1.0 2010-04-08 22:10:21 UTC 2019-11-26 03:07:33 UTC FDB012760 (Z,Z)-9,12-Octadecadienoic acid Constituent of most vegetable oils and animal fats. The Fe salt is the major component of metallic drier compositions used to line food cans Linoleic acid is one of two essential fatty acids that humans and other animals must ingest for good health, because the body requires them for various biological processes, but cannot synthesize them from other food components. (Z,Z)-9,12-Octadecadienoic acid is found in many foods, some of which are green bean, cloves, kumquat, and pecan nut. (9Z,12Z)-9,12-Octadecadienoate (9Z,12Z)-9,12-Octadecadienoic acid (9Z,12Z)-Octadecadienoate (9Z,12Z)-Octadecadienoic acid (Z,Z)-9,12-Octadecadienoate (Z,Z)-9,12-Octadecadienoic acid 9-(Z), 12-(Z)-Octadecadienoic acid 9-cis,12-cis-Linoleate 9-cis,12-cis-Linoleic acid 9-cis,12-cis-Octadecadienoate 9-cis,12-cis-Octadecadienoic acid 9,12-Linoleic acid 9,12-Octadecadienoic acid (Z,Z)- 9Z,12Z-Linoleate 9Z,12Z-Linoleic acid 9Z,12Z-Octadecadienoate 9Z,12Z-Octadecadienoic acid Acide cis-linoleique Acide linoleique Acido linoleico all-cis-9,12-Octadecadienoate all-cis-9,12-Octadecadienoic acid C18:2 9c, 12c Omega6 todos cis-9,12-octadienoico C18:2, N-6,9 all-cis cis-9-cis-12-Octadecadienoic acid cis-9,cis-12-Octadecadienoate cis-9,cis-12-Octadecadienoic acid cis-D9,12-Octadecadienoate cis-D9,12-Octadecadienoic acid cis-delta(9,12)-Octadecadienoate cis-Delta(9,12)-Octadecadienoic acid cis-δ(9,12)-octadecadienoate cis-δ(9,12)-octadecadienoic acid cis, cis-9,12-Octadecadienoic acid cis,cis-9,12-Octadecadienoate cis,cis-9,12-octadecadienoic acid Cis,cis-linoleate Cis,cis-linoleic acid Emersol 315 Extra linoleic 90 Leinolic acid Linolate Linoleate Linoleic acid Linolic acid Polylin 515 Telfairic acid Unifac 6550 C18H32O2 280.4455 280.240230268 (9E,12Z)-octadeca-9,12-dienoic acid 10-trans,12-cis-linoleic acid 60-33-3 [H]\C(CCCCC)=C(/[H])C\C([H])=C(/[H])CCCCCCCC(O)=O InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/b7-6-,10-9+ OYHQOLUKZRVURQ-IXWMQOLASA-N belongs to the class of organic compounds known as lineolic acids and derivatives. These are derivatives of lineolic acid. Lineolic acid is a polyunsaturated omega-6 18 carbon long fatty acid, with two CC double bonds at the 9- and 12-positions. Lineolic acids and derivatives Organic compounds Lipids and lipid-like molecules Fatty Acyls Lineolic acids and derivatives Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Long-chain fatty acids Monocarboxylic acids and derivatives Organic oxides Straight chain fatty acids Unsaturated fatty acids Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acid Hydrocarbon derivative Long-chain fatty acid Monocarboxylic acid or derivatives Octadecanoid Organic oxide Organic oxygen compound Organooxygen compound Straight chain fatty acid Unsaturated fatty acid Unsaturated fatty acids Liquid logp 7.06 ALOGPS logs -6.26 ALOGPS solubility 1.54e-04 g/l ALOGPS melting_point Mp -5° logp 6.42 ChemAxon pka_strongest_acidic 4.99 ChemAxon iupac (9E,12Z)-octadeca-9,12-dienoic acid ChemAxon average_mass 280.4455 ChemAxon mono_mass 280.240230268 ChemAxon smiles [H]\C(CCCCC)=C(/[H])C\C([H])=C(/[H])CCCCCCCC(O)=O ChemAxon formula C18H32O2 ChemAxon inchi InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/b7-6-,10-9+ ChemAxon inchikey OYHQOLUKZRVURQ-IXWMQOLASA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 88.52 ChemAxon polarizability 35.41 ChemAxon rotatable_bond_count 14 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Alpha Linolenic Acid and Linoleic Acid Metabolism SMP00018 map00592 Specdb::CMs 82291 Specdb::MsMs 1011587 Specdb::MsMs 1011588 Specdb::MsMs 1011589 Specdb::MsMs 1135364 Specdb::MsMs 1135365 Specdb::MsMs 1135366 HMDB00673 EIC #<Reference:0x000055ce324e9700> #<Reference:0x000055ce324e9520> #<Reference:0x000055ce324e9318> #<Reference:0x000055ce324e90e8> #<Reference:0x000055ce324e8ee0> #<Reference:0x000055ce324e8cd8> #<Reference:0x000055ce324e8aa8> #<Reference:0x000055ce324e88a0> #<Reference:0x000055ce324e8698> #<Reference:0x000055ce324e8468> #<Reference:0x000055ce324e8210> Adzuki bean Type 1 specific Vigna angularis 3914 0.0 0.0 0.0 mg/100 g Alaska pollock Type 1 specific Theragra chalcogramma 1042646 4.0 4.0 4.0 mg/100 g Alfalfa Type 1 specific Medicago sativa 3879 234.0 234.0 234.0 mg/100 g Allium Type 1 specific Allium 4678 49.2 100.0 0.0 mg/100 g Almond Type 1 specific Prunus dulcis 3755 10000.466667 12055.0 7210.0 mg/100 g American lobster Type 1 specific Homarus americanus 6706 33.0 33.0 33.0 mg/100 g Anatidae Type 1 specific Anatidae 8830 1459.75 4690.0 296.0 mg/100 g Anchovy Type 1 specific Engraulidae 43062 259.0 259.0 259.0 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 882.5 892.0 873.0 mg/100 g Anise Type 1 specific Pimpinella anisum 271192 Apple Type 1 specific Malus pumila 283210 170.666667 318.0 44.