1.0 2010-04-08 22:10:22 UTC 2019-11-26 03:07:39 UTC FDB012811 Ergocalciferol Antirachitic vitamin Ergocalciferol is a form of vitamin D, also called vitamin D2. Ergocalciferol is found in many foods, some of which are chervil, salt, lard, and common octopus. (+)-Vitamin D2 (3b,5Z,7e,22e)-9,10-Secoergosta-5,7,10(19),22-tetraen-3-ol (3beta,5Z,7e,22e)-9,10-Secoergosta-5,7,10(19),22-tetraen-3-ol (3S,5Z,7E,22E)-9,10-secoergosta-5,7,10,22-tetraen-3-ol (3S,5Z,7E,22E)-9,10-secoergosta-5,7,10(19),22-tetraen-3-ol (3β,5Z,7e,22e)-9,10-secoergosta-5,7,10(19),22-tetraen-3-ol (5e,7e,22e)-9,10-Secoergosta-5,7,10,22-tetraen-3-ol (5Z,7e,22e)-(3S)-9,10-Seco-5,7,10(19),22-ergostatetraen-3-ol (5Z,7e,22e)-(3S)-9,10-Secoergosta-5,7,10(19),22-tetraen-3-ol 22-Tetraen 3beta 9,10,secoergosta-5,7,10(19)-ol 4-Methylene-3-[2-[tetrahydro-7a-methyl-1-(1,4,5-trimethyl-2-hexenyl)-4(3ah)-indanylidene]ethylidene]-cyclohexanol 9,10-Seco(5Z,7E,22E)-5,7,10(19),22-ergostatetraen-3-ol 9,10-Secoergosta-5,7,10(19),22-tetraen-3b-ol Activated ergosterol beta-Ol Buco-D Calciferol Calciferol (vitamin D2) Calciferon 2 Condacaps Condocaps Condol Crtron Crystallina D-Arthin D-Tracetten Daral Davitamon D Davitin De-rat concentrate Decaps Dee-osterol Dee-ron Dee-ronal Dee-roual delta-Arthin delta-Tracetten Deltalin Deratol Detalup Diactol Divit urto Doral Drisdol Ercalciol Ergocalciferol (D2) Ergocalciferol oil Ergocalciferol, BAN, INN, USAN Ergocalciferolum Ergorone Ergosterol (activated) Ergosterol activated Ergosterol irradiated Fortodyl Geltabs Hi-deratol Infron Irradiated ergosta-5,7,22-trien-3beta-ol Metadee Mina D2 Mulsiferol Mykostin Novovitamin-D Oleovitamin D Oleovitamin D2 Osteil Ostelin Radiostol Radstein Radsterin Rodine C Shock-ferol Shock-ferol sterogyl Sterogyl Synthetic vitamin D Uvesterol D Uvesterol-D Vio D Vio-D Viostdrol Viosterol Viosterol in oil Vitamin D2 Vitamina D2 Vitavel-D C28H44O 396.6484 396.33921603 (1S,3Z)-3-{2-[(1R,3aS,4E,7aR)-1-[(2R,3E,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-octahydro-1H-inden-4-ylidene]ethylidene}-4-methylidenecyclohexan-1-ol ergocalciferol 50-14-6 CC(C)[C@@H](C)\C=C\[C@@H](C)[C@@]1([H])CC[C@@]2([H])\C(CCC[C@]12C)=C\C=C1\C[C@@H](O)CCC1=C InChI=1S/C28H44O/c1-19(2)20(3)9-10-22(5)26-15-16-27-23(8-7-17-28(26,27)6)12-13-24-18-25(29)14-11-21(24)4/h9-10,12-13,19-20,22,25-27,29H,4,7-8,11,14-18H2,1-3,5-6H3/b10-9+,23-12+,24-13-/t20-,22+,25-,26+,27-,28+/m0/s1 MECHNRXZTMCUDQ-RKHKHRCZSA-N belongs to the class of organic compounds known as vitamin d and derivatives. Vitamin D and derivatives are compounds containing a secosteroid backbone, usually secoergostane or secocholestane. Vitamin D and derivatives Organic compounds Lipids and lipid-like molecules Steroids and steroid derivatives Vitamin D and derivatives Aliphatic homopolycyclic compounds Cyclic alcohols and derivatives Hydrocarbon derivatives Secondary alcohols Triterpenoids Alcohol Aliphatic homopolycyclic compound Cyclic alcohol Hydrocarbon derivative Organic oxygen compound Organooxygen compound Secondary alcohol Triterpenoid Fat-soluble vitamins Vitamin D2 and derivatives Vitamin D2 and derivatives hydroxy seco-steroid seco-ergostane vitamin D Solid logp 7.59 ALOGPS logs -5.96 ALOGPS solubility 4.33e-04 g/l ALOGPS melting_point Mp 114.5-117° logp 7.05 ChemAxon pka_strongest_acidic 18.38 ChemAxon pka_strongest_basic -1.3 ChemAxon iupac (1S,3Z)-3-{2-[(1R,3aS,4E,7aR)-1-[(2R,3E,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-octahydro-1H-inden-4-ylidene]ethylidene}-4-methylidenecyclohexan-1-ol ChemAxon average_mass 396.6484 ChemAxon mono_mass 396.33921603 ChemAxon smiles CC(C)[C@@H](C)\C=C\[C@@H](C)[C@@]1([H])CC[C@@]2([H])\C(CCC[C@]12C)=C\C=C1\C[C@@H](O)CCC1=C ChemAxon formula C28H44O ChemAxon inchi InChI=1S/C28H44O/c1-19(2)20(3)9-10-22(5)26-15-16-27-23(8-7-17-28(26,27)6)12-13-24-18-25(29)14-11-21(24)4/h9-10,12-13,19-20,22,25-27,29H,4,7-8,11,14-18H2,1-3,5-6H3/b10-9+,23-12+,24-13-/t20-,22+,25-,26+,27-,28+/m0/s1 ChemAxon inchikey MECHNRXZTMCUDQ-RKHKHRCZSA-N ChemAxon polar_surface_area 20.23 ChemAxon refractivity 128.89 ChemAxon polarizability 50.72 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 1 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::NmrOneD 1593 Specdb::CMs 2233 Specdb::CMs 12356 Specdb::CMs 31259 Specdb::CMs 37831 Specdb::CMs 148015 Specdb::CMs 1081137 Specdb::NmrTwoD 1534 Specdb::MsMs 1277 Specdb::MsMs 1278 Specdb::MsMs 1279 Specdb::MsMs 4826 Specdb::MsMs 254724 Specdb::MsMs 254725 Specdb::MsMs 254726 Specdb::MsMs 274665 Specdb::MsMs 274666 Specdb::MsMs 274667 Specdb::MsMs 448217 Specdb::MsMs 2295135 Specdb::MsMs 2295136 Specdb::MsMs 2295137 Specdb::MsMs 2640622 Specdb::MsMs 2640623 Specdb::MsMs 2640624 HMDB00900 28934 D2V #<Reference:0x000055ce306a9268> #<Reference:0x000055ce306a8fe8> #<Reference:0x000055ce306a8e30> #<Reference:0x000055ce306a8c00> #<Reference:0x000055ce306a89f8> #<Reference:0x000055ce306a87a0> #<Reference:0x000055ce306a8520> #<Reference:0x000055ce306a8340> #<Reference:0x000055ce306a8070> #<Reference:0x000055ce306a7dc8> #<Reference:0x000055ce306a7bc0> #<Reference:0x000055ce306a7968> #<Reference:0x000055ce306a7710> #<Reference:0x000055ce306a74b8> #<Reference:0x000055ce306a7120> #<Reference:0x000055ce306a6f18> #<Reference:0x000055ce306a6c70> #<Reference:0x000055ce306a69c8> #<Reference:0x000055ce306a6748> #<Reference:0x000055ce306a6518> #<Reference:0x000055ce306a6310> Acorn squash Type 1 Cucurbita pepo var. turbinata 0.0 0.0 0.0 mg/100 g Adzuki bean Type 1 specific Vigna angularis 3914 0.0 0.0 0.0 mg/100 g Agar Type 1 specific Eucheuma 31444 0.0 0.0 0.0 mg/100 g Agave Type 1 specific Agave 39509 0.0 0.0 0.0 mg/100 g Alfalfa Type 1 specific Medicago sativa 3879 0.0 0.0 0.0 mg/100 g Allium Type 1 specific Allium 4678 0.0 0.0 0.0 mg/100 g Allspice Type 1 specific Pimenta dioica 375272 0.0 0.0 0.0 mg/100 g Almond Type 1 specific Prunus dulcis 3755 0.0 0.0 0.0 mg/100 g Almond milk Type 1 14.0 41.0 0.0 mg/100 g Amaranth Type 1 specific Amaranthus 3564 0.0 0.0 0.0 mg/100 g American lobster Type 1 specific Homarus americanus 6706 0.5 1.0 0.0 mg/100 g American shad Type 1 specific Alosa sapidissima 34773 97.4 190.0 4.8 mg/100 g Anatidae Type 1 specific Anatidae 8830 2.053846 26.0 0.0 mg/100 g Anchovy Type 1 specific Engraulidae 43062 0.0 0.0 0.0 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 159.216667 932.0 0.0 mg/100 g Anise Type 1 specific Pimpinella anisum 271192 0.0 0.0 0.0 mg/100 g Apple Type 1 specific Malus pumila 283210 0.0 0.0 0.0 mg/100 g Apple cider Type 2 specific 0.0 0.0 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 0.0 0.0 0.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 0.0 0.0 0.0 mg/100 g Arrowhead Type 1 specific Sagittaria latifolia 15008 0.0 0.0 0.0 mg/100 g Arrowroot Type 1 specific Maranta arundinacea 210060 0.0 0.0 0.0 mg/100 g Asian pear Type 1 specific Pyrus pyrifolia 3767 0.0 0.0 0.0 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 0.0 0.0 0.0 mg/100 g Atlantic cod Type 1 specific Gadus morhua 8049 18.45 36.0 0.9 mg/100 g Atlantic croaker Type 1 specific Micropogonias undulatus 29154 13.85 27.0 0.7 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 0.0 0.0 0.0 mg/100 g Atlantic herring Type 1 specific Clupea harengus harengus 7950 85.6 167.0 4.2 mg/100 g Atlantic pollock Type 1 specific Pollachius pollachius 185739 329.55 643.0 16.1 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 0.0 0.0 0.0 mg/100 g Avocado Type 1 specific Persea americana 3435 0.0 0.0 0.0 mg/100 g Baby food Type 2 specific 0.0 0.0 0.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.0 0.0 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 0.0 0.0 0.0 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 0.0 0.0 0.0 mg/100 g Beefalo Type 1 specific Bos taurus X Bison bison 297284 Beer Type 2 specific 0.0 0.0 0.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 0.0 0.0 0.0 mg/100 g Biscuit Type 2 specific 0.0 0.0 0.0 mg/100 g Bison Type 1 specific Bison bison 9901 Bitter gourd Type 1 specific Momordica charantia 3673 0.0 0.0 0.0 mg/100 g Black raisin Type 1 0.0 0.0 0.0 mg/100 g Black salsify Type 1 specific Scorzonera hispanica 114289 0.0 0.0 0.0 mg/100 g Black tea Type 1 0.0 0.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 0.0 0.0 0.0 mg/100 g Black-eyed pea Type 1 specific Vigna unguiculata ssp. unguiculata 3920 0.0 0.0 0.0 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 0.0 0.0 0.0 mg/100 g Blue cheese Type 2 10.75 21.0 0.5 mg/100 g Blue mussel Type 1 specific Mytilus edulis 6550 0.0 0.0 0.0 mg/100 g Blue whiting Type 1 specific Micromesistius poutassou 81636 0.0 0.0 0.0 mg/100 g Borage Type 1 specific Borago officinalis 13363 0.0 0.0 0.0 mg/100 g Brazil nut Type 1 specific Bertholletia excelsa 3645 0.0 0.0 0.0 mg/100 g Breadfruit Type 1 specific Artocarpus altilis 194251 0.0 0.0 0.0 mg/100 g Breadnut tree seed Type 1 specific Brosimum alicastrum 194253 0.0 0.0 0.0 mg/100 g Breakfast cereal Type 2 specific 0.0 0.0 0.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 0.0 0.0 0.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 0.0 0.0 0.0 mg/100 g Buffalo Type 1 specific Bubalus bubalis 89462 Bulgur Type 2 specific 0.0 0.0 0.0 mg/100 g Burbot Type 1 specific Lota lota 69944 0.0 0.0 0.0 mg/100 g Burdock Type 1 specific Arctium lappa 4217 0.0 0.0 0.0 mg/100 g Butter Type 2 specific 0.0 0.0 0.0 mg/100 g Buttermilk Type 2 specific 8.883333 52.0 0.0 mg/100 g Butternut Type 1 specific Juglans cinerea 91214 0.0 0.0 0.0 mg/100 g Butternut squash Type 1 specific Cucurbita moschata 3662 0.0 0.0 0.0 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 0.0 0.0 0.0 mg/100 g Calabash Type 1 specific Lagenaria siceraria 3668 0.0 0.0 0.0 mg/100 g Capers Type 1 specific Capparis spinosa 65558 0.0 0.0 0.0 mg/100 g Caraway Type 1 specific Carum carvi 48032 0.0 0.0 0.0 mg/100 g Cardamom Type 1 specific Elettaria cardamomum 105181 0.0 0.0 0.0 mg/100 g Cardoon Type 1 specific Cynara cardunculus 4265 0.0 0.0 0.0 mg/100 g Carp bream Type 1 specific Abramis brama 38527 253.175 988.0 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.0 0.0 0.0 mg/100 g Casein Type 2 specific 0.0 0.0 0.