1.0 2010-04-08 22:10:41 UTC 2025-11-18 23:44:21 UTC FDB013405 2',3'-Dihydro-phytomenadione Present in hydrogenated vegetable oils and a wide range of foods prepared from them. Readily absorbed by humans from dietary sources. About 15-fold less potent than natural vitamin K1 in chick blood coagulation assay. 2',3'-Dihydro-phytomenadione is found in many foods, some of which are soursop, enokitake, date, and agave. 2-Methyl-3-(3,7,11,15-tetramethylhexadecyl)-1,4-naphthalenedione, 9CI 2',3'-Dihydrophylloquinone 2',3'-Dihydrovitamin K1 Dihydrophylloquinone C31H48O2 452.7116 452.36543078 2-methyl-3-(3,7,11,15-tetramethylhexadecyl)-1,4-dihydronaphthalene-1,4-dione 2-methyl-3-(3,7,11,15-tetramethylhexadecyl)naphthalene-1,4-dione 64236-23-3 CC(C)CCCC(C)CCCC(C)CCCC(C)CCC1=C(C)C(=O)C2=CC=CC=C2C1=O InChI=1S/C31H48O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-27-26(6)30(32)28-18-7-8-19-29(28)31(27)33/h7-8,18-19,22-25H,9-17,20-21H2,1-6H3 XOQNYHSBHIIJMQ-UHFFFAOYSA-N belongs to the class of organic compounds known as vitamin k compounds. These are quinone lipids containing a methylated naphthoquinone ring structure, and vary in the aliphatic side chain attached at the 3-position. Vitamin K compounds Organic compounds Lipids and lipid-like molecules Prenol lipids Quinone and hydroquinone lipids Aromatic homopolycyclic compounds Aryl ketones Diterpenoids Hydrocarbon derivatives Naphthoquinones Organic oxides Quinones Aromatic homopolycyclic compound Aryl ketone Benzenoid Diterpenoid Hydrocarbon derivative Ketone Naphthalene Naphthoquinone Organic oxide Organic oxygen compound Organooxygen compound Quinone logp 8.69 ALOGPS logs -7.29 ALOGPS solubility 2.34e-05 g/l ALOGPS logp 10.1 ChemAxon pka_strongest_basic -7.2 ChemAxon iupac 2-methyl-3-(3,7,11,15-tetramethylhexadecyl)-1,4-dihydronaphthalene-1,4-dione ChemAxon average_mass 452.7116 ChemAxon mono_mass 452.36543078 ChemAxon smiles CC(C)CCCC(C)CCCC(C)CCCC(C)CCC1=C(C)C(=O)C2=CC=CC=C2C1=O ChemAxon formula C31H48O2 ChemAxon inchi InChI=1S/C31H48O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-27-26(6)30(32)28-18-7-8-19-29(28)31(27)33/h7-8,18-19,22-25H,9-17,20-21H2,1-6H3 ChemAxon inchikey XOQNYHSBHIIJMQ-UHFFFAOYSA-N ChemAxon polar_surface_area 34.14 ChemAxon refractivity 142.11 ChemAxon polarizability 58.34 ChemAxon rotatable_bond_count 15 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 18326 Specdb::CMs 122306 Specdb::CMs 136768 Specdb::CMs 144502 Specdb::MsMs 78438 Specdb::MsMs 78439 Specdb::MsMs 78440 Specdb::MsMs 138786 Specdb::MsMs 138787 Specdb::MsMs 138788 Specdb::MsMs 2726810 Specdb::MsMs 2726811 Specdb::MsMs 2726812 Specdb::MsMs 2979473 Specdb::MsMs 2979474 Specdb::MsMs 2979475 HMDB34839 #<Reference:0x000055ce32ff96b8> Agave Type 1 specific Agave 39509 0.0 0.0 0.0 mg/100 g Alaska blueberry Type 1 specific Vaccinium alaskaense 190544 0.0 0.0 0.0 mg/100 g Alaska pollock Type 1 specific Theragra chalcogramma 1042646 0.0 0.0 0.0 mg/100 g Allium Type 1 specific Allium 4678 0.0 0.0 0.0 mg/100 g Almond Type 1 specific Prunus dulcis 3755 0.0 0.0 0.0 mg/100 g Amaranth Type 1 specific Amaranthus 3564 0.0 0.0 0.0 mg/100 g American cranberry Type 1 specific Vaccinium macrocarpon 13750 0.0 0.0 0.0 mg/100 g American lobster Type 1 specific Homarus americanus 6706 0.0 0.0 0.0 mg/100 g Anatidae Type 1 specific Anatidae 8830 Apple Type 1 specific Malus pumila 283210 0.0 0.0 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 0.0 0.0 0.0 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 0.0 0.0 0.0 mg/100 g Atlantic salmon Type 1 specific Salmo salar 8030 0.0 0.0 0.0 mg/100 g Avocado Type 1 specific Persea americana 3435 0.0 0.0 0.0 mg/100 g Baby food