1.0 2010-04-08 22:11:22 UTC 2025-11-19 00:48:12 UTC FDB014604 Taraxasterol acetate Taraxasterol acetate, also known as urs-20(30)-en-3-ol acetate, is a member of the class of compounds known as triterpenoids. Triterpenoids are terpene molecules containing six isoprene units. Taraxasterol acetate is practically insoluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). Taraxasterol acetate can be found in burdock, which makes taraxasterol acetate a potential biomarker for the consumption of this food product. Lactucerin Lactucone Taraxasterol acetate Taraxasterol, acetate C32H52O2 468.7541 468.396730908 4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-docosahydropicen-3-yl acetate 4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-hexadecahydropicen-3-yl acetate 6426-43-3 CC1C2C3CCC4C5(C)CCC(OC(C)=O)C(C)(C)C5CCC4(C)C3(C)CCC2(C)CCC1=C InChI=1S/C32H52O2/c1-20-12-15-29(6)18-19-31(8)23(27(29)21(20)2)10-11-25-30(7)16-14-26(34-22(3)33)28(4,5)24(30)13-17-32(25,31)9/h21,23-27H,1,10-19H2,2-9H3 SFEUTIOWNUGQMZ-UHFFFAOYSA-N belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. Triterpenoids Organic compounds Lipids and lipid-like molecules Prenol lipids Triterpenoids Aliphatic homopolycyclic compounds Carbonyl compounds Carboxylic acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Aliphatic homopolycyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Triterpenoid logp 6.42 ALOGPS logs -6.74 ALOGPS solubility 8.48e-05 g/l ALOGPS melting_point Mp 256-257° logp 7.89 ChemAxon pka_strongest_basic -7 ChemAxon iupac 4,4,6a,6b,8a,12,14b-heptamethyl-11-methylidene-docosahydropicen-3-yl acetate ChemAxon average_mass 468.7541 ChemAxon mono_mass 468.396730908 ChemAxon smiles CC1C2C3CCC4C5(C)CCC(OC(C)=O)C(C)(C)C5CCC4(C)C3(C)CCC2(C)CCC1=C ChemAxon formula C32H52O2 ChemAxon inchi InChI=1S/C32H52O2/c1-20-12-15-29(6)18-19-31(8)23(27(29)21(20)2)10-11-25-30(7)16-14-26(34-22(3)33)28(4,5)24(30)13-17-32(25,31)9/h21,23-27H,1,10-19H2,2-9H3 ChemAxon inchikey SFEUTIOWNUGQMZ-UHFFFAOYSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 140.06 ChemAxon polarizability 58.3 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 62379 Specdb::MsMs 62380 Specdb::MsMs 62381 Specdb::MsMs 119088 Specdb::MsMs 119089 Specdb::MsMs 119090 Specdb::MsMs 3605713 Specdb::MsMs 3605714 Specdb::MsMs 3605715 Specdb::MsMs 3605716 Specdb::MsMs 3605717 Specdb::MsMs 3605718 Burdock Type 1 specific Arctium lappa 4217 Anti-edemic 248 Anti-inflammatory 370 A substance that reduces or suppresses inflammation.