1.0 2010-04-08 22:10:20 UTC 2019-11-26 03:07:28 UTC FDB012732 Vitamin D3 Constituent of fish-liver oil, especies tuna oil. Antirachitic vitamin with approx. the same potency as vitamin D2 in humans Cholecalciferol (vitamin D3) is a steroid hormone that has long been known for its important role in regulating body levels of calcium and phosphorus, in mineralization of bone, and for the assimilation of Vitamin A. Vitamin D3 is found in many foods, some of which are bamboo shoots, processed cheese, alaska pollock, and celeriac. (+)-Vitamin D3 (3beta,Z,7e)-9,10-Secocholesta-5,7,10(19)-trien-3-ol (5e,7e)-9,10-Secocholesta-5,7,10-trien-3-ol 3-beta,Z,7E-9,10-Secocholestr-5,7,10(19)-trien-3-ol 9,10-Secocholesta-5,7,10-trien-3-ol 9,10-Secocholesta-5,7,10(19)-trien-3-beta-ol 9,10-Secocholesta-5,7,10(19)-trien-3-ol Activated 7-dehydrocholesterol Arachitol Calciol CC Cholecalciferol Cholecalciferol D3 Cholecalciferol, BAN Colecalciferol Colecalciferol, INN D3-Vigantol Delsterol Deparal Devaron Ebivit Feracol Granuvit D3 Micro-dee Oleovitamin D3 Provitina Quintox Ricketon Riva-d Trivitan Vi-De3 VidDe-3-hydrosol Videkhol Vigantol Vigorsan Vitamin D3 Vitinc dan-dee-3 C27H44O 384.6377 384.33921603 (3E)-3-{2-[(4E)-7a-methyl-1-(6-methylheptan-2-yl)-octahydro-1H-inden-4-ylidene]ethylidene}-4-methylidenecyclohexan-1-ol cholecalciferol 67-97-0 CC(C)CCCC(C)C1CCC2\C(CCCC12C)=C\C=C1/CC(O)CCC1=C InChI=1S/C27H44O/c1-19(2)8-6-9-21(4)25-15-16-26-22(10-7-17-27(25,26)5)12-13-23-18-24(28)14-11-20(23)3/h12-13,19,21,24-26,28H,3,6-11,14-18H2,1-2,4-5H3/b22-12+,23-13+ QYSXJUFSXHHAJI-FWSOMWAYSA-N belongs to the class of organic compounds known as vitamin d and derivatives. Vitamin D and derivatives are compounds containing a secosteroid backbone, usually secoergostane or secocholestane. Vitamin D and derivatives Organic compounds Lipids and lipid-like molecules Steroids and steroid derivatives Vitamin D and derivatives Aliphatic homopolycyclic compounds Cyclic alcohols and derivatives Hydrocarbon derivatives Secondary alcohols Triterpenoids Alcohol Aliphatic homopolycyclic compound Cyclic alcohol Hydrocarbon derivative Organic oxygen compound Organooxygen compound Secondary alcohol Triterpenoid Solid logp 7.98 ALOGPS logs -6.01 ALOGPS solubility 3.80e-04 g/l ALOGPS melting_point Mp 87-88° logp 7.13 ChemAxon pka_strongest_acidic 18.38 ChemAxon pka_strongest_basic -1.3 ChemAxon iupac (3E)-3-{2-[(4E)-7a-methyl-1-(6-methylheptan-2-yl)-octahydro-1H-inden-4-ylidene]ethylidene}-4-methylidenecyclohexan-1-ol ChemAxon average_mass 384.6377 ChemAxon mono_mass 384.33921603 ChemAxon smiles CC(C)CCCC(C)C1CCC2\C(CCCC12C)=C\C=C1/CC(O)CCC1=C ChemAxon formula C27H44O ChemAxon inchi InChI=1S/C27H44O/c1-19(2)8-6-9-21(4)25-15-16-26-22(10-7-17-27(25,26)5)12-13-23-18-24(28)14-11-20(23)3/h12-13,19,21,24-26,28H,3,6-11,14-18H2,1-2,4-5H3/b22-12+,23-13+ ChemAxon inchikey QYSXJUFSXHHAJI-FWSOMWAYSA-N ChemAxon polar_surface_area 20.23 ChemAxon refractivity 123.22 ChemAxon polarizability 49.65 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 1 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Steroid Biosynthesis SMP00023 map00100 HMDB00876 28940 #<Reference:0x000055ac3f8bb758> #<Reference:0x000055ac3f8bb5a0> #<Reference:0x000055ac3f8bb3e8> #<Reference:0x000055ac3f8bb208> #<Reference:0x000055ac3f8bb050> #<Reference:0x000055ac3f8bae70> #<Reference:0x000055ac3f8bac40> #<Reference:0x000055ac3f8baa38> #<Reference:0x000055ac3f8ba858> #<Reference:0x000055ac3f8ba420> #<Reference:0x000055ac3f8b9ea8> #<Reference:0x000055ac3f8b9cf0> #<Reference:0x000055ac3f8b9b38> #<Reference:0x000055ac3f8b9958> #<Reference:0x000055ac3f8b97a0> #<Reference:0x000055ac3f8b95e8> #<Reference:0x000055ac3f8b9430> #<Reference:0x000055ac3f8b9250> #<Reference:0x000055ac3f8b8fd0> #<Reference:0x000055ac3f8b8df0> #<Reference:0x000055ac3f8b8c38> Abalone