Type 2 specific 0.0 0.0 0.0 mg/100 g Bagel Type 2 specific 0.00025 0.0003 0.0002 mg/100 g Baked beans Type 2 specific 0.0 0.0 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 0.0 0.0 0.0 mg/100 g Bean Type 1 specific 0.0 0.0 0.0 mg/100 g Bearded seal Type 1 specific Erignathus barbatus 39304 0.0014 0.004 0.0 mg/100 g Beefalo Type 1 specific Bos taurus X Bison bison 297284 Beer Type 2 specific 0.0 0.0 0.0 mg/100 g Beluga whale Type 1 specific Delphinapterus leucas 9749 0.00065 0.0013 0.0 mg/100 g Biscuit Type 2 specific 0.01584 0.0787 0.0 mg/100 g Bison Type 1 specific Bison bison 9901 Bivalvia (Clam, Mussel, Oyster) Type 1 specific Bivalvia 6544 0.0 0.0 0.0 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 0.0 0.0 0.0 mg/100 g Brazil nut Type 1 specific Bertholletia excelsa 3645 0.0 0.0 0.0 mg/100 g Breakfast cereal Type 2 specific 0.000025 0.0003 0.0 mg/100 g Breakfast sandwich Type 2 specific 0.008167 0.0289 0.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 0.0 0.0 0.0 mg/100 g Buffalo Type 1 specific Bubalus bubalis 89462 Burrito Type 2 specific 0.003343 0.0051 0.0018 mg/100 g Canola Type 2 specific 138011 0.0 0.0 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.0 0.0 0.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 0.0 0.0 0.0 mg/100 g Catfish Type 1 specific Siluriformes 7995 0.0 0.0 0.0 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 0.000008 0.0009 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 0.0 0.0 0.0 mg/100 g Channel catfish Type 1 specific Ictalurus punctatus 7998 0.0 0.0 0.0 mg/100 g Cheese Type 2 specific 0.0 0.0 0.0 mg/100 g Chicken Type 1 specific Gallus gallus 9031 Chinese cinnamon Type 1 specific Cinnamomum aromaticum 119260 0.0 0.0 0.0 mg/100 g Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 0.0 0.0 0.0 mg/100 g Chocolate Type 2 specific 0.0 0.0 0.0 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 0.0 0.0 0.0 mg/100 g Cichlidae (Tilapia) Type 1 specific Cichlidae 8113 0.0 0.0 0.0 mg/100 g Cloves Type 1 specific Syzygium aromaticum 219868 0.0 0.0 0.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 0.0 0.0 0.0 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 0.0 0.0 0.0 mg/100 g Cold cut Type 2 specific 0.0 0.0 0.0 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 0.0 0.0 0.0 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 0.0 0.0 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 0.0 0.0 0.0 mg/100 g Common chokecherry Type 1 specific Prunus virginiana 133204 0.0 0.0 0.0 mg/100 g Common grape Type 1 specific Vitis vinifera 29760 0.0 0.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 0.002413 0.007 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 0.0 0.0 0.0 mg/100 g Common pea Type 1 specific Pisum sativum 3888 0.0 0.0 0.0 mg/100 g Common walnut Type 1 specific Juglans regia 51240 0.0 0.0 0.0 mg/100 g Cooking oil Type 2 specific 0.0 0.0 0.0 mg/100 g Corn Type 1 specific Zea mays 4577 0.000035 0.0006 0.0 mg/100 g Corn chip Type 2 specific 0.009133 0.0168 0.0053 mg/100 g Corn grits Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 0% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 1% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 2% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin D added, 3.25% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Cracker Type 2 specific 0.014 0.0643 0.0 mg/100 g Cream Type 2 specific 0.0 0.0 0.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 0.0 0.0 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 0.0 0.0 0.0 mg/100 g Curry powder Type 2 specific 0.0 0.