1.0 2010-04-08 22:10:36 UTC 2025-11-18 23:42:41 UTC FDB013245 (±)-Phenylalanine Flavouring ingredient. (±)-Phenylalanine is found in many foods, some of which are cucumber, green bell pepper, yellow bell pepper, and saskatoon berry. (.+/-.)-phenylalanine (+/-)-2-Amino-3-phenylpropionic acid (2R)-2-amino-3-phenylpropanoic acid α-amino-α-alanine β-phenylalanine, DL- 2-amino-3-phenylpropanoic acid 2-Amino-3-phenylpropionic acid, dl- Alanine, phenyl-, d- Alanine, phenyl-, DL- Alanine, phenyl-, DL- (8CI) Alpha-aminohydrocinnamic acid, DL- D -alpha-amino- beta-phenyl- propionic acid D-beta-phenyl-alpha-alanine D-phenylalanine DL-α-amino-β-phenylpropionic acid DL-β-phenyl-α-alanine DL-β-phenylalanine DL-2-Amino-3-phenylpropanoic acid DL-3-Phenylalanine DL-alpha-amino-beta-phenylpropionic acid DL-phenylalanine DL-phenylalanine, homopolymer FEMA 3726 L -2-Amino-3-phenylpropanoic acid L-Phenylalanine-[ring-2,6-3H(N) L-phenylalanine, u.s.p. Phenylalanin Phenylalanine DL-form Phenylalanine, DL- Phenylalanine, homopolymer Polyphenylalanine Sabiden C9H11NO2 165.1891 165.078978601 2-amino-3-phenylpropanoic acid phenylalanin 150-30-1 NC(CC1=CC=CC=C1)C(O)=O InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) COLNVLDHVKWLRT-UHFFFAOYSA-N belongs to the class of organic compounds known as phenylalanine and derivatives. Phenylalanine and derivatives are compounds containing phenylalanine or a derivative thereof resulting from reaction of phenylalanine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Phenylalanine and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aromatic homomonocyclic compounds Alpha amino acids Amino acids Amphetamines and derivatives Aralkylamines Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Phenylpropanoic acids 3-phenylpropanoic-acid Alpha-amino acid Amine Amino acid Amphetamine or derivatives Aralkylamine Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenylalanine or derivatives Primary aliphatic amine Primary amine alpha-amino acid aromatic amino acid logp -1.35 ALOGPS logs -1.60 ALOGPS solubility 4.14e+00 g/l ALOGPS melting_point Mp 318-320° dec. logp -1.2 ChemAxon pka_strongest_acidic 2.47 ChemAxon pka_strongest_basic 9.45 ChemAxon iupac 2-amino-3-phenylpropanoic acid ChemAxon average_mass 165.1891 ChemAxon mono_mass 165.078978601 ChemAxon smiles NC(CC1=CC=CC=C1)C(O)=O ChemAxon formula C9H11NO2 ChemAxon inchi InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) ChemAxon inchikey COLNVLDHVKWLRT-UHFFFAOYSA-N ChemAxon polar_surface_area 63.32 ChemAxon refractivity 45.12 ChemAxon polarizability 17.2 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::NmrOneD 2552 Specdb::NmrOneD 3252 Specdb::EiMs 1215 Specdb::MsMs 20282 Specdb::MsMs 20283 Specdb::MsMs 20284 Specdb::MsMs 21833 Specdb::MsMs 21834 Specdb::MsMs 21835 Specdb::MsMs 2237214 Specdb::MsMs 2238320 Specdb::MsMs 2239247 Specdb::MsMs 2241223 Specdb::MsMs 2242491 Specdb::MsMs 2244559 Specdb::MsMs 2244650 Specdb::MsMs 2245453 Specdb::MsMs 2245543 Specdb::MsMs 2246802 Specdb::MsMs 2247499 Specdb::MsMs 2247654 Specdb::MsMs 2248729 Specdb::MsMs 2248910 Specdb::MsMs 2249467 Specdb::MsMs 2249637 Specdb::MsMs 2249689 Specdb::MsMs 2250802 Specdb::MsMs 2250903 Specdb::CMs 78986 Specdb::CMs 117858 Specdb::CMs 868410 Specdb::CMs 868411 Specdb::CMs 868412 Specdb::CMs 868413 28044 Acorn Type 1 specific Quercus 3511 0.269 0.269 0.269 mg/100 g Acorn squash Type 1 Cucurbita pepo var. turbinata 0.031 0.031 0.031 mg/100 g Agave Type 1 specific Agave 39509 0.019 0.019 0.019 