Type 1 specific Haliotis 6452 0.0 0.0 0.0 mg/100 g Adzuki bean Type 1 specific Vigna angularis 3914 0.0 0.0 0.0 mg/100 g Agar Type 1 specific Eucheuma 31444 0.0 0.0 0.0 mg/100 g Alaska pollock Type 1 specific Theragra chalcogramma 1042646 0.00075 0.0013 0.0002 mg/100 g Albacore tuna Type 1 specific Thunnus alalunga 8235 0.002 0.002 0.002 mg/100 g Alfalfa Type 1 specific Medicago sativa 3879 0.0 0.0 0.0 mg/100 g Allium Type 1 specific Allium 4678 0.0 0.0 0.0 mg/100 g Almond Type 1 specific Prunus dulcis 3755 0.0 0.0 0.0 mg/100 g Almond milk Type 1 1.0 1.0 1.0 mg/100 g American lobster Type 1 specific Homarus americanus 6706 0.0 0.0 0.0 mg/100 g American shad Type 1 specific Alosa sapidissima 34773 2.4024 4.8 0.0048 mg/100 g Anatidae Type 1 specific Anatidae 8830 0.0 0.0 0.0 mg/100 g Anchovy Type 1 specific Engraulidae 43062 0.0 0.0 0.0 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 4.66 23.3 0.0 mg/100 g Apple Type 1 specific Malus pumila 283210 0.0 0.0 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 0.0 0.0 0.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 0.0 0.0 0.0 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 0.0 0.0 0.0 mg/100 g Atlantic cod Type 1 specific Gadus morhua 8049 0.18146 0.9 0.0009 mg/100 g Atlantic croaker Type 1 specific Micropogonias undulatus 29154 0.35035 0.7 0.0007 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 0.0 0.0 0.0 mg/100 g Atlantic herring Type 1 specific Clupea harengus harengus 7950 0.703233 4.2 0.0022 mg/100 g Atlantic mackerel Type 1 specific Scomber scombrus 13677 0.0161 0.0161 0.0161 mg/100 g Atlantic pollock Type 1 specific Pollachius pollachius 185739 8.0505 16.1 0.001 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 0.0 0.0 0.0 mg/100 g Avocado Type 1 specific Persea americana 3435 0.0 0.0 0.0 mg/100 g Baby food Type 2 specific 0.000355 0.0071 0.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.0 0.0 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 0.0 0.0 0.0 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 0.0 0.0 0.0 mg/100 g Beer Type 2 specific 0.0 0.0 0.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 0.0 0.0 0.0 mg/100 g Biscuit Type 2 specific 0.0 0.0 0.0 mg/100 g Bivalvia (Clam, Mussel, Oyster) Type 1 specific Bivalvia 6544 0.000033 0.0001 0.0 mg/100 g Black raisin Type 1 0.0 0.0 0.0 mg/100 g Black salsify Type 1 specific Scorzonera hispanica 114289 0.0 0.0 0.0 mg/100 g Black tea Type 1 0.0 0.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 0.0 0.0 0.0 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 0.0 0.0 0.0 mg/100 g Blue cheese Type 2 0.5 0.5 0.5 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 0.0 0.0 0.0 mg/100 g Blue mussel Type 1 specific Mytilus edulis 6550 0.0 0.0 0.0 mg/100 g Blue whiting Type 1 specific Micromesistius poutassou 81636 0.0 0.0 0.0 mg/100 g Brazil nut Type 1 specific Bertholletia excelsa 3645 0.0 0.0 0.0 mg/100 g Breakfast cereal Type 2 specific 0.002673 0.0063 0.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 0.0 0.0 0.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 0.0 0.0 0.0 mg/100 g Burbot Type 1 specific Lota lota 69944 0.0 0.0 0.0 mg/100 g Butter Type 2 specific 0.00065 0.0015 0.0 mg/100 g Butterfat Type 2 specific 0.0018 0.0018 0.0018 mg/100 g Buttermilk Type 2 specific 0.144678 1.3 0.0 mg/100 g Carp bream Type 1 specific Abramis brama 38527 8.233333 24.7 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.0 0.0 0.0 mg/100 g Casein Type 2 specific 0.0 0.0 0.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 0.0 0.0 0.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 0.0 0.0 0.0 mg/100 g Catfish Type 1 specific Siluriformes 7995 0.0 0.0 0.0 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 0.000112 0.0012 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 0.0 0.0 0.