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 0.0 0.0 0.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 0.0 0.0 0.0 mg/100 g Catfish Type 1 specific Siluriformes 7995 128.125 500.0 0.0 mg/100 g Catjang pea Type 1 specific Vigna unguiculata ssp. cylindrica 3840 0.0 0.0 0.0 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 0.0 0.0 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 0.0 0.0 0.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 0.0 0.0 0.0 mg/100 g Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 0.0 0.0 0.0 mg/100 g Celery stalks Type 1 specific Apium graveolens var. dulce 117781 0.0 0.0 0.0 mg/100 g Cetacea (Dolphin, Porpoise, Whale) Type 1 specific Cetacea 9721 0.0 0.0 0.0 mg/100 g Channel catfish Type 1 specific Ictalurus punctatus 7998 256.25 500.0 12.5 mg/100 g Chanterelle Type 1 specific Cantharellus cibarius 36066 22.150883 124.5 0.0 mg/100 g Charr Type 1 specific Salvelinus 8033 0.0 0.0 0.0 mg/100 g Chayote Type 1 specific Sechium edule 184140 0.0 0.0 0.0 mg/100 g Cheese Type 2 specific 0.0 0.0 0.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 0.0 0.0 0.0 mg/100 g Chervil Type 1 specific Anthriscus cerefolium 40888 0.0 0.0 0.0 mg/100 g Chestnut Type 1 specific Castanea 21019 0.0 0.0 0.0 mg/100 g Chewing gum Type 2 specific 0.0 0.0 0.0 mg/100 g Chicken Type 1 specific Gallus gallus 9031 0.0 0.0 0.0 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 0.0 0.0 0.0 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 0.0 0.0 0.0 mg/100 g Chicory roots Type 1 specific Cichorium intybus var. sativum 13427 0.0 0.0 0.0 mg/100 g Chinese broccoli Type 1 specific Brassica alboglabra 3714 0.0 0.0 0.0 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 0.0 0.0 0.0 mg/100 g Chinese chestnut Type 1 specific Castanea mollissima 60419 0.0 0.0 0.0 mg/100 g Chinese chives Type 1 specific Allium tuberosum 4683 0.0 0.0 0.0 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 0.0 0.0 0.0 mg/100 g Chocolate Type 2 specific 0.0 0.0 0.0 mg/100 g Chocolate spread Type 2 specific 0.0 0.0 0.0 mg/100 g Cichlidae (Tilapia) Type 1 specific Cichlidae 8113 63.55 124.0 3.1 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 0.0 0.0 0.0 mg/100 g Clam Type 1 1.025 2.0 0.05 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 0.125 1.0 0.0 mg/100 g Clementine Type 1 Citrus × clementina 0.0 0.0 0.0 mg/100 g Cloud ear fungus Type 1 specific Auricularia polytricha 29893 0.0 0.0 0.0 mg/100 g Cloves Type 1 specific Syzygium aromaticum 219868 0.0 0.0 0.0 mg/100 g Clupeinae (Herring, Sardine, Sprat) Type 1 specific Clupeinae 7948 0.0 0.0 0.0 mg/100 g Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa powder Type 2 specific 0.0 0.0 0.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 0.0 0.0 0.0 mg/100 g Coconut milk Type 1 14.666667 42.0 1.0 mg/100 g Coffee Type 1 generic Coffea 13442 0.0 0.0 0.0 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 185.0 361.0 9.0 mg/100 g Cold cut Type 2 specific 0.0 0.0 0.0 mg/100 g Colorado pinyon Type 1 specific Pinus edulis 3340 0.0 0.0 0.0 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 0.0 0.0 0.0 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 0.0 0.0 0.0 mg/100 g Common beet Type 1 specific Beta vulgaris 161934 0.0 0.0 0.0 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 0.0 0.0 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 0.0 0.0 0.0 mg/100 g Common carp Type 1 specific Cyprinus carpio 7962 506.35 988.0 24.7 mg/100 g Common dab Type 1 specific Limanda limanda 27771 0.0 0.0 0.0 mg/100 g Common hazelnut Type 1 specific Corylus avellana 13451 0.0 0.0 0.0 mg/100 g Common ling Type 1 specific Molva molva 163112 0.0 0.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 0.001753 0.0131 0.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 0.0 0.0 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 0.0 0.0 0.0 mg/100 g Common pea Type 1 specific Pisum sativum 3888 0.0 0.0 0.0 mg/100 g Common salsify Type 1 specific Tragopogon porrifolius 13731 0.0 0.0 0.0 mg/100 g Common thyme Type 1 specific Thymus vulgaris 49992 0.0 0.0 0.0 mg/100 g Common walnut Type 1 specific Juglans regia 51240 0.0 0.0 0.0 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 0.0 0.0 0.0 mg/100 g Corn Type 1 specific Zea mays 4577 0.0 0.0 0.0 mg/100 g Cottonseed Type 1 specific Gossypium 3633 0.0 0.0 0.0 mg/100 g Cottonseed oil Type 2 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 0% fat Type 2 specific Cow milk, pasteurized, vitamin A + D added, 1% fat Type 2 specific Cow milk, pasteurized, vitamin A + D added, 2% fat Type 2 specific Cow milk, pasteurized, vitamin D added, 3.25% fat Type 2 specific Cowpea Type 1 specific Vigna unguiculata 3917 0.0 0.0 0.0 mg/100 g Crab Type 1 specific Brachyura 6752 0.0 0.0 0.0 mg/100 g Cracker Type 2 specific 0.0 0.0 0.