1.0 2010-04-08 22:10:20 UTC 2019-11-26 03:07:30 UTC FDB012739 L-Serine Dietary supplement. L-Serine is found in many foods, some of which are cold cut, mammee apple, coho salmon, and carrot. (-)-serine (2S)-2-amino-3-Hydroxypropanoate (2S)-2-amino-3-hydroxypropanoic acid (s)-(-)-serine (S)-2-amino-3-hydroxy-Propanoate (S)-2-amino-3-hydroxy-Propanoic acid (S)-2-Amino-3-hydroxypropanoate (S)-2-Amino-3-hydroxypropanoic acid (S)-2-Amino-3-hydroxypropionic acid (s)-a-amino-b-hydroxypropionate (s)-a-amino-b-hydroxypropionic acid (s)-alpha-amino-beta-hydroxypropionate (s)-alpha-amino-beta-hydroxypropionic acid (S)-b-Amino-3-hydroxypropionate (S)-b-Amino-3-hydroxypropionic acid (S)-beta-Amino-3-hydroxypropionate (S)-beta-Amino-3-hydroxypropionic acid (s)-serine (S)-α-amino-β-hydroxypropionate (S)-α-amino-β-hydroxypropionic acid 2-amino-3-Hydroxypropanoate 2-amino-3-Hydroxypropanoic acid 3-hydroxy-L-Alanine 3-Hydroxyalanine Alpha-amino-beta-hydroxypropionic acid B-hydroxy-l-alanine b-Hydroxyalanine Beta-hydroxy-l-alanine Beta-hydroxyalanine L-(-)-serine l-2-Amino-3-hydroxy-propanoic acid L-2-amino-3-Hydroxypropionate l-2-Amino-3-hydroxypropionic acid L-3-Hydroxy-2-aminopropionate L-3-Hydroxy-2-aminopropionic acid L-3-Hydroxy-alanine L-ser L-Serin L-Serine S Ser SERINE Serine; L-form β-hydroxy-L-alanine β-hydroxyalanine C3H7NO3 105.0926 105.042593095 2-amino-3-hydroxypropanoic acid serin 56-45-1 NC(CO)C(O)=O InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7) MTCFGRXMJLQNBG-UHFFFAOYSA-N belongs to the class of organic compounds known as serine and derivatives. Serine and derivatives are compounds containing serine or a derivative thereof resulting from reaction of serine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Serine and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Alpha amino acids Amino acids Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Primary alcohols Alcohol Aliphatic acyclic compound Alpha-amino acid Amine Amino acid Beta-hydroxy acid Carbonyl group Carboxylic acid Hydrocarbon derivative Hydroxy acid Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary alcohol Primary aliphatic amine Primary amine Serine or derivatives Amino fatty acids alpha-amino acid Solid logp -3.42 ALOGPS logs 0.66 ALOGPS solubility 4.80e+02 g/l ALOGPS melting_point Mp 228° dec. logp -3.9 ChemAxon pka_strongest_acidic 2.03 ChemAxon pka_strongest_basic 8.93 ChemAxon iupac 2-amino-3-hydroxypropanoic acid ChemAxon average_mass 105.0926 ChemAxon mono_mass 105.042593095 ChemAxon smiles NC(CO)C(O)=O ChemAxon formula C3H7NO3 ChemAxon inchi InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7) ChemAxon inchikey MTCFGRXMJLQNBG-UHFFFAOYSA-N ChemAxon polar_surface_area 83.55 ChemAxon refractivity 22.04 ChemAxon polarizability 9.45 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Ammonia Recycling SMP00009 map00910 Glycine and Serine Metabolism SMP00004 map00260 Homocysteine Degradation SMP00455 Methionine Metabolism SMP00033 map00270 Sphingolipid Metabolism SMP00034 map00500 Specdb::EiMs 1141 Specdb::NmrOneD 3162 Specdb::MsMs 20150 Specdb::MsMs 20151 Specdb::MsMs 20152 Specdb::MsMs 21701 Specdb::MsMs 21702 Specdb::MsMs 21703 Specdb::MsMs 445210 Specdb::MsMs 445211 Specdb::MsMs 445212 Specdb::MsMs 445213 Specdb::MsMs 447514 Specdb::MsMs 447515 Specdb::MsMs 447516 Specdb::MsMs 447517 Specdb::MsMs 447518 Specdb::MsMs 447519 Specdb::MsMs 447520 Specdb::MsMs 447521 Specdb::MsMs 447522 Specdb::MsMs 447523 Specdb::MsMs 447524 Specdb::MsMs 447525 Specdb::MsMs 447526 Specdb::MsMs 447527 Specdb::MsMs 447528 Specdb::CMs 997 Specdb::CMs 1264 Specdb::CMs 31952 Specdb::CMs 31953 Specdb::CMs 35269 Specdb::CMs 48812 HMDB00187 17115 SER #<Reference:0x0000561272089dc0> #<Reference:0x0000561272089bb8> #<Reference:0x00005612720899b0> #<Reference:0x00005612720897a8> #<Reference:0x00005612720895a0> #<Reference:0x0000561272089398> #<Reference:0x0000561272089168> #<Reference:0x0000561272088f60> #<Reference:0x0000561272088d58> #<Reference:0x0000561272088b50> #<Reference:0x0000561272088948> #<Reference:0x0000561272088718> #<Reference:0x0000561272088510> #<Reference:0x0000561272088330> #<Reference:0x0000561272088100> #<Reference:0x000056127207bef0> #<Reference:0x000056127207bd38> #<Reference:0x000056127207bb80> #<Reference:0x000056127207b9c8> #<Reference:0x000056127207b810> #<Reference:0x000056127207b658> Abalone Type 1 specific Haliotis 6452 825.5 885.0 766.0 mg/100 g Abiyuch Type 1 specific Crateva religiosa 202634 Acerola Type 1 specific Malpighia emarginata 151847 Acorn Type 1 specific Quercus 3511 230.81525 344.0 0.261 mg/100 g Acorn squash Type 1 Cucurbita pepo var. turbinata 0.031 0.031 0.031 mg/100 g Adzuki bean Type 1 specific Vigna angularis 3914 444.821429 1051.75 0.0 mg/100 g Agar Type 1 specific Eucheuma 31444 0.0 0.0 0.0 mg/100 g Agave Type 1 specific Agave 39509 10.5105 21.0 0.021 mg/100 g Alaska blueberry Type 1 specific Vaccinium alaskaense 190544 Alaska pollock Type 1 specific Theragra chalcogramma 1042646 728.5 958.0 499.0 mg/100 g Alaska wild rhubarb Type 1 specific Polygonum alpinum 125586 Albacore tuna Type 1 specific Thunnus alalunga 8235 1023.0 1082.0 964.0 mg/100 g Albizia gummifera Type 1 Albizia gummifera Alfalfa Type 1 specific Medicago sativa 3879 0.0 0.0 0.0 mg/100 g Allium Type 1 specific Allium 4678 72.076923 263.0 14.0 mg/100 g Allspice Type 1 specific Pimenta dioica 375272 Almond Type 1 specific Prunus dulcis 3755 809.686571 1012.0 0.0 mg/100 g Alpine sweetvetch Type 1 specific Hedysarum alpinum 57576 Amaranth Type 1 specific Amaranthus 3564 362.216333 1148.0 1.148 mg/100 g American butterfish Type 1 specific Peprilus triacanthus 183653 536.568333 904.0 0.705 mg/100 g American cranberry Type 1 specific Vaccinium macrocarpon 13750 51.0 51.0 51.0 mg/100 g American lobster Type 1 specific Homarus americanus 6706 456.879 733.0 0.637 mg/100 g American pokeweed Type 1 specific Phytolacca americana 3527 American shad Type 1 specific Alosa sapidissima 34773 525.897 886.0 0.691 mg/100 g Anatidae Type 1 specific Anatidae 8830 550.200133 980.0 0.488 mg/100 g Anchovy Type 1 specific Engraulidae 43062 346.943333 520.0 0.83 mg/100 g Angelica Type 1 specific Angelica keiskei 357850 Anguilliformes Type 1 specific Anguilliformes 7933 736.1506 1000.0 0.753 mg/100 g Anise Type 1 specific Pimpinella anisum 271192 Annual wild rice Type 1 specific Zizania aquatica 75727 Apple Type 1 specific Malus pumila 283210 14.719345 54.0 0.011 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 69.274292 345.5 0.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 35.357143 126.0 0.0 mg/100 g Arctic blackberry Type 1 specific Rubus arcticus 70741 Arepa Type 2 specific 288.0 288.0 288.0 mg/100 g Arrowhead Type 1 specific Sagittaria latifolia 15008 Arrowroot Type 1 specific Maranta arundinacea 210060 13.0 13.0 13.0 mg/100 g Asian pear Type 1 specific Pyrus pyrifolia 3767 9.009 18.0 0.018 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 129.500316 806.4 0.106 mg/100 g Atlantic cod Type 1 specific Gadus morhua 8049 1030.1452 2563.0 0.726 mg/100 g Atlantic croaker Type 1 specific Micropogonias undulatus 29154 504.575 788.0 0.725 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 736.182 920.0 0.91 mg/100 g Atlantic herring Type 1 specific Clupea harengus harengus 7950 709.9555 1004.0 0.733 mg/100 g Atlantic mackerel Type 1 specific Scomber scombrus 13677 866.0 973.0 759.0 mg/100 g Atlantic pollock Type 1 specific Pollachius pollachius 185739 603.586333 1017.0 0.759 mg/100 g Atlantic salmon Type 1 specific Salmo salar 8030 729.1618 1038.0 0.809 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 633.9428 915.0 0.714 mg/100 g Avocado Type 1 specific Persea americana 3435 101.430571 197.9 0.114 mg/100 g Babassu palm Type 1 specific Attalea speciosa 145700 0.0 0.0 0.0 mg/100 g Baby food Type 2 specific 205.352941 762.0 0.0 mg/100 g Bagel Type 2 specific 515.444444 564.0 481.0 mg/100 g Baked beans Type 2 specific 309.714286 357.0 286.0 mg/100 g Baked potato Type 2 specific 227.6 304.0 102.