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 0.0 0.0 0.0 mg/100 g Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 0.0 0.0 0.0 mg/100 g Cetacea (Dolphin, Porpoise, Whale) Type 1 specific Cetacea 9721 0.0 0.0 0.0 mg/100 g Channel catfish Type 1 specific Ictalurus punctatus 7998 0.00025 0.0003 0.0002 mg/100 g Chanterelle Type 1 specific Cantharellus cibarius 36066 0.0 0.0 0.0 mg/100 g Charr Type 1 specific Salvelinus 8033 0.0 0.0 0.0 mg/100 g Chayote Type 1 specific Sechium edule 184140 0.0 0.0 0.0 mg/100 g Cheese Type 2 specific 0.000361 0.0075 0.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 0.0 0.0 0.0 mg/100 g Chervil Type 1 specific Anthriscus cerefolium 40888 0.0 0.0 0.0 mg/100 g Chestnut Type 1 specific Castanea 21019 0.0 0.0 0.0 mg/100 g Chewing gum Type 2 specific 0.0 0.0 0.0 mg/100 g Chicken Type 1 specific Gallus gallus 9031 0.0 0.0 0.0 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 0.0 0.0 0.0 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 0.0 0.0 0.0 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 0.0 0.0 0.0 mg/100 g Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 0.0171 0.0171 0.0171 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 0.0 0.0 0.0 mg/100 g Chocolate Type 2 specific 0.0 0.0 0.0 mg/100 g Chocolate spread Type 2 specific 0.0 0.0 0.0 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 0.0096 0.0096 0.0096 mg/100 g Cichlidae (Tilapia) Type 1 specific Cichlidae 8113 1.0356 3.1 0.0031 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 0.0 0.0 0.0 mg/100 g Cisco Type 1 specific Coregonus artedi 36181 0.0133 0.0133 0.0133 mg/100 g Clam Type 1 0.05 0.05 0.05 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 0.0 0.0 0.0 mg/100 g Clupeinae (Herring, Sardine, Sprat) Type 1 specific Clupeinae 7948 0.003958 0.013 0.0 mg/100 g Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa powder Type 2 specific 0.0 0.0 0.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 0.0 0.0 0.0 mg/100 g Coffee Type 1 generic Coffea 13442 0.0 0.0 0.0 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 3.006767 9.0 0.009 mg/100 g Cold cut Type 2 specific 0.000317 0.0009 0.0 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 0.000067 0.0002 0.0 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 0.0 0.0 0.0 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 0.0 0.0 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 0.0 0.0 0.0 mg/100 g Common carp Type 1 specific Cyprinus carpio 7962 12.36235 24.7 0.0247 mg/100 g Common dab Type 1 specific Limanda limanda 27771 0.0 0.0 0.0 mg/100 g Common ling Type 1 specific Molva molva 163112 0.0 0.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 0.0 0.0 0.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 0.0 0.0 0.0 mg/100 g Common pea Type 1 specific Pisum sativum 3888 0.0 0.0 0.0 mg/100 g Conch Type 1 specific Strombidae 69694 0.0 0.0 0.0 mg/100 g Condensed milk Type 2 specific 0.0002 0.0002 0.0002 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 0.0 0.0 0.0 mg/100 g Corn Type 1 specific Zea mays 4577 0.0 0.0 0.0 mg/100 g Cottonseed Type 1 specific Gossypium 3633 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 0% fat Type 2 specific 0.0012 0.0012 0.0012 mg/100 g Cow milk, pasteurized, vitamin A + D added, 1% fat Type 2 specific 0.0012 0.0012 0.0012 mg/100 g Cow milk, pasteurized, vitamin A + D added, 2% fat Type 2 specific 0.0012 0.0012 0.0012 mg/100 g Cow milk, pasteurized, vitamin D added, 3.25% fat Type 2 specific 0.0013 0.0013 0.0013 mg/100 g Crab Type 1 specific Brachyura 6752 0.0 0.0 0.0 mg/100 g Cracker Type 2 specific 0.0 0.0 0.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 0.0 0.0 0.0 mg/100 g Cream Type 2 specific 0.106688 1.6 0.0 mg/100 g Cream substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Crisp bread Type 2 specific 0.0 0.0 0.