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 4871.9 23360.0 10.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 11.166667 67.0 0.0 mg/100 g Arepa Type 2 specific 825.0 825.0 825.0 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 223.72 632.6 50.0 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 29.0 29.0 29.0 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 36.0 36.0 36.0 mg/100 g Avocado Type 1 specific Persea americana 3435 13889.5 26489.0 1290.0 mg/100 g Baby food Type 2 specific 4330.0 4330.0 4330.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.0 0.0 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 35.0 35.0 35.0 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 1180.666667 1311.0 991.0 mg/100 g Beer Type 2 specific 0.0 0.0 0.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 0.0 0.0 0.0 mg/100 g Biscuit Type 2 specific 2032.125 4640.0 0.0 mg/100 g Bitter gourd Type 1 specific Momordica charantia 3673 1948.1 1948.1 1948.1 mg/100 g Bivalvia (Clam, Mussel, Oyster) Type 1 specific Bivalvia 6544 27.0 27.0 27.0 mg/100 g Black elderberry Type 1 specific Sambucus nigra 4202 Black salsify Type 1 specific Scorzonera hispanica 114289 0.0 0.0 0.0 mg/100 g Black tea Type 1 0.0 0.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 Black-eyed pea Type 1 specific Vigna unguiculata ssp. unguiculata 3920 Blackcurrant Type 1 specific Ribes nigrum 78511 6636.128571 45000.0 147.0 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 16.0 16.0 16.0 mg/100 g Blue whiting Type 1 specific Micromesistius poutassou 81636 0.0 0.0 0.0 mg/100 g Borage Type 1 specific Borago officinalis 13363 36000.0 36000.0 36000.0 mg/100 g Brazil nut Type 1 specific Bertholletia excelsa 3645 24663.125 26600.0 22726.25 mg/100 g Breadfruit Type 1 specific Artocarpus altilis 194251 3763.25 3763.25 3763.25 mg/100 g Breakfast cereal Type 2 specific 709.407407 2832.0 0.0 mg/100 g Broad bean Type 1 specific Vicia faba 3906 375.75 375.75 375.75 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 19.666667 58.0 0.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 94.03 183.15 71.0 mg/100 g Burbot Type 1 specific Lota lota 69944 0.0 0.0 0.0 mg/100 g Burdock Type 1 specific Arctium lappa 4217 11385.0 11385.0 11385.0 mg/100 g Burrito Type 2 specific 2093.333333 2628.0 1826.0 mg/100 g Butter Type 2 specific 1870.5 2166.0 1400.0 mg/100 g Buttermilk Type 2 specific 10.0 10.0 10.0 mg/100 g Butternut Type 1 specific Juglans cinerea 91214 34309.7 34309.7 34309.7 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 251.5 251.5 251.5 mg/100 g Cake Type 2 specific 3852.0 3999.0 3639.0 mg/100 g Calabash Type 1 specific Lagenaria siceraria 3668 15670.125 31212.5 127.75 mg/100 g Canola Type 2 specific 138011 15163.5 18640.0 8781.0 mg/100 g Capers Type 1 specific Capparis spinosa 65558 140.75 140.75 140.75 mg/100 g Caraway Type 1 specific Carum carvi 48032 3350.7 3350.7 3350.7 mg/100 g Cardamom Type 1 specific Elettaria cardamomum 105181 876.75 876.75 876.75 mg/100 g Carob Type 1 specific Ceratonia siliqua 20340 Carp bream Type 1 specific Abramis brama 38527 76.0 76.0 76.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 477.34375 2638.0 69.0 mg/100 g Casein Type 2 specific 46.0 46.0 46.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 8095.416667 8900.0 7660.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 62.0 92.0 32.0 mg/100 g Catfish Type 1 specific Siluriformes 7995 3298.5 6532.0 65.0 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 370.726761 857.0 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 24.4 30.0 6.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 159.0 159.0 159.0 mg/100 g Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 158.0 158.0 158.0 mg/100 g Celery stalks Type 1 specific Apium graveolens var. dulce 117781 Cetacea (Dolphin, Porpoise, Whale) Type 1 specific Cetacea 9721 0.0 0.0 0.0 mg/100 g Channel catfish Type 1 specific Ictalurus punctatus 7998 755.0 755.0 755.0 mg/100 g Chanterelle Type 1 specific Cantharellus cibarius 36066 0.0 0.0 0.0 mg/100 g Charr Type 1 specific Salvelinus 8033 0.0 0.0 0.0 mg/100 g Chayote Type 1 specific Sechium edule 184140 0.0 0.0 0.0 mg/100 g Cheese Type 2 specific 491.738462 917.0 8.