1.0 2010-04-08 22:10:50 UTC 2019-11-26 03:08:47 UTC FDB013644 Gibberellin A3 Gibberellic acid is a very potent hormone whose natural occurrence in plants controls their development. Since GA regulates growth, applications of very low concentrations can have a profound effect while too much will have the opposite effect. Gibberellic acid is a hormone found in plants. Gibberelic acid is a simple gibberellin promoting growth and elongation of cells. Affects decomposition of plants. Helps plants grow if used in small amounts, but eventually plants grow a tolerance for it. Gibberellic acid stimulates the cells of germinating seeds to produce mRNA molecules that code for hydrolytic enzymes. [HMDB] 2b-Hydroxygibberellin 1 Activol Berelex Brellin GA3 Gib-sol Gib-tabs Gibb-tabs Gibberelate Gibberelic acid Gibberelin Gibberellate Gibberellic acid Gibberellic acid, BSI Gibberellin 1 Gibberellin X Gibberellins Gibberellinsaeure Gibberillate Gibberillic acid Gibrescol Gibrofit C19H22O6 346.3744 346.141638436 5,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.1^{5,8}.0^{1,10}.0^{2,8}]heptadec-13-ene-9-carboxylic acid 5,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.1^{5,8}.0^{1,10}.0^{2,8}]heptadec-13-ene-9-carboxylic acid 77-06-5 CC12C3C(C(O)=O)C45CC(=C)C(O)(C4)CCC5C3(OC1=O)C=CC2O InChI=1S/C19H22O6/c1-9-7-17-8-18(9,24)5-3-10(17)19-6-4-11(20)16(2,15(23)25-19)13(19)12(17)14(21)22/h4,6,10-13,20,24H,1,3,5,7-8H2,2H3,(H,21,22) IXORZMNAPKEEDV-UHFFFAOYSA-N belongs to the class of organic compounds known as c19-gibberellin 6-carboxylic acids. These are c19-gibberellins with a carboxyl group at the 6-position. C19-gibberellin 6-carboxylic acids Organic compounds Lipids and lipid-like molecules Prenol lipids Diterpenoids Aliphatic heteropolycyclic compounds Carbonyl compounds Carboxylic acid esters Carboxylic acids Cyclic alcohols and derivatives Dicarboxylic acids and derivatives Diterpene lactones Gamma butyrolactones Hydrocarbon derivatives Organic oxides Oxacyclic compounds Secondary alcohols Tertiary alcohols Tetrahydrofurans 20-norgibberellane-6-carboxylic acid Alcohol Aliphatic heteropolycyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Carboxylic acid ester Cyclic alcohol Dicarboxylic acid or derivatives Diterpene lactone Gamma butyrolactone Hydrocarbon derivative Lactone Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Secondary alcohol Tertiary alcohol Tetrahydrofuran Solid logp 0.66 ALOGPS logs -2.25 ALOGPS solubility 1.95e+00 g/l ALOGPS logp 0.35 ChemAxon pka_strongest_acidic 4.16 ChemAxon pka_strongest_basic -0.9 ChemAxon iupac 5,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.1^{5,8}.0^{1,10}.0^{2,8}]heptadec-13-ene-9-carboxylic acid ChemAxon average_mass 346.3744 ChemAxon mono_mass 346.141638436 ChemAxon smiles CC12C3C(C(O)=O)C45CC(=C)C(O)(C4)CCC5C3(OC1=O)C=CC2O ChemAxon formula C19H22O6 ChemAxon inchi InChI=1S/C19H22O6/c1-9-7-17-8-18(9,24)5-3-10(17)19-6-4-11(20)16(2,15(23)25-19)13(19)12(17)14(21)22/h4,6,10-13,20,24H,1,3,5,7-8H2,2H3,(H,21,22) ChemAxon inchikey IXORZMNAPKEEDV-UHFFFAOYSA-N ChemAxon polar_surface_area 104.06 ChemAxon refractivity 86.42 ChemAxon polarizability 34.86 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 5 ChemAxon donor_count 3 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 110390 Specdb::CMs 123350 Specdb::CMs 896575 Specdb::CMs 896576 Specdb::CMs 896577 Specdb::CMs 896578 Specdb::CMs 896579 Specdb::CMs 896580 Specdb::CMs 896581 Specdb::CMs 896582 Specdb::CMs 896583 Specdb::CMs 896584 Specdb::CMs 896585 Specdb::CMs 896586 Specdb::CMs 896587 Specdb::CMs 896588 Specdb::MsMs 109674 Specdb::MsMs 109675 Specdb::MsMs 109676 Specdb::MsMs 177171 Specdb::MsMs 177172 Specdb::MsMs 177173 Specdb::MsMs 3436279 Specdb::MsMs 3436280 Specdb::MsMs 3436281 Specdb::MsMs 3436282 Specdb::MsMs 3436283 Specdb::MsMs 3436284 HMDB03559 #<Reference:0x000055ce31f8ad40> Apple Type 1 specific Malus pumila 283210 Barley Type 1 specific Hordeum vulgare 4513 Black tea Type 1 Chayote Type 1 specific Sechium edule 184140 Common grape Type 1 specific Vitis vinifera 29760 Common pea Type 1 specific Pisum sativum 3888 Common wheat Type 1 specific Triticum aestivum 4565 Corn Type 1 specific Zea mays 4577 Cowpea Type 1 specific Vigna unguiculata 3917 Cucumber Type 1 specific Cucumis sativus 3659 Green tea Type 1 Herbal tea Type 1 Lettuce Type 1 specific Lactuca sativa 4236 Lima bean Type 1 specific Phaseolus lunatus 3884 Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 Mango Type 1 specific Mangifera indica 29780 Muskmelon Type 1 specific Cucumis melo 3656 Oat Type 1 specific Avena sativa 4498 Okra Type 1 specific Abelmoschus esculentus 455045 Papaya Type 1 specific Carica papaya 3649 Peach Type 1 specific Prunus persica 3760 Pear Type 1 specific Pyrus communis 23211 Red tea Type 1 Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia Rye Type 1 specific Secale cereale 4550 Safflower Type 1 specific Carthamus tinctorius 4222 Scarlet bean Type 1 specific Phaseolus coccineus 3886 Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 Sour cherry Type 1 specific Prunus cerasus 140311 Strawberry Type 1 specific Fragaria X ananassa 3747 Swamp cabbage Type 1 specific Ipomoea aquatica 89636 Swede Type 1 specific Brassica napus 3708 Sweet cherry Type 1 specific Prunus avium 42229 Sweet orange Type 1 specific Citrus sinensis 2711 Sweet potato Type 1 specific Ipomoea batatas 4120 Tea Type 1 specific Camellia sinensis 4442 Turnip Type 1 specific Brassica rapa var. rapa 51350 White lupine Type 1 specific Lupinus albus 3870