mg/100 g Almond Type 1 specific Prunus dulcis 3755 1.132 1.132 1.132 mg/100 g Amaranth Type 1 specific Amaranthus 3564 0.542 0.542 0.542 mg/100 g American butterfish Type 1 specific Peprilus triacanthus 183653 0.675 0.675 0.675 mg/100 g American lobster Type 1 specific Homarus americanus 6706 0.68 0.68 0.68 mg/100 g American shad Type 1 specific Alosa sapidissima 34773 0.661 0.661 0.661 mg/100 g Anatidae Type 1 specific Anatidae 8830 0.76375 0.932 0.459 mg/100 g Anchovy Type 1 specific Engraulidae 43062 0.794 0.794 0.794 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 0.72 0.72 0.72 mg/100 g Apple Type 1 specific Malus pumila 283210 0.007 0.007 0.007 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 0.052 0.052 0.052 mg/100 g Asian pear Type 1 specific Pyrus pyrifolia 3767 0.013 0.013 0.013 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 0.075 0.075 0.075 mg/100 g Atlantic cod Type 1 specific Gadus morhua 8049 0.695 0.695 0.695 mg/100 g Atlantic croaker Type 1 specific Micropogonias undulatus 29154 0.694 0.694 0.694 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 0.821 0.821 0.821 mg/100 g Atlantic herring Type 1 specific Clupea harengus harengus 7950 0.701 0.701 0.701 mg/100 g Atlantic pollock Type 1 specific Pollachius pollachius 185739 0.726 0.726 0.726 mg/100 g Atlantic salmon Type 1 specific Salmo salar 8030 0.775 0.775 0.775 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 0.683 0.683 0.683 mg/100 g Avocado Type 1 specific Persea americana 3435 0.097 0.097 0.097 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.09 0.09 0.09 mg/100 g Banana Type 1 specific Musa acuminata 4641 0.049 0.049 0.049 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 254.42803 540.0 0.556 mg/100 g Beech nut Type 1 specific Fagus 21024 0.262 0.262 0.262 mg/100 g Beer Type 2 specific 0.0 0.0 0.0 mg/100 g Bison Type 1 specific Bison bison 9901 0.793 0.793 0.793 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 1.094 1.094 1.094 mg/100 g Black-eyed pea Type 1 specific Vigna unguiculata ssp. unguiculata 3920 0.7675 1.373 0.162 mg/100 g Blue cheese Type 2 1.087 1.087 1.087 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 0.763 0.763 0.763 mg/100 g Blue mussel Type 1 specific Mytilus edulis 6550 0.426 0.426 0.426 mg/100 g Bluefish Type 1 specific Pomatomus saltatrix 75034 0.782 0.782 0.782 mg/100 g Breadfruit Type 1 specific Artocarpus altilis 194251 0.026 0.026 0.026 mg/100 g Breadnut tree seed Type 1 specific Brosimum alicastrum 194253 0.282 0.282 0.282 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 115.731 200.0 0.033 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 0.098 0.098 0.098 mg/100 g Buffalo Type 1 specific Bubalus bubalis 89462 0.817 0.817 0.817 mg/100 g Bulgur Type 2 specific 0.58 0.58 0.58 mg/100 g Burbot Type 1 specific Lota lota 69944 0.754 0.754 0.754 mg/100 g Burdock Type 1 specific Arctium lappa 4217 0.033 0.033 0.033 mg/100 g Butter Type 2 specific 0.041 0.041 0.041 mg/100 g Buttermilk Type 2 specific 0.166 0.166 0.166 mg/100 g Butternut Type 1 specific Juglans cinerea 91214 1.442 1.442 1.442 mg/100 g Butternut squash Type 1 specific Cucurbita moschata 3662 0.039 0.039 0.039 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 0.032 0.032 0.032 mg/100 g Calabash Type 1 specific Lagenaria siceraria 3668 0.015 0.015 0.015 mg/100 g Cantaloupe melon Type 1 Cucumis melo var. cantalupensis 0.002 0.002 0.002 mg/100 g Carp bream Type 1 specific Abramis brama 38527 0.696 0.696 0.696 