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 2035.125 7830.0 0.0 mg/100 g Chervil Type 1 specific Anthriscus cerefolium 40888 2379.333333 6890.0 124.0 mg/100 g Chestnut Type 1 specific Castanea 21019 866.0 866.0 866.0 mg/100 g Chia Type 1 specific Salvia hispanica 49212 5835.0 5835.0 5835.0 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 1381.0 2762.0 0.0 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 196.725 395.9 72.0 mg/100 g Chili Type 2 specific 240.5 248.0 233.0 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 15.0 15.0 15.0 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 808.75 1498.5 119.0 mg/100 g Chocolate Type 2 specific 1056.0 1510.0 513.0 mg/100 g Chocolate spread Type 2 specific 0.0 0.0 0.0 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 68.0 68.0 68.0 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 42.666667 45.0 40.0 mg/100 g Cloves Type 1 specific Syzygium aromaticum 219868 2681.0 2681.0 2681.0 mg/100 g Clupeinae (Herring, Sardine, Sprat) Type 1 specific Clupeinae 7948 1208.833333 4580.0 0.0 mg/100 g Cocoa bean Type 1 specific Theobroma cacao 3641 1146.5 1146.5 1146.5 mg/100 g Cocoa butter Type 2 specific 2800.0 2800.0 2800.0 mg/100 g Cocoa powder Type 2 specific 281.333333 628.0 102.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 1081.433333 1800.0 0.0 mg/100 g Coffee Type 1 generic Coffea 13442 11.166667 67.0 0.0 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 89.0 89.0 89.0 mg/100 g Cold cut Type 2 specific 54.0 54.0 54.0 mg/100 g Colorado pinyon Type 1 specific Pinus edulis 3340 25662.0 25662.0 25662.0 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 361.6875 3718.0 0.0 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 743.966667 1020.0 501.9 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 57.0 75.0 31.0 mg/100 g Common dab Type 1 specific Limanda limanda 27771 0.0 0.0 0.0 mg/100 g Common grape Type 1 specific Vitis vinifera 29760 3774.675 7150.0 399.35 mg/100 g Common hazelnut Type 1 specific Corylus avellana 13451 1667.5 1667.5 1667.5 mg/100 g Common ling Type 1 specific Molva molva 163112 0.0 0.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 154.166667 318.0 33.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 0.0 0.0 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 109.05 109.05 109.05 mg/100 g Common pea Type 1 specific Pisum sativum 3888 473.816667 948.0 320.0 mg/100 g Common sage Type 1 specific Salvia officinalis 38868 7300.0 7300.0 7300.0 mg/100 g Common thyme Type 1 specific Thymus vulgaris 49992 520.0 520.0 520.0 mg/100 g Common walnut Type 1 specific Juglans regia 51240 38038.0 38038.0 38038.0 mg/100 g Common wheat Type 1 specific Triticum aestivum 4565 Cooking oil Type 2 specific 36337.6 56601.0 6619.0 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 976.125 1760.0 40.0 mg/100 g Corn Type 1 specific Zea mays 4577 9972.3625 55200.0 0.0 mg/100 g Corn chip Type 2 specific 13598.0 13598.0 13598.0 mg/100 g Cottonseed Type 1 specific Gossypium 3633 20209.133333 51500.0 287.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 1% fat Type 2 specific 27.0 27.0 27.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 2% fat Type 2 specific 55.0 55.0 55.0 mg/100 g Crab Type 1 specific Brachyura 6752 75.333333 132.0 47.0 mg/100 g Cracker Type 2 specific 5380.769231 11480.0 876.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 7.0 7.0 7.0 mg/100 g Cream Type 2 specific 371.888889 798.0 187.0 mg/100 g Crisp bread Type 2 specific 1527.0 2820.0 955.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 4783.8625 26090.0 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 6023.25 20667.0 18.0 mg/100 g Curry powder Type 2 specific 0.0 0.0 0.0 mg/100 g Custard apple Type 1 specific Annona reticulata 301862 Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 14.0 16.0 12.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 0.0 0.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 375.0 750.0 0.0 mg/100 g Dill Type 1 specific Anethum graveolens 40922 358.95 999.85 0.0 mg/100 g Domestic pig Type 1 specific Sus scrofa domestica 9825 1215.394052 11700.0 0.0 mg/100 g Dried milk Type 2 specific 286.5 557.0 16.0 mg/100 g Dulce de leche Type 2 specific 131.0 131.0 131.0 mg/100 g Eastern oyster Type 1 specific Crassostrea virginica 6565 61.0 61.0 61.0 mg/100 g Egg roll Type 2 specific 4871.0 4871.0 4871.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 117.175 234.35 0.0 mg/100 g Eggs Unknown generic 1837.785714 6400.0 0.0 mg/100 g Elderberry Type 1 specific Sambucus 4201 171.666667 179.0 157.0 mg/100 g Empanada Type 2 specific 3665.0 3665.0 3665.0 mg/100 g Endive Type 1 specific Cichorium endivia 114280 263.783333 641.35 75.0 mg/100 g European plum Type 1 specific Prunus domestica 3758 1933.675 6888.0 110.0 mg/100 g Evening primrose Type 1 specific Oenothera biennis 3942 17464.9 17464.9 17464.9 mg/100 g Fats and oils Unknown generic Feijoa Type 1 specific Feijoa sellowiana 260130 153.0 153.0 153.0 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 1105.65 1690.0 0.0 mg/100 g Fenugreek Type 1 specific Trigonella foenum-graecum 78534 Fig Type 1 specific Ficus carica 3494 2217.73 9450.0 112.0 mg/100 g Fish oil Type 1 863.0 863.0 863.