1.0 2010-04-08 22:10:21 UTC 2025-11-18 23:39:25 UTC FDB012765 Petroselinic acid Found in umbelliferous seed oils e.g. major constituent of oils of parsley, ivy, fennel, celery and others [DFC]. (6Z)-6-Octadecenoate (6Z)-6-Octadecenoic acid (6Z)-Octadec-6-enoate (6Z)-Octadec-6-enoic acid (6Z)-Octadecenoate (6Z)-Octadecenoic acid (6Z)-Petroselinate (6Z)-Petroselinic acid (Z)-6-Octadecenoate (Z)-6-Octadecenoic acid 6-Octadecenoic acid, (Z)- 6Z-Octadecenoate 6Z-Octadecenoic acid cis-6-Octadecenoate cis-6-Octadecenoic acid cis-Delta(6)-Octadecenoate cis-delta(6)-Octadecenoic acid cis-Octadec-6-enoate cis-Octadec-6-enoic acid cis-Omega-12-octadecenoate cis-Omega-12-octadecenoic acid cis-Petroselinate cis-Petroselinic acid cis-δ(6)-octadecenoate cis-δ(6)-octadecenoic acid Petroselinate Petroselinic acid C18H34O2 282.4614 282.255880332 (6Z)-octadec-6-enoic acid petroselinic acid 593-39-5 CCCCCCCCCCC\C=C/CCCCC(O)=O InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h12-13H,2-11,14-17H2,1H3,(H,19,20)/b13-12- CNVZJPUDSLNTQU-SEYXRHQNSA-N belongs to the class of organic compounds known as long-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. Long-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Straight chain fatty acids Unsaturated fatty acids Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Long-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Straight chain fatty acid Unsaturated fatty acid Monounsaturated fatty acids Unsaturated fatty acids octadec-6-enoic acid Solid logp 7.72 ALOGPS logs -6.39 ALOGPS solubility 1.15e-04 g/l ALOGPS melting_point Mp 33° logp 6.78 ChemAxon pka_strongest_acidic 4.89 ChemAxon iupac (6Z)-octadec-6-enoic acid ChemAxon average_mass 282.4614 ChemAxon mono_mass 282.255880332 ChemAxon smiles CCCCCCCCCCC\C=C/CCCCC(O)=O ChemAxon formula C18H34O2 ChemAxon inchi InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h12-13H,2-11,14-17H2,1H3,(H,19,20)/b13-12- ChemAxon inchikey CNVZJPUDSLNTQU-SEYXRHQNSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 87.4 ChemAxon polarizability 37.06 ChemAxon rotatable_bond_count 15 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 1702 Specdb::NmrOneD 3917 Specdb::NmrOneD 4196 Specdb::CMs 1872 Specdb::MsMs 66960 Specdb::MsMs 66961 Specdb::MsMs 66962 Specdb::MsMs 124665 Specdb::MsMs 124666 Specdb::MsMs 124667 HMDB02080 28194 #<Reference:0x000055ce306e1000> Anatidae Type 1 specific Anatidae 8830 Anise Type 1 specific Pimpinella anisum 271192 48900.0 48900.0 48900.0 mg/100 g Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Bitter gourd Type 1 specific Momordica charantia 3673 Brassicas Unknown generic 3705 Buffalo Type 1 specific Bubalus bubalis 89462 Caraway Type 1 specific Carum carvi 48032 3302.0 3302.0 3302.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 71200.0 71200.0 71200.0 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chervil Type 1 specific Anthriscus cerefolium 40888 5330.0 5330.0 5330.0 mg/100 g Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Coriander Type 1 specific Coriandrum sativum 4047 7600.0 7600.0 7600.0 mg/100 g Cumin Type 1 specific Cuminum cyminum 52462 Deer Type 1 specific Cervidae 9850 Dill Type 1 specific Anethum graveolens 40922 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Fennel Type 1 specific Foeniculum vulgare 48038 Green vegetables Unknown generic Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Parsley Type 1 specific Petroselinum crispum 4043 71500.0 71500.0 71500.0 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 10604.0 10604.0 10604.0 mg/100 g Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Wild carrot Type 1 specific Daucus carota 4039 71200.0 71200.0 71200.0 mg/100 g Wild celery Type 1 specific Apium graveolens 4045