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 19.372833 32.1 0.0185 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 0.026 0.026 0.026 mg/100 g Catfish Type 1 specific Siluriformes 7995 0.639 0.639 0.639 mg/100 g Catjang pea Type 1 specific Vigna unguiculata ssp. cylindrica 3840 1.393 1.393 1.393 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 0.065 0.065 0.065 mg/100 g Celery stalks Type 1 specific Apium graveolens var. dulce 117781 0.02 0.02 0.02 mg/100 g Channel catfish Type 1 specific Ictalurus punctatus 7998 0.639 0.639 0.639 mg/100 g Chayote Type 1 specific Sechium edule 184140 0.047 0.047 0.047 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 0.042 0.042 0.042 mg/100 g Chestnut Type 1 specific Castanea 21019 0.19 0.19 0.19 mg/100 g Chia Type 1 specific Salvia hispanica 49212 1.016 1.016 1.016 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 1.103 1.103 1.103 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 0.041 0.041 0.041 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 0.044 0.044 0.044 mg/100 g Chinese chestnut Type 1 specific Castanea mollissima 60419 0.19 0.19 0.19 mg/100 g Chinese chives Type 1 specific Allium tuberosum 4683 0.105 0.105 0.105 mg/100 g Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 0.783 0.783 0.783 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 0.105 0.105 0.105 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 0.786 0.786 0.786 mg/100 g Cichlidae (Tilapia) Type 1 specific Cichlidae 8113 0.81 0.81 0.81 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 0.146 0.146 0.146 mg/100 g Cisco Type 1 specific Coregonus artedi 36181 0.741 0.741 0.741 mg/100 g Clam Type 1 0.56 0.56 0.56 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 0.68 0.68 0.68 mg/100 g Cloves Type 1 specific Syzygium aromaticum 219868 0.23 0.23 0.23 mg/100 g Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 0.169 0.169 0.169 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 0.844 0.844 0.844 mg/100 g Colorado pinyon Type 1 specific Pinus edulis 3340 0.443 0.443 0.443 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 0.825333 0.944 0.759 mg/100 g Common beet Type 1 specific Beta vulgaris 161934 0.046 0.046 0.046 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 0.52 0.52 0.52 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 0.039 0.039 0.039 mg/100 g Common carp Type 1 specific Cyprinus carpio 7962 0.696 0.696 0.696 mg/100 g Common hazelnut Type 1 specific Corylus avellana 13451 0.663 0.663 0.663 mg/100 g Common ling Type 1 specific Molva molva 163112 0.741 0.741 0.741 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 0.534 0.534 0.534 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 0.449 0.449 0.449 mg/100 g Common persimmon Type 1 specific Diospyros virginiana 13493 0.036 0.036 0.036 mg/100 g Common walnut Type 1 specific Juglans regia 51240 0.711 0.711 0.711 mg/100 g Corn Type 1 specific Zea mays 4577 0.463 0.463 0.463 mg/100 g Cottonseed Type 1 specific Gossypium 3633 2.029 2.029 2.029 mg/100 g Cottonseed oil Type 2 0.0 0.0 0.0 mg/100 g Cowpea Type 1 specific Vigna unguiculata 3917 0.162 0.162 0.162 mg/100 g Crab Type 1 specific Brachyura 6752 0.772333 0.781 0.763 mg/100 g Crayfish Type 1 specific Astacidea 6712 0.6485 0.672 0.625 mg/100 g Cream Type 2 specific 0.12825 0.143 0.105 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 10.239667 17.0 0.019 mg/100 g Cusk Type 1 specific Brosme brosme 81638 0.742 0.742 0.742 mg/100 g Cuttlefish Type 1 specific Sepiidae 6608 0.582 