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 0.0 0.0 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 0.0 0.0 0.0 mg/100 g Curry powder Type 2 specific 0.0 0.0 0.0 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 0.0 0.0 0.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 0.0 0.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 0.0 0.0 0.0 mg/100 g Deer Type 1 specific Cervidae 9850 0.0 0.0 0.0 mg/100 g Dill Type 1 specific Anethum graveolens 40922 0.0 0.0 0.0 mg/100 g Domestic goat Type 1 specific Capra aegagrus hircus 9925 0.0 0.0 0.0 mg/100 g Domestic pig Type 1 specific Sus scrofa domestica 9825 0.000502 0.0031 0.0 mg/100 g Dragée Type 2 specific 0.0 0.0 0.0 mg/100 g Dried milk Type 2 specific 0.003304 0.011 0.0 mg/100 g Dripping Type 2 specific 0.0025 0.0025 0.0025 mg/100 g Dulce de leche Type 2 specific 0.0002 0.0002 0.0002 mg/100 g Dumpling Type 2 specific 0.0 0.0 0.0 mg/100 g Eastern oyster Type 1 specific Crassostrea virginica 6565 0.0 0.0 0.0 mg/100 g Egg substitute Type 2 specific 0.8008 1.6 0.0016 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 0.0 0.0 0.0 mg/100 g Eggs Unknown generic 0.092536 4.095 0.0 mg/100 g Elderberry Type 1 specific Sambucus 4201 0.0 0.0 0.0 mg/100 g Endive Type 1 specific Cichorium endivia 114280 0.0 0.0 0.0 mg/100 g Enokitake Type 1 specific Flammulina velutipes 38945 0.0 0.0 0.0 mg/100 g European anchovy Type 1 specific Engraulis encrasicolus 184585 0.0017 0.0017 0.0017 mg/100 g European plum Type 1 specific Prunus domestica 3758 0.0 0.0 0.0 mg/100 g Evaporated milk Type 2 specific 0.001367 0.002 0.0001 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 0.0 0.0 0.0 mg/100 g Fig Type 1 specific Ficus carica 3494 0.0 0.0 0.0 mg/100 g Fish oil Type 1 0.0 0.0 0.0 mg/100 g Fishes Unknown generic Flatfish Type 1 specific Pleuronectiformes 8252 0.62126 3.1 0.0 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 0.0 0.0 0.0 mg/100 g Florida pompano Type 1 specific Trachinotus carolinus 173342 5.5055 11.0 0.011 mg/100 g French plantain Type 1 specific Musa X paradisiaca 89151 0.0 0.0 0.0 mg/100 g Freshwater eel Type 1 specific Anguilla 7935 11.66165 23.3 0.0233 mg/100 g Frozen yogurt Type 2 specific 0.0001 0.0001 0.0001 mg/100 g Fruit gum Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit juice Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit preserve Type 2 specific 0.0 0.0 0.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.2875 0.9 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 0.034503 0.9 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 0.0 0.0 0.0 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 0.0 0.0 0.0 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 0.0 0.0 0.0 mg/100 g Garfish Type 1 specific Belone belone 129037 0.0 0.0 0.0 mg/100 g Garlic Type 1 specific Allium sativum 4682 0.0 0.0 0.0 mg/100 g Gelatin Type 2 specific 0.0 0.0 0.0 mg/100 g Gelatin dessert Type 2 specific 0.0 0.0 0.0 mg/100 g Gin Type 2 specific 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 0.0 0.0 0.0 mg/100 g Globe artichoke Type 1 specific Cynara scolymus 59895 0.0 0.0 0.0 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 0.0 0.0 0.0 mg/100 g Grape Type 1 specific Vitis 3603 0.0 0.0 0.0 mg/100 g Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 0.0 0.0 0.0 mg/100 g Greater sturgeon Type 1 specific Acipenser 7901 2.584825 10.3 0.0103 mg/100 g Greek feta cheese Type 2 0.4 0.4 0.4 mg/100 g Green bean Type 1 specific Phaseolus vulgaris 3885 0.0 0.0 0.0 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Green tea Type 1 0.0 0.0 0.0 mg/100 g Green turtle Type 1 specific Chelonia mydas 8469 0.0 0.0 0.0 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.0 0.0 0.0 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 