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 21.5 43.0 0.0 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 10687.0 15679.0 4310.0 mg/100 g French plantain Type 1 specific Musa X paradisiaca 89151 1416.333333 2278.0 0.0 mg/100 g Fruit gum Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit juice Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit preserve Type 2 specific 0.0 0.0 0.0 mg/100 g Fudge Type 2 specific 203.5 211.0 196.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.0 0.0 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 589.142857 4250.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 433.0 793.0 73.0 mg/100 g Garden onion Type 1 specific Allium cepa 4679 Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 121.0 121.0 121.0 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 313.375 1290.0 22.0 mg/100 g Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 727.5 727.5 727.5 mg/100 g Garfish Type 1 specific Belone belone 129037 72.0 72.0 72.0 mg/100 g Garlic Type 1 specific Allium sativum 4682 299.0 368.0 230.0 mg/100 g Gelatin Type 2 specific 2.0 2.0 2.0 mg/100 g Gelatin dessert Type 2 specific 0.0 0.0 0.0 mg/100 g German camomile Type 1 specific Matricaria recutita 127986 Gin Type 2 specific 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 373.0 621.0 125.0 mg/100 g Ginkgo nuts Type 1 specific Ginkgo biloba 3311 Globe artichoke Type 1 specific Cynara scolymus 59895 0.0 0.0 0.0 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 713.275 1252.55 174.0 mg/100 g Gram bean Type 1 specific Vigna mungo 3915 277.1 277.1 277.1 mg/100 g Grape Type 1 specific Vitis 3603 16877.75 67200.0 17.0 mg/100 g Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 57.5 86.0 29.0 mg/100 g Green bean Type 1 specific Phaseolus vulgaris 3885 60.333333 65.0 51.0 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 602.35 1603.05 96.0 mg/100 g Green tea Type 1 0.0 0.0 0.0 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 93.125 277.5 29.0 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 195.333333 211.0 166.0 mg/100 g Groundcherry Type 1 specific Physalis 24663 0.0 0.0 0.0 mg/100 g Guava Type 1 specific Psidium guajava 120290 762.733333 1390.0 152.0 mg/100 g Haddock Type 1 specific Melanogrammus aeglefinus 8056 1003.5 4000.0 0.0 mg/100 g Hamburger Type 2 specific 1599.416667 2757.0 943.0 mg/100 g Hazelnut Type 1 specific Corylus 13450 5120.0 5120.0 5120.0 mg/100 g Herbal tea Type 1 0.0 0.0 0.0 mg/100 g Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 19.0 19.0 19.0 mg/100 g Honey Type 2 specific 0.0 0.0 0.0 mg/100 g Horchata Type 2 specific 1991.0 1991.0 1991.0 mg/100 g Horseradish Type 1 specific Armoracia rusticana 3704 118.0 118.0 118.0 mg/100 g Hot chocolate Type 2 specific 22.75 36.0 10.0 mg/100 g Hushpuppy Type 2 specific 1451.0 1451.0 1451.0 mg/100 g Hyacinth bean Type 1 specific Lablab purpureus 35936 4.6 4.6 4.6 mg/100 g Ice cream Type 2 specific 99.0 150.0 0.0 mg/100 g Icing Type 2 specific 176.0 176.0 176.0 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 144.0 144.0 144.0 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 15.0 15.0 15.0 mg/100 g Japanese pumpkin Type 1 specific Cucurbita maxima 3661 14955.25 20667.0 36.0 mg/100 g Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 256.0 256.0 256.0 mg/100 g Jicama Type 1 specific Pachyrhizus erosus 109171 Jute Type 1 specific Corchorus olitorius 93759 4345.5 8156.25 534.75 mg/100 g Kale Type 1 specific Brassica napus var. pabularia 151.333333 197.0 103.0 mg/100 g Kefir Type 2 specific 75.0 75.0 75.0 mg/100 g Ketchup Type 2 specific 540.0 1080.0 0.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 0.0 0.0 0.0 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 71.05 121.1 21.0 mg/100 g Kombu Type 1 specific Saccharina japonica 88149 0.0 0.0 0.0 mg/100 g Kumquat Type 1 specific Fortunella 2706 305.0 305.0 305.0 mg/100 g Lake trout Type 1 specific Salvelinus namaycush 8040 0.0 0.0 0.0 mg/100 g Lard Type 2 specific 8220.0 8220.0 8220.0 mg/100 g Leavening agent Type 2 specific 1.25 5.