0.582 0.582 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 0.036 0.036 0.036 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 0.048 0.048 0.048 mg/100 g Deer Type 1 specific Cervidae 9850 0.937 0.937 0.937 mg/100 g Dill Type 1 specific Anethum graveolens 40922 134.2875 268.51 0.065 mg/100 g Dock Type 1 specific Rumex 3618 0.114 0.114 0.114 mg/100 g Domestic goat Type 1 specific Capra aegagrus hircus 9925 0.715 0.715 0.715 mg/100 g Dungeness crab Type 1 specific Cancer magister 29965 0.735 0.735 0.735 mg/100 g Eastern oyster Type 1 specific Crassostrea virginica 6565 0.207 0.207 0.207 mg/100 g Egg substitute Type 2 specific 0.645 0.645 0.645 mg/100 g Egg yolk Type 1 0.06 0.06 0.06 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 28.574333 44.68 0.043 mg/100 g Eggs Unknown generic 0.06 0.06 0.06 mg/100 g Elk Type 1 specific Cervus canadensis 1574408 0.797 0.797 0.797 mg/100 g Emu Type 1 specific Dromaius novaehollandiae 8790 0.65 0.65 0.65 mg/100 g Endive Type 1 specific Cichorium endivia 114280 0.053 0.053 0.053 mg/100 g European anchovy Type 1 specific Engraulis encrasicolus 184585 0.794 0.794 0.794 mg/100 g European chestnut Type 1 specific Castanea sativa 21020 0.069 0.069 0.069 mg/100 g European rabbit Type 1 specific Oryctolagus 9984 0.895 0.895 0.895 mg/100 g Feijoa Type 1 specific Feijoa sellowiana 260130 0.019 0.019 0.019 mg/100 g Fenugreek Type 1 specific Trigonella foenum-graecum 78534 1.089 1.089 1.089 mg/100 g Fig Type 1 specific Ficus carica 3494 0.009 0.009 0.009 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 0.508 0.508 0.508 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 0.957 0.957 0.957 mg/100 g Florida pompano Type 1 specific Trachinotus carolinus 173342 0.721 0.721 0.721 mg/100 g Freshwater drum Type 1 specific Aplodinotus grunniens 225389 0.685 0.685 0.685 mg/100 g Freshwater eel Type 1 specific Anguilla 7935 0.72 0.72 0.72 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.645 0.695 0.595 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 0.695 0.695 0.695 mg/100 g Garden onion Type 1 specific Allium cepa 4679 24.708333 39.1 0.025 mg/100 g Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 0.025 0.025 0.025 mg/100 g Garlic Type 1 specific Allium sativum 4682 0.183 0.183 0.183 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 0.045 0.045 0.045 mg/100 g Ginkgo nuts Type 1 specific Ginkgo biloba 3311 0.171 0.171 0.171 mg/100 g Goji Type 1 0.271 0.271 0.271 mg/100 g Grape Type 1 specific Vitis 3603 0.016 0.019 0.013 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 0.038 0.038 0.038 mg/100 g Grapefruit/Pummelo hybrid Type 1 specific Citrus paradisi X Citrus maxima 37656 0.013 0.013 0.013 mg/100 g Grapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Greater sturgeon Type 1 specific Acipenser 7901 0.63 0.63 0.63 mg/100 g Greek feta cheese Type 2 0.675 0.675 0.675 mg/100 g Green bean Type 1 specific Phaseolus vulgaris 3885 45.9 52.0 39.8 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 24.266667 27.0 18.8 mg/100 g Green lentil Type 1 Lens culinaris 1.215 1.215 1.215 mg/100 g Green plum Type 1 0.014 0.014 0.014 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 43.5215 87.99 0.096 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 0.561 0.561 0.561 mg/100 g Grouper Type 1 specific Epinephelus 94231 0.756 0.756 0.756 mg/100 g Guava Type 1 specific Psidium guajava 120290 0.006 0.006 0.006 mg/100 g Guinea hen Type 1 specific Numida meleagris 8996 0.819 0.819 0.819 mg/100 