3.428425 27.4 0.0 mg/100 g Groundcherry Type 1 specific Physalis 24663 0.0 0.0 0.0 mg/100 g Guava Type 1 specific Psidium guajava 120290 0.0 0.0 0.0 mg/100 g Haddock Type 1 specific Melanogrammus aeglefinus 8056 0.01519 0.15 0.0 mg/100 g Hamburger Type 2 specific 0.0001 0.0001 0.0001 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 0.0 0.0 0.0 mg/100 g Hazelnut Type 1 specific Corylus 13450 0.0 0.0 0.0 mg/100 g Herbal tea Type 1 0.0 0.0 0.0 mg/100 g Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 1.686833 5.05 0.0047 mg/100 g Honey Type 2 specific 0.0 0.0 0.0 mg/100 g Horseradish Type 1 specific Armoracia rusticana 3704 0.0 0.0 0.0 mg/100 g Hot chocolate Type 2 specific 0.000444 0.0013 0.000075 mg/100 g Ice cream Type 2 specific 0.000121 0.0007 0.0 mg/100 g Ice cream cone Type 2 specific 0.0001 0.0001 0.0001 mg/100 g Icing Type 2 specific 0.000067 0.0002 0.0 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Japanese pumpkin Type 1 specific Cucurbita maxima 3661 0.0 0.0 0.0 mg/100 g Japanese sea bass Type 1 Lateolabrax japonicus 5.6 5.6 5.6 mg/100 g Jellyfish Type 1 specific Scyphozoa 6142 0.0 0.0 0.0 mg/100 g Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 0.0 0.0 0.0 mg/100 g Kale Type 1 specific Brassica napus var. pabularia 0.0 0.0 0.0 mg/100 g Kefir Type 2 specific 0.333401 1.0 0.000101 mg/100 g Ketchup Type 2 specific 0.0 0.0 0.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 0.0 0.0 0.0 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 0.0 0.0 0.0 mg/100 g Kombu Type 1 specific Saccharina japonica 88149 0.0 0.0 0.0 mg/100 g Kumquat Type 1 specific Fortunella 2706 0.0 0.0 0.0 mg/100 g Lake trout Type 1 specific Salvelinus namaycush 8040 0.0187 0.0187 0.0187 mg/100 g Lard Type 2 specific 0.417083 2.5 0.0 mg/100 g Leavening agent Type 2 specific 0.0 0.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 0.0 0.0 0.0 mg/100 g Lemon Type 1 specific Citrus limon 2708 0.0 0.0 0.0 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 0.775 3.1 0.0 mg/100 g Lentils Type 1 generic Lens culinaris 3864 0.0 0.0 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 0.0 0.0 0.0 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.0 0.0 0.0 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 0.0 0.0 0.0 mg/100 g Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 0.0 0.0 0.0 mg/100 g Liquor Type 2 specific 0.0 0.0 0.0 mg/100 g Liquorice Type 2 specific 0.0 0.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 0.0 0.0 0.0 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 0.0 0.0 0.0 mg/100 g Lumpsucker Type 1 specific Cyclopteridae 8101 0.0 0.0 0.0 mg/100 g Madeira wine Type 2 specific 0.0 0.0 0.0 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 0.0 0.0 0.0 mg/100 g Malus (Crab apple) Type 1 specific Malus 3749 0.0 0.0 0.0 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 0.0 0.0 0.0 mg/100 g Mango Type 1 specific Mangifera indica 29780 0.0 0.0 0.0 mg/100 g Margarine Type 2 specific 0.0 0.0 0.0 mg/100 g Margarine-like spread Type 2 specific 0.0 0.0 0.0 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 0.0 0.0 0.0 mg/100 g Marshmallow Type 2 specific 0.0 0.0 0.0 mg/100 g Marzipan Type 2 specific 0.0 0.0 0.0 mg/100 g Meat bouillon Type 2 specific 0.0 0.0 0.0 mg/100 g Meatball Type 2 specific 0.0 0.0 0.0 mg/100 g Meringue Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Cow) Type 2 specific 0.002808 0.0435 0.0 mg/100 g Milk (Human) Type 2 specific 0.000014 0.0001 0.0 mg/100 g Milk (Other mammals) Type 2 specific 0.000433 0.0013 0.0 mg/100 g Milkshake Type 2 specific 0.0011 0.0012 0.001 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 0.0 0.0 0.0 mg/100 g Miso Type 2 specific 0.0 0.0 0.0 mg/100 g Morchella (Morel) Type 1 specific Morchellaceae 5192 0.0 0.0 0.0 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 0.0 0.0 0.0 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 0.0 0.0 0.0 mg/100 g Muskmelon Type 1 specific Cucumis melo 3656 0.0 0.0 0.0 mg/100 g Mustard Type 2 specific 0.0 0.0 0.