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 0.0 0.0 0.0 mg/100 g Cream Type 2 specific 4.130303 63.0 0.0 mg/100 g Crisp bread Type 2 specific 0.0 0.0 0.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 0.0 0.0 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 0.0 0.0 0.0 mg/100 g Cumin Type 1 specific Cuminum cyminum 52462 0.0 0.0 0.0 mg/100 g Curry powder Type 2 specific 0.0 0.0 0.0 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 0.0 0.0 0.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 0.0 0.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 0.0 0.0 0.0 mg/100 g Deer Type 1 specific Cervidae 9850 Dessert wine Type 2 0.0 0.0 0.0 mg/100 g Dill Type 1 specific Anethum graveolens 40922 0.0 0.0 0.0 mg/100 g Dock Type 1 specific Rumex 3618 0.0 0.0 0.0 mg/100 g Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 0.0 0.0 0.0 mg/100 g Dragée Type 2 specific 0.0 0.0 0.0 mg/100 g Dried milk Type 2 specific 0.0 0.0 0.0 mg/100 g Dumpling Type 2 specific 0.0 0.0 0.0 mg/100 g Eastern oyster Type 1 specific Crassostrea virginica 6565 0.5 1.0 0.0 mg/100 g Egg substitute Type 2 specific 16.9 66.0 0.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 0.0 0.0 0.0 mg/100 g Eggs Unknown generic 3.477931 98.4 0.0 mg/100 g Elderberry Type 1 specific Sambucus 4201 0.0 0.0 0.0 mg/100 g Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 Endive Type 1 specific Cichorium endivia 114280 0.0 0.0 0.0 mg/100 g Enokitake Type 1 specific Flammulina velutipes 38945 0.0001 0.0001 0.0001 mg/100 g Epazote Type 1 specific Dysphania ambrosioides 330163 0.0 0.0 0.0 mg/100 g European chestnut Type 1 specific Castanea sativa 21020 0.0 0.0 0.0 mg/100 g European plum Type 1 specific Prunus domestica 3758 0.0 0.0 0.0 mg/100 g European rabbit Type 1 specific Oryctolagus 9984 Fennel Type 1 specific Foeniculum vulgare 48038 0.0 0.0 0.0 mg/100 g Fenugreek Type 1 specific Trigonella foenum-graecum 78534 0.0 0.0 0.0 mg/100 g Fig Type 1 specific Ficus carica 3494 0.0 0.0 0.0 mg/100 g Fireweed Type 1 specific Chamerion angustifolium 13055 0.0 0.0 0.0 mg/100 g Fish oil Type 1 0.0 0.0 0.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 31.65 123.5 0.0 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 0.0 0.0 0.0 mg/100 g Florida pompano Type 1 specific Trachinotus carolinus 173342 225.0 439.0 11.0 mg/100 g French plantain Type 1 specific Musa X paradisiaca 89151 0.0 0.0 0.0 mg/100 g Freshwater eel Type 1 specific Anguilla 7935 477.65 932.0 23.3 mg/100 g Fruit gum Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit juice Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit preserve Type 2 specific 0.0 0.0 0.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 8.191667 36.0 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 1.23 36.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 0.0 0.0 0.0 mg/100 g Garden onion Type 1 specific Allium cepa 4679 0.0 0.0 0.0 mg/100 g Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 0.0 0.0 0.0 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 0.0 0.0 0.0 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 0.0 0.0 0.0 mg/100 g Garfish Type 1 specific Belone belone 129037 0.0 0.0 0.0 mg/100 g Garland chrysanthemum Type 1 specific Chrysanthemum coronarium 99038 0.0 0.0 0.0 mg/100 g Garlic Type 1 specific Allium sativum 4682 0.0 0.0 0.0 mg/100 g Gelatin Type 2 specific 0.0 0.0 0.0 mg/100 g Gelatin dessert Type 2 specific 0.0 0.0 0.0 mg/100 g German camomile Type 1 specific Matricaria recutita 127986 0.0 0.0 0.0 mg/100 g Giant butterbur Type 1 specific Petasites japonicus 186965 0.0 0.0 0.0 mg/100 g Gin Type 2 specific 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 0.0 0.0 0.0 mg/100 g Ginkgo nuts Type 1 specific Ginkgo biloba 3311 0.0 0.0 0.0 mg/100 g Globe artichoke Type 1 specific Cynara scolymus 59895 0.0 0.0 0.0 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 0.0 0.0 0.0 mg/100 g Grape Type 1 specific Vitis 3603 0.0 0.0 0.0 mg/100 g Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 0.0 0.0 0.0 mg/100 g Grapefruit/Pummelo hybrid Type 1 specific Citrus paradisi X Citrus maxima 37656 0.0 0.0 0.0 mg/100 g Greater sturgeon Type 1 specific Acipenser 7901 211.15 412.0 10.3 mg/100 g Greek feta cheese Type 2 8.2 16.0 0.4 mg/100 g Green bean Type 1 specific Phaseolus vulgaris 3885 0.0 0.0 0.0 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Green cabbage Type 1 Brassica oleracea var. sabauda L. 0.0 0.0 0.0 mg/100 g Green lentil Type 1 Lens culinaris 0.0 0.0 0.0 mg/100 g Green plum Type 1 0.0 0.0 0.0 mg/100 g Green tea Type 1 0.0 0.0 0.0 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.0 0.0 0.0 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 140.55 1097.0 0.0 mg/100 g Greylag goose Type 1 specific Anser anser 8843 Groundcherry Type 