g Hazelnut Type 1 specific Corylus 13450 0.663 0.663 0.663 mg/100 g Hickory nut Type 1 specific Carya 13402 0.713 0.713 0.713 mg/100 g Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 0.813 0.813 0.813 mg/100 g Honey Type 2 specific 0.011 0.011 0.011 mg/100 g Horse Type 1 specific Equus caballus 9796 0.879 0.879 0.879 mg/100 g Hyacinth bean Type 1 specific Lablab purpureus 35936 1.204 1.204 1.204 mg/100 g Iceberg lettuce Type 1 0.023 0.023 0.023 mg/100 g Italian oregano Type 1 specific Origanum X majoricum 1384207 0.449 0.449 0.449 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 50.0 50.0 50.0 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 0.052 0.052 0.052 mg/100 g Japanese chestnut Type 1 specific Castanea crenata 103480 0.088 0.088 0.088 mg/100 g Japanese persimmon Type 1 specific Diospyros kaki 35925 0.026 0.026 0.026 mg/100 g Japanese pumpkin Type 1 specific Cucurbita maxima 3661 120.3 150.0 90.6 mg/100 g Japanese sea bass Type 1 Lateolabrax japonicus 0.72 0.72 0.72 mg/100 g Jicama Type 1 specific Pachyrhizus erosus 109171 0.017 0.017 0.017 mg/100 g Jute Type 1 specific Corchorus olitorius 93759 0.212 0.212 0.212 mg/100 g Kelp Type 1 specific Laminaria 33637 0.043 0.043 0.043 mg/100 g King mackerel Type 1 specific Scomberomorus cavalla 13679 0.792 0.792 0.792 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 0.002 0.002 0.002 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 0.039 0.039 0.039 mg/100 g Lambsquarters Type 1 specific Chenopodium album 3559 0.166 0.166 0.166 mg/100 g Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 0.055 0.055 0.055 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 0.508 0.508 0.508 mg/100 g Lentils Type 1 generic Lens culinaris 3864 1.215 1.215 1.215 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 0.022 0.022 0.022 mg/100 g Lima bean Type 1 specific Phaseolus lunatus 3884 0.337 0.337 0.337 mg/100 g Lingcod Type 1 specific Ophiodon elongatus 225387 0.689 0.689 0.689 mg/100 g Longan Type 1 specific Dimocarpus longan 128017 0.03 0.03 0.03 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 0.014 0.014 0.014 mg/100 g Lotus Type 1 specific Nelumbo 4430 0.047 0.047 0.047 mg/100 g Lupine Type 1 specific Lupinus 3869 1.435 1.435 1.435 mg/100 g Macadamia nut Type 1 specific Macadamia 4329 0.665 0.665 0.665 mg/100 g Macadamia nut (M. tetraphylla) Type 1 specific Macadamia tetraphylla 512563 0.665 0.665 0.665 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 0.06 0.06 0.06 mg/100 g Mamey sapote Type 1 specific Pouteria sapota 233744 0.061 0.061 0.061 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 0.018 0.018 0.018 mg/100 g Mango Type 1 specific Mangifera indica 29780 0.027 0.027 0.027 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 0.426 0.426 0.426 mg/100 g Mexican oregano Type 1 specific Lippia graveolens 0.449 0.449 0.449 mg/100 g Milkfish Type 1 specific Chanos chanos 29144 0.802 0.802 0.802 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 0.58 0.58 0.58 mg/100 g Monkfish Type 1 specific Lophius piscatorius 8074 0.565 0.565 0.565 mg/100 g Moth bean Type 1 specific Vigna aconitifolia 3918 1.028 1.028 1.028 mg/100 g Mountain yam Type 1 specific Dioscorea pentaphylla 167592 0.062 0.062 0.062 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 1.443 1.443 1.443 mg/100 g Nanking cherry Type 1 specific Prunus tomentosa 105667 15.05 24.0 6.1 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 0.0105 0.0105 0.0105 mg/100 g Nopal Type 1 specific Opuntia