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 45.140875 127.0 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 81.51 226.0 0.04 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 402.368525 527.0 0.418 mg/100 g Bayberry Type 1 specific Myrica 3509 Bean Type 1 specific 309.714286 357.0 286.0 mg/100 g Bearded seal Type 1 specific Erignathus barbatus 39304 1847.75 2994.0 856.0 mg/100 g Beech nut Type 1 specific Fagus 21024 155.155 310.0 0.31 mg/100 g Beefalo Type 1 specific Bos taurus X Bison bison 297284 Beer Type 2 specific 7.502941 12.0 0.0 mg/100 g Beluga whale Type 1 specific Delphinapterus leucas 9749 2422.0 2422.0 2422.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 0.0 0.0 0.0 mg/100 g Biscuit Type 2 specific 309.697674 761.0 144.0 mg/100 g Bison Type 1 specific Bison bison 9901 0.776 0.776 0.776 mg/100 g Bitter gourd Type 1 specific Momordica charantia 3673 Bivalvia (Clam, Mussel, Oyster) Type 1 specific Bivalvia 6544 634.25 1144.0 1.0 mg/100 g Black cabbage Type 1 specific Brassica oleracea var. viridis 3713 81.5 95.0 67.0 mg/100 g Black chokeberry Type 1 specific Photinia melanocarpa 661339 Black crowberry Type 1 specific Empetrum nigrum 191066 Black elderberry Type 1 specific Sambucus nigra 4202 Black huckleberry Type 1 specific Gaylussacia baccata 128893 Black mulberry Type 1 specific Morus nigra 85232 Black plum Type 1 Syzygium cumini Black radish Type 1 specific Raphanus sativus var. niger 41679 Black raisin Type 1 Black raspberry Type 1 specific Rubus occidentalis 75079 Black salsify Type 1 specific Scorzonera hispanica 114289 0.0 0.0 0.0 mg/100 g Black tea Type 1 0.5 4.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 705.408333 1225.0 1.225 mg/100 g Black-eyed pea Type 1 specific Vigna unguiculata ssp. unguiculata 3920 387.863 1178.0 1.178 mg/100 g Blackberry Type 1 specific Rubus Blackcurrant Type 1 specific Ribes nigrum 78511 1.0 6.0 0.0 mg/100 g Blue cheese Type 2 1.12 1.12 1.12 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 581.7422 841.0 0.711 mg/100 g Blue mussel Type 1 specific Mytilus edulis 6550 533.511 1067.0 0.533 mg/100 g Blue whiting Type 1 specific Micromesistius poutassou 81636 0.0 0.0 0.0 mg/100 g Bluefish Type 1 specific Pomatomus saltatrix 75034 622.272667 1048.0 0.818 mg/100 g Bog bilberry Type 1 specific Vaccinium uliginosum 190548 Borage Type 1 specific Borago officinalis 13363 Boysenberry Type 1 specific Rubus ursinus X idaeus Brassicas Unknown generic 3705 Brazil nut Type 1 specific Bertholletia excelsa 3645 750.475 780.0 683.0 mg/100 g Breadfruit Type 1 specific Artocarpus altilis 194251 520.25 815.0 355.0 mg/100 g Breadnut tree seed Type 1 specific Brosimum alicastrum 194253 325.8 577.0 0.4 mg/100 g Breakfast cereal Type 2 specific 333.791045 1386.0 0.0 mg/100 g Breakfast sandwich Type 2 specific 629.904762 740.0 411.0 mg/100 g Broad bean Type 1 specific Vicia faba 3906 447.1875 1195.0 210.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 133.914941 944.53 0.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 185.0 210.0 140.0 mg/100 g Buffalo Type 1 specific Bubalus bubalis 89462 0.875 0.875 0.875 mg/100 g Buffalo currant Type 1 specific Ribes aureum var. villosum 23283 Bulgur Type 2 specific 241.86 580.0 0.58 mg/100 g Burbot Type 1 specific Lota lota 69944 449.697 1010.0 0.0 mg/100 g Burdock Type 1 specific Arctium lappa 4217 33.605 75.0 0.025 mg/100 g Burrito Type 2 specific 415.0 574.0 166.0 mg/100 g Butter Type 2 specific 31.25575 46.0 0.046 mg/100 g Butterfat Type 2 specific 15.0 15.0 15.0 mg/100 g Buttermilk Type 2 specific 362.799222 1866.0 0.193 mg/100 g Butternut Type 1 specific Juglans cinerea 91214 1103.33 1668.35 1.64 mg/100 g Butternut squash Type 1 specific Cucurbita moschata 3662 39.148429 69.0 0.039 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 255.1015 510.15 0.053 mg/100 g Cake Type 2 specific 272.854167 583.0 126.0 mg/100 g Calabash Type 1 specific Lagenaria siceraria 3668 Canada blueberry Type 1 specific Vaccinium myrtilloides 1503870 Cannellini bean Type 1 Canola Type 2 specific 138011 Cantaloupe melon Type 1 Cucumis melo var. cantalupensis 0.003 0.003 0.003 mg/100 g Cape gooseberry Type 1 Physalis peruviana Capers Type 1 specific Capparis spinosa 65558 Caraway Type 1 specific Carum carvi 48032 946.0 946.0 946.0 mg/100 g Cardamom Type 1 specific Elettaria cardamomum 105181 Cardoon Type 1 specific Cynara cardunculus 4265 Carob Type 1 specific Ceratonia siliqua 20340 1327.0 2350.0 304.0 mg/100 g Carp bream Type 1 specific Abramis brama 38527 0.364 0.728 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 47.452625 275.0 0.0035 mg/100 g Cascade huckleberry Type 1 specific Vaccinium deliciosum 190531 Casein Type 2 specific 4100.0 4100.0 4100.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 936.279167 1079.0 840.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 51.5566 158.75 0.033 mg/100 g Castanospermum australe Type 1 Castanospermum australe Catfish Type 1 specific Siluriformes 7995 620.167 940.0 0.668 mg/100 g Catjang pea Type 1 specific Vigna unguiculata ssp. cylindrica 3840 502.2985 1194.0 1.194 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 964.551087 1498.0 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 104.267684 159.0 0.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 54.0 54.0 54.0 mg/100 g Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 54.0 54.0 54.0 mg/100 g Celery stalks Type 1 specific Apium graveolens var. dulce 117781 0.02 0.02 0.02 mg/100 g Cereals and cereal products Unknown generic Cetacea (Dolphin, Porpoise, Whale) Type 1 specific Cetacea 9721 0.0 0.0 0.0 mg/100 g Ceylon cinnamon Type 1 specific Cinnamomum verum 128608 Channel catfish Type 1 specific Ictalurus punctatus 7998 576.944667 764.0 0.668 mg/100 g Chanterelle Type 1 specific Cantharellus cibarius 36066 0.0 0.0 0.0 mg/100 g Charr Type 1 specific Salvelinus 8033 0.0 0.0 0.0 mg/100 g Chayote Type 1 specific Sechium edule 184140 85.828143 389.75 0.047 mg/100 g Cheese Type 2 specific 1242.231638 2404.0 190.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 21.021 63.0 0.0 mg/100 g Cherry tomato Type 1 specific Solanum lycopersicum var. cerasiforme 195583 Chervil Type 1 specific Anthriscus cerefolium 40888 137.5 180.0 95.0 mg/100 g Chestnut Type 1 specific Castanea 21019 66.061333 99.0 0.184 mg/100 g Chewing gum Type 2 specific 0.0 0.0 0.0 mg/100 g Chia Type 1 specific Salvia hispanica 49212 525.0245 1049.0 1.049 mg/100 g Chicken Type 1 specific Gallus gallus 9031 750.714286 1000.0 0.0 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 586.6536 1036.5 1.036 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 28.0 42.0 0.0 mg/100 g Chicory leaves Type 1 specific Cichorium intybus var. foliosum 13427 Chicory roots Type 1 specific Cichorium intybus var. sativum 13427 Chili Type 2 specific 343.666667 406.0 293.0 mg/100 g Chimichanga Type 2 specific 426.25 486.0 350.0 mg/100 g Chinese bayberry Type 1 specific Myrica rubra 262757 Chinese broccoli Type 1 specific Brassica alboglabra 3714 Chinese cabbage Type 1 specific Brassica rapa 3711 26.682667 40.0 0.048 mg/100 g Chinese chestnut Type 1 specific Castanea mollissima 60419 161.0368 299.0 0.184 mg/100 g Chinese chives Type 1 specific Allium tuberosum 4683 0.148 0.148 0.148 mg/100 g Chinese cinnamon Type 1 specific Cinnamomum aromaticum 119260 195.0 195.0 195.0 mg/100 g Chinese mustard Type 1 specific Brassica juncea 3707 Chinese plum Type 1 Chinese water chestnut Type 1 specific Eleocharis dulcis 110284 Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 