1 specific Physalis 24663 0.0 0.0 0.0 mg/100 g Guava Type 1 specific Psidium guajava 120290 0.0 0.0 0.0 mg/100 g Guinea hen Type 1 specific Numida meleagris 8996 Haddock Type 1 specific Melanogrammus aeglefinus 8056 0.875 6.5 0.0 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 0.0 0.0 0.0 mg/100 g Hazelnut Type 1 specific Corylus 13450 0.0 0.0 0.0 mg/100 g Heart of palm Type 1 specific 0.0 0.0 0.0 mg/100 g Herbal tea Type 1 0.0 0.0 0.0 mg/100 g Hibiscus tea Type 1 specific Hibiscus sabbariffa 183260 0.0 0.0 0.0 mg/100 g Hickory nut Type 1 specific Carya 13402 0.0 0.0 0.0 mg/100 g Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 103.525 202.0 5.05 mg/100 g Honey Type 2 specific 0.0 0.0 0.0 mg/100 g Horse Type 1 specific Equus caballus 9796 Horseradish Type 1 specific Armoracia rusticana 3704 0.0 0.0 0.0 mg/100 g Hot chocolate Type 2 specific 0.0 0.0 0.0 mg/100 g Hyacinth bean Type 1 specific Lablab purpureus 35936 0.0 0.0 0.0 mg/100 g Ice cream Type 2 specific 0.0 0.0 0.0 mg/100 g Iceberg lettuce Type 1 0.0 0.0 0.0 mg/100 g Irish moss Type 1 specific Chondrus crispus 2769 0.0 0.0 0.0 mg/100 g Italian oregano Type 1 specific Origanum X majoricum 1384207 0.0 0.0 0.0 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Jalapeno pepper Type 1 Capsicum annuum 'Jalapeño' 0.0 0.0 0.0 mg/100 g Japanese chestnut Type 1 specific Castanea crenata 103480 0.0 0.0 0.0 mg/100 g Japanese persimmon Type 1 specific Diospyros kaki 35925 0.0 0.0 0.0 mg/100 g Japanese pumpkin Type 1 specific Cucurbita maxima 3661 0.0 0.0 0.0 mg/100 g Japanese sea bass Type 1 Lateolabrax japonicus 115.8 226.0 5.6 mg/100 g Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 0.0 0.0 0.0 mg/100 g Jew's ear Type 1 specific Auricularia auricula-judae 29892 0.0 0.0 0.0 mg/100 g Jicama Type 1 specific Pachyrhizus erosus 109171 0.0 0.0 0.0 mg/100 g Jute Type 1 specific Corchorus olitorius 93759 0.0 0.0 0.0 mg/100 g Kale Type 1 specific Brassica napus var. pabularia 0.0 0.0 0.0 mg/100 g Kefir Type 2 specific 8.4 41.0 0.0 mg/100 g Kelp Type 1 specific Laminaria 33637 0.0 0.0 0.0 mg/100 g Ketchup Type 2 specific 0.0 0.0 0.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 0.0 0.0 0.0 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 0.0 0.0 0.0 mg/100 g Kombu Type 1 specific Saccharina japonica 88149 0.0 0.0 0.0 mg/100 g Kumquat Type 1 specific Fortunella 2706 0.0 0.0 0.0 mg/100 g Lake trout Type 1 specific Salvelinus namaycush 8040 0.0 0.0 0.0 mg/100 g Lambsquarters Type 1 specific Chenopodium album 3559 0.0 0.0 0.0 mg/100 g Lard Type 2 specific 17.416667 102.0 0.0 mg/100 g Leavening agent Type 2 specific 0.0 0.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 0.0 0.0 0.0 mg/100 g Lemon Type 1 specific Citrus limon 2708 0.0 0.0 0.0 mg/100 g Lemon grass Type 1 specific Cymbopogon citratus 66014 0.0 0.0 0.0 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 25.32 123.5 0.0 mg/100 g Lentils Type 1 generic Lens culinaris 3864 0.0 0.0 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 0.0 0.0 0.0 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.0 0.0 0.0 mg/100 g Lima bean Type 1 specific Phaseolus lunatus 3884 0.0 0.0 0.0 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 0.0 0.0 0.0 mg/100 g Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 0.0 0.0 0.0 mg/100 g Liquor Type 2 specific 0.0 0.0 0.0 mg/100 g Liquorice Type 2 specific 0.0 0.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 0.0 0.0 0.0 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 0.0 0.0 0.0 mg/100 g Lotus Type 1 specific Nelumbo 4430 0.0 0.0 0.0 mg/100 g Lumpsucker Type 1 specific Cyclopteridae 8101 0.0 0.0 0.0 mg/100 g Lupine Type 1 specific Lupinus 3869 0.0 0.0 0.0 mg/100 g Macadamia nut Type 1 specific Macadamia 4329 0.0 0.0 0.0 mg/100 g Macadamia nut (M. tetraphylla) Type 1 specific Macadamia tetraphylla 512563 0.0 0.0 0.0 mg/100 g Madeira wine Type 2 specific 0.0 0.0 0.0 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 330.669525 1263.0 0.0281 mg/100 g Malabar spinach Type 1 specific Basella alba 3589 0.0 0.0 0.0 mg/100 g Mallard duck Type 1 specific Anas platyrhynchos 8839 Malus (Crab apple) Type 1 specific Malus 3749 0.0 0.0 0.0 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 0.0 0.0 0.0 mg/100 g Mango Type 1 specific Mangifera indica 29780 0.0 0.0 0.0 mg/100 g Margarine Type 2 specific 0.0 0.0 0.0 mg/100 g Margarine-like spread Type 2 specific 0.0 0.0 0.0 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 0.0 0.0 0.0 mg/100 g Marshmallow Type 2 specific 0.0 0.0 0.0 mg/100 g Marzipan Type 2 specific 0.0 0.0 0.0 mg/100 g Meat bouillon Type 2 specific 0.0 0.0 0.0 mg/100 g Meatball Type 2 specific 0.0 0.0 0.0 mg/100 g Meringue Type 2 specific 0.0 0.0 0.0 mg/100 g Mexican oregano Type 1 specific Lippia graveolens 0.0 0.0 0.0 mg/100 g Milk (Cow) Type 2 specific 0.000122 0.000504 0.0 mg/100 g Milk (Human) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Other