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 159.0 159.0 159.0 mg/100 g Lemon Type 1 specific Citrus limon 2708 117.25 385.0 0.0 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 5.0 5.0 5.0 mg/100 g Lentils Type 1 generic Lens culinaris 3864 241.8125 392.25 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 115.23 415.15 15.0 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.0 0.0 0.0 mg/100 g Lima bean Type 1 specific Phaseolus lunatus 3884 582.95 582.95 582.95 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 105.5 171.0 40.0 mg/100 g Linden Type 1 specific Tilia 64580 Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 200.5 344.0 57.0 mg/100 g Liquor Type 2 specific 76.571429 381.0 0.0 mg/100 g Liquorice Type 2 specific 0.0 0.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 0.0 0.0 0.0 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 78.0 78.0 78.0 mg/100 g Lumpsucker Type 1 specific Cyclopteridae 8101 382.5 542.0 223.0 mg/100 g Macadamia nut Type 1 specific Macadamia 4329 1271.75 1271.75 1271.75 mg/100 g Macaroni and cheese Type 2 specific 1122.833333 1569.0 884.0 mg/100 g Malus (Crab apple) Type 1 specific Malus 3749 104.0 104.0 104.0 mg/100 g Mamey sapote Type 1 specific Pouteria sapota 233744 11.0 11.0 11.0 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 79.1 122.3 43.0 mg/100 g Mango Type 1 specific Mangifera indica 29780 35.625 45.25 26.0 mg/100 g Margarine Type 2 specific 19193.470588 41000.0 5759.0 mg/100 g Margarine-like spread Type 2 specific 13508.4375 23423.0 376.0 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 23.666667 37.0 0.0 mg/100 g Marzipan Type 2 specific 4810.0 4810.0 4810.0 mg/100 g Meat bouillon Type 2 specific 73.2 272.0 0.0 mg/100 g Meatball Type 2 specific 0.0 0.0 0.0 mg/100 g Meringue Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Cow) Type 2 specific 2871.271171 28882.617 0.0 mg/100 g Milk (Human) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Other mammals) Type 2 specific 119.0 119.0 119.0 mg/100 g Milkshake Type 2 specific 255.0 255.0 255.0 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 849.666667 2549.0 0.0 mg/100 g Miso Type 2 specific 0.0 0.0 0.0 mg/100 g Mixed nuts Type 2 specific 14455.0 14455.0 14455.0 mg/100 g Morchella (Morel) Type 1 specific Morchellaceae 5192 215.0 215.0 215.0 mg/100 g Moth bean Type 1 specific Vigna aconitifolia 3918 511.0 511.0 511.0 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 649.0 649.0 649.0 mg/100 g Mountain yam Type 1 specific Dioscorea pentaphylla 167592 121.5 121.5 121.5 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 269.4 423.0 46.0 mg/100 g Muskmelon Type 1 specific Cucumis melo 3656 11299.92 39140.0 19.0 mg/100 g Mustard Type 2 specific 0.0 0.0 0.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 0.0 0.0 0.0 mg/100 g New Zealand spinach Type 1 specific Tetragonia tetragonioides 45318 114.75 114.75 114.75 mg/100 g Northern pike Type 1 specific Esox lucius 8010 33.0 33.0 33.0 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Norway lobster Type 1 specific Nephrops norvegicus 6829 40.0 40.0 40.0 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.0 0.0 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 150.0 300.0 0.0 mg/100 g Nutritional drink Type 2 specific 130.0 130.0 130.0 mg/100 g Oat Type 1 specific Avena sativa 4498 2560.0 2600.0 2480.0 mg/100 g Oil palm Type 1 specific Elaeis 51952 1852.25 9100.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 26.0 26.0 26.0 mg/100 g Olive Type 1 specific Olea europaea 4146 3783.75 8200.0 1230.0 mg/100 g Opium poppy Type 1 specific Papaver somniferum 3469 30490.0 30490.0 30490.0 mg/100 g Orange bell pepper Type 1 specific Capsicum annuum 4072 1603.05 1603.05 1603.05 mg/100 g Other animal fat Type 2 specific 8595.0 9800.0 7390.0 mg/100 g Other bread Type 2 specific 2316.083333 8074.0 0.0 mg/100 g Other bread product Type 2 specific 853.5 903.0 804.0 mg/100 g Other candy Type 2 specific 374.5 967.0 0.0 mg/100 g Other dish Type 2 specific 2179.333333 6470.0 0.0 mg/100 g Other fermented milk Type 2 specific 74.0 75.0 73.0 mg/100 g Other fish product Type 2 specific 467.5 863.0 72.0 mg/100 g Other fruit product Type 2 specific 943.0 943.0 943.0 mg/100 g Other pasta dish Type 2 specific 152.0 152.0 152.0 mg/100 g Other sandwich Type 2 specific 2197.0 2705.0 1650.0 mg/100 g Other snack food Type 2 specific 4541.666667 11480.0 1971.0 mg/100 g Other soy product Type 2 specific 1789.0 1789.0 1789.0 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 15.0 15.0 15.0 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 11.0 11.0 11.0 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 22.0 22.0 22.0 mg/100 g Painted comber Type 1 specific Serranus scriba 349661 27.0 27.0 27.