711.469667 1049.0 0.818 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 362.608 957.0 0.148 mg/100 g Chocolate Type 2 specific 337.727273 530.0 0.0 mg/100 g Chocolate spread Type 2 specific 0.0 0.0 0.0 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 733.970333 1053.0 0.822 mg/100 g Cichlidae (Tilapia) Type 1 specific Cichlidae 8113 591.604333 961.0 0.813 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 0.065 0.195 0.0 mg/100 g Cisco Type 1 specific Coregonus artedi 36181 481.258333 775.0 0.775 mg/100 g Citrus Unknown generic Clam Type 1 0.69 0.69 0.69 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 834.376714 1000.0 0.637 mg/100 g Clementine Type 1 Citrus × clementina Climbing bean Type 1 specific Vigna umbellata 87088 Cloud ear fungus Type 1 specific Auricularia polytricha 29893 Cloudberry Type 1 specific Rubus chamaemorus 57936 Cloves Type 1 specific Syzygium aromaticum 219868 120.12 240.0 0.24 mg/100 g Clupeinae (Herring, Sardine, Sprat) Type 1 specific Clupeinae 7948 491.428571 980.0 0.0 mg/100 g Cocoa bean Type 1 specific Theobroma cacao 3641 880.0 880.0 880.0 mg/100 g Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa powder Type 2 specific 713.375 900.0 280.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 137.04688 360.0 0.0 mg/100 g Coffee Type 1 generic Coffea 13442 35.357143 126.0 0.0 mg/100 g Coffee substitute Type 2 specific 135.5 180.0 91.0 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 807.840286 1116.0 0.882 mg/100 g Cold cut Type 2 specific 593.727273 1147.0 0.0 mg/100 g Colorado pinyon Type 1 specific Pinus edulis 3340 332.663667 506.5 0.491 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 308.5588 800.0 0.854 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 463.530556 1378.0 33.0 mg/100 g Common beet Type 1 specific Beta vulgaris 161934 47.33825 82.0 0.059 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 394.97375 711.0 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 66.697769 190.0 0.071 mg/100 g Common carp Type 1 specific Cyprinus carpio 7962 553.909333 933.0 0.728 mg/100 g Common chokecherry Type 1 specific Prunus virginiana 133204 Common dab Type 1 specific Limanda limanda 27771 0.0 0.0 0.0 mg/100 g Common grape Type 1 specific Vitis vinifera 29760 63.433333 98.3 22.0 mg/100 g Common hazelnut Type 1 specific Corylus avellana 13451 0.735 0.735 0.735 mg/100 g Common ling Type 1 specific Molva molva 163112 442.19375 993.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 91.733333 120.0 57.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 501.167 1336.0 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 157.157 314.0 0.314 mg/100 g Common pea Type 1 specific Pisum sativum 3888 300.808571 1100.0 0.0 mg/100 g Common persimmon Type 1 specific Diospyros virginiana 13493 15.5155 31.0 0.031 mg/100 g Common sage Type 1 specific Salvia officinalis 38868 Common salsify Type 1 specific Tragopogon porrifolius 13731 Common thyme Type 1 specific Thymus vulgaris 49992 Common verbena Type 1 specific Verbena officinalis 79772 Common walnut Type 1 specific Juglans regia 51240 577.228 934.0 0.934 mg/100 g Common wheat Type 1 specific Triticum aestivum 4565 554.3375 663.0 428.35 mg/100 g Conch Type 1 specific Strombidae 69694 Condensed milk Type 2 specific 430.0 430.0 430.0 mg/100 g Cooking oil Type 2 specific 0.0 0.0 0.0 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 0.0 0.0 0.0 mg/100 g Corn Type 1 specific Zea mays 4577 214.474692 732.0 0.0 mg/100 g Corn chip Type 2 specific 326.75 369.0 277.0 mg/100 g Corn grits Type 2 specific 173.307692 417.0 67.0 mg/100 g Corn salad Type 1 specific Valerianella locusta 59166 266.0 469.0 63.0 mg/100 g Cornbread Type 2 specific 356.0 396.0 336.0 mg/100 g Cornmint Type 1 specific Mentha arvensis 292239 Cottonseed Type 1 specific Gossypium 3633 1078.203625 2492.0 0.0 mg/100 g Cottonseed oil Type 2 0.0 0.0 0.0 mg/100 g Couscous Type 2 specific 390.0 601.0 179.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 0% fat Type 2 specific 203.0 203.0 203.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 1% fat Type 2 specific 203.0 203.0 203.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 2% fat Type 2 specific 199.0 199.0 199.0 mg/100 g Cow milk, pasteurized, vitamin D added, 3.25% fat Type 2 specific 190.0 190.0 190.0 mg/100 g Cowpea Type 1 specific Vigna unguiculata 3917 Crab Type 1 specific Brachyura 6752 755.795444 1200.0 0.711 mg/100 g Cracker Type 2 specific 505.6 768.0 316.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 366.316143 690.0 0.0 mg/100 g Cream Type 2 specific 131.462552 190.0 0.094 mg/100 g Cream substitute Type 2 specific 103.5 295.0 29.0 mg/100 g Crisp bread Type 2 specific 531.909091 660.0 431.0 mg/100 g Crosne Type 1 Stachys affinis Cubanelle pepper Type 1 Cucumber Type 1 specific Cucumis sativus 3659 25.514211 210.55 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 187.803191 1673.0 24.0 mg/100 g Cumin Type 1 specific Cuminum cyminum 52462 Cupuaçu Type 1 specific Theobroma grandiflorum 108881 0.0 0.0 0.0 mg/100 g Curry powder Type 2 specific 0.0 0.0 0.0 mg/100 g Cusk Type 1 specific Brosme brosme 81638 589.591667 993.0 0.775 mg/100 g Custard apple Type 1 specific Annona reticulata 301862 Cuttlefish Type 1 specific Sepiidae 6608 727.575667 1455.0 0.727 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 47.253375 240.0 0.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 0.0 0.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 59.010333 101.0 0.062 mg/100 g Deer Type 1 specific Cervidae 9850 926.330444 1281.0 0.974 mg/100 g Deerberry Type 1 specific Vaccinium stamineum 176259 Devilfish Type 1 specific Myoxocephalus 8095 Dill Type 1 specific Anethum graveolens 40922 112.6756 405.22 0.0 mg/100 g Dock Type 1 specific Rumex 3618 54.26925 77.0 0.077 mg/100 g Dolphin fish Type 1 specific Coryphaena hippurus 34814 861.5 968.0 755.0 mg/100 g Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 851.243802 2597.0 0.0 mg/100 g Dragée Type 2 specific 0.0 0.0 0.0 mg/100 g Dried milk Type 2 specific 1795.181818 2000.0 1432.0 mg/100 g Dumpling Type 2 specific 0.0 0.0 0.0 mg/100 g Dungeness crab Type 1 specific Cancer magister 29965 520.228333 875.0 0.685 mg/100 g Durian Type 1 specific Durio zibethinus 66656 Eastern oyster Type 1 specific Crassostrea virginica 6565 269.746429 450.0 0.225 mg/100 g Eddoe Type 1 Colocasia antiquorum Edible shell Type 2 specific 355.0 367.0 343.0 mg/100 g Egg roll Type 2 specific 368.25 430.0 320.0 mg/100 g Egg substitute Type 2 specific 375.8755 751.0 0.751 mg/100 g Egg yolk Type 1 0.09 0.09 0.09 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 58.4722 299.3 0.0 mg/100 g Eggs Unknown generic 1762.114906 6078.0 0.09 mg/100 g Elderberry Type 1 specific Sambucus 4201 27.428571 32.0 24.0 mg/100 g Elk Type 1 specific Cervus canadensis 1574408 0.777 0.777 0.777 mg/100 g Elliott's blueberry Type 1 specific Vaccinium elliottii 283798 Empanada Type 2 specific 454.0 454.0 454.0 mg/100 g Emu Type 1 specific Dromaius novaehollandiae 8790 0.542 0.542 0.542 mg/100 g Enchilada Type 2 specific 329.0 418.0 279.0 mg/100 g Endive Type 1 specific Cichorium endivia 114280 95.435571 419.0 0.049 mg/100 g Enokitake Type 1 specific Flammulina velutipes 38945 90.0 90.0 90.0 mg/100 g Epazote Type 1 specific Dysphania ambrosioides 330163 European anchovy Type 1 specific Engraulis encrasicolus 184585 669.943333 1179.0 0.83 mg/100 g European chestnut Type 1 specific Castanea sativa 21020 148.328875 319.0 0.081 mg/100 g European cranberry Type 1 specific Vaccinium oxycoccos 516948 European plum Type 1 specific Prunus domestica 3758 32.795833 77.55 9.0 mg/100 g European rabbit Type 1 specific Oryctolagus 9984 0.966 0.966 0.966 mg/100 g Evaporated milk Type 2 specific 380.25 411.0 370.0 mg/100 g Evening primrose Type 1 specific Oenothera biennis 3942 857.9 857.9 857.9 mg/100 g Evergreen huckleberry Type 1 specific Vaccinium ovatum 84019 Falafel Type 2 specific 667.0 667.0 667.0 mg/100 g Feijoa Type 1 specific Feijoa sellowiana 260130 19.514 39.0 0.028 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 732.73 943.65 0.0 mg/100 g Fenugreek Type 1 specific Trigonella foenum-graecum 78534 830.655 1275.75 1.215 mg/100 g Fig Type 1 specific Ficus carica 3494 67.871333 160.0 0.02 mg/100 g Fireweed Type 1 specific Chamerion angustifolium 13055 Fish oil Type 1 0.0 0.0 0.