mammals) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk substitute Type 2 specific 0.0011 0.0011 0.0011 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 0.0 0.0 0.0 mg/100 g Miso Type 2 specific 0.0 0.0 0.0 mg/100 g Molasses Type 2 specific 0.0 0.0 0.0 mg/100 g Monk fruit Type 1 Siraitia grosvenorii 0.0 0.0 0.0 mg/100 g Morchella (Morel) Type 1 specific Morchellaceae 5192 10.763775 37.0 0.0051 mg/100 g Moth bean Type 1 specific Vigna aconitifolia 3918 0.0 0.0 0.0 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 0.0 0.0 0.0 mg/100 g Mountain yam Type 1 specific Dioscorea pentaphylla 167592 0.0 0.0 0.0 mg/100 g Mule deer Type 1 specific Odocoileus 9871 Mung bean Type 1 specific Vigna radiata 157791 0.0 0.0 0.0 mg/100 g Muskmelon Type 1 specific Cucumis melo 3656 0.0 0.0 0.0 mg/100 g Mustard Type 2 specific 0.0 0.0 0.0 mg/100 g Mustard spinach Type 1 specific Brassica perviridis 0.0 0.0 0.0 mg/100 g Napa cabbage Type 1 specific Brassica rapa var. pekinensis 51351 0.0 0.0 0.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 0.0 0.0 0.0 mg/100 g New Zealand spinach Type 1 specific Tetragonia tetragonioides 45318 0.0 0.0 0.0 mg/100 g Nopal Type 1 specific Opuntia cochenillifera 338184 0.0 0.0 0.0 mg/100 g Northern bluefin tuna Type 1 specific Thunnus thynnus 8237 116.35 227.0 5.7 mg/100 g Northern pike Type 1 specific Esox lucius 8010 25.375 99.0 0.0 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 1.75 6.5 0.0 mg/100 g Norway lobster Type 1 specific Nephrops norvegicus 6829 0.0 0.0 0.0 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.0 0.0 0.0 mg/100 g Nougat Type 2 specific 0.0 0.0 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 0.0 0.0 0.0 mg/100 g Oat Type 1 specific Avena sativa 4498 0.0 0.0 0.0 mg/100 g Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 0.0 0.0 0.0 mg/100 g Olive Type 1 specific Olea europaea 4146 0.0 0.0 0.0 mg/100 g Ostrich Type 1 specific Struthio camelus 8801 Other alcoholic beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Other animal fat Type 2 specific 0.0 0.0 0.0 mg/100 g Other beverage Type 2 specific 0.001 0.001 0.001 mg/100 g Other bread Type 2 specific 0.0 0.0 0.0 mg/100 g Other bread product Type 2 specific 0.0 0.0 0.0 mg/100 g Other candy Type 2 specific 0.0 0.0 0.0 mg/100 g Other dish Type 2 specific 0.0 0.0 0.0 mg/100 g Other fermented milk Type 2 specific 0.0 0.0 0.0 mg/100 g Other fish product Type 2 specific 0.0 0.0 0.0 mg/100 g Other frozen dessert Type 2 specific 0.0 0.0 0.0 mg/100 g Other fruit product Type 2 specific 0.0 0.0 0.0 mg/100 g Other snack food Type 2 specific 0.0 0.0 0.0 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 10.39014 50.0 0.0 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 6.125 12.0 0.25 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 103.525 202.0 5.05 mg/100 g Pacific jack mackerel Type 1 specific Trachurus symmetricus 271940 187.55 366.0 9.1 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 17.3 67.5 0.0 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 65.266667 192.0 0.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 0.0 0.0 0.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 0.0 0.0 0.0 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 0.0 0.0 0.0 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 0.0 0.0 0.0 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 0.0 0.0 0.0 mg/100 g Pasta Type 2 specific 0.0 0.0 0.0 mg/100 g Pastry Type 2 specific 0.0 0.0 0.0 mg/100 g Pate Type 2 specific 0.0 0.0 0.0 mg/100 g Pea shoots Type 1 0.0 0.0 0.0 mg/100 g Peach Type 1 specific Prunus persica 3760 0.0 0.0 0.0 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 0.0 0.0 0.0 mg/100 g Peanut oil Type 2 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.0 0.0 0.0 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 0.0 0.0 0.0 mg/100 g Pectin Type 2 specific 0.0 0.0 0.0 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Pepper (Spice) Type 1 specific Piper nigrum 13216 0.0 0.0 0.0 mg/100 g Peppermint Type 1 specific Mentha X piperita 34256 0.0 0.0 0.0 mg/100 g Perciformes Type 1 specific Perciformes 8111 0.0 0.0 0.0 mg/100 g Persian lime Type 1 specific Citrus latifolia 200541 0.0 0.0 0.0 mg/100 g Persimmon Type 1 specific Diospyros 13492 0.0 0.0 0.0 mg/100 g Pheasant Type 1 specific Phasianus colchicus 9054 Pigeon pea Type 1 specific Cajanus cajan 3821 0.0 0.0 0.0 mg/100 g Pikeperch Type 1 specific Sander lucioperca 283035 0.0 0.0 0.0 mg/100 g Pine nut Type 1 specific Pinus 3337 0.0 0.0 0.0 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.0 0.0 0.0 mg/100 g Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 30.75 120.0 0.0 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 0.0 0.0 0.0 mg/100 g Pizza Type 2 specific 0.0 0.0 0.0 mg/100 g Pleuronectidae (Dab, Halibut, Plaice) Type 1 specific Pleuronectidae 8256 0.0 0.