cochenillifera 338184 0.049 0.049 0.049 mg/100 g Northern bluefin tuna Type 1 specific Thunnus thynnus 8237 0.911 0.911 0.911 mg/100 g Northern pike Type 1 specific Esox lucius 8010 0.752 0.752 0.752 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.65 0.65 0.65 mg/100 g Oat Type 1 specific Avena sativa 4498 344.137769 750.0 0.908 mg/100 g Ocean pout Type 1 specific Zoarces americanus 8199 0.65 0.65 0.65 mg/100 g Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 0.065 0.065 0.065 mg/100 g Orange bell pepper Type 1 specific Capsicum annuum 4072 39.51 40.0 39.02 mg/100 g Orange roughy Type 1 specific Hoplostethus atlanticus 96778 0.626 0.626 0.626 mg/100 g Oriental wheat Type 1 specific Triticum turanicum 376534 0.772 0.772 0.772 mg/100 g Ostrich Type 1 specific Struthio camelus 8801 0.88275 0.908 0.834 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 0.112 0.112 0.112 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 0.595 0.595 0.595 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 0.813 0.813 0.813 mg/100 g Pacific herring Type 1 specific Clupea pallasii 30724 0.64 0.64 0.64 mg/100 g Pacific jack mackerel Type 1 specific Trachurus symmetricus 271940 0.783 0.783 0.783 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.638 0.638 0.638 mg/100 g Pacific oyster Type 1 specific Crassostrea gigas 29159 0.339 0.339 0.339 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 0.772 0.772 0.772 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 0.044 0.044 0.044 mg/100 g Papaya Type 1 specific Carica papaya 3649 0.009 0.009 0.009 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 0.145 0.145 0.145 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 67.285842 67.28584225 67.28584225 mg/100 g Pea shoots Type 1 0.2 0.2 0.2 mg/100 g Peach Type 1 specific Prunus persica 3760 0.0015 0.0015 0.0015 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 0.0015 0.0015 0.0015 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 1.377 1.377 1.377 mg/100 g Peanut oil Type 2 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.002 0.002 0.002 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 0.426 0.426 0.426 mg/100 g Pepper (Spice) Type 1 specific Piper nigrum 13216 0.446 0.446 0.446 mg/100 g Peppermint Type 1 specific Mentha X piperita 34256 0.191 0.191 0.191 mg/100 g Percoidei (Bass and others) Type 1 specific Percoidei 8112 0.692 0.692 0.692 mg/100 g Persimmon Type 1 specific Diospyros 13492 0.036 0.036 0.036 mg/100 g Pheasant Type 1 specific Phasianus colchicus 9054 0.9355 0.951 0.92 mg/100 g Pigeon pea Type 1 specific Cajanus cajan 3821 1.858 1.858 1.858 mg/100 g Pili nut Type 1 specific Canarium ovatum 43691 0.497 0.497 0.497 mg/100 g Pine nut Type 1 specific Pinus 3337 0.524 0.524 0.524 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.021 0.021 0.021 mg/100 g Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 0.845 0.845 0.845 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 1.092 1.092 1.092 mg/100 g Pollock Type 1 specific Pollachius 8059 0.51 0.51 0.51 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 75.77 77.0 74.54 mg/100 g Pumpkinseed sunfish Type 1 specific Lepomis gibbosus 270329 0.757 0.757 0.757 mg/100 g Purple laver Type 1 specific Porphyra laciniata 0.273 0.273 0.273 mg/100 g Quail Type 1 specific Phasianidae 9005 0.944 0.944 0.944 mg/100 g Quinoa Type 1 specific Chenopodium quinoa 63459 0.593 0.593 0.593 mg/100 g Rabbit Type 1 specific Leporidae 9979 0.895 0.895 0.895 mg/100 g Radish Type 1 