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 594.3158 840.0 0.579 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 510.142114 1300.0 0.0 mg/100 g Florida pompano Type 1 specific Trachinotus carolinus 173342 573.584667 966.0 0.754 mg/100 g Flour Type 2 specific Fox grape Type 1 specific Vitis labrusca 103355 French plantain Type 1 specific Musa X paradisiaca 89151 37.5 42.0 25.0 mg/100 g French toast Type 2 specific 415.5 472.0 305.0 mg/100 g Freshwater drum Type 1 specific Aplodinotus grunniens 225389 544.572 917.0 0.716 mg/100 g Freshwater eel Type 1 specific Anguilla 7935 572.917667 965.0 0.753 mg/100 g Frozen yogurt Type 2 specific 202.5 204.0 201.0 mg/100 g Fruit gum Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit juice Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit preserve Type 2 specific 7.0 28.0 0.0 mg/100 g Fruit-flavor drink Type 2 specific 85.5 164.0 7.0 mg/100 g Fruits Unknown generic Gadiformes Type 1 specific Gadiformes 8043 0.457667 0.726 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 447.434296 1300.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 100.0 100.0 100.0 mg/100 g Garden onion Type 1 specific Allium cepa 4679 57.7042 208.25 0.021 mg/100 g Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 0.021 0.021 0.021 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 27.0 27.0 27.0 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 85.081081 380.0 0.0 mg/100 g Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 201.2 201.2 201.2 mg/100 g Garfish Type 1 specific Belone belone 129037 890.0 890.0 890.0 mg/100 g Garland chrysanthemum Type 1 specific Chrysanthemum coronarium 99038 Garlic Type 1 specific Allium sativum 4682 302.17 510.0 0.19 mg/100 g Gefilte fish Type 2 specific 473.0 473.0 473.0 mg/100 g Gelatin Type 2 specific 3200.0 3200.0 3200.0 mg/100 g Gelatin dessert Type 2 specific 992.428571 2605.0 0.0 mg/100 g Gentiana lutea Type 1 Gentiana lutea German camomile Type 1 specific Matricaria recutita 127986 Giant butterbur Type 1 specific Petasites japonicus 186965 Gin Type 2 specific 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 89.224167 250.0 0.045 mg/100 g Ginkgo nuts Type 1 specific Ginkgo biloba 3311 321.528 695.0 0.29 mg/100 g Ginseng Type 1 specific Panax 4054 Globe artichoke Type 1 specific Cynara scolymus 59895 0.0 0.0 0.0 mg/100 g Goji Type 1 0.498 0.498 0.498 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 0.0 0.0 0.0 mg/100 g Gram bean Type 1 specific Vigna mungo 3915 707.0 1327.0 397.0 mg/100 g Grape Type 1 specific Vitis 3603 19.356 73.0 0.0 mg/100 g Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 23.1348 43.0 0.022 mg/100 g Grapefruit/Pummelo hybrid Type 1 specific Citrus paradisi X Citrus maxima 37656 0.028 0.028 0.028 mg/100 g Grapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Grass pea Type 1 specific Lathyrus sativus 3860 Greater sturgeon Type 1 specific Acipenser 7901 694.16475 1273.0 0.659 mg/100 g Greek feta cheese Type 2 1.169 1.169 1.169 mg/100 g Green apple Type 1 Green bean Type 1 specific Phaseolus vulgaris 3885 92.851875 140.0 43.0 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 107.942857 719.0 32.0 mg/100 g Green cabbage Type 1 Brassica oleracea var. sabauda L. Green grape Type 1 Green lentil Type 1 Lens culinaris 1.136 1.136 1.136 mg/100 g Green onion Type 1 Green plum Type 1 0.023 0.023 0.023 mg/100 g Green tea Type 1 0.5 4.0 0.0 mg/100 g Green vegetables Unknown generic Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 70.645071 403.75 0.111 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 354.083714 752.0 0.0 mg/100 g Greenthread tea Type 1 specific Thelesperma 153159 Greylag goose Type 1 specific Anser anser 8843 Groundcherry Type 1 specific Physalis 24663 0.0 0.0 0.0 mg/100 g Grouper Type 1 specific Epinephelus 94231 601.930333 1014.0 0.791 mg/100 g Guarana Type 1 Paullinia cupana Guava Type 1 specific Psidium guajava 120290 39.079167 98.4 0.075 mg/100 g Guinea hen Type 1 specific Numida meleagris 8996 0.71 0.71 0.71 mg/100 g Haddock Type 1 specific Melanogrammus aeglefinus 8056 878.0 1200.0 0.0 mg/100 g Half-highbush blueberry Type 1 specific Vaccinium angustifolium X Vaccinium corymbosum 934696 Hamburger Type 2 specific 550.21875 775.0 330.0 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 333.5 667.0 0.0 mg/100 g Hawthorn Type 1 Crataegus Hazelnut Type 1 specific Corylus 13450 564.105 900.0 0.0 mg/100 g Heart of palm Type 1 specific 81.0 81.0 81.0 mg/100 g Hedge mustard Type 1 specific Sisymbrium 3729 483.0 483.0 483.0 mg/100 g Herbal tea Type 1 0.0 0.0 0.0 mg/100 g Herbs and Spices Unknown generic Hibiscus tea Type 1 specific Hibiscus sabbariffa 183260 Hickory nut Type 1 specific Carya 13402 403.403 806.0 0.806 mg/100 g Highbush blueberry Type 1 specific Vaccinium corymbosum 69266 75.0 75.0 75.0 mg/100 g Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 754.3698 1031.0 0.849 mg/100 g Honey Type 2 specific 3.003 6.0 0.006 mg/100 g Horned melon Type 2 specific Cucumis metuliferus 61886 Horse Type 1 specific Equus caballus 9796 0.817 0.817 0.817 mg/100 g Horseradish Type 1 specific Armoracia rusticana 3704 135.666667 190.0 27.0 mg/100 g Horseradish tree Type 1 specific Moringa oleifera 3735 513.75 1177.0 232.0 mg/100 g Hot chocolate Type 2 specific 195.384615 210.0 170.0 mg/100 g Hot dog Type 2 specific 484.666667 525.0 448.0 mg/100 g Hummus Type 2 specific 245.0 245.0 245.0 mg/100 g Hushpuppy Type 2 specific 412.0 412.0 412.0 mg/100 g Hyacinth bean Type 1 specific Lablab purpureus 35936 500.289375 1383.0 1.315 mg/100 g Hyssop Type 1 specific Hyssopus officinalis 39324 Ice cream Type 2 specific 162.304348 244.0 0.0 mg/100 g Ice cream cone Type 2 specific 388.0 393.0 383.0 mg/100 g Iceberg lettuce Type 1 0.025 0.025 0.025 mg/100 g Icing Type 2 specific 53.444444 151.0 0.0 mg/100 g Irish moss Type 1 specific Chondrus crispus 2769 Italian oregano Type 1 specific Origanum X majoricum 1384207 0.314 0.314 0.314 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 107.090909 719.0 32.0 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 51.5515 103.0 0.103 mg/100 g Jalapeno pepper Type 1 Capsicum annuum 'Jalapeño' Japanese chestnut Type 1 specific Castanea crenata 103480 110.422 257.0 0.11 mg/100 g Japanese persimmon Type 1 specific Diospyros kaki 35925 25.007333 53.0 0.022 mg/100 g Japanese pumpkin Type 1 specific Cucurbita maxima 3661 633.836364 1673.0 35.0 mg/100 g Japanese sea bass Type 1 Lateolabrax japonicus 0.752 0.752 0.752 mg/100 g Japanese walnut Type 1 specific Juglans ailanthifolia 91209 Java plum Type 1 specific Syzygium cumini 260142 Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 147.7 295.4 0.0 mg/100 g Jew's ear Type 1 specific Auricularia auricula-judae 29892 Jicama Type 1 specific Pachyrhizus erosus 109171 63.005 240.0 0.025 mg/100 g Jostaberry Type 1 specific Ribes × nidigrolaria Jujube Type 1 specific Ziziphus zizyphus 48393 Juniperus communis Type 1 Juniperus communis Junket Type 2 specific 155.4 173.0 101.0 mg/100 g Jute Type 1 specific Corchorus olitorius 93759 259.9864 831.75 0.182 mg/100 g Kai-lan Type 1 specific Brassica oleracea var. alboglabra 3714 Kale Type 1 specific Brassica napus var. pabularia 105.692308 190.0 80.0 mg/100 g Kefir Type 2 specific 190.0 190.0 190.0 mg/100 g Kelp Type 1 specific Laminaria 33637 49.049 98.0 0.098 mg/100 g Ketchup Type 2 specific 60.4 86.0 0.0 mg/100 g King mackerel Type 1 specific Scomberomorus cavalla 13679 629.609 1061.0 0.827 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 36.2005 53.0 0.0025 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 0.0 0.0 0.0 mg/100 g Komatsuna Type 1 specific Brassica rapa var. perviridis 344680 Kombu Type 1 specific Saccharina japonica 88149 0.0 0.0 0.0 mg/100 g Kumquat Type 1 specific Fortunella 2706 0.0 0.0 0.0 mg/100 g Lake trout Type 1 specific Salvelinus namaycush 8040 0.0 0.0 0.0 mg/100 g Lambsquarters Type 1 specific Chenopodium album 3559 248.24 737.0 0.2 mg/100 g Lantern fruit Type 1 Physalis alkekengi Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Lasagna Type 2 specific 325.0 390.0 260.0 mg/100 g Leavening agent Type 2 specific 1097.0 1980.