1.0 2010-04-08 22:10:16 UTC 2019-11-26 03:07:11 UTC FDB012611 L,L-Cyclo(leucylprolyl) Production by microorganisms. Bitter component of sake and contributes to the flavour of beer. L,L-Cyclo(leucylprolyl) is found in alcoholic beverages. 3-Isobutylhexahydropyrrolo[1,2-a]pyrazine-1,4-dione Cyclo-L-Leu-L-Pro Cyclo(Leu-Pro) Cyclo(leucyl-prolyl) Cyclo(leucylprolyl); L,L-form Gancidin W L-Cyclo(Leu-Pro) L-Cyclo(leucyloprolyl) L-Leucyl-L-proline lactam Maculosin 6 C11H18N2O2 210.2728 210.13682783 3-(2-methylpropyl)-octahydropyrrolo[1,2-a]piperazine-1,4-dione 3-(2-methylpropyl)-hexahydropyrrolo[1,2-a]piperazine-1,4-dione 2873-36-1 CC(C)CC1NC(=O)C2CCCN2C1=O InChI=1S/C11H18N2O2/c1-7(2)6-8-11(15)13-5-3-4-9(13)10(14)12-8/h7-9H,3-6H2,1-2H3,(H,12,14) SZJNCZMRZAUNQT-UHFFFAOYSA-N belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof. Alpha amino acids and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic heteropolycyclic compounds 2,5-dioxopiperazines Azacyclic compounds Carbonyl compounds Hydrocarbon derivatives Lactams N-alkylpiperazines Organic oxides Organonitrogen compounds Organopnictogen compounds Pyrrolidines Secondary carboxylic acid amides Tertiary carboxylic acid amides 1,4-diazinane 2,5-dioxopiperazine Aliphatic heteropolycyclic compound Alpha-amino acid or derivatives Azacycle Carbonyl group Carboxamide group Dioxopiperazine Hydrocarbon derivative Lactam N-alkylpiperazine Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Piperazine Pyrrolidine Secondary carboxylic acid amide Tertiary carboxylic acid amide logp 0.21 ALOGPS logs -0.67 ALOGPS solubility 4.46e+01 g/l ALOGPS melting_point Mp 168-172° (158-159°) logp 0.45 ChemAxon pka_strongest_acidic 11.47 ChemAxon pka_strongest_basic -3.4 ChemAxon iupac 3-(2-methylpropyl)-octahydropyrrolo[1,2-a]piperazine-1,4-dione ChemAxon average_mass 210.2728 ChemAxon mono_mass 210.13682783 ChemAxon smiles CC(C)CC1NC(=O)C2CCCN2C1=O ChemAxon formula C11H18N2O2 ChemAxon inchi InChI=1S/C11H18N2O2/c1-7(2)6-8-11(15)13-5-3-4-9(13)10(14)12-8/h7-9H,3-6H2,1-2H3,(H,12,14) ChemAxon inchikey SZJNCZMRZAUNQT-UHFFFAOYSA-N ChemAxon polar_surface_area 49.41 ChemAxon refractivity 55.96 ChemAxon polarizability 23.07 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 9281 Specdb::MsMs 9282 Specdb::MsMs 9283 Specdb::MsMs 15953 Specdb::MsMs 15954 Specdb::MsMs 15955 Specdb::MsMs 452094 Specdb::MsMs 452202 Specdb::MsMs 452203 Specdb::CMs 26207 HMDB34276 #<Reference:0x000055ce319284c0> Alcoholic beverages Unknown generic