specific Raphanus sativus 3726 0.036 0.036 0.036 mg/100 g Rainbow smelt Type 1 specific Osmerus mordax 8014 0.688 0.688 0.688 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 0.799 0.799 0.799 mg/100 g Rapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra 13.45 16.0 10.9 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 13358.258947 40000.0 34.77684211 mg/100 g Red king crab Type 1 specific Paralithodes camtschaticus 6741 0.773 0.773 0.773 mg/100 g Red raspberry Type 1 specific Rubus idaeus 32247 6.200978 6.200978462 6.200978462 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 0.41 0.41 0.41 mg/100 g Roe Type 2 generic 1.092 1.092 1.092 mg/100 g Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 47.3 65.0 32.3 mg/100 g Rosemary Type 1 specific Rosmarinus officinalis 39367 0.169 0.169 0.169 mg/100 g Rye Type 1 specific Secale cereale 4550 222.745 430.0 0.435 mg/100 g Sablefish Type 1 specific Anoplopoma fimbria 229290 0.524 0.524 0.524 mg/100 g Salted butter Type 1 0.041 0.041 0.041 mg/100 g Sapodilla Type 1 specific Manilkara zapota 3741 0.013 0.013 0.013 mg/100 g Saskatoon berry Type 1 specific Amelanchier alnifolia 32219 12.3 15.0 9.6 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 0.064 0.064 0.064 mg/100 g Scallop Type 1 specific Pectinidae 6566 0.042 0.042 0.042 mg/100 g Scup Type 1 specific Stenotomus chrysops 35579 0.737 0.737 0.737 mg/100 g Sea trout Type 1 specific Salmo trutta forma trutta 13028 0.654 0.654 0.654 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 0.94 0.94 0.94 mg/100 g Sesame oil Type 2 0.0 0.0 0.0 mg/100 g Sesbania flower Type 1 specific Sesbania bispinosa 485725 0.07 0.07 0.07 mg/100 g Shallot Type 1 specific Allium ascalonicum 1476995 0.081 0.081 0.081 mg/100 g Shark Type 1 specific Squaliformes 282414 0.819 0.819 0.819 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 0.85 0.85 0.85 mg/100 g Sheepshead Type 1 specific Archosargus probatocephalus 119682 0.789 0.789 0.789 mg/100 g Shiitake Type 1 specific Lentinus edodes 5353 0.111 0.111 0.111 mg/100 g Skipjack tuna Type 1 specific Katsuwonus pelamis 8226 0.859 0.859 0.859 mg/100 g Snapper Type 1 specific Lutjanidae 30850 0.801 0.801 0.801 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 0.913 0.913 0.913 mg/100 g Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 0.183 0.183 0.183 mg/100 g Sorghum Type 1 specific Sorghum bicolor 4558 0.546 0.546 0.546 mg/100 g Soy bean Type 1 specific Glycine max 3847 2.066 2.066 2.066 mg/100 g Soy sauce Type 2 specific 0.534 0.534 0.534 mg/100 g Soybean oil Type 2 0.0 0.0 0.0 mg/100 g Spanish mackerel Type 1 specific Scomberomorus maculatus 99344 0.753 0.753 0.753 mg/100 g Spearmint Type 1 specific Mentha spicata 29719 0.168 0.168 0.168 mg/100 g Spelt Type 1 specific Triticum spelta 58933 0.737 0.737 0.737 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 70.476333 120.0 0.129 mg/100 g Spiny lobster Type 1 specific Palinuridae 6731 0.87 0.87 0.87 mg/100 g Spirulina Type 1 specific Spirulina 551299 0.286 0.286 0.286 mg/100 g Spot croaker Type 1 specific Leiostomus xanthurus 59837 0.723 0.723 0.723 mg/100 g Squab Type 1 specific Columba 8931 0.759 0.759 0.759 mg/100 g Squid Type 1 specific Teuthida 551290 0.558 0.558 0.558 mg/100 g Star fruit Type 1 specific Averrhoa carambola 28974 0.037 0.037 0.037 mg/100 g Strawberry guava Type 1 specific Psidium cattleianum 375274 0.001 0.001 0.001 mg/100 g Striped bass Type 1 specific Morone saxatilis 34816 0.692 0.692 0.692 mg/100 g Striped mullet