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 48.030667 72.0 0.092 mg/100 g Lemon Type 1 specific Citrus limon 2708 7.0 14.0 0.0 mg/100 g Lemon balm Type 1 specific Melissa officinalis 39338 Lemon grass Type 1 specific Cymbopogon citratus 66014 Lemon sole Type 1 specific Microstomus kitt 106175 657.64475 930.0 0.579 mg/100 g Lemon thyme Type 1 specific Thymus pulegioides 751873 Lemon verbena Type 1 specific Aloysia triphylla 542672 Lentils Type 1 generic Lens culinaris 3864 673.680375 1400.0 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 55.406281 344.5 0.0005 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.0 0.0 0.0 mg/100 g Lima bean Type 1 specific Phaseolus lunatus 3884 524.54635 1428.0 0.427 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 0.0 0.0 0.0 mg/100 g Linden Type 1 specific Tilia 64580 Lingcod Type 1 specific Ophiodon elongatus 225387 548.24 924.0 0.72 mg/100 g Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 0.0 0.0 0.0 mg/100 g Liquor Type 2 specific 37.75 153.0 0.0 mg/100 g Liquorice Type 2 specific 0.0 0.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 0.0 0.0 0.0 mg/100 g Longan Type 1 specific Dimocarpus longan 128017 76.016 180.0 0.048 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 15.005 20.0 0.02 mg/100 g Lotus Type 1 specific Nelumbo 4430 397.02 939.0 0.06 mg/100 g Lovage Type 1 specific Levisticum officinale 48042 Lowbush blueberry Type 1 specific Vaccinium angustifolium 472369 Lumpsucker Type 1 specific Cyclopteridae 8101 0.0 0.0 0.0 mg/100 g Lupine Type 1 specific Lupinus 3869 1.869 1.869 1.869 mg/100 g Macadamia nut Type 1 specific Macadamia 4329 297.10475 419.0 0.419 mg/100 g Macadamia nut (M. tetraphylla) Type 1 specific Macadamia tetraphylla 512563 0.419 0.419 0.419 mg/100 g Macaroni and cheese Type 2 specific 394.125 728.0 291.0 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 50.05 100.0 0.1 mg/100 g Malabar plum Type 1 specific Syzygium jambos 334483 Malabar spinach Type 1 specific Basella alba 3589 249.25 441.5 57.0 mg/100 g Mallard duck Type 1 specific Anas platyrhynchos 8839 Malus (Crab apple) Type 1 specific Malus 3749 16.0 16.0 16.0 mg/100 g Mamey sapote Type 1 specific Pouteria sapota 233744 97.5975 195.0 0.195 mg/100 g Mammee apple Type 1 specific Mammea americana 198777 Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 24.898692 94.65 0.033 mg/100 g Mango Type 1 specific Mangifera indica 29780 49.507 168.5 0.035 mg/100 g Margarine Type 2 specific 31.076923 46.0 0.0 mg/100 g Margarine-like spread Type 2 specific 23.333333 28.0 21.0 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 765.790429 1200.0 0.533 mg/100 g Marshmallow Type 2 specific 30.5 61.0 0.0 mg/100 g Marzipan Type 2 specific 340.0 510.0 0.0 mg/100 g Mate Type 1 Ilex paraguariensis Meat bouillon Type 2 specific 451.428571 1200.0 0.0 mg/100 g Meatball Type 2 specific 0.0 0.0 0.0 mg/100 g Meatloaf Type 2 specific 648.090909 916.0 413.0 mg/100 g Medlar Type 1 specific Mespilus germanica 36616 Mentha Type 1 specific Mentha 21819 Meringue Type 2 specific 0.0 0.0 0.0 mg/100 g Mexican groundcherry Type 1 specific Physalis philadelphica var. immaculata 374021 Mexican oregano Type 1 specific Lippia graveolens 0.314 0.314 0.314 mg/100 g Mikan Type 1 Citrus unshiu Milk (Cow) Type 2 specific 5513.32987 203000.0 0.0 mg/100 g Milk (Human) Type 2 specific 10.75 43.0 0.0 mg/100 g Milk (Other mammals) Type 2 specific 252.0 492.0 180.0 mg/100 g Milk substitute Type 2 specific 108.0 108.0 108.0 mg/100 g Milkfish Type 1 specific Chanos chanos 29144 637.612667 1074.0 0.838 mg/100 g Milkshake Type 2 specific 194.4 228.0 166.0 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 415.949143 782.0 0.0 mg/100 g Miso Type 2 specific 300.5 601.0 0.0 mg/100 g Mixed nuts Type 2 specific 1040.777778 1620.0 587.0 mg/100 g Monk fruit Type 1 Siraitia grosvenorii Monkfish Type 1 specific Lophius piscatorius 8074 449.530333 757.0 0.591 mg/100 g Morchella (Morel) Type 1 specific Morchellaceae 5192 Moth bean Type 1 specific Vigna aconitifolia 3918 Mountain hare Type 1 specific Lepus timidus 62621 0.0 0.0 0.0 mg/100 g Mountain yam Type 1 specific Dioscorea pentaphylla 167592 96.3642 226.75 0.071 mg/100 g Mugwort Type 1 specific Artemisia vulgaris 4220 Mulberry Type 1 specific Morus 3497 Mule deer Type 1 specific Odocoileus 9871 Multigrain bread Type 2 specific 397.5 414.0 381.0 mg/100 g Mundu Type 1 Garcinia dulcis Mung bean Type 1 specific Vigna radiata 157791 393.965067 1234.5 1.176 mg/100 g Muscadine grape Type 1 specific Vitis rotundifolia 103349 Muskmelon Type 1 specific Cucumis melo 3656 25.875 42.0 0.0 mg/100 g Mustard Type 2 specific 180.0 270.0 0.0 mg/100 g Mustard spinach Type 1 specific Brassica perviridis Nachos Type 2 specific 351.666667 409.0 263.0 mg/100 g Nance Type 1 specific Byrsonima crassifolia 4270 Nanking cherry Type 1 specific Prunus tomentosa 105667 36.05 40.0 32.1 mg/100 g Napa cabbage Type 1 specific Brassica rapa var. pekinensis 51351 44.666667 48.0 38.0 mg/100 g Naranjilla Type 1 specific Solanum quitoense 227725 Narrowleaf cattail Type 1 specific Typha angustifolia 59011 Natal plum Type 1 specific Carissa macrocarpa 403101 Natto Type 2 specific 1121.0 1121.0 1121.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 14.004375 19.0 0.0175 mg/100 g New Zealand spinach Type 1 specific Tetragonia tetragonioides 45318 Nopal Type 1 specific Opuntia cochenillifera 338184 29.681 46.0 0.043 mg/100 g Northern bluefin tuna Type 1 specific Thunnus thynnus 8237 724.317333 1220.0 0.952 mg/100 g Northern pike Type 1 specific Esox lucius 8010 448.4465 1007.0 0.0 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Norway lobster Type 1 specific Nephrops norvegicus 6829 1000.0 1000.0 1000.0 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.3395 0.679 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 0.0 0.0 0.0 mg/100 g Nutritional drink Type 2 specific 205.0 205.0 205.0 mg/100 g Nuts Unknown generic Oat Type 1 specific Avena sativa 4498 559.570264 890.0 0.0 mg/100 g Oat bread Type 2 specific 449.75 552.0 376.0 mg/100 g Ocean pout Type 1 specific Zoarces americanus 8199 516.559667 870.0 0.679 mg/100 g Ohelo berry Type 1 specific Vaccinium reticulatum 180767 Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Oil-seed Camellia Type 1 specific Camellia oleifera 385388 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 36.227111 45.0 0.044 mg/100 g Olive Type 1 specific Olea europaea 4146 8.375 36.0 0.0 mg/100 g Onion-family vegetables Unknown generic Opium poppy Type 1 specific Papaver somniferum 3469 987.45 1022.9 952.0 mg/100 g Orange bell pepper Type 1 specific Capsicum annuum 4072 119.78 248.9 48.44 mg/100 g Orange mint Type 1 specific Mentha aquatica 190902 Orange roughy Type 1 specific Hoplostethus atlanticus 96778 537.225 936.0 0.675 mg/100 g Oregon