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 39.0 39.0 39.0 mg/100 g Pan dulce Type 2 specific 1210.0 1210.0 1210.0 mg/100 g Pancake Type 2 specific 1754.5 2638.0 871.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 166.1875 538.9 13.0 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 601.666667 1248.0 273.0 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 1342.166667 3633.0 120.5 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 6888.5 13777.0 0.0 mg/100 g Pasta Type 2 specific 4224.75 14776.0 166.0 mg/100 g Pastry Type 2 specific 2961.368421 4690.0 341.0 mg/100 g Pate Type 2 specific 2400.0 2400.0 2400.0 mg/100 g Peach Type 1 specific Prunus persica 3760 209.8125 405.0 78.0 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 15863.392857 31700.0 3817.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 170.566667 333.7 75.0 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 20700.0 22300.0 19400.0 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 271.38125 1603.05 0.0 mg/100 g Pepper (C. frutescens) Type 1 specific Capsicum annuum var. annuum 40321 476.3 476.3 476.3 mg/100 g Pepper (Spice) Type 1 specific Piper nigrum 13216 698.75 1397.5 0.0 mg/100 g Peppermint Type 1 specific Mentha X piperita 34256 Perciformes Type 1 specific Perciformes 8111 33.0 33.0 33.0 mg/100 g Persimmon Type 1 specific Diospyros 13492 0.0 0.0 0.0 mg/100 g Pigeon pea Type 1 specific Cajanus cajan 3821 1612.6 1612.6 1612.6 mg/100 g Pikeperch Type 1 specific Sander lucioperca 283035 0.0 0.0 0.0 mg/100 g Piki bread Type 2 specific 1159.0 1565.0 753.0 mg/100 g Pine nut Type 1 specific Pinus 3337 36000.0 36000.0 36000.0 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 94.275 353.1 0.0 mg/100 g Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 67.5 77.0 57.0 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 11918.333333 13600.0 9055.0 mg/100 g Pizza Type 2 specific 1988.421053 3784.0 0.0 mg/100 g Pleuronectidae (Dab, Halibut, Plaice) Type 1 specific Pleuronectidae 8256 110.0 330.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.0 0.0 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.0 0.0 0.0 mg/100 g Popcorn Type 2 specific 1855.5 2093.0 1618.0 mg/100 g Poppy Type 1 specific Papaver 3468 30500.0 30500.0 30500.0 mg/100 g Port wine Type 2 specific 0.0 0.0 0.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 2294.458333 6550.0 0.0 mg/100 g Potato chip Type 2 specific 12638.0 13290.0 11986.0 mg/100 g Prickly pear Type 1 specific Opuntia 106975 0.0 0.0 0.0 mg/100 g Processed cheese Type 2 specific 3076.857143 6499.0 560.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 50.75 68.0 15.0 mg/100 g Pupusa Type 2 specific 1899.0 2488.0 1259.0 mg/100 g Purslane Type 1 specific Portulaca oleracea 46147 3858.025 6768.6 947.45 mg/100 g Quesadilla Type 2 specific 3427.0 3427.0 3427.0 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 36.0 36.0 36.0 mg/100 g Rabbit Type 1 specific Leporidae 9979 792.0 792.0 792.0 mg/100 g Radish Type 1 specific Raphanus sativus 3726 85.0 163.0 7.0 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 360.5 466.0 255.0 mg/100 g Rape Type 1 specific Brassica napus var. napus 138011 21150.0 22100.0 20200.0 mg/100 g Ravioli Type 2 specific 256.5 338.0 175.0 mg/100 g Red algae Type 1 specific Rhodophyta 2763 0.0 0.0 0.0 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra 123.6 204.4 59.0 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 618.35 1603.05 108.0 mg/100 g Red raspberry Type 1 specific Rubus idaeus 32247 Red tea Type 1 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 163.52 398.0 24.0 mg/100 g Remoulade Type 2 specific 7600.0 8840.0 6360.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 449.625 982.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 11.166667 67.0 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 325.0 325.0 325.0 mg/100 g Rocket salad (ssp.) Type 1 specific Eruca vesicaria ssp. sativa 29727 Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 47.0 47.0 47.0 mg/100 g Rose hip Type 1 specific Rosa 3764 0.0 0.0 0.0 mg/100 g Roselle Type 1 specific Hibiscus sabdariffa 183260 Rosemary Type 1 specific Rosmarinus officinalis 39367 Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 208.857143 473.0 0.0 mg/100 g Rum Type 2 specific 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 942.5 1017.0 733.0 mg/100 g Rye bread Type 2 specific 1181.117647 2790.0 0.0 mg/100 g Sacred lotus Type 1 specific Nelumbo nucifera 4432 307.4 574.3 40.5 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 32948.425 74500.0 12724.0 mg/100 g Saffron Type 1 specific Crocus sativus 82528 Salad Type 2 