Type 1 specific Mugil cephalus 48193 0.755 0.755 0.755 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 0.63 0.63 0.63 mg/100 g Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 52.4 57.8 47.0 mg/100 g Sunflower oil Type 2 0.0 0.0 0.0 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 0.13 0.13 0.13 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 0.052 0.052 0.052 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 0.089 0.089 0.089 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 69.448849 110.0 0.11 mg/100 g Swordfish Type 1 specific Xiphias gladius 8245 0.773 0.773 0.773 mg/100 g Tallow Type 2 specific 0.0 0.0 0.0 mg/100 g Tapioca pearl Type 2 specific 0.004 0.004 0.004 mg/100 g Taro Type 1 specific Colocasia esculenta 4460 0.082 0.082 0.082 mg/100 g Teff Type 1 specific Eragrostis tef 110835 0.698 0.698 0.698 mg/100 g Tilefish Type 1 specific Lopholatilus chamaeleonticeps 390349 0.683 0.683 0.683 mg/100 g Tofu Type 2 specific 1.199 2.334 0.428 mg/100 g Triticale Type 1 specific X Triticosecale rimpaui 0.638 0.638 0.638 mg/100 g True sole Type 1 specific Soleidae 30948 0.508 0.508 0.508 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 0.627 0.627 0.627 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 0.73 0.73 0.73 mg/100 g Turmeric Type 1 specific Curcuma longa 136217 0.53 0.53 0.53 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 8.372333 13.1 0.017 mg/100 g Ucuhuba Type 1 specific Virola surinamensis 224910 0.0 0.0 0.0 mg/100 g Vodka Type 2 specific 0.0 0.0 0.0 mg/100 g Wakame Type 1 specific Undaria pinnatifida 74381 0.112 0.112 0.112 mg/100 g Walnut Type 1 specific Juglans 16718 1.094 1.094 1.094 mg/100 g Water spinach Type 1 Ipomoea aquatica 0.129 0.129 0.129 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 0.114 0.114 0.114 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 0.015 0.015 0.015 mg/100 g Welsh onion Type 1 specific Allium fistulosum 35875 0.061 0.061 0.061 mg/100 g Wheat Type 1 specific Triticum 4564 798.803029 1400.0 326.4090865 mg/100 g Whelk Type 1 specific Buccinidae 37796 0.824 0.824 0.824 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 23.34 24.68 22.0 mg/100 g White sucker Type 1 specific Catostomus commersonii 7971 0.654 0.654 0.654 mg/100 g Whitefish Type 1 specific Coregonus 27772 0.745 0.745 0.745 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 0.715 0.715 0.715 mg/100 g Wild boar Type 1 specific Sus scrofa 9823 0.86 0.86 0.86 mg/100 g Wild carrot Type 1 specific Daucus carota 4039 0.0185 0.0185 0.0185 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 0.02 0.02 0.02 mg/100 g Wild leek Type 1 specific Allium ampeloprasum 4681 0.055 0.055 0.055 mg/100 g Wild rice Type 1 specific Zizania 15949 0.721 0.721 0.721 mg/100 g Winged bean Type 1 specific Psophocarpus tetragonolobus 3891 1.429 1.429 1.429 mg/100 g Winter squash Type 1 specific Cucurbita maxima 3661 0.031 0.031 0.031 mg/100 g Yam Type 1 specific Dioscorea 4672 0.071 0.071 0.071 mg/100 g Yardlong bean Type 1 specific Vigna unguiculata ssp. sesquipedalis 138955 0.154 0.154 0.154 mg/100 g Yellow bell pepper Type 1 specific Capsicum annuum 4072 27.665 28.33 27.0 mg/100 g Yellow wax bean Type 1 specific Phaseolus vulgaris 3885 56.6 57.0 56.2 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 27.654333 43.0 0.033 mg/100 g Yellowfin tuna Type 1 specific Thunnus albacares 8236 0.913 0.913 0.913 mg/100 g Yellowtail amberjack Type 1 specific Seriola lalandi 302047 0.904 0.904 0.904 mg/100 g odorless