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 0.0 0.0 0.0 mg/100 g Deer Type 1 specific Cervidae 9850 0.0 0.0 0.0 mg/100 g Domestic goat Type 1 specific Capra aegagrus hircus 9925 0.0 0.0 0.0 mg/100 g Domestic pig Type 1 specific Sus scrofa domestica 9825 0.000002 0.0002 0.0 mg/100 g Dulce de leche Type 2 specific 0.0 0.0 0.0 mg/100 g Eastern oyster Type 1 specific Crassostrea virginica 6565 0.0 0.0 0.0 mg/100 g Egg roll Type 2 specific 0.0 0.0 0.0 mg/100 g Eggs Unknown generic 0.000075 0.0001 0.0 mg/100 g Elk Type 1 specific Cervus canadensis 1574408 Empanada Type 2 specific 0.0057 0.0057 0.0057 mg/100 g Emu Type 1 specific Dromaius novaehollandiae 8790 Enokitake Type 1 specific Flammulina velutipes 38945 0.0005 0.0005 0.0005 mg/100 g European anchovy Type 1 specific Engraulis encrasicolus 184585 0.0 0.0 0.0 mg/100 g European plum Type 1 specific Prunus domestica 3758 0.0 0.0 0.0 mg/100 g European rabbit Type 1 specific Oryctolagus 9984 Fats and oils Unknown generic Feijoa Type 1 specific Feijoa sellowiana 260130 0.0 0.0 0.0 mg/100 g Fig Type 1 specific Ficus carica 3494 0.0 0.0 0.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 0.0 0.0 0.0 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 0.0 0.0 0.0 mg/100 g Flour Type 2 specific 0.0163 0.0163 0.0163 mg/100 g French plantain Type 1 specific Musa X paradisiaca 89151 0.0008 0.0008 0.0008 mg/100 g French toast Type 2 specific 0.0277 0.0277 0.0277 mg/100 g Fruit juice Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit-flavor drink Type 2 specific 0.0 0.0 0.0 mg/100 g Frybread Type 2 specific 0.0004 0.0008 0.0 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 0.0 0.0 0.0 mg/100 g Garlic Type 1 specific Allium sativum 4682 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 0.0024 0.0024 0.0024 mg/100 g Globe artichoke Type 1 specific Cynara scolymus 59895 0.0 0.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 0.0 0.0 0.0 mg/100 g Green bean Type 1 specific Phaseolus vulgaris 3885 0.0 0.0 0.0 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Greylag goose Type 1 specific Anser anser 8843 Guava Type 1 specific Psidium guajava 120290 0.0 0.0 0.0 mg/100 g Guinea hen Type 1 specific Numida meleagris 8996 Hamburger Type 2 specific 0.000104 0.0007 0.0 mg/100 g Hazelnut Type 1 specific Corylus 13450 0.0 0.0 0.0 mg/100 g Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 0.0 0.0 0.0 mg/100 g Horchata Type 2 specific 0.0 0.0 0.0 mg/100 g Horse Type 1 specific Equus caballus 9796 Hot chocolate Type 2 specific 0.0 0.0 0.0 mg/100 g Hummus Type 2 specific 0.0 0.0 0.0 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Japanese pumpkin Type 1 specific Cucurbita maxima 3661 0.0 0.0 0.0 mg/100 g Ketchup Type 2 specific 0.0 0.0 0.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 0.0 0.0 0.0 mg/100 g Lambsquarters Type 1 specific Chenopodium album 3559 0.0 0.0 0.0 mg/100 g Leavening agent Type 2 specific 0.0 0.0 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 0.0 0.0 0.0 mg/100 g Macadamia nut Type 1 specific Macadamia 4329 0.0 0.0 0.0 mg/100 g Macaroni and cheese Type 2 specific 0.0041 0.0064 0.0 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 0.0 0.0 0.0 mg/100 g Mallard duck Type 1 specific Anas platyrhynchos 8839 Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 0.0 0.0 0.0 mg/100 g Mango Type 1 specific Mangifera indica 29780 0.0 0.0 0.0 mg/100 g Margarine Type 2 specific 0.059425 0.1038 0.0267 mg/100 g Margarine-like spread Type 2 specific 0.019538 0.0723 0.0 mg/100 g Meatloaf Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Cow) Type 2 specific 0.0 0.0 0.0 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 0.0 0.0 0.0 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Muskmelon Type 1 specific Cucumis melo 3656 0.0 0.0 0.0 mg/100 g Nachos Type 2 specific 0.03875 0.0564 0.0211 mg/100 g Narrowleaf cattail Type 1 specific Typha angustifolia 59011 0.0 0.0 0.