specific 4812.25 5686.0 4277.0 mg/100 g Salad dressing Type 2 specific 14187.571429 37404.0 0.0 mg/100 g Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 290.833333 650.0 107.0 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Sauce Type 2 specific 3538.545455 24752.0 0.0 mg/100 g Sausage Type 2 specific 2408.0 4225.0 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 20.0 20.0 20.0 mg/100 g Scallop Type 1 specific Pectinidae 6566 7.0 7.0 7.0 mg/100 g Scombridae (Bonito, Mackerel, Tuna) Type 1 specific Scombridae 8224 462.5 803.0 258.0 mg/100 g Sea-buckthornberry Type 1 specific Hippophae rhamnoides 193516 754.375 1298.75 210.0 mg/100 g Semolina Type 2 specific 570.0 570.0 570.0 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 26205.5 41300.0 20122.0 mg/100 g Shea tree Type 1 specific Vitellaria paradoxa 292385 Sherry Type 2 specific 0.0 0.0 0.0 mg/100 g Shiitake Type 1 specific Lentinus edodes 5353 Shortening Type 2 specific 22259.5 32239.0 2667.0 mg/100 g Shrimp Type 1 specific Caridea 6694 4044.6 9170.0 0.0 mg/100 g Snack bar Type 2 specific 1367.333333 2575.0 561.0 mg/100 g Snail Type 1 specific Gastropoda 6448 0.0 0.0 0.0 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 199.75 471.0 93.0 mg/100 g Soft drink Type 2 specific 0.0 0.0 0.0 mg/100 g Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 Sorghum Type 1 specific Sorghum bicolor 4558 1295.0 1295.0 1295.0 mg/100 g Sorrel Type 1 specific Rumex acetosa 41241 0.0 0.0 0.0 mg/100 g Soup Type 2 specific 305.0 624.0 65.0 mg/100 g Sour cherry Type 1 specific Prunus cerasus 140311 7514.3 14840.0 188.6 mg/100 g Soy bean Type 1 specific Glycine max 3847 25170.553125 55680.0 0.0 mg/100 g Soy milk Type 2 specific 0.0 0.0 0.0 mg/100 g Soy sauce Type 2 specific 18.0 18.0 18.0 mg/100 g Spearmint Type 1 specific Mentha spicata 29719 Spinach Type 1 specific Spinacia oleracea 3562 84.283333 135.85 55.0 mg/100 g Spiny dogfish Type 1 specific Squalus acanthias 7797 0.0 0.0 0.0 mg/100 g Spirit Type 2 specific 0.0 0.0 0.0 mg/100 g Star fruit Type 1 specific Averrhoa carambola 28974 0.0 0.0 0.0 mg/100 g Stew Type 2 specific 86.0 86.0 86.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 112.5 182.0 30.0 mg/100 g Strawberry guava Type 1 specific Psidium cattleianum 375274 561.5 561.5 561.5 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 98.5 197.0 0.0 mg/100 g Sugar Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Summer savory Type 1 specific Satureja hortensis 49987 7560.0 7560.0 7560.0 mg/100 g Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 12019.7 20667.0 36.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 28643.625 63000.0 9723.0 mg/100 g Swede Type 1 specific Brassica napus 3708 18.0 18.0 18.0 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 Sweet bay Type 1 specific Laurus nobilis 85223 Sweet marjoram Type 1 specific Origanum majorana 268884 1000.0 1000.0 1000.0 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 70.9875 168.0 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 167.425 259.85 75.0 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 0.0 0.0 0.0 mg/100 g Swordfish Type 1 specific Xiphias gladius 8245 46.0 46.0 46.0 mg/100 g Syrup Type 2 specific 49.5 99.0 0.0 mg/100 g Taco Type 2 specific 1774.666667 2708.0 1273.0 mg/100 g Tallow Type 2 specific 2950.0 2950.0 2950.0 mg/100 g Tamale Type 2 specific 1363.333333 1817.0 904.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 1077.766667 3108.8 52.0 mg/100 g Taro Type 1 specific Colocasia esculenta 4460 490.5 853.25 127.75 mg/100 g Tea Type 1 specific Camellia sinensis 4442 0.0 0.0 0.0 mg/100 g Thistle Type 1 specific Cirsium 41549 74500.0 74500.0 74500.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 1927.5 5040.0 0.0 mg/100 g Toffee Type 2 specific 0.0 0.0 0.0 mg/100 g Tofu Type 2 specific 0.0 0.0 0.0 mg/100 g Tortilla Type 2 specific 662.0 662.0 662.0 mg/100 g Tortilla chip Type 2 specific 9806.5 10890.0 8723.0 mg/100 g Towel gourd Type 1 specific Luffa aegyptiaca 3670 8094.25 15275.0 913.5 mg/100 g True frog Type 1 specific Ranidae 8397 0.0 0.0 0.0 mg/100 g True oyster Type 1 specific Ostreidae 6563 21.0 21.0 21.0 mg/100 g True sole Type 1 specific Soleidae 30948 4.0 4.0 4.0 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 0.0 0.0 0.0 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 0.0 0.0 0.0 mg/100 g Ucuhuba Type 1 specific Virola surinamensis 224910 3264.0 3264.0 3264.0 mg/100 g Unclassified food or beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 0.0 0.0 0.0 mg/100 g Vegetable juice Type 2 specific 196.0 196.0 196.0 mg/100 g Vermouth Type 2 specific 0.0 0.0 0.0 mg/100 g