yampah Type 1 specific Perideridia oregana 234866 Oriental wheat Type 1 specific Triticum turanicum 376534 364.253 759.0 0.759 mg/100 g Ostrich Type 1 specific Struthio camelus 8801 0.856 0.88 0.809 mg/100 g Ostrich fern Type 1 specific Matteuccia struthiopteris 3277 Other alcoholic beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Other animal fat Type 2 specific 47.5 190.0 0.0 mg/100 g Other beverage Type 2 specific 105.625 241.0 10.0 mg/100 g Other bread Type 2 specific 314.307692 664.0 0.0 mg/100 g Other bread product Type 2 specific 449.818182 720.0 0.0 mg/100 g Other candy Type 2 specific 159.916667 753.0 0.0 mg/100 g Other cereal product Type 2 specific Other dish Type 2 specific 397.4375 808.0 110.0 mg/100 g Other fermented milk Type 2 specific 190.0 190.0 190.0 mg/100 g Other fish product Type 2 specific 515.0 758.0 0.0 mg/100 g Other frozen dessert Type 2 specific 56.666667 170.0 0.0 mg/100 g Other fruit product Type 2 specific 120.0 120.0 120.0 mg/100 g Other pasta dish Type 2 specific 232.0 277.0 187.0 mg/100 g Other sandwich Type 2 specific 518.4375 755.0 370.0 mg/100 g Other snack food Type 2 specific 422.842105 1503.0 0.0 mg/100 g Other soy product Type 2 specific 2952.583333 4600.0 151.0 mg/100 g Other vegetable product Type 2 specific 106.714286 158.0 68.0 mg/100 g Oval-leaf huckleberry Type 1 specific Vaccinium ovalifolium 190544 Oxheart cabbage Type 1 specific Brassica oleracea var. conica Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 175.375333 400.0 0.126 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 480.549 794.0 0.647 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 0.849 0.849 0.849 mg/100 g Pacific herring Type 1 specific Clupea pallasii 30724 508.889667 857.0 0.669 mg/100 g Pacific jack mackerel Type 1 specific Trachurus symmetricus 271940 473.4095 946.0 0.819 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.3145 0.629 0.0 mg/100 g Pacific oyster Type 1 specific Crassostrea gigas 29159 423.474333 847.0 0.423 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 562.254333 923.0 0.763 mg/100 g Pacific sardine Type 1 specific Sardinops sagax 28381 727.0 727.0 727.0 mg/100 g Painted comber Type 1 specific Serranus scriba 349661 694.5 760.0 629.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 40.674667 50.0 0.048 mg/100 g Pancake Type 2 specific 387.230769 599.0 180.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 24.733 74.65 0.015 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 252.448 1159.0 0.136 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 68.319612 77.0 55.29806197 mg/100 g Partridge berry Type 1 Mitchella repens Passion fruit Type 1 specific Passiflora edulis 78168 0.0 0.0 0.0 mg/100 g Pasta Type 2 specific 442.982143 941.0 8.0 mg/100 g Pastry Type 2 specific 277.698113 589.0 0.0 mg/100 g Pate Type 2 specific 408.428571 687.0 0.0 mg/100 g Pea shoots Type 1 0.181 0.181 0.181 mg/100 g Peach Type 1 specific Prunus persica 3760 49.069609 226.0 0.001 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 0.001 0.001 0.001 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 1234.238515 2572.0 0.0 mg/100 g Peanut oil Type 2 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 19.265719 67.0 0.0015 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 437.372833 491.0 0.474 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 115.520455 719.0 0.0 mg/100 g Pepper (C. baccatum) Type 1 specific Capsicum baccatum var. baccatum 165788 Pepper (C. chinense) Type 1 specific Capsicum chinense 80379 Pepper (C. frutescens) Type 1 specific Capsicum annuum var. annuum 40321 366.4 366.4 366.4 mg/100 g Pepper (C. pubescens) Type 1 specific Capsicum pubescens 113210 Pepper (Capsicum) Type 1 specific Capsicum 4071 Pepper (Spice) Type 1 specific Piper nigrum 13216 136.469667 409.0 0.0 mg/100 g Peppermint Type 1 specific Mentha X piperita 34256 73.073 146.0 0.146 mg/100 g Perciformes Type 1 specific Perciformes 8111 623.0 1050.0 0.0 mg/100 g Percoidei (Bass and others) Type 1 specific Percoidei 8112 753.960429 1014.0 0.723 mg/100 g Persian lime Type 1 specific Citrus latifolia 200541 35.0 35.0 35.0 mg/100 g Persimmon Type 1 specific Diospyros 13492 18.010333 27.0 0.031 mg/100 g Pheasant Type 1 specific Phasianus colchicus 9054 1.0315 1.049 1.014 mg/100 g Phyllo dough Type 2 specific 356.0 356.0 356.0 mg/100 g Pie Type 2 specific 169.142857 334.0 94.0 mg/100 g Pie crust Type 2 specific 255.8125 333.0 131.0 mg/100 g Pie filling Type 2 specific 14.0 14.0 14.0 mg/100 g Pigeon pea Type 1 specific Cajanus cajan 3821 546.6056 1064.0 1.028 mg/100 g Pikeperch Type 1 specific Sander lucioperca 283035 0.0 0.0 0.0 mg/100 g Piki bread Type 2 specific Pili nut Type 1 specific Canarium ovatum 43691 299.7995 599.0 0.599 mg/100 g Pine nut Type 1 specific Pinus 3337 623.95875 835.0 0.835 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 21.395 105.1 0.0 mg/100 g Pineappple sage Type 1 specific Salvia elegans 888065 Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 824.843571 1087.0 0.905 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 1124.609222 1378.2 1.283 mg/100 g Pita bread Type 2 specific 448.333333 469.0 438.0 mg/100 g Pitanga Type 1 specific Eugenia uniflora 119951 Pitaya Type 1 Hylocereus undatus Pizza Type 2 specific 634.125 1122.0 0.0 mg/100 g Plains prickly pear Type 1 specific Opuntia macrorhiza 1041245 Plantain Type 1 Musa × paradisiaca Pleuronectidae (Dab, Halibut, Plaice) Type 1 specific Pleuronectidae 8256 360.0 900.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.135 0.54 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.0 0.0 0.0 mg/100 g Pomes Unknown generic Popcorn Type 2 specific 421.363636 571.0 156.0 mg/100 g Poppy Type 1 specific Papaver 3468 653.333333 980.0 0.0 mg/100 g Pot marjoram Type 1 specific Origanum onites 452416 Pot pie Type 2 specific 266.5 289.0 244.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 119.698409 476.0 0.0 mg/100 g Potato bread Type 2 specific 275.0 275.0 275.0 mg/100 g Potato chip Type 2 specific 304.916667 362.0 230.0 mg/100 g Potato gratin Type 2 specific 208.5 275.0 142.0 mg/100 g Potato puffs Type 2 specific 101.0 102.0 100.0 mg/100 g Prairie turnip Type 1 specific Pediomelum esculentum 458363 185.7 185.7 185.7 mg/100 g Prickly pear Type 1 specific Opuntia 106975 0.0 0.0 0.0 mg/100 g Processed cheese Type 2 specific 873.777778 1058.0 532.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 24.25 40.0 14.0 mg/100 g Pudding Type 2 specific 101.285714 170.0 0.0 mg/100 g Pulses Unknown generic Pummelo Type 1 specific Citrus maxima 37334 Pumpkinseed sunfish Type 1 specific Lepomis gibbosus 270329 602.597333 1015.0 0.792 mg/100 g Pupusa Type 2 specific 489.333333 696.0 309.0 mg/100 g Purple laver Type 1 specific Porphyra laciniata 149.6495 299.0 0.299 mg/100 g Purple mangosteen Type 1 specific Garcinia mangostana 58228 Purslane Type 1 specific Portulaca oleracea 46147 143.375 444.5 39.0 mg/100 g Quail Type 1 specific Phasianidae 9005 775.7655 1103.0 1.062 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 0.0 0.0 0.0 mg/100 g Quinoa Type 1 specific Chenopodium quinoa 63459 247.855667 567.0 0.567 mg/100 g Rabbit Type 1 specific Leporidae 9979 853.9932 1463.0 0.966 mg/100 g Rabbiteye blueberry Type 1 specific Vaccinium virgatum Radish Type 1 specific Raphanus sativus 3726 60.2054 214.0 0.027 mg/100 g Radish (var.) Type 1 specific Raphanus sativus var. sativus 240228 Rainbow smelt Type 1 specific Osmerus mordax 8014 547.239667 922.0 0.719 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 454.8545 1016.0 0.0 mg/100 g Raisin bread Type 2 specific 367.333333 388.0 357.0 mg/100 g Rambutan Type 1 specific Nephelium lappaceum 151071 Rape Type 1 specific Brassica napus var. napus 138011 0.0 0.0 0.0 mg/100 g Rapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Rapini Type 1 specific Brassica ruvo 1204434 109.5 120.0 99.0 mg/100 g Ravioli Type 2 specific 183.0 216.0 150.0 mg/100 g Red algae Type 1 specific Rhodophyta 2763 Red beetroot Type 1 specific Beta vulgaris var. rubra 67.561111 239.95 28.0 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 3987.955257 62000.0 32.0 mg/100 g Red clover Type 1 Trifolium pratense Red grape Type 1 Red huckleberry Type 1 specific Vaccinium parvifolium 180766 Red king crab Type 1 specific Paralithodes camtschaticus 6741 494.24 762.0 0.72 mg/100 g Red onion Type 1 Red raspberry Type 1 specific Rubus idaeus 32247 150.898462 150.8984615 150.8984615 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 0.411 0.411 0.411 mg/100 g Red tea Type 1 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.0 0.0 0.0 mg/100 g Relish Type 2 specific 26.666667 49.0 11.0 mg/100 g Remoulade Type 2 specific 0.0 0.0 0.