1.0 2010-04-08 22:10:13 UTC 2019-11-26 03:07:00 UTC FDB012537 L-2-Aminobutanoic acid alpha-Aminobutyric acid (AABA) is an isomer of the amino acid aminobutyric acid. It is a key intermediate in the biosynthesis of ophthalmic acid or ophthalmate. L-2-Aminobutanoic acid is found in common pea. (-)-2-Aminobutyrate (-)-2-Aminobutyric acid (+)-2-Aminobutanoate (+)-2-Aminobutanoic acid (+)-2-Aminobutyric acid (+)-alpha-Aminobutyric acid (2S)-2-Aminobutanoate (2S)-2-Aminobutanoic acid (2S)-2-Aminobutyrate (2S)-2-Aminobutyric acid (S)-(+)-alpha-Aminobutyric acid (S)-2-amino-Butanoate (S)-2-amino-Butanoic acid (S)-2-Aminobutanoate (S)-2-Aminobutanoic acid (S)-2-Aminobutyrate (S)-2-Aminobutyric acid 2-Aminobutanoate 2-Aminobutanoic acid 2-Aminobutanoic acid, 9CI; L-form 2-Aminobutyrate 2-Aminobutyric acid, L- 2S-amino-Butanoate 2S-amino-Butanoic acid AABA Alpha-Aminobutyric acid Butanoic acid, 2-amino-, (2S)- Butanoic acid, 2-amino-, (S)- (9CI) Butyric acid, 2-amino-, L- (8CI) L-(+)-2-Aminobutyrate L-(+)-2-Aminobutyric acid L-&alpha;-Amino-n-butyric acid L-&alpha;-Aminobutyrate L-&alpha;-Aminobutyric acid L-2-Amino-n-butyric acid L-2-Aminobuttersaeure L-2-Aminobutyrate L-2-Aminobutyric acid L-a-amino-N-Butyrate L-a-amino-N-Butyric acid L-a-Aminobutyrate L-a-Aminobutyric acid L-AABA L-alpha-amino-N-Butyrate L-alpha-Amino-n-butyric acid L-alpha-Aminobutyrate L-alpha-Aminobutyric acid L-butyrine L-Ethylglycine L-α-amino-N-butyrate L-α-amino-N-butyric acid L-α-aminobutyrate L-α-aminobutyric acid S-Butyrine C4H9NO2 103.1198 103.063328537 (2S)-2-aminobutanoic acid (-)-2-aminobutyric acid 1492-24-6 CC[C@H](N)C(O)=O InChI=1S/C4H9NO2/c1-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1 QWCKQJZIFLGMSD-VKHMYHEASA-N belongs to the class of organic compounds known as l-alpha-amino acids. These are alpha amino acids which have the L-configuration of the alpha-carbon atom. L-alpha-amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Amino acids Carbonyl compounds Carboxylic acids Fatty acids and conjugates Hydrocarbon derivatives Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Aliphatic acyclic compound Amine Amino acid Carbonyl group Carboxylic acid Fatty acid Hydrocarbon derivative L-alpha-amino acid Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Amino fatty acids Amino fatty acids alpha-aminobutyric acid non-proteinogenic L-alpha-amino acid Solid logp -2.55 ALOGPS logs 0.54 ALOGPS solubility 3.58e+02 g/l ALOGPS melting_point Mp 292 dec. (303° in sealed tube) logp -2.3 ChemAxon pka_strongest_acidic 2.62 ChemAxon pka_strongest_basic 9.53 ChemAxon iupac (2S)-2-aminobutanoic acid ChemAxon average_mass 103.1198 ChemAxon mono_mass 103.063328537 ChemAxon smiles CC[C@H](N)C(O)=O ChemAxon formula C4H9NO2 ChemAxon inchi InChI=1S/C4H9NO2/c1-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1 ChemAxon inchikey QWCKQJZIFLGMSD-VKHMYHEASA-N ChemAxon polar_surface_area 63.32 ChemAxon refractivity 25.02 ChemAxon polarizability 10.34 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::NmrTwoD 1320 Specdb::MsIr 532 Specdb::MsIr 533 Specdb::MsIr 534 Specdb::NmrOneD 1376 Specdb::NmrOneD 143970 Specdb::NmrOneD 143971 Specdb::NmrOneD 143972 Specdb::NmrOneD 143973 Specdb::NmrOneD 143974 Specdb::NmrOneD 143975 Specdb::NmrOneD 143976 Specdb::NmrOneD 143977 Specdb::NmrOneD 143978 Specdb::NmrOneD 143979 Specdb::NmrOneD 143980 Specdb::NmrOneD 143981 Specdb::NmrOneD 143982 Specdb::NmrOneD 143983 Specdb::NmrOneD 143984 Specdb::NmrOneD 143985 Specdb::NmrOneD 143986 Specdb::NmrOneD 143987 Specdb::NmrOneD 143988 Specdb::NmrOneD 143989 Specdb::MsMs 4065 Specdb::MsMs 4066 Specdb::MsMs 4067 Specdb::MsMs 4068 Specdb::MsMs 4076 Specdb::MsMs 437324 Specdb::MsMs 437325 Specdb::MsMs 437326 Specdb::MsMs 437327 Specdb::MsMs 439231 Specdb::MsMs 659 Specdb::MsMs 660 Specdb::MsMs 661 Specdb::MsMs 4069 Specdb::MsMs 4070 Specdb::MsMs 4071 Specdb::MsMs 4072 Specdb::MsMs 4073 Specdb::MsMs 4075 Specdb::MsMs 445776 Specdb::MsMs 445777 Specdb::MsMs 445778 Specdb::MsMs 445779 Specdb::MsMs 445780 Specdb::MsMs 448172 Specdb::CMs 551 Specdb::CMs 945 Specdb::CMs 1119 Specdb::CMs 3038 Specdb::CMs 30588 Specdb::CMs 31147 Specdb::CMs 31148 Specdb::CMs 37546 Specdb::CMs 167727 Specdb::CMs 1062959 Specdb::CMs 1062961 Specdb::CMs 1062963 HMDB00452 35619 ABA #<Reference:0x00005612736f5e60> #<Reference:0x00005612736f5be0> #<Reference:0x00005612736f5910> #<Reference:0x00005612736f56b8> #<Reference:0x00005612736f54b0> #<Reference:0x00005612736f5258> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Common pea Type 1 specific Pisum sativum 3888 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Milk (Cow) Type 2 specific 5.0 5.0 5.0 uM Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Glycine amidinotransferase, mitochondrial P50440 GATM