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 0.0 0.0 0.0 mg/100 g Northern bluefin tuna Type 1 specific Thunnus thynnus 8237 2.85285 5.7 0.0057 mg/100 g Northern pike Type 1 specific Esox lucius 8010 0.625625 2.5 0.0 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.05 0.15 0.0 mg/100 g Norway lobster Type 1 specific Nephrops norvegicus 6829 0.0 0.0 0.0 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.0 0.0 0.0 mg/100 g Nougat Type 2 specific 0.0 0.0 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 0.0 0.0 0.0 mg/100 g Nutritional drink Type 2 specific 0.004367 0.007 0.0011 mg/100 g Oat Type 1 specific Avena sativa 4498 0.0 0.0 0.0 mg/100 g Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 0.0 0.0 0.0 mg/100 g Olive Type 1 specific Olea europaea 4146 0.0 0.0 0.0 mg/100 g Other alcoholic beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Other animal fat Type 2 specific 0.002233 0.0048 0.0 mg/100 g Other beverage Type 2 specific 0.0012 0.0012 0.0012 mg/100 g Other bread Type 2 specific 0.0 0.0 0.0 mg/100 g Other bread product Type 2 specific 0.0 0.0 0.0 mg/100 g Other candy Type 2 specific 0.0 0.0 0.0 mg/100 g Other dish Type 2 specific 0.000145 0.0008 0.0 mg/100 g Other fermented milk Type 2 specific 0.000101 0.000101 0.0001 mg/100 g Other fish product Type 2 specific 0.0001 0.0004 0.0 mg/100 g Other frozen dessert Type 2 specific 0.00008 0.0002 0.0 mg/100 g Other fruit product Type 2 specific 0.0 0.0 0.0 mg/100 g Other snack food Type 2 specific 0.0 0.0 0.0 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 0.0 0.0 0.0 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 0.0837 0.25 0.0005 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 5.05 5.05 5.05 mg/100 g Pacific jack mackerel Type 1 specific Trachurus symmetricus 271940 4.55365 9.1 0.0073 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.566667 1.7 0.0 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 1.6028 4.8 0.0038 mg/100 g Pacific sardine Type 1 specific Sardinops sagax 28381 0.0048 0.0048 0.0048 mg/100 g Painted comber Type 1 specific Serranus scriba 349661 0.0013 0.0014 0.0012 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 0.0 0.0 0.0 mg/100 g Pancake Type 2 specific 0.0003 0.0003 0.0003 mg/100 g Papaya Type 1 specific Carica papaya 3649 0.0 0.0 0.0 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 0.0 0.0 0.0 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 0.0 0.0 0.0 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 0.0 0.0 0.0 mg/100 g Pasta Type 2 specific 0.0 0.0 0.0 mg/100 g Pastry Type 2 specific 0.0 0.0 0.0 mg/100 g Pate Type 2 specific 0.0 0.0 0.0 mg/100 g Peach Type 1 specific Prunus persica 3760 0.0 0.0 0.0 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.0 0.0 0.0 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 0.0 0.0 0.0 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Pepper (Spice) Type 1 specific Piper nigrum 13216 0.0 0.0 0.0 mg/100 g Perciformes Type 1 specific Perciformes 8111 0.00914 0.0252 0.0 mg/100 g Percoidei (Bass and others) Type 1 specific Percoidei 8112 0.0043 0.0056 0.003 mg/100 g Persimmon Type 1 specific Diospyros 13492 0.0 0.0 0.0 mg/100 g Pie filling Type 2 specific 0.0 0.0 0.0 mg/100 g Pikeperch Type 1 specific Sander lucioperca 283035 0.0 0.0 0.0 mg/100 g Pine nut Type 1 specific Pinus 3337 0.0 0.0 0.0 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.0 0.0 0.0 mg/100 g Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 0.511033 3.0 0.0109 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 0.0 0.0 0.0 mg/100 g Pizza Type 2 specific 0.0 0.0 0.0 mg/100 g Pleuronectidae (Dab, Halibut, Plaice) Type 1 specific Pleuronectidae 8256 0.0 0.