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 0.0 0.0 0.0 mg/100 g Olive Type 1 specific Olea europaea 4146 0.0 0.0 0.0 mg/100 g Opium poppy Type 1 specific Papaver somniferum 3469 0.0 0.0 0.0 mg/100 g Orange roughy Type 1 specific Hoplostethus atlanticus 96778 0.0 0.0 0.0 mg/100 g Oriental wheat Type 1 specific Triticum turanicum 376534 0.0 0.0 0.0 mg/100 g Ostrich Type 1 specific Struthio camelus 8801 Other beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Other bread Type 2 specific 0.0023 0.0041 0.0005 mg/100 g Other bread product Type 2 specific 0.00055 0.0011 0.0 mg/100 g Other candy Type 2 specific 0.00382 0.0187 0.0 mg/100 g Other dish Type 2 specific 0.001214 0.0111 0.0 mg/100 g Other fish product Type 2 specific 0.00595 0.0119 0.0 mg/100 g Other frozen dessert Type 2 specific 0.0 0.0 0.0 mg/100 g Other fruit product Type 2 specific 0.0 0.0 0.0 mg/100 g Other pasta dish Type 2 specific 0.0033 0.0033 0.0033 mg/100 g Other sandwich Type 2 specific 0.00256 0.0077 0.0 mg/100 g Other snack food Type 2 specific 0.000333 0.0029 0.0 mg/100 g Other soy product Type 2 specific 0.0 0.0 0.0 mg/100 g Other vegetable product Type 2 specific 0.0 0.0 0.0 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 0.0 0.0 0.0 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 0.0 0.0 0.0 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 0.0 0.0 0.0 mg/100 g Pacific sardine Type 1 specific Sardinops sagax 28381 0.0 0.0 0.0 mg/100 g Painted comber Type 1 specific Serranus scriba 349661 0.0 0.0 0.0 mg/100 g Pan dulce Type 2 specific 0.0104 0.0104 0.0104 mg/100 g Pancake Type 2 specific 0.0024 0.0048 0.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 0.0 0.0 0.0 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 0.0 0.0 0.0 mg/100 g Pasta Type 2 specific 0.000188 0.0005 0.0 mg/100 g Pastry Type 2 specific 0.017367 0.0291 0.0002 mg/100 g Peach Type 1 specific Prunus persica 3760 0.0 0.0 0.0 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 0.000433 0.0008 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.0 0.0 0.0 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 0.0 0.0 0.0 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Pepper (Spice) Type 1 specific Piper nigrum 13216 0.0 0.0 0.0 mg/100 g Persian lime Type 1 specific Citrus latifolia 200541 0.0 0.0 0.0 mg/100 g Pheasant Type 1 specific Phasianus colchicus 9054 Pie crust Type 2 specific 0.029683 0.0614 0.0 mg/100 g Piki bread Type 2 specific 0.0 0.0 0.0 mg/100 g Pine nut Type 1 specific Pinus 3337 0.0 0.0 0.0 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.0 0.0 0.0 mg/100 g Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 0.0 0.0 0.0 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 0.0 0.0 0.0 mg/100 g Pizza Type 2 specific 0.000859 0.0114 0.0 mg/100 g Plains prickly pear Type 1 specific Opuntia macrorhiza 1041245 0.0 0.0 0.0 mg/100 g Popcorn Type 2 specific 0.0387 0.0689 0.0085 mg/100 g Pot pie Type 2 specific 0.00165 0.0033 0.