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.9 7.0 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.0 0.0 0.0 mg/100 g Poppy Type 1 specific Papaver 3468 0.0 0.0 0.0 mg/100 g Port wine Type 2 specific 0.0 0.0 0.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 0.0 0.0 0.0 mg/100 g Prickly pear Type 1 specific Opuntia 106975 0.0 0.0 0.0 mg/100 g Processed cheese Type 2 specific 0.0 0.0 0.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 0.0 0.0 0.0 mg/100 g Purple laver Type 1 specific Porphyra laciniata 0.0 0.0 0.0 mg/100 g Purslane Type 1 specific Portulaca oleracea 46147 0.0 0.0 0.0 mg/100 g Quail Type 1 specific Phasianidae 9005 Quince Type 1 specific Cydonia oblonga 36610 0.0 0.0 0.0 mg/100 g Quinoa Type 1 specific Chenopodium quinoa 63459 0.0 0.0 0.0 mg/100 g Rabbit Type 1 specific Leporidae 9979 0.0 0.0 0.0 mg/100 g Radish Type 1 specific Raphanus sativus 3726 0.0 0.0 0.0 mg/100 g Rainbow smelt Type 1 specific Osmerus mordax 8014 15.9 31.0 0.8 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 0.0 0.0 0.0 mg/100 g Rape Type 1 specific Brassica napus var. napus 138011 0.0 0.0 0.0 mg/100 g Red algae Type 1 specific Rhodophyta 2763 0.0 0.0 0.0 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra 0.0 0.0 0.0 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 0.0 0.0 0.0 mg/100 g Red tea Type 1 0.0 0.0 0.0 mg/100 g Red wine Type 2 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.0 0.0 0.0 mg/100 g Remoulade Type 2 specific 0.0 0.0 0.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 0.0 0.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 0.0 0.0 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 0.0 0.0 0.0 mg/100 g Rocket salad (ssp.) Type 1 specific Eruca vesicaria ssp. sativa 29727 0.0 0.0 0.0 mg/100 g Roe Type 2 generic 248.05 484.0 12.1 mg/100 g Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 0.0 0.0 0.0 mg/100 g Roman camomile Type 1 specific Chamaemelum nobile 99037 0.0 0.0 0.0 mg/100 g Rose hip Type 1 specific Rosa 3764 0.0 0.0 0.0 mg/100 g Rosé wine Type 2 0.0 0.0 0.0 mg/100 g Rosemary Type 1 specific Rosmarinus officinalis 39367 0.0 0.0 0.0 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.0 0.0 0.0 mg/100 g Rum Type 2 specific 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 0.0 0.0 0.0 mg/100 g Rye bread Type 2 specific 0.0 0.0 0.0 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 0.0 0.0 0.0 mg/100 g Saffron Type 1 specific Crocus sativus 82528 0.0 0.0 0.0 mg/100 g Sake Type 2 specific 0.0 0.0 0.0 mg/100 g Salad dressing Type 2 specific 0.0 0.0 0.0 mg/100 g Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 0.0 0.0 0.0 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Salted butter Type 1 0.0 0.0 0.0 mg/100 g Sauce Type 2 specific 0.0 0.0 0.0 mg/100 g Sausage Type 2 specific 0.0 0.0 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 0.0 0.0 0.0 mg/100 g Scallop Type 1 specific Pectinidae 6566 0.0 0.0 0.0 mg/100 g Scombridae (Bonito, Mackerel, Tuna) Type 1 specific Scombridae 8224 0.0 0.0 0.0 mg/100 g Scup Type 1 specific Stenotomus chrysops 35579 24.1 47.0 1.2 mg/100 g Semolina Type 2 specific 0.0 0.0 0.0 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 0.0 0.0 0.0 mg/100 g Sesame oil Type 2 0.0 0.0 0.0 mg/100 g Sesbania flower Type 1 specific Sesbania bispinosa 485725 0.0 0.0 0.0 mg/100 g Shallot Type 1 specific Allium ascalonicum 1476995 0.0 0.0 0.0 mg/100 g Shark Type 1 specific Squaliformes 282414 12.3 24.0 0.6 mg/100 g Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 0.0 0.0 0.0 mg/100 g Sherry Type 2 specific 0.0 0.0 0.0 mg/100 g Shiitake Type 1 specific Lentinus edodes 5353 2.938275 22.5 0.0004 mg/100 g Shrimp Type 1 specific Caridea 6694 0.0 0.0 0.0 mg/100 g Snail Type 1 specific Gastropoda 6448 0.0 0.0 0.0 mg/100 g Snapper Type 1 specific Lutjanidae 30850 209.1 408.0 10.2 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 144.275 563.0 0.0 mg/100 g Soft drink Type 2 specific 0.0 0.0 0.0 mg/100 g Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 0.0 0.0 0.0 mg/100 g Sorghum Type 1 specific Sorghum bicolor 4558 0.0 0.0 0.0 mg/100 g Sorrel Type 1 specific Rumex acetosa 41241 0.0 0.0 0.0 mg/100 g Soup Type 2 specific 0.0 0.0 0.0 mg/100 g Sour cream Type 2 4.1 8.0 0.2 mg/100 g Soursop Type 1 specific Annona muricata 13337 0.0 0.0 0.0 mg/100 g Soy bean Type 1 specific Glycine max 3847 0.0 0.0 0.0 mg/100 g Soy milk Type 2 specific 0.085454 1.1 0.0 mg/100 g Soy sauce Type 2 specific 0.0 0.0 0.0 mg/100 g Soybean oil Type 2 0.0 0.0 0.0 mg/100 g Spanish mackerel Type 1 specific Scomberomorus maculatus 99344 149.65 292.0 7.3 mg/100 g Spearmint Type 1 specific Mentha spicata 29719 0.0 0.0 0.0 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 0.0 0.0 0.0 mg/100 g Spiny dogfish Type 1 specific Squalus acanthias 7797 0.0 0.0 0.0 mg/100 g Spirit Type 2 specific 0.0 0.0 0.0 mg/100 g Spirulina Type 1 specific Spirulina 551299 0.0 0.0 0.0 mg/100 g Squab Type 1 specific Columba 8931 Squid Type 1 specific Teuthida 551290 0.0 0.0 0.0 mg/100 g Star anise Type 1 specific Illicium verum 124778 0.0 0.0 0.0 mg/100 g Star fruit Type 1 specific Averrhoa carambola 28974 0.0 0.0 0.