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.021429 0.15 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.0 0.0 0.0 mg/100 g Popcorn Type 2 specific 0.0 0.0 0.0 mg/100 g Poppy Type 1 specific Papaver 3468 0.0 0.0 0.0 mg/100 g Port wine Type 2 specific 0.0 0.0 0.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 0.000038 0.0003 0.0 mg/100 g Prickly pear Type 1 specific Opuntia 106975 0.0 0.0 0.0 mg/100 g Processed cheese Type 2 specific 0.002357 0.007 0.0003 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 0.0 0.0 0.0 mg/100 g Pudding Type 2 specific 0.000491 0.0011 0.0 mg/100 g Quail Type 1 specific Phasianidae 9005 0.0002 0.0002 0.0002 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 0.0 0.0 0.0 mg/100 g Rabbit Type 1 specific Leporidae 9979 0.0 0.0 0.0 mg/100 g Radish Type 1 specific Raphanus sativus 3726 0.0 0.0 0.0 mg/100 g Rainbow smelt Type 1 specific Osmerus mordax 8014 0.4004 0.8 0.0008 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 0.01218 0.019 0.0 mg/100 g Rape Type 1 specific Brassica napus var. napus 138011 0.0 0.0 0.0 mg/100 g Red algae Type 1 specific Rhodophyta 2763 0.0 0.0 0.0 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra 0.0 0.0 0.0 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Red tea Type 1 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.0 0.0 0.0 mg/100 g Remoulade Type 2 specific 0.0 0.0 0.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 0.0 0.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 0.0 0.0 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 0.0 0.0 0.0 mg/100 g Roe Type 2 generic 4.038333 12.1 0.0029 mg/100 g Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 0.0 0.0 0.0 mg/100 g Rose hip Type 1 specific Rosa 3764 0.0 0.0 0.0 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.0 0.0 0.0 mg/100 g Rum Type 2 specific 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 0.0 0.0 0.0 mg/100 g Rye bread Type 2 specific 0.0 0.0 0.0 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 0.0 0.0 0.0 mg/100 g Salad dressing Type 2 specific 0.0 0.0 0.0 mg/100 g Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 0.000325 0.0039 0.0 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Salted butter Type 1 0.0 0.0 0.0 mg/100 g Sauce Type 2 specific 0.000143 0.001 0.0 mg/100 g Sausage Type 2 specific 0.000255 0.002 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 0.0 0.0 0.0 mg/100 g Scallop Type 1 specific Pectinidae 6566 0.0 0.0 0.0 mg/100 g Scombridae (Bonito, Mackerel, Tuna) Type 1 specific Scombridae 8224 0.003935 0.00545 0.00238 mg/100 g Scrapple Type 2 specific 0.0003 0.0003 0.0003 mg/100 g Scup Type 1 specific Stenotomus chrysops 35579 0.6006 1.2 0.0012 mg/100 g Semolina Type 2 specific 0.0 0.0 0.0 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 0.0 0.0 0.0 mg/100 g Shark Type 1 specific Squaliformes 282414 0.3003 0.6 0.0006 mg/100 g Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 0.0 0.0 0.0 mg/100 g Sherry Type 2 specific 0.0 0.0 0.0 mg/100 g Shiitake Type 1 specific Lentinus edodes 5353 0.0 0.0 0.0 mg/100 g Shrimp Type 1 specific Caridea 6694 0.00003 0.0001 0.0 mg/100 g Snack bar Type 2 specific 0.00006 0.0002 0.0 mg/100 g Snail Type 1 specific Gastropoda 6448 0.0 0.0 0.0 mg/100 g Snapper Type 1 specific Lutjanidae 30850 5.1051 10.2 0.0102 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 0.5226 3.05 0.011 mg/100 g Soft drink Type 2 specific 0.0 0.0 0.0 mg/100 g Sorrel Type 1 specific Rumex acetosa 41241 0.0 0.0 0.0 mg/100 g Soup Type 2 specific 0.0002 0.0006 0.0 mg/100 g Sour cream Type 2 0.2 0.2 0.2 mg/100 g Soy bean Type 1 specific Glycine max 3847 0.0 0.0 0.0 mg/100 g Soy milk Type 2 specific 0.0 0.0 0.0 mg/100 g Soy sauce Type 2 specific 0.0 0.0 0.0 mg/100 g Spanish mackerel Type 1 specific Scomberomorus maculatus 99344 3.65365 7.3 0.0073 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 0.0 0.0 0.0 mg/100 g Spiny dogfish Type 1 specific Squalus acanthias 7797 0.0 0.0 0.0 mg/100 g Spirit Type 2 specific 0.0 0.0 0.0 mg/100 g Spread Type 2 specific 0.00045 0.0007 0.0002 mg/100 g Squid Type 1 specific Teuthida 551290 0.0 0.0 0.0 mg/100 g Star fruit Type 1 specific Averrhoa carambola 28974 0.0 0.0 0.