Vinegar Type 2 specific 0.0 0.0 0.0 mg/100 g Vodka Type 2 specific 0.0 0.0 0.0 mg/100 g Walnut Type 1 specific Juglans 16718 44650.0 52900.0 36400.0 mg/100 g Water Type 2 specific 0.0 0.0 0.0 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 0.0 0.0 0.0 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 6563.5 13114.0 13.0 mg/100 g Wax gourd Type 1 specific Benincasa hispida 102211 1158.75 1158.75 1158.75 mg/100 g Wheat Type 1 specific Triticum 4564 6484.888889 46900.0 625.0 mg/100 g Wheat bread Type 2 specific 992.863636 1900.0 480.0 mg/100 g Whey Type 2 specific 199.0 561.0 9.0 mg/100 g Whisky Type 2 specific 0.0 0.0 0.0 mg/100 g White bread Type 1 4603.5 8074.0 2260.0 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 141.25 251.5 31.0 mg/100 g White lupine Type 1 specific Lupinus albus 3870 2111.25 2111.25 2111.25 mg/100 g White mustard Type 1 specific Sinapis alba 3728 1559.3 2683.6 435.0 mg/100 g Whitefish Type 1 specific Coregonus 27772 90.0 90.0 90.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 0.0 0.0 0.0 mg/100 g Wild carrot Type 1 specific Daucus carota 4039 1472.875 2638.0 307.75 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 1112.9875 3645.1 59.6 mg/100 g Wild leek Type 1 specific Allium ampeloprasum 4681 Winged bean Type 1 specific Psophocarpus tetragonolobus 3891 1018.183333 2301.05 256.1 mg/100 g Winter squash Type 1 specific Cucurbita maxima 3661 15175.0 15175.0 15175.0 mg/100 g Yam Type 1 specific Dioscorea 4672 63.0 63.0 63.0 mg/100 g Yardlong bean Type 1 specific Vigna unguiculata ssp. sesquipedalis 138955 382.625 443.05 322.2 mg/100 g Yellow bell pepper Type 1 specific Capsicum annuum 4072 855.525 1603.05 108.0 mg/100 g Yellow pond-lily Type 1 specific Nuphar lutea 77113 91.0 139.0 43.0 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 93.125 277.5 29.0 mg/100 g Yellowfin tuna Type 1 specific Thunnus albacares 8236 6.0 6.0 6.0 mg/100 g Ymer Type 2 specific 70.5 104.0 37.0 mg/100 g Yogurt Type 2 specific 74.2 160.0 33.0 mg/100 g faint fatty Acyl-coenzyme A thioesterase 1 Q86TX2 ACOT1 Acyl-coenzyme A thioesterase 2, mitochondrial P49753 ACOT2 Acyl-coenzyme A thioesterase 4 Q8N9L9 ACOT4 Acyl-coenzyme A thioesterase 8 O14734 ACOT8 Bile acid-CoA:amino acid N-acyltransferase Q14032 BAAT Cytochrome P450 2D6 Q6NWU0 CYP2D6 Cytochrome P450, family 1, subfamily A, polypeptide 1 A0N0X8 CYP1A1 Cytosolic acyl coenzyme A thioester hydrolase O00154 ACOT7 5-alpha-reductase inhibitor 7 An EC 1.3.1.* (oxidoreductase acting on CH-CH group of donor, NAD(+) or NADP(+) as acceptor) inhibitor that interferes with the action of of 3-oxo-5alpha-steroid 4-dehydrogenase (NADP(+)), EC 1.3.1.22, the enzyme which converts testosterone (CHEBI:17347) into the more potent androgen 5alpha-dihydrotestosterone. Anti coronary 207 Any substance introduced into a living organism with therapeutic or diagnostic purpose. Anti eczemic 247 Any substance introduced into a living organism with therapeutic or diagnostic purpose. Anti fibrinolytic 277 Anti histaminic 331 Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. Anti leukotriene-D4 401 A substance that diminishes the rate of a chemical reaction. Anti monosodium-glutamate 448 Anti-acne 78 A drug used to treat or prevent skin disorders or for the routine care of skin. Anti-alopecic 104 Any substance introduced into a living organism with therapeutic or diagnostic purpose. Anti-anaphylactic 111 Any substance introduced into a living organism with therapeutic or diagnostic purpose. Anti-androgenic 112 A compound which inhibits or antagonises the biosynthesis or actions of androgens. Anti-arteriosclerotic 130 A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. Anti-arthritic 131 Any substance introduced into a living organism with therapeutic or diagnostic purpose. Anti-granular 310 Anti-inflammatory 370 A substance that reduces or suppresses inflammation. Anti-menorrhagic 430 Any substance introduced into a living organism with therapeutic or diagnostic purpose. Anti-prostatitic 553 Cancer preventive 754 A substance that inhibits or prevents the proliferation of neoplasms. Carcinogenic 762 A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. Comedolytic 828 Hepatoprotective 981 Any compound that is able to prevent damage to the liver. Hypocholesterolemic 1016 Immunomodulator 1031 Biologically active substance whose activity affects or plays a role in the functioning of the immune system. Insectifuge 1041 Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. Metastatic 1102 Nematicide 1141 A substance used to destroy pests of the phylum Nematoda (roundworms). Tyrosine kinase inhibitor 1253