181 0.181 0.181 mg/100 g Yellow bell pepper Type 1 specific Capsicum annuum 4072 81.065 120.0 42.13 mg/100 g Yellow wax bean Type 1 specific Phaseolus vulgaris 3885 240.95 261.9 220.0 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 154.38025 383.13 0.101 mg/100 g Yellowfin tuna Type 1 specific Thunnus albacares 8236 3.489 3.489 3.489 mg/100 g Yellowtail amberjack Type 1 specific Seriola lalandi 302047 3.455 3.455 3.455 mg/100 g