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 0.0 0.0 0.0 mg/100 g Striped mullet Type 1 specific Mugil cephalus 48193 31.25 61.0 1.5 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 70.383333 412.0 0.0 mg/100 g Sugar Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Summer savory Type 1 specific Satureja hortensis 49987 0.0 0.0 0.0 mg/100 g Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 0.0 0.0 0.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 0.0 0.0 0.0 mg/100 g Sunflower oil Type 2 0.0 0.0 0.0 mg/100 g Swede Type 1 specific Brassica napus 3708 0.0 0.0 0.0 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 0.0 0.0 0.0 mg/100 g Sweet marjoram Type 1 specific Origanum majorana 268884 0.0 0.0 0.0 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 0.0 0.0 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 0.0 0.0 0.0 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 0.0 0.0 0.0 mg/100 g Swiss cheese Type 2 0.0 0.0 0.0 mg/100 g Swordfish Type 1 specific Xiphias gladius 8245 475.075 927.0 23.15 mg/100 g Syrup Type 2 specific 0.0 0.0 0.0 mg/100 g Tallow Type 2 specific 4.783333 28.0 0.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 0.0 0.0 0.0 mg/100 g Tapioca pearl Type 2 specific 0.0 0.0 0.0 mg/100 g Taro Type 1 specific Colocasia esculenta 4460 0.0 0.0 0.0 mg/100 g Tea Type 1 specific Camellia sinensis 4442 0.0 0.0 0.0 mg/100 g Thistle Type 1 specific Cirsium 41549 0.0 0.0 0.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 0.0 0.0 0.0 mg/100 g Toffee Type 2 specific 0.0 0.0 0.0 mg/100 g Tofu Type 2 specific 0.0 0.0 0.0 mg/100 g Tree fern Type 1 specific Cyathea 0.0 0.0 0.0 mg/100 g Triticale Type 1 specific X Triticosecale rimpaui 0.0 0.0 0.0 mg/100 g True frog Type 1 specific Ranidae 8397 2.05 8.0 0.0 mg/100 g True oyster Type 1 specific Ostreidae 6563 0.0 0.0 0.0 mg/100 g True seal Type 1 specific Phocidae 9709 0.0 0.0 0.0 mg/100 g True sole Type 1 specific Soleidae 30948 42.2 123.5 0.0 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 0.0 0.0 0.0 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 1.366667 8.0 0.0 mg/100 g Turmeric Type 1 specific Curcuma longa 136217 0.0 0.0 0.0 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 0.0 0.0 0.0 mg/100 g Unclassified food or beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 0.0 0.0 0.0 mg/100 g Vanilla Type 1 specific Vanilla 51238 0.0 0.0 0.0 mg/100 g Vegetable juice Type 2 specific 0.0 0.0 0.0 mg/100 g Velvet duck Type 1 specific Melanitta fusca 371864 Vermouth Type 2 specific 0.0 0.0 0.0 mg/100 g Vinegar Type 2 specific 0.0 0.0 0.0 mg/100 g Vodka Type 2 specific 0.0 0.0 0.0 mg/100 g Wakame Type 1 specific Undaria pinnatifida 74381 0.0 0.0 0.0 mg/100 g Walnut Type 1 specific Juglans 16718 0.0 0.0 0.0 mg/100 g Wasabi Type 1 specific Wasabia japonica 75806 0.0 0.0 0.0 mg/100 g Water Type 2 specific 0.0 0.0 0.0 mg/100 g Water spinach Type 1 Ipomoea aquatica 0.0 0.0 0.0 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 0.0 0.0 0.0 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 0.0 0.0 0.0 mg/100 g Wax gourd Type 1 specific Benincasa hispida 102211 0.0 0.0 0.0 mg/100 g Welsh onion Type 1 specific Allium fistulosum 35875 0.0 0.0 0.0 mg/100 g Wheat Type 1 specific Triticum 4564 0.0 0.0 0.0 mg/100 g Wheat bread Type 2 specific 0.0 0.0 0.0 mg/100 g Whelk Type 1 specific Buccinidae 37796 0.0 0.0 0.0 mg/100 g Whey Type 2 specific 0.0 0.0 0.0 mg/100 g Whisky Type 2 specific 0.0 0.0 0.0 mg/100 g White bread Type 1 0.0 0.0 0.0 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 0.0 0.0 0.0 mg/100 g White wine Type 2 0.0 0.0 0.0 mg/100 g Whitefish Type 1 specific Coregonus 27772 122.5 478.0 0.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 14.6 57.0 0.0 mg/100 g Wild boar Type 1 specific Sus scrofa 9823 Wild celery Type 1 specific Apium graveolens 4045 0.0 0.0 0.0 mg/100 g Wild leek Type 1 specific Allium ampeloprasum 4681 0.0 0.0 0.0 mg/100 g Wild rice Type 1 specific Zizania 15949 0.0 0.0 0.0 mg/100 g Winged bean Type 1 specific Psophocarpus tetragonolobus 3891 0.0 0.0 0.0 mg/100 g Winter squash Type 1 specific Cucurbita maxima 3661 0.0 0.0 0.0 mg/100 g Yam Type 1 specific Dioscorea 4672 0.0 0.0 0.0 mg/100 g Yardlong bean Type 1 specific Vigna unguiculata ssp. sesquipedalis 138955 0.0 0.0 0.0 mg/100 g Yautia Type 1 specific Xanthosoma sagittifolium 28478 0.0 0.0 0.0 mg/100 g Yellow bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.0 0.0 0.0 mg/100 g Yellowfin tuna Type 1 specific Thunnus albacares 8236 4.875 9.5 0.25 mg/100 g Ymer Type 2 specific 0.0 0.0 0.0 mg/100 g Yogurt Type 2 specific 0.0 0.0 0.0 mg/100 g Cytosolic 5'-nucleotidase 3 Q9H0P0 NT5C3 Cytosolic 5'-nucleotidase III-like protein Q969T7 NT5C3L UMP-CMP kinase 2, mitochondrial Q5EBM0 CMPK2