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 0.009833 0.0584 0.0 mg/100 g Potato chip Type 2 specific 0.0 0.0 0.0 mg/100 g Potato puffs Type 2 specific 0.02755 0.0282 0.0269 mg/100 g Prairie turnip Type 1 specific Pediomelum esculentum 458363 0.0 0.0 0.0 mg/100 g Processed cheese Type 2 specific 0.0 0.0 0.0 mg/100 g Pudding Type 2 specific 0.0 0.0 0.0 mg/100 g Quail Type 1 specific Phasianidae 9005 0.0 0.0 0.0 mg/100 g Quinoa Type 1 specific Chenopodium quinoa 63459 0.0 0.0 0.0 mg/100 g Rabbit Type 1 specific Leporidae 9979 0.0 0.0 0.0 mg/100 g Radish Type 1 specific Raphanus sativus 3726 0.0 0.0 0.0 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 0.0 0.0 0.0 mg/100 g Rapini Type 1 specific Brassica ruvo 1204434 0.0 0.0 0.0 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 0.0 0.0 0.0 mg/100 g Rose hip Type 1 specific Rosa 3764 0.0 0.0 0.0 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.0 0.0 0.0 mg/100 g Salad Type 2 specific 0.0 0.0 0.0 mg/100 g Salad dressing Type 2 specific 0.0 0.0 0.0 mg/100 g Salmonberry Type 1 specific Rubus spectabilis 59499 0.0 0.0 0.0 mg/100 g Sauce Type 2 specific 0.0 0.0 0.0 mg/100 g Sausage Type 2 specific 0.000092 0.0011 0.0 mg/100 g Scallop Type 1 specific Pectinidae 6566 0.0 0.0 0.0 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 0.0 0.0 0.0 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 0.0 0.0 0.0 mg/100 g Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Shiitake Type 1 specific Lentinus edodes 5353 0.0 0.0 0.0 mg/100 g Shortening Type 2 specific 0.1649 0.1649 0.1649 mg/100 g Shrimp Type 1 specific Caridea 6694 0.000017 0.0001 0.0 mg/100 g Smelt Type 1 specific Osmeridae 8012 0.0 0.0 0.0 mg/100 g Snack bar Type 2 specific 0.000853 0.0145 0.0 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 0.0 0.0 0.0 mg/100 g Sorghum Type 1 specific Sorghum bicolor 4558 0.0 0.0 0.0 mg/100 g Soup Type 2 specific 0.0 0.0 0.0 mg/100 g Soursop Type 1 specific Annona muricata 13337 0.0 0.0 0.0 mg/100 g Soy bean Type 1 specific Glycine max 3847 0.0 0.0 0.0 mg/100 g Spelt Type 1 specific Triticum spelta 58933 0.0 0.0 0.0 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 0.0 0.0 0.0 mg/100 g Spotted seal Type 1 specific Phoca largha 39090 0.0 0.0 0.0 mg/100 g Squab Type 1 specific Columba 8931 Stew Type 2 specific 0.0 0.0 0.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 0.0 0.0 0.0 mg/100 g Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 0.0 0.0 0.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 0.0 0.0 0.0 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 0.0 0.0 0.0 mg/100 g Sweet cherry Type 1 specific Prunus avium 42229 0.0 0.0 0.0 mg/100 g Sweet custard Type 2 specific 0.0 0.0 0.0 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 0.0 0.0 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 0.0 0.0 0.0 mg/100 g Taco Type 2 specific 0.0061 0.01 0.0042 mg/100 g Tamale Type 2 specific 0.0028 0.0028 0.0028 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 0.0 0.0 0.0 mg/100 g Teff Type 1 specific Eragrostis tef 110835 0.0 0.0 0.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 0.0 0.0 0.0 mg/100 g Topping Type 2 specific 0.0 0.0 0.0 mg/100 g Tortilla Type 2 specific 0.002767 0.0083 0.0 mg/100 g Tortilla chip Type 2 specific 0.0225 0.0437 0.0005 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 Turmeric Type 1 specific Curcuma longa 136217 0.0 0.0 0.0 mg/100 g Unclassified food or beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 0.0 0.0 0.0 mg/100 g Vegetarian food Type 2 specific 0.0009 0.0009 0.0009 mg/100 g Velvet duck Type 1 specific Melanitta fusca 371864 Waffle Type 2 specific 0.02336 0.0355 0.0179 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 0.0 0.0 0.0 mg/100 g Wheat bread Type 2 specific 0.0007 0.0007 0.0007 mg/100 g White bread Type 1 0.0023 0.0041 0.0005 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 0.0 0.0 0.0 mg/100 g White mustard Type 1 specific Sinapis alba 3728 0.0 0.0 0.0 mg/100 g Whitefish Type 1 specific Coregonus 27772 0.0 0.0 0.0 mg/100 g Wild boar Type 1 specific Sus scrofa 9823 Wild celery Type 1 specific Apium graveolens 4045 0.0 0.0 0.0 mg/100 g