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 289.234043 670.0 0.0 mg/100 g Rice bread Type 2 specific 452.0 471.0 433.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 35.357143 126.0 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 0.0 0.0 0.0 mg/100 g Rocket salad Type 1 specific Eruca vesicaria 180536 Rocket salad (ssp.) Type 1 specific Eruca vesicaria ssp. sativa 29727 Roe Type 2 generic 1030.74375 1897.0 0.975 mg/100 g Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 47.675 50.0 42.7 mg/100 g Roman camomile Type 1 specific Chamaemelum nobile 99037 Root vegetables Unknown generic Rose hip Type 1 specific Rosa 3764 0.0 0.0 0.0 mg/100 g Roselle Type 1 specific Hibiscus sabdariffa 183260 Rosemary Type 1 specific Rosmarinus officinalis 39367 64.5645 129.0 0.129 mg/100 g Rowal Type 1 specific Pangium edule 112823 Rowanberry Type 1 specific Sorbus aucuparia 36599 Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.0 0.0 0.0 mg/100 g Rum Type 2 specific 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 379.758706 722.75 0.0 mg/100 g Rye bread Type 2 specific 197.785714 512.0 0.0 mg/100 g Sablefish Type 1 specific Anoplopoma fimbria 229290 492.13675 720.0 0.547 mg/100 g Sacred lotus Type 1 specific Nelumbo nucifera 4432 163.06 507.8 37.0 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 325.0 1788.0 0.0 mg/100 g Saffron Type 1 specific Crocus sativus 82528 Sago palm Type 1 specific Metroxylon sagu 93297 Salad Type 2 specific 157.0 375.0 34.0 mg/100 g Salad dressing Type 2 specific 41.72973 250.0 0.0 mg/100 g Salmonberry Type 1 specific Rubus spectabilis 59499 Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 792.090909 1086.0 0.0 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Salted butter Type 1 0.046 0.046 0.046 mg/100 g Sapodilla Type 1 specific Manilkara zapota 3741 9.009 18.0 0.018 mg/100 g Saskatoon berry Type 1 specific Amelanchier alnifolia 32219 37.85 62.7 13.0 mg/100 g Sauce Type 2 specific 82.222222 539.0 0.0 mg/100 g Sausage Type 2 specific 575.990566 1130.0 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 80.038667 120.0 0.116 mg/100 g Scallop Type 1 specific Pectinidae 6566 471.0098 847.0 0.049 mg/100 g Scarlet bean Type 1 specific Phaseolus coccineus 3886 Scombridae (Bonito, Mackerel, Tuna) Type 1 specific Scombridae 8224 740.0 850.0 620.0 mg/100 g Scup Type 1 specific Stenotomus chrysops 35579 586.256667 988.0 0.77 mg/100 g Sea trout Type 1 specific Salmo trutta forma trutta 13028 519.894333 876.0 0.683 mg/100 g Sea-buckthornberry Type 1 specific Hippophae rhamnoides 193516 Semolina Type 2 specific 539.0 598.0 480.0 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 997.137136 2734.0 0.0 mg/100 g Sesame oil Type 2 0.0 0.0 0.0 mg/100 g Sesbania flower Type 1 specific Sesbania bispinosa 485725 Shallot Type 1 specific Allium ascalonicum 1476995 222.704333 555.0 0.113 mg/100 g Shark Type 1 specific Squaliformes 282414 548.618667 856.0 0.856 mg/100 g Shea tree Type 1 specific Vitellaria paradoxa 292385 0.0 0.0 0.0 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 425.425 850.0 0.85 mg/100 g Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 674.444444 810.0 580.0 mg/100 g Sheepshead Type 1 specific Archosargus probatocephalus 119682 629.275 1062.0 0.825 mg/100 g Sherry Type 2 specific 0.0 0.0 0.0 mg/100 g Shiitake Type 1 specific Lentinus edodes 5353 155.3575 506.0 0.145 mg/100 g Shortening Type 2 specific 0.0 0.0 0.0 mg/100 g Shrimp Type 1 specific Caridea 6694 733.533333 1100.0 481.0 mg/100 g Silver linden Type 1 specific Tilia argentea Skipjack tuna Type 1 specific Katsuwonus pelamis 8226 683.299333 1151.0 0.898 mg/100 g Skunk currant Type 1 specific Ribes glandulosum 175226 Small-leaf linden Type 1 specific Tilia cordata 172266 Smelt Type 1 specific Osmeridae 8012 2450.0 2450.0 2450.0 mg/100 g Snack bar Type 2 specific 472.571429 1352.0 72.0 mg/100 g Snail Type 1 specific Gastropoda 6448 0.0 0.0 0.0 mg/100 g Snapper Type 1 specific Lutjanidae 30850 636.945667 1073.0 0.837 mg/100 g Snow crab Type 1 specific Chionoecetes opilio 41210 829.0 930.0 728.0 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 907.189 1320.0 0.89 mg/100 g Soft drink Type 2 specific 0.0 0.0 0.0 mg/100 g Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 161.595 323.0 0.19 mg/100 g Sorghum Type 1 specific Sorghum bicolor 4558 282.154 462.0 0.462 mg/100 g Sorrel Type 1 specific Rumex acetosa 41241 77.0 77.0 77.0 mg/100 g Soup Type 2 specific 166.056338 1156.0 10.0 mg/100 g Sour cherry Type 1 specific Prunus cerasus 140311 Sour cream Type 2 148.0 148.0 148.0 mg/100 g Sour orange Type 1 Citrus × aurantium Sourdock Type 1 specific Rumex articus 395311 Sourdough Type 2 specific Soursop Type 1 specific Annona muricata 13337 Soy bean Type 1 specific Glycine max 3847 1492.5365 4600.0 0.0 mg/100 g Soy cream Type 2 specific Soy milk Type 2 specific 91.8 140.0 0.0 mg/100 g Soy sauce Type 2 specific 310.913833 483.0 0.483 mg/100 g Soybean oil Type 2 0.0 0.0 0.0 mg/100 g Spanish mackerel Type 1 specific Scomberomorus maculatus 99344 583.262333 962.0 0.787 mg/100 g Sparkleberry Type 1 specific Vaccinium arboreum 229201 Spearmint Type 1 specific Mentha spicata 29719 302.042667 778.0 0.128 mg/100 g Spelt Type 1 specific Triticum spelta 58933 362.8625 725.0 0.725 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 137.138471 669.55 0.104 mg/100 g Spiny dogfish Type 1 specific Squalus acanthias 7797 0.0 0.0 0.0 mg/100 g Spiny lobster Type 1 specific Palinuridae 6731 615.603667 1035.0 0.811 mg/100 g Spirit Type 2 specific 0.0 0.0 0.0 mg/100 g Spirulina Type 1 specific Spirulina 551299 1102.436333 2998.0 0.309 mg/100 g Spot croaker Type 1 specific Leiostomus xanthurus 59837 574.585 968.0 0.755 mg/100 g Spread Type 2 specific 442.333333 806.0 75.0 mg/100 g Squab Type 1 specific Columba 8931 0.854 0.854 0.854 mg/100 g Squashberry Type 1 specific Viburnum edule 237934 Squid Type 1 specific Teuthida 551290 503.566 812.0 0.698 mg/100 g Star anise Type 1 specific Illicium verum 124778 Star fruit Type 1 specific Averrhoa carambola 28974 101.4666 258.25 0.083 mg/100 g Steller sea lion Type 1 specific Eumetopias jubatus 34886 150.0 300.0 0.0 mg/100 g Stew Type 2 specific 262.75 330.0 156.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 20.904762 30.0 13.0 mg/100 g Strawberry guava Type 1 specific Psidium cattleianum 375274 23.172333 52.5 0.017 mg/100 g Striped bass Type 1 specific Morone saxatilis 34816 550.241 927.0 0.723 mg/100 g Striped mullet Type 1 specific Mugil cephalus 48193 600.596333 1012.0 0.789 mg/100 g Stuffing Type 2 specific 278.0 278.0 278.0 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 0.16475 0.659 0.0 mg/100 g Succotash Type 2 specific 240.0 292.0 150.0 mg/100 g Sugar Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar apple Type 1 specific Annona squamosa 301693 Sugar substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Summer grape Type 1 specific Vitis aestivalis 3605 Summer savory Type 1 specific Satureja hortensis 49987 Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 618.254167 1673.0 37.