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 0.0 0.0 0.0 mg/100 g Striped mullet Type 1 specific Mugil cephalus 48193 0.75075 1.5 0.0015 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 2.06152 10.3 0.0 mg/100 g Sugar Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 0.0 0.0 0.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 0.0 0.0 0.0 mg/100 g Swede Type 1 specific Brassica napus 3708 0.0 0.0 0.0 mg/100 g Sweet custard Type 2 specific 0.00115 0.0012 0.0011 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 0.0002 0.0014 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 0.0 0.0 0.0 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 0.0 0.0 0.0 mg/100 g Swiss cheese Type 2 0.0 0.0 0.0 mg/100 g Swordfish Type 1 specific Xiphias gladius 8245 7.726833 23.15 0.0139 mg/100 g Syrup Type 2 specific 0.0 0.0 0.0 mg/100 g Tallow Type 2 specific 0.1002 0.7 0.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 0.0 0.0 0.0 mg/100 g Tea Type 1 specific Camellia sinensis 4442 0.0 0.0 0.0 mg/100 g Thistle Type 1 specific Cirsium 41549 0.0 0.0 0.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 0.00328 0.0067 0.0021 mg/100 g Toffee Type 2 specific 0.0 0.0 0.0 mg/100 g Tofu Type 2 specific 0.0 0.0 0.0 mg/100 g Topping Type 2 specific 0.00045 0.0009 0.0 mg/100 g True frog Type 1 specific Ranidae 8397 0.05005 0.2 0.0 mg/100 g True oyster Type 1 specific Ostreidae 6563 0.0 0.0 0.0 mg/100 g True seal Type 1 specific Phocidae 9709 0.0 0.0 0.0 mg/100 g True sole Type 1 specific Soleidae 30948 1.55 3.1 0.0 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 0.0 0.0 0.0 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 0.03335 0.2 0.0 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 0.0 0.0 0.0 mg/100 g Unclassified food or beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 0.0 0.0 0.0 mg/100 g Vegetable juice Type 2 specific 0.0 0.0 0.0 mg/100 g Vegetarian food Type 2 specific 0.0 0.0 0.0 mg/100 g Vermouth Type 2 specific 0.0 0.0 0.0 mg/100 g Vinegar Type 2 specific 0.0 0.0 0.0 mg/100 g Vodka Type 2 specific 0.0 0.0 0.0 mg/100 g Walnut Type 1 specific Juglans 16718 0.0 0.0 0.0 mg/100 g Water Type 2 specific 0.0 0.0 0.0 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 0.0 0.0 0.0 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 0.0 0.0 0.0 mg/100 g Wheat Type 1 specific Triticum 4564 0.0 0.0 0.0 mg/100 g Wheat bread Type 2 specific 0.0 0.0 0.0 mg/100 g Whelk Type 1 specific Buccinidae 37796 0.0 0.0 0.0 mg/100 g Whey Type 2 specific 0.000084 0.000252 0.0 mg/100 g Whisky Type 2 specific 0.0 0.0 0.0 mg/100 g White bread Type 1 0.0 0.0 0.0 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 0.0 0.0 0.0 mg/100 g Whitefish Type 1 specific Coregonus 27772 2.40496 12.0 0.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 0.28064 1.4 0.0 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 0.0 0.0 0.0 mg/100 g Yam Type 1 specific Dioscorea 4672 0.0 0.0 0.0 mg/100 g Yellow bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.0 0.0 0.0 mg/100 g Yellowfin tuna Type 1 specific Thunnus albacares 8236 0.084567 0.25 0.0017 mg/100 g Ymer Type 2 specific 0.000092 0.000098 0.000085 mg/100 g Yogurt Type 2 specific 0.00031 0.0013 0.0 mg/100 g Nuclear receptor coactivator 3 Q9Y6Q9 NCOA3 Transcription initiation factor TFIID subunit 4 O00268 TAF4