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 678.705882 2267.0 0.0 mg/100 g Sunflower oil Type 2 0.0 0.0 0.0 mg/100 g Swamp cabbage Type 1 specific Ipomoea aquatica 89636 296.75 871.0 97.0 mg/100 g Swede Type 1 specific Brassica napus 3708 27.25 37.0 0.0 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 297.52475 561.0 0.099 mg/100 g Sweet bay Type 1 specific Laurus nobilis 85223 Sweet cherry Type 1 specific Prunus avium 42229 30.0 30.0 30.0 mg/100 g Sweet custard Type 2 specific 245.4 475.0 161.0 mg/100 g Sweet marjoram Type 1 specific Origanum majorana 268884 Sweet orange Type 1 specific Citrus sinensis 2711 28.500119 122.5 0.0025 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 83.715158 212.5 0.088 mg/100 g Sweet rowanberry Type 1 specific Grataegosorbus mitschurinii Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 256.85985 385.29 0.0 mg/100 g Swordfish Type 1 specific Xiphias gladius 8245 590.936 964.0 0.808 mg/100 g Syrup Type 2 specific 83.5 232.0 0.0 mg/100 g Taco Type 2 specific 422.0 609.0 287.0 mg/100 g Taco shell Type 2 355.0 367.0 343.0 mg/100 g Tallow Type 2 specific 272.857143 800.0 0.0 mg/100 g Tamale Type 2 specific 243.0 276.0 180.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 0.0 0.0 0.0 mg/100 g Tapioca pearl Type 2 specific 2.5025 5.0 0.005 mg/100 g Taro Type 1 specific Colocasia esculenta 4460 71.7684 202.75 0.092 mg/100 g Tarragon Type 1 specific Artemisia dracunculus 72341 Tartary buckwheat Type 1 specific Fagopyrum tataricum 62330 Tea Type 1 specific Camellia sinensis 4442 0.571429 4.0 0.0 mg/100 g Tea leaf willow Type 1 specific Salix pulchra 669814 Teff Type 1 specific Eragrostis tef 110835 267.874 622.0 0.622 mg/100 g Thistle Type 1 specific Cirsium 41549 0.0 0.0 0.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 970.538462 1189.0 657.0 mg/100 g Tilefish Type 1 specific Lopholatilus chamaeleonticeps 390349 571.238 999.0 0.714 mg/100 g Tinda Type 1 specific Citrullus lanatus var. fistulosus Toffee Type 2 specific 0.0 0.0 0.0 mg/100 g Tofu Type 2 specific 548.371095 2259.0 0.0 mg/100 g Topping Type 2 specific 152.666667 301.0 60.0 mg/100 g Tortilla Type 2 specific 349.666667 432.0 275.0 mg/100 g Tortilla chip Type 2 specific 389.0 449.0 351.0 mg/100 g Tostada Type 2 specific 343.25 485.0 221.0 mg/100 g Tostada shell Type 2 Towel gourd Type 1 specific Luffa aegyptiaca 3670 Trail mix Type 2 specific 564.2 656.0 209.0 mg/100 g Tree fern Type 1 specific Cyathea Triticale Type 1 specific X Triticosecale rimpaui 397.531 599.0 0.593 mg/100 g Tronchuda cabbage Type 1 specific Brassica oleracea var. costata 416546 True frog Type 1 specific Ranidae 8397 0.0 0.0 0.0 mg/100 g True oyster Type 1 specific Ostreidae 6563 400.0 400.0 400.0 mg/100 g True seal Type 1 specific Phocidae 9709 0.0 0.0 0.0 mg/100 g True sole Type 1 specific Soleidae 30948 465.2895 930.0 0.579 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 571.131 840.0 0.655 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 396.6495 840.0 0.0 mg/100 g Turmeric Type 1 specific Curcuma longa 136217 0.28 0.28 0.28 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 57.109 137.0 0.029 mg/100 g Ucuhuba Type 1 specific Virola surinamensis 224910 0.0 0.0 0.0 mg/100 g Unclassified food or beverage Type 2 specific 345.0 1380.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 21.666667 51.0 0.0 mg/100 g Vanilla Type 1 specific Vanilla 51238 Vegetable juice Type 2 specific 0.0 0.0 0.0 mg/100 g Vegetarian food Type 2 specific 1228.75 2235.0 626.0 mg/100 g Velvet duck Type 1 specific Melanitta fusca 371864 Vermouth Type 2 specific 0.0 0.0 0.0 mg/100 g Vinegar Type 2 specific 0.0 0.0 0.0 mg/100 g Vodka Type 2 specific 0.0 0.0 0.0 mg/100 g Waffle Type 2 specific 372.6 447.0 324.0 mg/100 g Wakame Type 1 specific Undaria pinnatifida 74381 39.039 78.0 0.078 mg/100 g Walleye Type 1 specific Sander vitreus 283036 891.0 1001.0 781.0 mg/100 g Walnut Type 1 specific Juglans 16718 178.245 890.0 0.0 mg/100 g Wampee Type 1 Clausena lansium Wasabi Type 1 specific Wasabia japonica 75806 Water Type 2 specific 0.0 0.0 0.0 mg/100 g Water spinach Type 1 Ipomoea aquatica 0.104 0.104 0.104 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 155.612 630.0 0.06 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 446.073714 1508.0 0.016 mg/100 g Wax apple Type 1 specific Eugenia javanica 119950 Wax gourd Type 1 specific Benincasa hispida 102211 Welsh onion Type 1 specific Allium fistulosum 35875 43.043 86.0 0.086 mg/100 g Wheat Type 1 specific Triticum 4564 613.46091 1600.0 0.0 mg/100 g Wheat bread Type 2 specific 346.686275 550.0 0.0 mg/100 g Whelk Type 1 specific Buccinidae 37796 1110.37 2220.0 1.11 mg/100 g Whey Type 2 specific 428.1 850.0 35.0 mg/100 g Whisky Type 2 specific 0.0 0.0 0.0 mg/100 g White bread Type 1 437.176471 664.0 0.0 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 128.93 510.15 51.0 mg/100 g White lupine Type 1 specific Lupinus albus 3870 1364.25 1978.0 805.0 mg/100 g White mulberry Type 1 Morus alba White mustard Type 1 specific Sinapis alba 3728 696.283333 1118.85 211.0 mg/100 g White sucker Type 1 specific Catostomus commersonii 7971 520.561333 877.0 0.684 mg/100 g White wine Type 2 12.025 13.6 8.1 mg/100 g Whitefish Type 1 specific Coregonus 27772 893.397 2340.0 0.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 426.43675 958.0 0.0 mg/100 g Wild boar Type 1 specific Sus scrofa 9823 0.884 0.884 0.884 mg/100 g Wild carrot Type 1 specific Daucus carota 4039 80.37675 160.75 0.0035 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 46.752857 215.25 0.02 mg/100 g Wild leek Type 1 specific Allium ampeloprasum 4681 225.6184 936.0 0.092 mg/100 g Wild rice Type 1 specific Zizania 15949 329.926 778.0 0.778 mg/100 g Winged bean Type 1 specific Psophocarpus tetragonolobus 3891 616.190714 1291.2 1.235 mg/100 g Winter savory Type 1 specific Satureja montana 49988 Winter squash Type 1 specific Cucurbita maxima 3661 43.730091 78.0 0.031 mg/100 g Wonton wrapper Type 2 specific 483.0 483.0 483.0 mg/100 g Yali pear Type 1 specific Pyrus × bretschneideri Yam Type 1 specific Dioscorea 4672 66.846833 81.0 0.081 mg/100 g Yardlong bean Type 1 specific Vigna unguiculata ssp. sesquipedalis 138955 682.666667 1218.0 415.0 mg/100 g Yau choy Type 1 Yautia Type 1 specific Xanthosoma sagittifolium 28478 Yellow bell pepper Type 1 specific Capsicum annuum 4072 120.7825 248.9 38.0 mg/100 g Yellow pond-lily Type 1 specific Nuphar lutea 77113 Yellow wax bean Type 1 specific Phaseolus vulgaris 3885 219.346667 1197.0 43.0 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 74.119867 403.75 0.038 mg/100 g Yellowfin tuna Type 1 specific Thunnus albacares 8236 698.318 1140.0 0.954 mg/100 g Yellowtail amberjack Type 1 specific Seriola lalandi 302047 718.314667 1210.0 0.944 mg/100 g Ymer Type 2 specific 380.0 390.0 370.0 mg/100 g Yogurt Type 2 specific 211.647059 355.0 0.0 mg/100 g Zwieback Type 2 specific L-serine dehydratase/L-threonine deaminase P20132 SDS Phosphatidylserine synthase 1 P48651 PTDSS1 Phosphatidylserine synthase 2 Q9BVG9 PTDSS2 Serine dehydratase-like Q96GA7 SDSL Serine hydroxymethyltransferase, cytosolic P34896 SHMT1 Serine hydroxymethyltransferase, mitochondrial P34897 SHMT2 Serine palmitoyltransferase 1 O15269 SPTLC1 Serine palmitoyltransferase 2 O15270 SPTLC2 Serine palmitoyltransferase 3 Q9NUV7 SPTLC3 Serine racemase Q9GZT4 SRR Serine--tRNA ligase, cytoplasmic P49591 SARS Serine--tRNA ligase, mitochondrial Q9NP81 SARS2 cancer preventive 754 A substance that inhibits or prevents the proliferation of neoplasms.